commit 0a07894d55125d6d67c0323dc2b4d6a34033570e
Author: Stefan Zwischenbrugger <stefan.zwischenbrugger@gmail.com>
Date:   Fri Mar 27 12:36:18 2026 +0100

    Initialer Stand der Einkaufsliste
    
    Made-with: Cursor

diff --git a/.editorconfig b/.editorconfig
new file mode 100644
index 0000000..a186cd2
--- /dev/null
+++ b/.editorconfig
@@ -0,0 +1,18 @@
+root = true
+
+[*]
+charset = utf-8
+end_of_line = lf
+indent_size = 4
+indent_style = space
+insert_final_newline = true
+trim_trailing_whitespace = true
+
+[*.md]
+trim_trailing_whitespace = false
+
+[*.{yml,yaml}]
+indent_size = 2
+
+[compose.yaml]
+indent_size = 4
diff --git a/.env.example b/.env.example
new file mode 100644
index 0000000..c0660ea
--- /dev/null
+++ b/.env.example
@@ -0,0 +1,65 @@
+APP_NAME=Laravel
+APP_ENV=local
+APP_KEY=
+APP_DEBUG=true
+APP_URL=http://localhost
+
+APP_LOCALE=en
+APP_FALLBACK_LOCALE=en
+APP_FAKER_LOCALE=en_US
+
+APP_MAINTENANCE_DRIVER=file
+# APP_MAINTENANCE_STORE=database
+
+# PHP_CLI_SERVER_WORKERS=4
+
+BCRYPT_ROUNDS=12
+
+LOG_CHANNEL=stack
+LOG_STACK=single
+LOG_DEPRECATIONS_CHANNEL=null
+LOG_LEVEL=debug
+
+DB_CONNECTION=sqlite
+# DB_HOST=127.0.0.1
+# DB_PORT=3306
+# DB_DATABASE=laravel
+# DB_USERNAME=root
+# DB_PASSWORD=
+
+SESSION_DRIVER=database
+SESSION_LIFETIME=120
+SESSION_ENCRYPT=false
+SESSION_PATH=/
+SESSION_DOMAIN=null
+
+BROADCAST_CONNECTION=log
+FILESYSTEM_DISK=local
+QUEUE_CONNECTION=database
+
+CACHE_STORE=database
+# CACHE_PREFIX=
+
+MEMCACHED_HOST=127.0.0.1
+
+REDIS_CLIENT=phpredis
+REDIS_HOST=127.0.0.1
+REDIS_PASSWORD=null
+REDIS_PORT=6379
+
+MAIL_MAILER=log
+MAIL_SCHEME=null
+MAIL_HOST=127.0.0.1
+MAIL_PORT=2525
+MAIL_USERNAME=null
+MAIL_PASSWORD=null
+MAIL_FROM_ADDRESS="hello@example.com"
+MAIL_FROM_NAME="${APP_NAME}"
+
+AWS_ACCESS_KEY_ID=
+AWS_SECRET_ACCESS_KEY=
+AWS_DEFAULT_REGION=us-east-1
+AWS_BUCKET=
+AWS_USE_PATH_STYLE_ENDPOINT=false
+
+VITE_APP_NAME="${APP_NAME}"
diff --git a/.gitattributes b/.gitattributes
new file mode 100644
index 0000000..fcb21d3
--- /dev/null
+++ b/.gitattributes
@@ -0,0 +1,11 @@
+* text=auto eol=lf
+
+*.blade.php diff=html
+*.css diff=css
+*.html diff=html
+*.md diff=markdown
+*.php diff=php
+
+/.github export-ignore
+CHANGELOG.md export-ignore
+.styleci.yml export-ignore
diff --git a/.gitignore b/.gitignore
new file mode 100644
index 0000000..b71b1ea
--- /dev/null
+++ b/.gitignore
@@ -0,0 +1,24 @@
+*.log
+.DS_Store
+.env
+.env.backup
+.env.production
+.phpactor.json
+.phpunit.result.cache
+/.fleet
+/.idea
+/.nova
+/.phpunit.cache
+/.vscode
+/.zed
+/auth.json
+/node_modules
+/public/build
+/public/hot
+/public/storage
+/storage/*.key
+/storage/pail
+/vendor
+Homestead.json
+Homestead.yaml
+Thumbs.db
diff --git a/README.md b/README.md
new file mode 100644
index 0000000..0165a77
--- /dev/null
+++ b/README.md
@@ -0,0 +1,59 @@
+<p align="center"><a href="https://laravel.com" target="_blank"><img src="https://raw.githubusercontent.com/laravel/art/master/logo-lockup/5%20SVG/2%20CMYK/1%20Full%20Color/laravel-logolockup-cmyk-red.svg" width="400" alt="Laravel Logo"></a></p>
+
+<p align="center">
+<a href="https://github.com/laravel/framework/actions"><img src="https://github.com/laravel/framework/workflows/tests/badge.svg" alt="Build Status"></a>
+<a href="https://packagist.org/packages/laravel/framework"><img src="https://img.shields.io/packagist/dt/laravel/framework" alt="Total Downloads"></a>
+<a href="https://packagist.org/packages/laravel/framework"><img src="https://img.shields.io/packagist/v/laravel/framework" alt="Latest Stable Version"></a>
+<a href="https://packagist.org/packages/laravel/framework"><img src="https://img.shields.io/packagist/l/laravel/framework" alt="License"></a>
+</p>
+
+## About Laravel
+
+Laravel is a web application framework with expressive, elegant syntax. We believe development must be an enjoyable and creative experience to be truly fulfilling. Laravel takes the pain out of development by easing common tasks used in many web projects, such as:
+
+- [Simple, fast routing engine](https://laravel.com/docs/routing).
+- [Powerful dependency injection container](https://laravel.com/docs/container).
+- Multiple back-ends for [session](https://laravel.com/docs/session) and [cache](https://laravel.com/docs/cache) storage.
+- Expressive, intuitive [database ORM](https://laravel.com/docs/eloquent).
+- Database agnostic [schema migrations](https://laravel.com/docs/migrations).
+- [Robust background job processing](https://laravel.com/docs/queues).
+- [Real-time event broadcasting](https://laravel.com/docs/broadcasting).
+
+Laravel is accessible, powerful, and provides tools required for large, robust applications.
+
+## Learning Laravel
+
+Laravel has the most extensive and thorough [documentation](https://laravel.com/docs) and video tutorial library of all modern web application frameworks, making it a breeze to get started with the framework. You can also check out [Laravel Learn](https://laravel.com/learn), where you will be guided through building a modern Laravel application.
+
+If you don't feel like reading, [Laracasts](https://laracasts.com) can help. Laracasts contains thousands of video tutorials on a range of topics including Laravel, modern PHP, unit testing, and JavaScript. Boost your skills by digging into our comprehensive video library.
+
+## Laravel Sponsors
+
+We would like to extend our thanks to the following sponsors for funding Laravel development. If you are interested in becoming a sponsor, please visit the [Laravel Partners program](https://partners.laravel.com).
+
+### Premium Partners
+
+- **[Vehikl](https://vehikl.com)**
+- **[Tighten Co.](https://tighten.co)**
+- **[Kirschbaum Development Group](https://kirschbaumdevelopment.com)**
+- **[64 Robots](https://64robots.com)**
+- **[Curotec](https://www.curotec.com/services/technologies/laravel)**
+- **[DevSquad](https://devsquad.com/hire-laravel-developers)**
+- **[Redberry](https://redberry.international/laravel-development)**
+- **[Active Logic](https://activelogic.com)**
+
+## Contributing
+
+Thank you for considering contributing to the Laravel framework! The contribution guide can be found in the [Laravel documentation](https://laravel.com/docs/contributions).
+
+## Code of Conduct
+
+In order to ensure that the Laravel community is welcoming to all, please review and abide by the [Code of Conduct](https://laravel.com/docs/contributions#code-of-conduct).
+
+## Security Vulnerabilities
+
+If you discover a security vulnerability within Laravel, please send an e-mail to Taylor Otwell via [taylor@laravel.com](mailto:taylor@laravel.com). All security vulnerabilities will be promptly addressed.
+
+## License
+
+The Laravel framework is open-sourced software licensed under the [MIT license](https://opensource.org/licenses/MIT).
diff --git a/add-einkauf-hosts.bat b/add-einkauf-hosts.bat
new file mode 100644
index 0000000..d8b26b6
--- /dev/null
+++ b/add-einkauf-hosts.bat
@@ -0,0 +1,32 @@
+@echo off
+setlocal
+
+REM Pruefen, ob Adminrechte vorhanden sind
+net session >nul 2>&1
+if %errorlevel% neq 0 (
+    echo Starte mit Administratorrechten neu...
+    powershell -NoProfile -ExecutionPolicy Bypass -Command "Start-Process -FilePath '%~f0' -Verb RunAs"
+    exit /b
+)
+
+set "HOSTS_FILE=%SystemRoot%\System32\drivers\etc\hosts"
+
+findstr /R /C:"^[ ]*127\.0\.0\.1[ ]\+einkauf\.local" "%HOSTS_FILE%" >nul 2>&1
+if %errorlevel% neq 0 (
+    echo 127.0.0.1 einkauf.local>>"%HOSTS_FILE%"
+)
+
+findstr /R /C:"^[ ]*::1[ ]\+einkauf\.local" "%HOSTS_FILE%" >nul 2>&1
+if %errorlevel% neq 0 (
+    echo ::1 einkauf.local>>"%HOSTS_FILE%"
+)
+
+ipconfig /flushdns
+
+echo.
+echo Fertig. Pruefe jetzt:
+echo   ping einkauf.local
+echo Dann im Browser:
+echo   http://einkauf.local
+echo.
+pause
diff --git a/app/Http/Controllers/Auth/AuthenticatedSessionController.php b/app/Http/Controllers/Auth/AuthenticatedSessionController.php
new file mode 100644
index 0000000..613bcd9
--- /dev/null
+++ b/app/Http/Controllers/Auth/AuthenticatedSessionController.php
@@ -0,0 +1,47 @@
+<?php
+
+namespace App\Http\Controllers\Auth;
+
+use App\Http\Controllers\Controller;
+use App\Http\Requests\Auth\LoginRequest;
+use Illuminate\Http\RedirectResponse;
+use Illuminate\Http\Request;
+use Illuminate\Support\Facades\Auth;
+use Illuminate\View\View;
+
+class AuthenticatedSessionController extends Controller
+{
+    /**
+     * Display the login view.
+     */
+    public function create(): View
+    {
+        return view('auth.login');
+    }
+
+    /**
+     * Handle an incoming authentication request.
+     */
+    public function store(LoginRequest $request): RedirectResponse
+    {
+        $request->authenticate();
+
+        $request->session()->regenerate();
+
+        return redirect()->intended(route('dashboard', absolute: false));
+    }
+
+    /**
+     * Destroy an authenticated session.
+     */
+    public function destroy(Request $request): RedirectResponse
+    {
+        Auth::guard('web')->logout();
+
+        $request->session()->invalidate();
+
+        $request->session()->regenerateToken();
+
+        return redirect('/');
+    }
+}
diff --git a/app/Http/Controllers/Auth/ConfirmablePasswordController.php b/app/Http/Controllers/Auth/ConfirmablePasswordController.php
new file mode 100644
index 0000000..712394a
--- /dev/null
+++ b/app/Http/Controllers/Auth/ConfirmablePasswordController.php
@@ -0,0 +1,40 @@
+<?php
+
+namespace App\Http\Controllers\Auth;
+
+use App\Http\Controllers\Controller;
+use Illuminate\Http\RedirectResponse;
+use Illuminate\Http\Request;
+use Illuminate\Support\Facades\Auth;
+use Illuminate\Validation\ValidationException;
+use Illuminate\View\View;
+
+class ConfirmablePasswordController extends Controller
+{
+    /**
+     * Show the confirm password view.
+     */
+    public function show(): View
+    {
+        return view('auth.confirm-password');
+    }
+
+    /**
+     * Confirm the user's password.
+     */
+    public function store(Request $request): RedirectResponse
+    {
+        if (! Auth::guard('web')->validate([
+            'email' => $request->user()->email,
+            'password' => $request->password,
+        ])) {
+            throw ValidationException::withMessages([
+                'password' => __('auth.password'),
+            ]);
+        }
+
+        $request->session()->put('auth.password_confirmed_at', time());
+
+        return redirect()->intended(route('dashboard', absolute: false));
+    }
+}
diff --git a/app/Http/Controllers/Auth/EmailVerificationNotificationController.php b/app/Http/Controllers/Auth/EmailVerificationNotificationController.php
new file mode 100644
index 0000000..f64fa9b
--- /dev/null
+++ b/app/Http/Controllers/Auth/EmailVerificationNotificationController.php
@@ -0,0 +1,24 @@
+<?php
+
+namespace App\Http\Controllers\Auth;
+
+use App\Http\Controllers\Controller;
+use Illuminate\Http\RedirectResponse;
+use Illuminate\Http\Request;
+
+class EmailVerificationNotificationController extends Controller
+{
+    /**
+     * Send a new email verification notification.
+     */
+    public function store(Request $request): RedirectResponse
+    {
+        if ($request->user()->hasVerifiedEmail()) {
+            return redirect()->intended(route('dashboard', absolute: false));
+        }
+
+        $request->user()->sendEmailVerificationNotification();
+
+        return back()->with('status', 'verification-link-sent');
+    }
+}
diff --git a/app/Http/Controllers/Auth/EmailVerificationPromptController.php b/app/Http/Controllers/Auth/EmailVerificationPromptController.php
new file mode 100644
index 0000000..ee3cb6f
--- /dev/null
+++ b/app/Http/Controllers/Auth/EmailVerificationPromptController.php
@@ -0,0 +1,21 @@
+<?php
+
+namespace App\Http\Controllers\Auth;
+
+use App\Http\Controllers\Controller;
+use Illuminate\Http\RedirectResponse;
+use Illuminate\Http\Request;
+use Illuminate\View\View;
+
+class EmailVerificationPromptController extends Controller
+{
+    /**
+     * Display the email verification prompt.
+     */
+    public function __invoke(Request $request): RedirectResponse|View
+    {
+        return $request->user()->hasVerifiedEmail()
+                    ? redirect()->intended(route('dashboard', absolute: false))
+                    : view('auth.verify-email');
+    }
+}
diff --git a/app/Http/Controllers/Auth/NewPasswordController.php b/app/Http/Controllers/Auth/NewPasswordController.php
new file mode 100644
index 0000000..fc16e14
--- /dev/null
+++ b/app/Http/Controllers/Auth/NewPasswordController.php
@@ -0,0 +1,63 @@
+<?php
+
+namespace App\Http\Controllers\Auth;
+
+use App\Http\Controllers\Controller;
+use App\Models\User;
+use Illuminate\Auth\Events\PasswordReset;
+use Illuminate\Http\RedirectResponse;
+use Illuminate\Http\Request;
+use Illuminate\Support\Facades\Hash;
+use Illuminate\Support\Facades\Password;
+use Illuminate\Support\Str;
+use Illuminate\Validation\Rules;
+use Illuminate\Validation\ValidationException;
+use Illuminate\View\View;
+
+class NewPasswordController extends Controller
+{
+    /**
+     * Display the password reset view.
+     */
+    public function create(Request $request): View
+    {
+        return view('auth.reset-password', ['request' => $request]);
+    }
+
+    /**
+     * Handle an incoming new password request.
+     *
+     * @throws ValidationException
+     */
+    public function store(Request $request): RedirectResponse
+    {
+        $request->validate([
+            'token' => ['required'],
+            'email' => ['required', 'email'],
+            'password' => ['required', 'confirmed', Rules\Password::defaults()],
+        ]);
+
+        // Here we will attempt to reset the user's password. If it is successful we
+        // will update the password on an actual user model and persist it to the
+        // database. Otherwise we will parse the error and return the response.
+        $status = Password::reset(
+            $request->only('email', 'password', 'password_confirmation', 'token'),
+            function (User $user) use ($request) {
+                $user->forceFill([
+                    'password' => Hash::make($request->password),
+                    'remember_token' => Str::random(60),
+                ])->save();
+
+                event(new PasswordReset($user));
+            }
+        );
+
+        // If the password was successfully reset, we will redirect the user back to
+        // the application's home authenticated view. If there is an error we can
+        // redirect them back to where they came from with their error message.
+        return $status == Password::PASSWORD_RESET
+                    ? redirect()->route('login')->with('status', __($status))
+                    : back()->withInput($request->only('email'))
+                        ->withErrors(['email' => __($status)]);
+    }
+}
diff --git a/app/Http/Controllers/Auth/PasswordController.php b/app/Http/Controllers/Auth/PasswordController.php
new file mode 100644
index 0000000..6916409
--- /dev/null
+++ b/app/Http/Controllers/Auth/PasswordController.php
@@ -0,0 +1,29 @@
+<?php
+
+namespace App\Http\Controllers\Auth;
+
+use App\Http\Controllers\Controller;
+use Illuminate\Http\RedirectResponse;
+use Illuminate\Http\Request;
+use Illuminate\Support\Facades\Hash;
+use Illuminate\Validation\Rules\Password;
+
+class PasswordController extends Controller
+{
+    /**
+     * Update the user's password.
+     */
+    public function update(Request $request): RedirectResponse
+    {
+        $validated = $request->validateWithBag('updatePassword', [
+            'current_password' => ['required', 'current_password'],
+            'password' => ['required', Password::defaults(), 'confirmed'],
+        ]);
+
+        $request->user()->update([
+            'password' => Hash::make($validated['password']),
+        ]);
+
+        return back()->with('status', 'password-updated');
+    }
+}
diff --git a/app/Http/Controllers/Auth/PasswordResetLinkController.php b/app/Http/Controllers/Auth/PasswordResetLinkController.php
new file mode 100644
index 0000000..1bc9c11
--- /dev/null
+++ b/app/Http/Controllers/Auth/PasswordResetLinkController.php
@@ -0,0 +1,45 @@
+<?php
+
+namespace App\Http\Controllers\Auth;
+
+use App\Http\Controllers\Controller;
+use Illuminate\Http\RedirectResponse;
+use Illuminate\Http\Request;
+use Illuminate\Support\Facades\Password;
+use Illuminate\Validation\ValidationException;
+use Illuminate\View\View;
+
+class PasswordResetLinkController extends Controller
+{
+    /**
+     * Display the password reset link request view.
+     */
+    public function create(): View
+    {
+        return view('auth.forgot-password');
+    }
+
+    /**
+     * Handle an incoming password reset link request.
+     *
+     * @throws ValidationException
+     */
+    public function store(Request $request): RedirectResponse
+    {
+        $request->validate([
+            'email' => ['required', 'email'],
+        ]);
+
+        // We will send the password reset link to this user. Once we have attempted
+        // to send the link, we will examine the response then see the message we
+        // need to show to the user. Finally, we'll send out a proper response.
+        $status = Password::sendResetLink(
+            $request->only('email')
+        );
+
+        return $status == Password::RESET_LINK_SENT
+                    ? back()->with('status', __($status))
+                    : back()->withInput($request->only('email'))
+                        ->withErrors(['email' => __($status)]);
+    }
+}
diff --git a/app/Http/Controllers/Auth/RegisteredUserController.php b/app/Http/Controllers/Auth/RegisteredUserController.php
new file mode 100644
index 0000000..44a3930
--- /dev/null
+++ b/app/Http/Controllers/Auth/RegisteredUserController.php
@@ -0,0 +1,51 @@
+<?php
+
+namespace App\Http\Controllers\Auth;
+
+use App\Http\Controllers\Controller;
+use App\Models\User;
+use Illuminate\Auth\Events\Registered;
+use Illuminate\Http\RedirectResponse;
+use Illuminate\Http\Request;
+use Illuminate\Support\Facades\Auth;
+use Illuminate\Support\Facades\Hash;
+use Illuminate\Validation\Rules;
+use Illuminate\Validation\ValidationException;
+use Illuminate\View\View;
+
+class RegisteredUserController extends Controller
+{
+    /**
+     * Display the registration view.
+     */
+    public function create(): View
+    {
+        return view('auth.register');
+    }
+
+    /**
+     * Handle an incoming registration request.
+     *
+     * @throws ValidationException
+     */
+    public function store(Request $request): RedirectResponse
+    {
+        $request->validate([
+            'name' => ['required', 'string', 'max:255'],
+            'email' => ['required', 'string', 'lowercase', 'email', 'max:255', 'unique:'.User::class],
+            'password' => ['required', 'confirmed', Rules\Password::defaults()],
+        ]);
+
+        $user = User::create([
+            'name' => $request->name,
+            'email' => $request->email,
+            'password' => Hash::make($request->password),
+        ]);
+
+        event(new Registered($user));
+
+        Auth::login($user);
+
+        return redirect(route('dashboard', absolute: false));
+    }
+}
diff --git a/app/Http/Controllers/Auth/VerifyEmailController.php b/app/Http/Controllers/Auth/VerifyEmailController.php
new file mode 100644
index 0000000..784765e
--- /dev/null
+++ b/app/Http/Controllers/Auth/VerifyEmailController.php
@@ -0,0 +1,27 @@
+<?php
+
+namespace App\Http\Controllers\Auth;
+
+use App\Http\Controllers\Controller;
+use Illuminate\Auth\Events\Verified;
+use Illuminate\Foundation\Auth\EmailVerificationRequest;
+use Illuminate\Http\RedirectResponse;
+
+class VerifyEmailController extends Controller
+{
+    /**
+     * Mark the authenticated user's email address as verified.
+     */
+    public function __invoke(EmailVerificationRequest $request): RedirectResponse
+    {
+        if ($request->user()->hasVerifiedEmail()) {
+            return redirect()->intended(route('dashboard', absolute: false).'?verified=1');
+        }
+
+        if ($request->user()->markEmailAsVerified()) {
+            event(new Verified($request->user()));
+        }
+
+        return redirect()->intended(route('dashboard', absolute: false).'?verified=1');
+    }
+}
diff --git a/app/Http/Controllers/Controller.php b/app/Http/Controllers/Controller.php
new file mode 100644
index 0000000..8677cd5
--- /dev/null
+++ b/app/Http/Controllers/Controller.php
@@ -0,0 +1,8 @@
+<?php
+
+namespace App\Http\Controllers;
+
+abstract class Controller
+{
+    //
+}
diff --git a/app/Http/Controllers/ProfileController.php b/app/Http/Controllers/ProfileController.php
new file mode 100644
index 0000000..a48eb8d
--- /dev/null
+++ b/app/Http/Controllers/ProfileController.php
@@ -0,0 +1,60 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\Http\Requests\ProfileUpdateRequest;
+use Illuminate\Http\RedirectResponse;
+use Illuminate\Http\Request;
+use Illuminate\Support\Facades\Auth;
+use Illuminate\Support\Facades\Redirect;
+use Illuminate\View\View;
+
+class ProfileController extends Controller
+{
+    /**
+     * Display the user's profile form.
+     */
+    public function edit(Request $request): View
+    {
+        return view('profile.edit', [
+            'user' => $request->user(),
+        ]);
+    }
+
+    /**
+     * Update the user's profile information.
+     */
+    public function update(ProfileUpdateRequest $request): RedirectResponse
+    {
+        $request->user()->fill($request->validated());
+
+        if ($request->user()->isDirty('email')) {
+            $request->user()->email_verified_at = null;
+        }
+
+        $request->user()->save();
+
+        return Redirect::route('profile.edit')->with('status', 'profile-updated');
+    }
+
+    /**
+     * Delete the user's account.
+     */
+    public function destroy(Request $request): RedirectResponse
+    {
+        $request->validateWithBag('userDeletion', [
+            'password' => ['required', 'current_password'],
+        ]);
+
+        $user = $request->user();
+
+        Auth::logout();
+
+        $user->delete();
+
+        $request->session()->invalidate();
+        $request->session()->regenerateToken();
+
+        return Redirect::to('/');
+    }
+}
diff --git a/app/Http/Controllers/ShoppingListController.php b/app/Http/Controllers/ShoppingListController.php
new file mode 100644
index 0000000..01153d4
--- /dev/null
+++ b/app/Http/Controllers/ShoppingListController.php
@@ -0,0 +1,134 @@
+<?php
+
+namespace App\Http\Controllers;
+
+use App\Http\Requests\StoreShoppingItemRequest;
+use App\Http\Requests\ToggleShoppingItemRequest;
+use App\Models\ItemPriceLog;
+use App\Models\ShoppingItem;
+use App\Models\Store;
+use Illuminate\Http\RedirectResponse;
+use Illuminate\Support\Carbon;
+use Illuminate\Support\Facades\DB;
+use Illuminate\Contracts\View\View;
+
+class ShoppingListController extends Controller
+{
+    public function index(): View
+    {
+        /** @var \App\Models\User|null $user */
+        $user = auth()->user();
+        if ($user === null) {
+            abort(403);
+        }
+
+        $items = ShoppingItem::query()
+            ->where('user_id', $user->id)
+            ->with(['store', 'latestPriceLog.store'])
+            ->latest()
+            ->get();
+
+        $openItems = $items->where('is_done', false);
+        $doneItems = $items->where('is_done', true);
+        $stores = Store::query()->orderBy('name')->get();
+
+        $totalsByStore = $items
+            ->filter(fn (ShoppingItem $item) => $item->latestPriceLog !== null)
+            ->groupBy(function (ShoppingItem $item) {
+                return $item->latestPriceLog->store->name ?? 'Ohne Geschäft';
+            })
+            ->map(fn ($group) => $group->sum(fn (ShoppingItem $item) => (float) $item->latestPriceLog->price_decimal))
+            ->sortDesc();
+
+        return view('shopping-list.index', [
+            'openItems' => $openItems,
+            'doneItems' => $doneItems,
+            'stores' => $stores,
+            'totalsByStore' => $totalsByStore,
+            'totalAll' => $totalsByStore->sum(),
+        ]);
+    }
+
+    public function store(StoreShoppingItemRequest $request): RedirectResponse
+    {
+        $storeId = $this->resolveStoreId(
+            $request->integer('store_id') ?: null,
+            $request->input('new_store_name'),
+            $request->user()->id
+        );
+
+        ShoppingItem::query()->create([
+            'user_id' => $request->user()->id,
+            'product_name' => $request->string('product_name')->toString(),
+            'quantity' => $request->filled('quantity') ? $request->string('quantity')->toString() : null,
+            'store_id' => $storeId,
+            'is_done' => false,
+        ]);
+
+        return back()->with('status', 'Eintrag wurde hinzugefuegt.');
+    }
+
+    public function toggle(ToggleShoppingItemRequest $request, ShoppingItem $shoppingItem): RedirectResponse
+    {
+        if ($shoppingItem->user_id !== $request->user()->id) {
+            abort(403);
+        }
+
+        $isDone = $request->boolean('is_done');
+        $storeId = $this->resolveStoreId(
+            $request->integer('store_id') ?: $shoppingItem->store_id,
+            $request->input('new_store_name'),
+            $request->user()->id
+        );
+
+        DB::transaction(function () use ($request, $shoppingItem, $isDone, $storeId): void {
+            $shoppingItem->update([
+                'is_done' => $isDone,
+                'done_at' => $isDone ? Carbon::now() : null,
+                'store_id' => $storeId,
+            ]);
+
+            if (!$isDone) {
+                return;
+            }
+
+            $photoPath = $request->file('photo')?->store('price-photos', 'public');
+            $price = $request->input('price_decimal');
+
+            if ($price === null && $photoPath === null) {
+                return;
+            }
+
+            ItemPriceLog::query()->create([
+                'shopping_item_id' => $shoppingItem->id,
+                'store_id' => $storeId,
+                'price_decimal' => $price ?? 0,
+                'currency' => 'EUR',
+                'logged_at' => Carbon::now(),
+                'photo_path' => $photoPath,
+                'source' => 'manual',
+            ]);
+        });
+
+        return back()->with('status', 'Eintrag wurde aktualisiert.');
+    }
+
+    private function resolveStoreId(?int $storeId, ?string $newStoreName, int $userId): ?int
+    {
+        $newStoreName = trim((string) $newStoreName);
+        if ($newStoreName === '') {
+            return $storeId;
+        }
+
+        $normalized = mb_strtolower($newStoreName);
+        $store = Store::query()->firstOrCreate(
+            ['normalized_name' => $normalized],
+            [
+                'name' => $newStoreName,
+                'created_by' => $userId,
+            ]
+        );
+
+        return $store->id;
+    }
+}
diff --git a/app/Http/Requests/Auth/LoginRequest.php b/app/Http/Requests/Auth/LoginRequest.php
new file mode 100644
index 0000000..711e0a1
--- /dev/null
+++ b/app/Http/Requests/Auth/LoginRequest.php
@@ -0,0 +1,86 @@
+<?php
+
+namespace App\Http\Requests\Auth;
+
+use Illuminate\Auth\Events\Lockout;
+use Illuminate\Contracts\Validation\ValidationRule;
+use Illuminate\Foundation\Http\FormRequest;
+use Illuminate\Support\Facades\Auth;
+use Illuminate\Support\Facades\RateLimiter;
+use Illuminate\Support\Str;
+use Illuminate\Validation\ValidationException;
+
+class LoginRequest extends FormRequest
+{
+    /**
+     * Determine if the user is authorized to make this request.
+     */
+    public function authorize(): bool
+    {
+        return true;
+    }
+
+    /**
+     * Get the validation rules that apply to the request.
+     *
+     * @return array<string, ValidationRule|array<mixed>|string>
+     */
+    public function rules(): array
+    {
+        return [
+            'email' => ['required', 'string', 'email'],
+            'password' => ['required', 'string'],
+        ];
+    }
+
+    /**
+     * Attempt to authenticate the request's credentials.
+     *
+     * @throws ValidationException
+     */
+    public function authenticate(): void
+    {
+        $this->ensureIsNotRateLimited();
+
+        if (! Auth::attempt($this->only('email', 'password'), $this->boolean('remember'))) {
+            RateLimiter::hit($this->throttleKey());
+
+            throw ValidationException::withMessages([
+                'email' => trans('auth.failed'),
+            ]);
+        }
+
+        RateLimiter::clear($this->throttleKey());
+    }
+
+    /**
+     * Ensure the login request is not rate limited.
+     *
+     * @throws ValidationException
+     */
+    public function ensureIsNotRateLimited(): void
+    {
+        if (! RateLimiter::tooManyAttempts($this->throttleKey(), 5)) {
+            return;
+        }
+
+        event(new Lockout($this));
+
+        $seconds = RateLimiter::availableIn($this->throttleKey());
+
+        throw ValidationException::withMessages([
+            'email' => trans('auth.throttle', [
+                'seconds' => $seconds,
+                'minutes' => ceil($seconds / 60),
+            ]),
+        ]);
+    }
+
+    /**
+     * Get the rate limiting throttle key for the request.
+     */
+    public function throttleKey(): string
+    {
+        return Str::transliterate(Str::lower($this->string('email')).'|'.$this->ip());
+    }
+}
diff --git a/app/Http/Requests/ProfileUpdateRequest.php b/app/Http/Requests/ProfileUpdateRequest.php
new file mode 100644
index 0000000..e2202dd
--- /dev/null
+++ b/app/Http/Requests/ProfileUpdateRequest.php
@@ -0,0 +1,31 @@
+<?php
+
+namespace App\Http\Requests;
+
+use App\Models\User;
+use Illuminate\Contracts\Validation\ValidationRule;
+use Illuminate\Foundation\Http\FormRequest;
+use Illuminate\Validation\Rule;
+
+class ProfileUpdateRequest extends FormRequest
+{
+    /**
+     * Get the validation rules that apply to the request.
+     *
+     * @return array<string, ValidationRule|array<mixed>|string>
+     */
+    public function rules(): array
+    {
+        return [
+            'name' => ['required', 'string', 'max:255'],
+            'email' => [
+                'required',
+                'string',
+                'lowercase',
+                'email',
+                'max:255',
+                Rule::unique(User::class)->ignore($this->user()->id),
+            ],
+        ];
+    }
+}
diff --git a/app/Http/Requests/StoreShoppingItemRequest.php b/app/Http/Requests/StoreShoppingItemRequest.php
new file mode 100644
index 0000000..eb65815
--- /dev/null
+++ b/app/Http/Requests/StoreShoppingItemRequest.php
@@ -0,0 +1,52 @@
+<?php
+
+namespace App\Http\Requests;
+
+use Illuminate\Foundation\Http\FormRequest;
+
+class StoreShoppingItemRequest extends FormRequest
+{
+    /**
+     * Determine if the user is authorized to make this request.
+     */
+    public function authorize(): bool
+    {
+        return $this->user() !== null;
+    }
+
+    /**
+     * Get the validation rules that apply to the request.
+     *
+     * @return array<string, \Illuminate\Contracts\Validation\ValidationRule|array<mixed>|string>
+     */
+    public function rules(): array
+    {
+        return [
+            'product_name' => ['required', 'string', 'max:255'],
+            'quantity' => ['nullable', 'string', 'max:255'],
+            'store_id' => ['nullable', 'integer', 'exists:stores,id'],
+            'new_store_name' => ['nullable', 'string', 'max:255'],
+        ];
+    }
+
+    public function messages(): array
+    {
+        return [
+            'product_name.required' => 'Bitte gib einen Produktnamen ein.',
+            'product_name.max' => 'Der Produktname darf maximal 255 Zeichen lang sein.',
+            'quantity.max' => 'Die Menge darf maximal 255 Zeichen lang sein.',
+            'store_id.exists' => 'Das ausgewaehlte Geschaeft existiert nicht.',
+            'new_store_name.max' => 'Der neue Geschaeftsname darf maximal 255 Zeichen lang sein.',
+        ];
+    }
+
+    public function attributes(): array
+    {
+        return [
+            'product_name' => 'Produktname',
+            'quantity' => 'Menge',
+            'store_id' => 'Geschaeft',
+            'new_store_name' => 'neues Geschaeft',
+        ];
+    }
+}
diff --git a/app/Http/Requests/ToggleShoppingItemRequest.php b/app/Http/Requests/ToggleShoppingItemRequest.php
new file mode 100644
index 0000000..be41ff0
--- /dev/null
+++ b/app/Http/Requests/ToggleShoppingItemRequest.php
@@ -0,0 +1,57 @@
+<?php
+
+namespace App\Http\Requests;
+
+use Illuminate\Foundation\Http\FormRequest;
+
+class ToggleShoppingItemRequest extends FormRequest
+{
+    /**
+     * Determine if the user is authorized to make this request.
+     */
+    public function authorize(): bool
+    {
+        return $this->user() !== null;
+    }
+
+    /**
+     * Get the validation rules that apply to the request.
+     *
+     * @return array<string, \Illuminate\Contracts\Validation\ValidationRule|array<mixed>|string>
+     */
+    public function rules(): array
+    {
+        return [
+            'is_done' => ['required', 'boolean'],
+            'store_id' => ['nullable', 'integer', 'exists:stores,id'],
+            'new_store_name' => ['nullable', 'string', 'max:255'],
+            'price_decimal' => ['nullable', 'numeric', 'min:0', 'max:999999.99'],
+            'photo' => ['nullable', 'image', 'max:5120'],
+        ];
+    }
+
+    public function messages(): array
+    {
+        return [
+            'is_done.required' => 'Statusfeld fehlt.',
+            'is_done.boolean' => 'Ungueltiger Statuswert.',
+            'store_id.exists' => 'Das ausgewaehlte Geschaeft existiert nicht.',
+            'new_store_name.max' => 'Der neue Geschaeftsname darf maximal 255 Zeichen lang sein.',
+            'price_decimal.numeric' => 'Der Preis muss eine Zahl sein.',
+            'price_decimal.min' => 'Der Preis darf nicht negativ sein.',
+            'price_decimal.max' => 'Der Preis ist zu gross.',
+            'photo.image' => 'Das Foto muss ein Bild sein.',
+            'photo.max' => 'Das Foto darf maximal 5 MB gross sein.',
+        ];
+    }
+
+    public function attributes(): array
+    {
+        return [
+            'store_id' => 'Geschaeft',
+            'new_store_name' => 'neues Geschaeft',
+            'price_decimal' => 'Preis',
+            'photo' => 'Foto',
+        ];
+    }
+}
diff --git a/app/Models/ItemPriceLog.php b/app/Models/ItemPriceLog.php
new file mode 100644
index 0000000..2fb99f2
--- /dev/null
+++ b/app/Models/ItemPriceLog.php
@@ -0,0 +1,37 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+use Illuminate\Database\Eloquent\Relations\BelongsTo;
+
+class ItemPriceLog extends Model
+{
+    protected $fillable = [
+        'shopping_item_id',
+        'store_id',
+        'price_decimal',
+        'currency',
+        'logged_at',
+        'photo_path',
+        'source',
+    ];
+
+    protected function casts(): array
+    {
+        return [
+            'price_decimal' => 'decimal:2',
+            'logged_at' => 'datetime',
+        ];
+    }
+
+    public function shoppingItem(): BelongsTo
+    {
+        return $this->belongsTo(ShoppingItem::class);
+    }
+
+    public function store(): BelongsTo
+    {
+        return $this->belongsTo(Store::class);
+    }
+}
diff --git a/app/Models/ShoppingItem.php b/app/Models/ShoppingItem.php
new file mode 100644
index 0000000..7a97284
--- /dev/null
+++ b/app/Models/ShoppingItem.php
@@ -0,0 +1,48 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+use Illuminate\Database\Eloquent\Relations\BelongsTo;
+use Illuminate\Database\Eloquent\Relations\HasOne;
+use Illuminate\Database\Eloquent\Relations\HasMany;
+
+class ShoppingItem extends Model
+{
+    protected $fillable = [
+        'user_id',
+        'product_name',
+        'quantity',
+        'store_id',
+        'is_done',
+        'done_at',
+    ];
+
+    protected function casts(): array
+    {
+        return [
+            'is_done' => 'boolean',
+            'done_at' => 'datetime',
+        ];
+    }
+
+    public function user(): BelongsTo
+    {
+        return $this->belongsTo(User::class);
+    }
+
+    public function store(): BelongsTo
+    {
+        return $this->belongsTo(Store::class);
+    }
+
+    public function priceLogs(): HasMany
+    {
+        return $this->hasMany(ItemPriceLog::class);
+    }
+
+    public function latestPriceLog(): HasOne
+    {
+        return $this->hasOne(ItemPriceLog::class)->latestOfMany('logged_at');
+    }
+}
diff --git a/app/Models/Store.php b/app/Models/Store.php
new file mode 100644
index 0000000..01534ba
--- /dev/null
+++ b/app/Models/Store.php
@@ -0,0 +1,39 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+use Illuminate\Database\Eloquent\Relations\BelongsTo;
+use Illuminate\Database\Eloquent\Relations\HasMany;
+
+class Store extends Model
+{
+    protected $fillable = [
+        'name',
+        'normalized_name',
+        'created_by',
+    ];
+
+    protected static function booted(): void
+    {
+        static::saving(function (Store $store): void {
+            $store->name = trim($store->name);
+            $store->normalized_name = mb_strtolower($store->name);
+        });
+    }
+
+    public function creator(): BelongsTo
+    {
+        return $this->belongsTo(User::class, 'created_by');
+    }
+
+    public function shoppingItems(): HasMany
+    {
+        return $this->hasMany(ShoppingItem::class);
+    }
+
+    public function priceLogs(): HasMany
+    {
+        return $this->hasMany(ItemPriceLog::class);
+    }
+}
diff --git a/app/Models/User.php b/app/Models/User.php
new file mode 100644
index 0000000..048e6ef
--- /dev/null
+++ b/app/Models/User.php
@@ -0,0 +1,55 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Contracts\Auth\MustVerifyEmail;
+use Database\Factories\UserFactory;
+use Illuminate\Database\Eloquent\Relations\HasMany;
+use Illuminate\Database\Eloquent\Factories\HasFactory;
+use Illuminate\Foundation\Auth\User as Authenticatable;
+use Illuminate\Notifications\Notifiable;
+
+class User extends Authenticatable implements MustVerifyEmail
+{
+    /** @use HasFactory<UserFactory> */
+    use HasFactory, Notifiable;
+
+    /**
+     * The attributes that are mass assignable.
+     *
+     * @var list<string>
+     */
+    protected $fillable = [
+        'name',
+        'email',
+        'password',
+    ];
+
+    /**
+     * The attributes that should be hidden for serialization.
+     *
+     * @var list<string>
+     */
+    protected $hidden = [
+        'password',
+        'remember_token',
+    ];
+
+    /**
+     * Get the attributes that should be cast.
+     *
+     * @return array<string, string>
+     */
+    protected function casts(): array
+    {
+        return [
+            'email_verified_at' => 'datetime',
+            'password' => 'hashed',
+        ];
+    }
+
+    public function shoppingItems(): HasMany
+    {
+        return $this->hasMany(ShoppingItem::class);
+    }
+}
diff --git a/app/Providers/AppServiceProvider.php b/app/Providers/AppServiceProvider.php
new file mode 100644
index 0000000..95abf06
--- /dev/null
+++ b/app/Providers/AppServiceProvider.php
@@ -0,0 +1,28 @@
+<?php
+
+namespace App\Providers;
+
+use App\Services\PriceScan\NullPriceScanService;
+use App\Services\PriceScan\PriceScanServiceInterface;
+use Illuminate\Support\Facades\Schema;
+use Illuminate\Support\ServiceProvider;
+
+class AppServiceProvider extends ServiceProvider
+{
+    /**
+     * Register any application services.
+     */
+    public function register(): void
+    {
+        $this->app->bind(PriceScanServiceInterface::class, NullPriceScanService::class);
+    }
+
+    /**
+     * Bootstrap any application services.
+     */
+    public function boot(): void
+    {
+        // Compatibility for older MariaDB/MySQL index length limits.
+        Schema::defaultStringLength(191);
+    }
+}
diff --git a/app/Services/PriceScan/NullPriceScanService.php b/app/Services/PriceScan/NullPriceScanService.php
new file mode 100644
index 0000000..cf54383
--- /dev/null
+++ b/app/Services/PriceScan/NullPriceScanService.php
@@ -0,0 +1,14 @@
+<?php
+
+namespace App\Services\PriceScan;
+
+class NullPriceScanService implements PriceScanServiceInterface
+{
+    public function detectPriceFromImage(string $imagePath): array
+    {
+        return [
+            'price' => null,
+            'currency' => null,
+        ];
+    }
+}
diff --git a/app/Services/PriceScan/PriceScanServiceInterface.php b/app/Services/PriceScan/PriceScanServiceInterface.php
new file mode 100644
index 0000000..2079800
--- /dev/null
+++ b/app/Services/PriceScan/PriceScanServiceInterface.php
@@ -0,0 +1,13 @@
+<?php
+
+namespace App\Services\PriceScan;
+
+interface PriceScanServiceInterface
+{
+    /**
+     * Placeholder for future OCR/scan integration.
+     *
+     * @return array{price: float|null, currency: string|null}
+     */
+    public function detectPriceFromImage(string $imagePath): array;
+}
diff --git a/app/View/Components/AppLayout.php b/app/View/Components/AppLayout.php
new file mode 100644
index 0000000..de0d46f
--- /dev/null
+++ b/app/View/Components/AppLayout.php
@@ -0,0 +1,17 @@
+<?php
+
+namespace App\View\Components;
+
+use Illuminate\View\Component;
+use Illuminate\View\View;
+
+class AppLayout extends Component
+{
+    /**
+     * Get the view / contents that represents the component.
+     */
+    public function render(): View
+    {
+        return view('layouts.app');
+    }
+}
diff --git a/app/View/Components/GuestLayout.php b/app/View/Components/GuestLayout.php
new file mode 100644
index 0000000..d1f6253
--- /dev/null
+++ b/app/View/Components/GuestLayout.php
@@ -0,0 +1,17 @@
+<?php
+
+namespace App\View\Components;
+
+use Illuminate\View\Component;
+use Illuminate\View\View;
+
+class GuestLayout extends Component
+{
+    /**
+     * Get the view / contents that represents the component.
+     */
+    public function render(): View
+    {
+        return view('layouts.guest');
+    }
+}
diff --git a/artisan b/artisan
new file mode 100644
index 0000000..c35e31d
--- /dev/null
+++ b/artisan
@@ -0,0 +1,18 @@
+#!/usr/bin/env php
+<?php
+
+use Illuminate\Foundation\Application;
+use Symfony\Component\Console\Input\ArgvInput;
+
+define('LARAVEL_START', microtime(true));
+
+// Register the Composer autoloader...
+require __DIR__.'/vendor/autoload.php';
+
+// Bootstrap Laravel and handle the command...
+/** @var Application $app */
+$app = require_once __DIR__.'/bootstrap/app.php';
+
+$status = $app->handleCommand(new ArgvInput);
+
+exit($status);
diff --git a/bootstrap/app.php b/bootstrap/app.php
new file mode 100644
index 0000000..c183276
--- /dev/null
+++ b/bootstrap/app.php
@@ -0,0 +1,18 @@
+<?php
+
+use Illuminate\Foundation\Application;
+use Illuminate\Foundation\Configuration\Exceptions;
+use Illuminate\Foundation\Configuration\Middleware;
+
+return Application::configure(basePath: dirname(__DIR__))
+    ->withRouting(
+        web: __DIR__.'/../routes/web.php',
+        commands: __DIR__.'/../routes/console.php',
+        health: '/up',
+    )
+    ->withMiddleware(function (Middleware $middleware): void {
+        //
+    })
+    ->withExceptions(function (Exceptions $exceptions): void {
+        //
+    })->create();
diff --git a/bootstrap/cache/.gitignore b/bootstrap/cache/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/bootstrap/cache/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/bootstrap/providers.php b/bootstrap/providers.php
new file mode 100644
index 0000000..fc94ae6
--- /dev/null
+++ b/bootstrap/providers.php
@@ -0,0 +1,7 @@
+<?php
+
+use App\Providers\AppServiceProvider;
+
+return [
+    AppServiceProvider::class,
+];
diff --git a/composer.json b/composer.json
new file mode 100644
index 0000000..fd3da06
--- /dev/null
+++ b/composer.json
@@ -0,0 +1,87 @@
+{
+    "$schema": "https://getcomposer.org/schema.json",
+    "name": "laravel/laravel",
+    "type": "project",
+    "description": "The skeleton application for the Laravel framework.",
+    "keywords": ["laravel", "framework"],
+    "license": "MIT",
+    "require": {
+        "php": "^8.2",
+        "laravel/framework": "^12.0",
+        "laravel/tinker": "^2.10.1"
+    },
+    "require-dev": {
+        "fakerphp/faker": "^1.23",
+        "laravel/breeze": "^2.4",
+        "laravel/pail": "^1.2.2",
+        "laravel/pint": "^1.24",
+        "laravel/sail": "^1.41",
+        "mockery/mockery": "^1.6",
+        "nunomaduro/collision": "^8.6",
+        "phpunit/phpunit": "^11.5.50"
+    },
+    "autoload": {
+        "psr-4": {
+            "App\\": "app/",
+            "Database\\Factories\\": "database/factories/",
+            "Database\\Seeders\\": "database/seeders/"
+        }
+    },
+    "autoload-dev": {
+        "psr-4": {
+            "Tests\\": "tests/"
+        }
+    },
+    "scripts": {
+        "setup": [
+            "composer install",
+            "@php -r \"file_exists('.env') || copy('.env.example', '.env');\"",
+            "@php artisan key:generate",
+            "@php artisan migrate --force",
+            "npm install",
+            "npm run build"
+        ],
+        "dev": [
+            "Composer\\Config::disableProcessTimeout",
+            "npx concurrently -c \"#93c5fd,#c4b5fd,#fb7185,#fdba74\" \"php artisan serve\" \"php artisan queue:listen --tries=1 --timeout=0\" \"php artisan pail --timeout=0\" \"npm run dev\" --names=server,queue,logs,vite --kill-others"
+        ],
+        "test": [
+            "@php artisan config:clear --ansi",
+            "@php artisan test"
+        ],
+        "post-autoload-dump": [
+            "Illuminate\\Foundation\\ComposerScripts::postAutoloadDump",
+            "@php artisan package:discover --ansi"
+        ],
+        "post-update-cmd": [
+            "@php artisan vendor:publish --tag=laravel-assets --ansi --force"
+        ],
+        "post-root-package-install": [
+            "@php -r \"file_exists('.env') || copy('.env.example', '.env');\""
+        ],
+        "post-create-project-cmd": [
+            "@php artisan key:generate --ansi",
+            "@php -r \"file_exists('database/database.sqlite') || touch('database/database.sqlite');\"",
+            "@php artisan migrate --graceful --ansi"
+        ],
+        "pre-package-uninstall": [
+            "Illuminate\\Foundation\\ComposerScripts::prePackageUninstall"
+        ]
+    },
+    "extra": {
+        "laravel": {
+            "dont-discover": []
+        }
+    },
+    "config": {
+        "optimize-autoloader": true,
+        "preferred-install": "dist",
+        "sort-packages": true,
+        "allow-plugins": {
+            "pestphp/pest-plugin": true,
+            "php-http/discovery": true
+        }
+    },
+    "minimum-stability": "stable",
+    "prefer-stable": true
+}
diff --git a/composer.lock b/composer.lock
new file mode 100644
index 0000000..173daef
--- /dev/null
+++ b/composer.lock
@@ -0,0 +1,8460 @@
+{
+    "_readme": [
+        "This file locks the dependencies of your project to a known state",
+        "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies",
+        "This file is @generated automatically"
+    ],
+    "content-hash": "fc2407b1a509d7fcbbc5146f46a2c921",
+    "packages": [
+        {
+            "name": "brick/math",
+            "version": "0.14.8",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/brick/math.git",
+                "reference": "63422359a44b7f06cae63c3b429b59e8efcc0629"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/brick/math/zipball/63422359a44b7f06cae63c3b429b59e8efcc0629",
+                "reference": "63422359a44b7f06cae63c3b429b59e8efcc0629",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^8.2"
+            },
+            "require-dev": {
+                "php-coveralls/php-coveralls": "^2.2",
+                "phpstan/phpstan": "2.1.22",
+                "phpunit/phpunit": "^11.5"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Brick\\Math\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "Arbitrary-precision arithmetic library",
+            "keywords": [
+                "Arbitrary-precision",
+                "BigInteger",
+                "BigRational",
+                "arithmetic",
+                "bigdecimal",
+                "bignum",
+                "bignumber",
+                "brick",
+                "decimal",
+                "integer",
+                "math",
+                "mathematics",
+                "rational"
+            ],
+            "support": {
+                "issues": "https://github.com/brick/math/issues",
+                "source": "https://github.com/brick/math/tree/0.14.8"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/BenMorel",
+                    "type": "github"
+                }
+            ],
+            "time": "2026-02-10T14:33:43+00:00"
+        },
+        {
+            "name": "carbonphp/carbon-doctrine-types",
+            "version": "3.2.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/CarbonPHP/carbon-doctrine-types.git",
+                "reference": "18ba5ddfec8976260ead6e866180bd5d2f71aa1d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/CarbonPHP/carbon-doctrine-types/zipball/18ba5ddfec8976260ead6e866180bd5d2f71aa1d",
+                "reference": "18ba5ddfec8976260ead6e866180bd5d2f71aa1d",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^8.1"
+            },
+            "conflict": {
+                "doctrine/dbal": "<4.0.0 || >=5.0.0"
+            },
+            "require-dev": {
+                "doctrine/dbal": "^4.0.0",
+                "nesbot/carbon": "^2.71.0 || ^3.0.0",
+                "phpunit/phpunit": "^10.3"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Carbon\\Doctrine\\": "src/Carbon/Doctrine/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "KyleKatarn",
+                    "email": "kylekatarnls@gmail.com"
+                }
+            ],
+            "description": "Types to use Carbon in Doctrine",
+            "keywords": [
+                "carbon",
+                "date",
+                "datetime",
+                "doctrine",
+                "time"
+            ],
+            "support": {
+                "issues": "https://github.com/CarbonPHP/carbon-doctrine-types/issues",
+                "source": "https://github.com/CarbonPHP/carbon-doctrine-types/tree/3.2.0"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/kylekatarnls",
+                    "type": "github"
+                },
+                {
+                    "url": "https://opencollective.com/Carbon",
+                    "type": "open_collective"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/nesbot/carbon",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2024-02-09T16:56:22+00:00"
+        },
+        {
+            "name": "dflydev/dot-access-data",
+            "version": "v3.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/dflydev/dflydev-dot-access-data.git",
+                "reference": "a23a2bf4f31d3518f3ecb38660c95715dfead60f"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/dflydev/dflydev-dot-access-data/zipball/a23a2bf4f31d3518f3ecb38660c95715dfead60f",
+                "reference": "a23a2bf4f31d3518f3ecb38660c95715dfead60f",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.1 || ^8.0"
+            },
+            "require-dev": {
+                "phpstan/phpstan": "^0.12.42",
+                "phpunit/phpunit": "^7.5 || ^8.5 || ^9.3",
+                "scrutinizer/ocular": "1.6.0",
+                "squizlabs/php_codesniffer": "^3.5",
+                "vimeo/psalm": "^4.0.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "3.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Dflydev\\DotAccessData\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Dragonfly Development Inc.",
+                    "email": "info@dflydev.com",
+                    "homepage": "http://dflydev.com"
+                },
+                {
+                    "name": "Beau Simensen",
+                    "email": "beau@dflydev.com",
+                    "homepage": "http://beausimensen.com"
+                },
+                {
+                    "name": "Carlos Frutos",
+                    "email": "carlos@kiwing.it",
+                    "homepage": "https://github.com/cfrutos"
+                },
+                {
+                    "name": "Colin O'Dell",
+                    "email": "colinodell@gmail.com",
+                    "homepage": "https://www.colinodell.com"
+                }
+            ],
+            "description": "Given a deep data structure, access data by dot notation.",
+            "homepage": "https://github.com/dflydev/dflydev-dot-access-data",
+            "keywords": [
+                "access",
+                "data",
+                "dot",
+                "notation"
+            ],
+            "support": {
+                "issues": "https://github.com/dflydev/dflydev-dot-access-data/issues",
+                "source": "https://github.com/dflydev/dflydev-dot-access-data/tree/v3.0.3"
+            },
+            "time": "2024-07-08T12:26:09+00:00"
+        },
+        {
+            "name": "doctrine/inflector",
+            "version": "2.1.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/inflector.git",
+                "reference": "6d6c96277ea252fc1304627204c3d5e6e15faa3b"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/inflector/zipball/6d6c96277ea252fc1304627204c3d5e6e15faa3b",
+                "reference": "6d6c96277ea252fc1304627204c3d5e6e15faa3b",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2 || ^8.0"
+            },
+            "require-dev": {
+                "doctrine/coding-standard": "^12.0 || ^13.0",
+                "phpstan/phpstan": "^1.12 || ^2.0",
+                "phpstan/phpstan-phpunit": "^1.4 || ^2.0",
+                "phpstan/phpstan-strict-rules": "^1.6 || ^2.0",
+                "phpunit/phpunit": "^8.5 || ^12.2"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\Inflector\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Guilherme Blanco",
+                    "email": "guilhermeblanco@gmail.com"
+                },
+                {
+                    "name": "Roman Borschel",
+                    "email": "roman@code-factory.org"
+                },
+                {
+                    "name": "Benjamin Eberlei",
+                    "email": "kontakt@beberlei.de"
+                },
+                {
+                    "name": "Jonathan Wage",
+                    "email": "jonwage@gmail.com"
+                },
+                {
+                    "name": "Johannes Schmitt",
+                    "email": "schmittjoh@gmail.com"
+                }
+            ],
+            "description": "PHP Doctrine Inflector is a small library that can perform string manipulations with regard to upper/lowercase and singular/plural forms of words.",
+            "homepage": "https://www.doctrine-project.org/projects/inflector.html",
+            "keywords": [
+                "inflection",
+                "inflector",
+                "lowercase",
+                "manipulation",
+                "php",
+                "plural",
+                "singular",
+                "strings",
+                "uppercase",
+                "words"
+            ],
+            "support": {
+                "issues": "https://github.com/doctrine/inflector/issues",
+                "source": "https://github.com/doctrine/inflector/tree/2.1.0"
+            },
+            "funding": [
+                {
+                    "url": "https://www.doctrine-project.org/sponsorship.html",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://www.patreon.com/phpdoctrine",
+                    "type": "patreon"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/doctrine%2Finflector",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-08-10T19:31:58+00:00"
+        },
+        {
+            "name": "doctrine/lexer",
+            "version": "3.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/lexer.git",
+                "reference": "31ad66abc0fc9e1a1f2d9bc6a42668d2fbbcd6dd"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/lexer/zipball/31ad66abc0fc9e1a1f2d9bc6a42668d2fbbcd6dd",
+                "reference": "31ad66abc0fc9e1a1f2d9bc6a42668d2fbbcd6dd",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^8.1"
+            },
+            "require-dev": {
+                "doctrine/coding-standard": "^12",
+                "phpstan/phpstan": "^1.10",
+                "phpunit/phpunit": "^10.5",
+                "psalm/plugin-phpunit": "^0.18.3",
+                "vimeo/psalm": "^5.21"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\Common\\Lexer\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Guilherme Blanco",
+                    "email": "guilhermeblanco@gmail.com"
+                },
+                {
+                    "name": "Roman Borschel",
+                    "email": "roman@code-factory.org"
+                },
+                {
+                    "name": "Johannes Schmitt",
+                    "email": "schmittjoh@gmail.com"
+                }
+            ],
+            "description": "PHP Doctrine Lexer parser library that can be used in Top-Down, Recursive Descent Parsers.",
+            "homepage": "https://www.doctrine-project.org/projects/lexer.html",
+            "keywords": [
+                "annotations",
+                "docblock",
+                "lexer",
+                "parser",
+                "php"
+            ],
+            "support": {
+                "issues": "https://github.com/doctrine/lexer/issues",
+                "source": "https://github.com/doctrine/lexer/tree/3.0.1"
+            },
+            "funding": [
+                {
+                    "url": "https://www.doctrine-project.org/sponsorship.html",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://www.patreon.com/phpdoctrine",
+                    "type": "patreon"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/doctrine%2Flexer",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2024-02-05T11:56:58+00:00"
+        },
+        {
+            "name": "dragonmantank/cron-expression",
+            "version": "v3.6.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/dragonmantank/cron-expression.git",
+                "reference": "d61a8a9604ec1f8c3d150d09db6ce98b32675013"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/dragonmantank/cron-expression/zipball/d61a8a9604ec1f8c3d150d09db6ce98b32675013",
+                "reference": "d61a8a9604ec1f8c3d150d09db6ce98b32675013",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^8.2|^8.3|^8.4|^8.5"
+            },
+            "replace": {
+                "mtdowling/cron-expression": "^1.0"
+            },
+            "require-dev": {
+                "phpstan/extension-installer": "^1.4.3",
+                "phpstan/phpstan": "^1.12.32|^2.1.31",
+                "phpunit/phpunit": "^8.5.48|^9.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Cron\\": "src/Cron/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Chris Tankersley",
+                    "email": "chris@ctankersley.com",
+                    "homepage": "https://github.com/dragonmantank"
+                }
+            ],
+            "description": "CRON for PHP: Calculate the next or previous run date and determine if a CRON expression is due",
+            "keywords": [
+                "cron",
+                "schedule"
+            ],
+            "support": {
+                "issues": "https://github.com/dragonmantank/cron-expression/issues",
+                "source": "https://github.com/dragonmantank/cron-expression/tree/v3.6.0"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/dragonmantank",
+                    "type": "github"
+                }
+            ],
+            "time": "2025-10-31T18:51:33+00:00"
+        },
+        {
+            "name": "egulias/email-validator",
+            "version": "4.0.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/egulias/EmailValidator.git",
+                "reference": "d42c8731f0624ad6bdc8d3e5e9a4524f68801cfa"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/egulias/EmailValidator/zipball/d42c8731f0624ad6bdc8d3e5e9a4524f68801cfa",
+                "reference": "d42c8731f0624ad6bdc8d3e5e9a4524f68801cfa",
+                "shasum": ""
+            },
+            "require": {
+                "doctrine/lexer": "^2.0 || ^3.0",
+                "php": ">=8.1",
+                "symfony/polyfill-intl-idn": "^1.26"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^10.2",
+                "vimeo/psalm": "^5.12"
+            },
+            "suggest": {
+                "ext-intl": "PHP Internationalization Libraries are required to use the SpoofChecking validation"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "4.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Egulias\\EmailValidator\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Eduardo Gulias Davis"
+                }
+            ],
+            "description": "A library for validating emails against several RFCs",
+            "homepage": "https://github.com/egulias/EmailValidator",
+            "keywords": [
+                "email",
+                "emailvalidation",
+                "emailvalidator",
+                "validation",
+                "validator"
+            ],
+            "support": {
+                "issues": "https://github.com/egulias/EmailValidator/issues",
+                "source": "https://github.com/egulias/EmailValidator/tree/4.0.4"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/egulias",
+                    "type": "github"
+                }
+            ],
+            "time": "2025-03-06T22:45:56+00:00"
+        },
+        {
+            "name": "fruitcake/php-cors",
+            "version": "v1.4.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/fruitcake/php-cors.git",
+                "reference": "38aaa6c3fd4c157ffe2a4d10aa8b9b16ba8de379"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/fruitcake/php-cors/zipball/38aaa6c3fd4c157ffe2a4d10aa8b9b16ba8de379",
+                "reference": "38aaa6c3fd4c157ffe2a4d10aa8b9b16ba8de379",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^8.1",
+                "symfony/http-foundation": "^5.4|^6.4|^7.3|^8"
+            },
+            "require-dev": {
+                "phpstan/phpstan": "^2",
+                "phpunit/phpunit": "^9",
+                "squizlabs/php_codesniffer": "^4"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.3-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Fruitcake\\Cors\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fruitcake",
+                    "homepage": "https://fruitcake.nl"
+                },
+                {
+                    "name": "Barryvdh",
+                    "email": "barryvdh@gmail.com"
+                }
+            ],
+            "description": "Cross-origin resource sharing library for the Symfony HttpFoundation",
+            "homepage": "https://github.com/fruitcake/php-cors",
+            "keywords": [
+                "cors",
+                "laravel",
+                "symfony"
+            ],
+            "support": {
+                "issues": "https://github.com/fruitcake/php-cors/issues",
+                "source": "https://github.com/fruitcake/php-cors/tree/v1.4.0"
+            },
+            "funding": [
+                {
+                    "url": "https://fruitcake.nl",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/barryvdh",
+                    "type": "github"
+                }
+            ],
+            "time": "2025-12-03T09:33:47+00:00"
+        },
+        {
+            "name": "graham-campbell/result-type",
+            "version": "v1.1.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/GrahamCampbell/Result-Type.git",
+                "reference": "e01f4a821471308ba86aa202fed6698b6b695e3b"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/GrahamCampbell/Result-Type/zipball/e01f4a821471308ba86aa202fed6698b6b695e3b",
+                "reference": "e01f4a821471308ba86aa202fed6698b6b695e3b",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2.5 || ^8.0",
+                "phpoption/phpoption": "^1.9.5"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^8.5.41 || ^9.6.22 || ^10.5.45 || ^11.5.7"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "GrahamCampbell\\ResultType\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Graham Campbell",
+                    "email": "hello@gjcampbell.co.uk",
+                    "homepage": "https://github.com/GrahamCampbell"
+                }
+            ],
+            "description": "An Implementation Of The Result Type",
+            "keywords": [
+                "Graham Campbell",
+                "GrahamCampbell",
+                "Result Type",
+                "Result-Type",
+                "result"
+            ],
+            "support": {
+                "issues": "https://github.com/GrahamCampbell/Result-Type/issues",
+                "source": "https://github.com/GrahamCampbell/Result-Type/tree/v1.1.4"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/GrahamCampbell",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/graham-campbell/result-type",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-12-27T19:43:20+00:00"
+        },
+        {
+            "name": "guzzlehttp/guzzle",
+            "version": "7.10.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/guzzle/guzzle.git",
+                "reference": "b51ac707cfa420b7bfd4e4d5e510ba8008e822b4"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/guzzle/guzzle/zipball/b51ac707cfa420b7bfd4e4d5e510ba8008e822b4",
+                "reference": "b51ac707cfa420b7bfd4e4d5e510ba8008e822b4",
+                "shasum": ""
+            },
+            "require": {
+                "ext-json": "*",
+                "guzzlehttp/promises": "^2.3",
+                "guzzlehttp/psr7": "^2.8",
+                "php": "^7.2.5 || ^8.0",
+                "psr/http-client": "^1.0",
+                "symfony/deprecation-contracts": "^2.2 || ^3.0"
+            },
+            "provide": {
+                "psr/http-client-implementation": "1.0"
+            },
+            "require-dev": {
+                "bamarni/composer-bin-plugin": "^1.8.2",
+                "ext-curl": "*",
+                "guzzle/client-integration-tests": "3.0.2",
+                "php-http/message-factory": "^1.1",
+                "phpunit/phpunit": "^8.5.39 || ^9.6.20",
+                "psr/log": "^1.1 || ^2.0 || ^3.0"
+            },
+            "suggest": {
+                "ext-curl": "Required for CURL handler support",
+                "ext-intl": "Required for Internationalized Domain Name (IDN) support",
+                "psr/log": "Required for using the Log middleware"
+            },
+            "type": "library",
+            "extra": {
+                "bamarni-bin": {
+                    "bin-links": true,
+                    "forward-command": false
+                }
+            },
+            "autoload": {
+                "files": [
+                    "src/functions_include.php"
+                ],
+                "psr-4": {
+                    "GuzzleHttp\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Graham Campbell",
+                    "email": "hello@gjcampbell.co.uk",
+                    "homepage": "https://github.com/GrahamCampbell"
+                },
+                {
+                    "name": "Michael Dowling",
+                    "email": "mtdowling@gmail.com",
+                    "homepage": "https://github.com/mtdowling"
+                },
+                {
+                    "name": "Jeremy Lindblom",
+                    "email": "jeremeamia@gmail.com",
+                    "homepage": "https://github.com/jeremeamia"
+                },
+                {
+                    "name": "George Mponos",
+                    "email": "gmponos@gmail.com",
+                    "homepage": "https://github.com/gmponos"
+                },
+                {
+                    "name": "Tobias Nyholm",
+                    "email": "tobias.nyholm@gmail.com",
+                    "homepage": "https://github.com/Nyholm"
+                },
+                {
+                    "name": "Márk Sági-Kazár",
+                    "email": "mark.sagikazar@gmail.com",
+                    "homepage": "https://github.com/sagikazarmark"
+                },
+                {
+                    "name": "Tobias Schultze",
+                    "email": "webmaster@tubo-world.de",
+                    "homepage": "https://github.com/Tobion"
+                }
+            ],
+            "description": "Guzzle is a PHP HTTP client library",
+            "keywords": [
+                "client",
+                "curl",
+                "framework",
+                "http",
+                "http client",
+                "psr-18",
+                "psr-7",
+                "rest",
+                "web service"
+            ],
+            "support": {
+                "issues": "https://github.com/guzzle/guzzle/issues",
+                "source": "https://github.com/guzzle/guzzle/tree/7.10.0"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/GrahamCampbell",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/Nyholm",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/guzzle",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-08-23T22:36:01+00:00"
+        },
+        {
+            "name": "guzzlehttp/promises",
+            "version": "2.3.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/guzzle/promises.git",
+                "reference": "481557b130ef3790cf82b713667b43030dc9c957"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/guzzle/promises/zipball/481557b130ef3790cf82b713667b43030dc9c957",
+                "reference": "481557b130ef3790cf82b713667b43030dc9c957",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2.5 || ^8.0"
+            },
+            "require-dev": {
+                "bamarni/composer-bin-plugin": "^1.8.2",
+                "phpunit/phpunit": "^8.5.44 || ^9.6.25"
+            },
+            "type": "library",
+            "extra": {
+                "bamarni-bin": {
+                    "bin-links": true,
+                    "forward-command": false
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "GuzzleHttp\\Promise\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Graham Campbell",
+                    "email": "hello@gjcampbell.co.uk",
+                    "homepage": "https://github.com/GrahamCampbell"
+                },
+                {
+                    "name": "Michael Dowling",
+                    "email": "mtdowling@gmail.com",
+                    "homepage": "https://github.com/mtdowling"
+                },
+                {
+                    "name": "Tobias Nyholm",
+                    "email": "tobias.nyholm@gmail.com",
+                    "homepage": "https://github.com/Nyholm"
+                },
+                {
+                    "name": "Tobias Schultze",
+                    "email": "webmaster@tubo-world.de",
+                    "homepage": "https://github.com/Tobion"
+                }
+            ],
+            "description": "Guzzle promises library",
+            "keywords": [
+                "promise"
+            ],
+            "support": {
+                "issues": "https://github.com/guzzle/promises/issues",
+                "source": "https://github.com/guzzle/promises/tree/2.3.0"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/GrahamCampbell",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/Nyholm",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/promises",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-08-22T14:34:08+00:00"
+        },
+        {
+            "name": "guzzlehttp/psr7",
+            "version": "2.9.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/guzzle/psr7.git",
+                "reference": "7d0ed42f28e42d61352a7a79de682e5e67fec884"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/guzzle/psr7/zipball/7d0ed42f28e42d61352a7a79de682e5e67fec884",
+                "reference": "7d0ed42f28e42d61352a7a79de682e5e67fec884",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2.5 || ^8.0",
+                "psr/http-factory": "^1.0",
+                "psr/http-message": "^1.1 || ^2.0",
+                "ralouphie/getallheaders": "^3.0"
+            },
+            "provide": {
+                "psr/http-factory-implementation": "1.0",
+                "psr/http-message-implementation": "1.0"
+            },
+            "require-dev": {
+                "bamarni/composer-bin-plugin": "^1.8.2",
+                "http-interop/http-factory-tests": "0.9.0",
+                "jshttp/mime-db": "1.54.0.1",
+                "phpunit/phpunit": "^8.5.44 || ^9.6.25"
+            },
+            "suggest": {
+                "laminas/laminas-httphandlerrunner": "Emit PSR-7 responses"
+            },
+            "type": "library",
+            "extra": {
+                "bamarni-bin": {
+                    "bin-links": true,
+                    "forward-command": false
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "GuzzleHttp\\Psr7\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Graham Campbell",
+                    "email": "hello@gjcampbell.co.uk",
+                    "homepage": "https://github.com/GrahamCampbell"
+                },
+                {
+                    "name": "Michael Dowling",
+                    "email": "mtdowling@gmail.com",
+                    "homepage": "https://github.com/mtdowling"
+                },
+                {
+                    "name": "George Mponos",
+                    "email": "gmponos@gmail.com",
+                    "homepage": "https://github.com/gmponos"
+                },
+                {
+                    "name": "Tobias Nyholm",
+                    "email": "tobias.nyholm@gmail.com",
+                    "homepage": "https://github.com/Nyholm"
+                },
+                {
+                    "name": "Márk Sági-Kazár",
+                    "email": "mark.sagikazar@gmail.com",
+                    "homepage": "https://github.com/sagikazarmark"
+                },
+                {
+                    "name": "Tobias Schultze",
+                    "email": "webmaster@tubo-world.de",
+                    "homepage": "https://github.com/Tobion"
+                },
+                {
+                    "name": "Márk Sági-Kazár",
+                    "email": "mark.sagikazar@gmail.com",
+                    "homepage": "https://sagikazarmark.hu"
+                }
+            ],
+            "description": "PSR-7 message implementation that also provides common utility methods",
+            "keywords": [
+                "http",
+                "message",
+                "psr-7",
+                "request",
+                "response",
+                "stream",
+                "uri",
+                "url"
+            ],
+            "support": {
+                "issues": "https://github.com/guzzle/psr7/issues",
+                "source": "https://github.com/guzzle/psr7/tree/2.9.0"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/GrahamCampbell",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/Nyholm",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/psr7",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-03-10T16:41:02+00:00"
+        },
+        {
+            "name": "guzzlehttp/uri-template",
+            "version": "v1.0.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/guzzle/uri-template.git",
+                "reference": "4f4bbd4e7172148801e76e3decc1e559bdee34e1"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/guzzle/uri-template/zipball/4f4bbd4e7172148801e76e3decc1e559bdee34e1",
+                "reference": "4f4bbd4e7172148801e76e3decc1e559bdee34e1",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2.5 || ^8.0",
+                "symfony/polyfill-php80": "^1.24"
+            },
+            "require-dev": {
+                "bamarni/composer-bin-plugin": "^1.8.2",
+                "phpunit/phpunit": "^8.5.44 || ^9.6.25",
+                "uri-template/tests": "1.0.0"
+            },
+            "type": "library",
+            "extra": {
+                "bamarni-bin": {
+                    "bin-links": true,
+                    "forward-command": false
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "GuzzleHttp\\UriTemplate\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Graham Campbell",
+                    "email": "hello@gjcampbell.co.uk",
+                    "homepage": "https://github.com/GrahamCampbell"
+                },
+                {
+                    "name": "Michael Dowling",
+                    "email": "mtdowling@gmail.com",
+                    "homepage": "https://github.com/mtdowling"
+                },
+                {
+                    "name": "George Mponos",
+                    "email": "gmponos@gmail.com",
+                    "homepage": "https://github.com/gmponos"
+                },
+                {
+                    "name": "Tobias Nyholm",
+                    "email": "tobias.nyholm@gmail.com",
+                    "homepage": "https://github.com/Nyholm"
+                }
+            ],
+            "description": "A polyfill class for uri_template of PHP",
+            "keywords": [
+                "guzzlehttp",
+                "uri-template"
+            ],
+            "support": {
+                "issues": "https://github.com/guzzle/uri-template/issues",
+                "source": "https://github.com/guzzle/uri-template/tree/v1.0.5"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/GrahamCampbell",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/Nyholm",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/uri-template",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-08-22T14:27:06+00:00"
+        },
+        {
+            "name": "laravel/framework",
+            "version": "v12.56.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/laravel/framework.git",
+                "reference": "dac16d424b59debb2273910dde88eb7050a2a709"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/laravel/framework/zipball/dac16d424b59debb2273910dde88eb7050a2a709",
+                "reference": "dac16d424b59debb2273910dde88eb7050a2a709",
+                "shasum": ""
+            },
+            "require": {
+                "brick/math": "^0.11|^0.12|^0.13|^0.14",
+                "composer-runtime-api": "^2.2",
+                "doctrine/inflector": "^2.0.5",
+                "dragonmantank/cron-expression": "^3.4",
+                "egulias/email-validator": "^3.2.1|^4.0",
+                "ext-ctype": "*",
+                "ext-filter": "*",
+                "ext-hash": "*",
+                "ext-mbstring": "*",
+                "ext-openssl": "*",
+                "ext-session": "*",
+                "ext-tokenizer": "*",
+                "fruitcake/php-cors": "^1.3",
+                "guzzlehttp/guzzle": "^7.8.2",
+                "guzzlehttp/uri-template": "^1.0",
+                "laravel/prompts": "^0.3.0",
+                "laravel/serializable-closure": "^1.3|^2.0",
+                "league/commonmark": "^2.8.1",
+                "league/flysystem": "^3.25.1",
+                "league/flysystem-local": "^3.25.1",
+                "league/uri": "^7.5.1",
+                "monolog/monolog": "^3.0",
+                "nesbot/carbon": "^3.8.4",
+                "nunomaduro/termwind": "^2.0",
+                "php": "^8.2",
+                "psr/container": "^1.1.1|^2.0.1",
+                "psr/log": "^1.0|^2.0|^3.0",
+                "psr/simple-cache": "^1.0|^2.0|^3.0",
+                "ramsey/uuid": "^4.7",
+                "symfony/console": "^7.2.0",
+                "symfony/error-handler": "^7.2.0",
+                "symfony/finder": "^7.2.0",
+                "symfony/http-foundation": "^7.2.0",
+                "symfony/http-kernel": "^7.2.0",
+                "symfony/mailer": "^7.2.0",
+                "symfony/mime": "^7.2.0",
+                "symfony/polyfill-php83": "^1.33",
+                "symfony/polyfill-php84": "^1.33",
+                "symfony/polyfill-php85": "^1.33",
+                "symfony/process": "^7.2.0",
+                "symfony/routing": "^7.2.0",
+                "symfony/uid": "^7.2.0",
+                "symfony/var-dumper": "^7.2.0",
+                "tijsverkoyen/css-to-inline-styles": "^2.2.5",
+                "vlucas/phpdotenv": "^5.6.1",
+                "voku/portable-ascii": "^2.0.2"
+            },
+            "conflict": {
+                "tightenco/collect": "<5.5.33"
+            },
+            "provide": {
+                "psr/container-implementation": "1.1|2.0",
+                "psr/log-implementation": "1.0|2.0|3.0",
+                "psr/simple-cache-implementation": "1.0|2.0|3.0"
+            },
+            "replace": {
+                "illuminate/auth": "self.version",
+                "illuminate/broadcasting": "self.version",
+                "illuminate/bus": "self.version",
+                "illuminate/cache": "self.version",
+                "illuminate/collections": "self.version",
+                "illuminate/concurrency": "self.version",
+                "illuminate/conditionable": "self.version",
+                "illuminate/config": "self.version",
+                "illuminate/console": "self.version",
+                "illuminate/container": "self.version",
+                "illuminate/contracts": "self.version",
+                "illuminate/cookie": "self.version",
+                "illuminate/database": "self.version",
+                "illuminate/encryption": "self.version",
+                "illuminate/events": "self.version",
+                "illuminate/filesystem": "self.version",
+                "illuminate/hashing": "self.version",
+                "illuminate/http": "self.version",
+                "illuminate/json-schema": "self.version",
+                "illuminate/log": "self.version",
+                "illuminate/macroable": "self.version",
+                "illuminate/mail": "self.version",
+                "illuminate/notifications": "self.version",
+                "illuminate/pagination": "self.version",
+                "illuminate/pipeline": "self.version",
+                "illuminate/process": "self.version",
+                "illuminate/queue": "self.version",
+                "illuminate/redis": "self.version",
+                "illuminate/reflection": "self.version",
+                "illuminate/routing": "self.version",
+                "illuminate/session": "self.version",
+                "illuminate/support": "self.version",
+                "illuminate/testing": "self.version",
+                "illuminate/translation": "self.version",
+                "illuminate/validation": "self.version",
+                "illuminate/view": "self.version",
+                "spatie/once": "*"
+            },
+            "require-dev": {
+                "ably/ably-php": "^1.0",
+                "aws/aws-sdk-php": "^3.322.9",
+                "ext-gmp": "*",
+                "fakerphp/faker": "^1.24",
+                "guzzlehttp/promises": "^2.0.3",
+                "guzzlehttp/psr7": "^2.4",
+                "laravel/pint": "^1.18",
+                "league/flysystem-aws-s3-v3": "^3.25.1",
+                "league/flysystem-ftp": "^3.25.1",
+                "league/flysystem-path-prefixing": "^3.25.1",
+                "league/flysystem-read-only": "^3.25.1",
+                "league/flysystem-sftp-v3": "^3.25.1",
+                "mockery/mockery": "^1.6.10",
+                "opis/json-schema": "^2.4.1",
+                "orchestra/testbench-core": "^10.9.0",
+                "pda/pheanstalk": "^5.0.6|^7.0.0",
+                "php-http/discovery": "^1.15",
+                "phpstan/phpstan": "^2.1.41",
+                "phpunit/phpunit": "^10.5.35|^11.5.3|^12.0.1",
+                "predis/predis": "^2.3|^3.0",
+                "resend/resend-php": "^0.10.0|^1.0",
+                "symfony/cache": "^7.2.0",
+                "symfony/http-client": "^7.2.0",
+                "symfony/psr-http-message-bridge": "^7.2.0",
+                "symfony/translation": "^7.2.0"
+            },
+            "suggest": {
+                "ably/ably-php": "Required to use the Ably broadcast driver (^1.0).",
+                "aws/aws-sdk-php": "Required to use the SQS queue driver, DynamoDb failed job storage, and SES mail driver (^3.322.9).",
+                "brianium/paratest": "Required to run tests in parallel (^7.0|^8.0).",
+                "ext-apcu": "Required to use the APC cache driver.",
+                "ext-fileinfo": "Required to use the Filesystem class.",
+                "ext-ftp": "Required to use the Flysystem FTP driver.",
+                "ext-gd": "Required to use Illuminate\\Http\\Testing\\FileFactory::image().",
+                "ext-memcached": "Required to use the memcache cache driver.",
+                "ext-pcntl": "Required to use all features of the queue worker and console signal trapping.",
+                "ext-pdo": "Required to use all database features.",
+                "ext-posix": "Required to use all features of the queue worker.",
+                "ext-redis": "Required to use the Redis cache and queue drivers (^4.0|^5.0|^6.0).",
+                "fakerphp/faker": "Required to generate fake data using the fake() helper (^1.23).",
+                "filp/whoops": "Required for friendly error pages in development (^2.14.3).",
+                "laravel/tinker": "Required to use the tinker console command (^2.0).",
+                "league/flysystem-aws-s3-v3": "Required to use the Flysystem S3 driver (^3.25.1).",
+                "league/flysystem-ftp": "Required to use the Flysystem FTP driver (^3.25.1).",
+                "league/flysystem-path-prefixing": "Required to use the scoped driver (^3.25.1).",
+                "league/flysystem-read-only": "Required to use read-only disks (^3.25.1)",
+                "league/flysystem-sftp-v3": "Required to use the Flysystem SFTP driver (^3.25.1).",
+                "mockery/mockery": "Required to use mocking (^1.6).",
+                "pda/pheanstalk": "Required to use the beanstalk queue driver (^5.0).",
+                "php-http/discovery": "Required to use PSR-7 bridging features (^1.15).",
+                "phpunit/phpunit": "Required to use assertions and run tests (^10.5.35|^11.5.3|^12.0.1).",
+                "predis/predis": "Required to use the predis connector (^2.3|^3.0).",
+                "psr/http-message": "Required to allow Storage::put to accept a StreamInterface (^1.0).",
+                "pusher/pusher-php-server": "Required to use the Pusher broadcast driver (^6.0|^7.0).",
+                "resend/resend-php": "Required to enable support for the Resend mail transport (^0.10.0|^1.0).",
+                "symfony/cache": "Required to PSR-6 cache bridge (^7.2).",
+                "symfony/filesystem": "Required to enable support for relative symbolic links (^7.2).",
+                "symfony/http-client": "Required to enable support for the Symfony API mail transports (^7.2).",
+                "symfony/mailgun-mailer": "Required to enable support for the Mailgun mail transport (^7.2).",
+                "symfony/postmark-mailer": "Required to enable support for the Postmark mail transport (^7.2).",
+                "symfony/psr-http-message-bridge": "Required to use PSR-7 bridging features (^7.2)."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "12.x-dev"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "src/Illuminate/Collections/functions.php",
+                    "src/Illuminate/Collections/helpers.php",
+                    "src/Illuminate/Events/functions.php",
+                    "src/Illuminate/Filesystem/functions.php",
+                    "src/Illuminate/Foundation/helpers.php",
+                    "src/Illuminate/Log/functions.php",
+                    "src/Illuminate/Reflection/helpers.php",
+                    "src/Illuminate/Support/functions.php",
+                    "src/Illuminate/Support/helpers.php"
+                ],
+                "psr-4": {
+                    "Illuminate\\": "src/Illuminate/",
+                    "Illuminate\\Support\\": [
+                        "src/Illuminate/Macroable/",
+                        "src/Illuminate/Collections/",
+                        "src/Illuminate/Conditionable/",
+                        "src/Illuminate/Reflection/"
+                    ]
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "The Laravel Framework.",
+            "homepage": "https://laravel.com",
+            "keywords": [
+                "framework",
+                "laravel"
+            ],
+            "support": {
+                "issues": "https://github.com/laravel/framework/issues",
+                "source": "https://github.com/laravel/framework"
+            },
+            "time": "2026-03-26T14:51:54+00:00"
+        },
+        {
+            "name": "laravel/prompts",
+            "version": "v0.3.16",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/laravel/prompts.git",
+                "reference": "11e7d5f93803a2190b00e145142cb00a33d17ad2"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/laravel/prompts/zipball/11e7d5f93803a2190b00e145142cb00a33d17ad2",
+                "reference": "11e7d5f93803a2190b00e145142cb00a33d17ad2",
+                "shasum": ""
+            },
+            "require": {
+                "composer-runtime-api": "^2.2",
+                "ext-mbstring": "*",
+                "php": "^8.1",
+                "symfony/console": "^6.2|^7.0|^8.0"
+            },
+            "conflict": {
+                "illuminate/console": ">=10.17.0 <10.25.0",
+                "laravel/framework": ">=10.17.0 <10.25.0"
+            },
+            "require-dev": {
+                "illuminate/collections": "^10.0|^11.0|^12.0|^13.0",
+                "mockery/mockery": "^1.5",
+                "pestphp/pest": "^2.3|^3.4|^4.0",
+                "phpstan/phpstan": "^1.12.28",
+                "phpstan/phpstan-mockery": "^1.1.3"
+            },
+            "suggest": {
+                "ext-pcntl": "Required for the spinner to be animated."
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "0.3.x-dev"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "src/helpers.php"
+                ],
+                "psr-4": {
+                    "Laravel\\Prompts\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "Add beautiful and user-friendly forms to your command-line applications.",
+            "support": {
+                "issues": "https://github.com/laravel/prompts/issues",
+                "source": "https://github.com/laravel/prompts/tree/v0.3.16"
+            },
+            "time": "2026-03-23T14:35:33+00:00"
+        },
+        {
+            "name": "laravel/serializable-closure",
+            "version": "v2.0.10",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/laravel/serializable-closure.git",
+                "reference": "870fc81d2f879903dfc5b60bf8a0f94a1609e669"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/laravel/serializable-closure/zipball/870fc81d2f879903dfc5b60bf8a0f94a1609e669",
+                "reference": "870fc81d2f879903dfc5b60bf8a0f94a1609e669",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^8.1"
+            },
+            "require-dev": {
+                "illuminate/support": "^10.0|^11.0|^12.0|^13.0",
+                "nesbot/carbon": "^2.67|^3.0",
+                "pestphp/pest": "^2.36|^3.0|^4.0",
+                "phpstan/phpstan": "^2.0",
+                "symfony/var-dumper": "^6.2.0|^7.0.0|^8.0.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Laravel\\SerializableClosure\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                },
+                {
+                    "name": "Nuno Maduro",
+                    "email": "nuno@laravel.com"
+                }
+            ],
+            "description": "Laravel Serializable Closure provides an easy and secure way to serialize closures in PHP.",
+            "keywords": [
+                "closure",
+                "laravel",
+                "serializable"
+            ],
+            "support": {
+                "issues": "https://github.com/laravel/serializable-closure/issues",
+                "source": "https://github.com/laravel/serializable-closure"
+            },
+            "time": "2026-02-20T19:59:49+00:00"
+        },
+        {
+            "name": "laravel/tinker",
+            "version": "v2.11.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/laravel/tinker.git",
+                "reference": "c9f80cc835649b5c1842898fb043f8cc098dd741"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/laravel/tinker/zipball/c9f80cc835649b5c1842898fb043f8cc098dd741",
+                "reference": "c9f80cc835649b5c1842898fb043f8cc098dd741",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/console": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0|^12.0",
+                "illuminate/contracts": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0|^12.0",
+                "illuminate/support": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0|^12.0",
+                "php": "^7.2.5|^8.0",
+                "psy/psysh": "^0.11.1|^0.12.0",
+                "symfony/var-dumper": "^4.3.4|^5.0|^6.0|^7.0|^8.0"
+            },
+            "require-dev": {
+                "mockery/mockery": "~1.3.3|^1.4.2",
+                "phpstan/phpstan": "^1.10",
+                "phpunit/phpunit": "^8.5.8|^9.3.3|^10.0"
+            },
+            "suggest": {
+                "illuminate/database": "The Illuminate Database package (^6.0|^7.0|^8.0|^9.0|^10.0|^11.0|^12.0)."
+            },
+            "type": "library",
+            "extra": {
+                "laravel": {
+                    "providers": [
+                        "Laravel\\Tinker\\TinkerServiceProvider"
+                    ]
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Laravel\\Tinker\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "Powerful REPL for the Laravel framework.",
+            "keywords": [
+                "REPL",
+                "Tinker",
+                "laravel",
+                "psysh"
+            ],
+            "support": {
+                "issues": "https://github.com/laravel/tinker/issues",
+                "source": "https://github.com/laravel/tinker/tree/v2.11.1"
+            },
+            "time": "2026-02-06T14:12:35+00:00"
+        },
+        {
+            "name": "league/commonmark",
+            "version": "2.8.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/thephpleague/commonmark.git",
+                "reference": "59fb075d2101740c337c7216e3f32b36c204218b"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/thephpleague/commonmark/zipball/59fb075d2101740c337c7216e3f32b36c204218b",
+                "reference": "59fb075d2101740c337c7216e3f32b36c204218b",
+                "shasum": ""
+            },
+            "require": {
+                "ext-mbstring": "*",
+                "league/config": "^1.1.1",
+                "php": "^7.4 || ^8.0",
+                "psr/event-dispatcher": "^1.0",
+                "symfony/deprecation-contracts": "^2.1 || ^3.0",
+                "symfony/polyfill-php80": "^1.16"
+            },
+            "require-dev": {
+                "cebe/markdown": "^1.0",
+                "commonmark/cmark": "0.31.1",
+                "commonmark/commonmark.js": "0.31.1",
+                "composer/package-versions-deprecated": "^1.8",
+                "embed/embed": "^4.4",
+                "erusev/parsedown": "^1.0",
+                "ext-json": "*",
+                "github/gfm": "0.29.0",
+                "michelf/php-markdown": "^1.4 || ^2.0",
+                "nyholm/psr7": "^1.5",
+                "phpstan/phpstan": "^1.8.2",
+                "phpunit/phpunit": "^9.5.21 || ^10.5.9 || ^11.0.0",
+                "scrutinizer/ocular": "^1.8.1",
+                "symfony/finder": "^5.3 | ^6.0 | ^7.0 || ^8.0",
+                "symfony/process": "^5.4 | ^6.0 | ^7.0 || ^8.0",
+                "symfony/yaml": "^2.3 | ^3.0 | ^4.0 | ^5.0 | ^6.0 | ^7.0 || ^8.0",
+                "unleashedtech/php-coding-standard": "^3.1.1",
+                "vimeo/psalm": "^4.24.0 || ^5.0.0 || ^6.0.0"
+            },
+            "suggest": {
+                "symfony/yaml": "v2.3+ required if using the Front Matter extension"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "2.9-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "League\\CommonMark\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Colin O'Dell",
+                    "email": "colinodell@gmail.com",
+                    "homepage": "https://www.colinodell.com",
+                    "role": "Lead Developer"
+                }
+            ],
+            "description": "Highly-extensible PHP Markdown parser which fully supports the CommonMark spec and GitHub-Flavored Markdown (GFM)",
+            "homepage": "https://commonmark.thephpleague.com",
+            "keywords": [
+                "commonmark",
+                "flavored",
+                "gfm",
+                "github",
+                "github-flavored",
+                "markdown",
+                "md",
+                "parser"
+            ],
+            "support": {
+                "docs": "https://commonmark.thephpleague.com/",
+                "forum": "https://github.com/thephpleague/commonmark/discussions",
+                "issues": "https://github.com/thephpleague/commonmark/issues",
+                "rss": "https://github.com/thephpleague/commonmark/releases.atom",
+                "source": "https://github.com/thephpleague/commonmark"
+            },
+            "funding": [
+                {
+                    "url": "https://www.colinodell.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://www.paypal.me/colinpodell/10.00",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/colinodell",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/league/commonmark",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-03-19T13:16:38+00:00"
+        },
+        {
+            "name": "league/config",
+            "version": "v1.2.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/thephpleague/config.git",
+                "reference": "754b3604fb2984c71f4af4a9cbe7b57f346ec1f3"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/thephpleague/config/zipball/754b3604fb2984c71f4af4a9cbe7b57f346ec1f3",
+                "reference": "754b3604fb2984c71f4af4a9cbe7b57f346ec1f3",
+                "shasum": ""
+            },
+            "require": {
+                "dflydev/dot-access-data": "^3.0.1",
+                "nette/schema": "^1.2",
+                "php": "^7.4 || ^8.0"
+            },
+            "require-dev": {
+                "phpstan/phpstan": "^1.8.2",
+                "phpunit/phpunit": "^9.5.5",
+                "scrutinizer/ocular": "^1.8.1",
+                "unleashedtech/php-coding-standard": "^3.1",
+                "vimeo/psalm": "^4.7.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "1.2-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "League\\Config\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Colin O'Dell",
+                    "email": "colinodell@gmail.com",
+                    "homepage": "https://www.colinodell.com",
+                    "role": "Lead Developer"
+                }
+            ],
+            "description": "Define configuration arrays with strict schemas and access values with dot notation",
+            "homepage": "https://config.thephpleague.com",
+            "keywords": [
+                "array",
+                "config",
+                "configuration",
+                "dot",
+                "dot-access",
+                "nested",
+                "schema"
+            ],
+            "support": {
+                "docs": "https://config.thephpleague.com/",
+                "issues": "https://github.com/thephpleague/config/issues",
+                "rss": "https://github.com/thephpleague/config/releases.atom",
+                "source": "https://github.com/thephpleague/config"
+            },
+            "funding": [
+                {
+                    "url": "https://www.colinodell.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://www.paypal.me/colinpodell/10.00",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/colinodell",
+                    "type": "github"
+                }
+            ],
+            "time": "2022-12-11T20:36:23+00:00"
+        },
+        {
+            "name": "league/flysystem",
+            "version": "3.33.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/thephpleague/flysystem.git",
+                "reference": "570b8871e0ce693764434b29154c54b434905350"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/thephpleague/flysystem/zipball/570b8871e0ce693764434b29154c54b434905350",
+                "reference": "570b8871e0ce693764434b29154c54b434905350",
+                "shasum": ""
+            },
+            "require": {
+                "league/flysystem-local": "^3.0.0",
+                "league/mime-type-detection": "^1.0.0",
+                "php": "^8.0.2"
+            },
+            "conflict": {
+                "async-aws/core": "<1.19.0",
+                "async-aws/s3": "<1.14.0",
+                "aws/aws-sdk-php": "3.209.31 || 3.210.0",
+                "guzzlehttp/guzzle": "<7.0",
+                "guzzlehttp/ringphp": "<1.1.1",
+                "phpseclib/phpseclib": "3.0.15",
+                "symfony/http-client": "<5.2"
+            },
+            "require-dev": {
+                "async-aws/s3": "^1.5 || ^2.0",
+                "async-aws/simple-s3": "^1.1 || ^2.0",
+                "aws/aws-sdk-php": "^3.295.10",
+                "composer/semver": "^3.0",
+                "ext-fileinfo": "*",
+                "ext-ftp": "*",
+                "ext-mongodb": "^1.3|^2",
+                "ext-zip": "*",
+                "friendsofphp/php-cs-fixer": "^3.5",
+                "google/cloud-storage": "^1.23",
+                "guzzlehttp/psr7": "^2.6",
+                "microsoft/azure-storage-blob": "^1.1",
+                "mongodb/mongodb": "^1.2|^2",
+                "phpseclib/phpseclib": "^3.0.36",
+                "phpstan/phpstan": "^1.10",
+                "phpunit/phpunit": "^9.5.11|^10.0",
+                "sabre/dav": "^4.6.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "League\\Flysystem\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Frank de Jonge",
+                    "email": "info@frankdejonge.nl"
+                }
+            ],
+            "description": "File storage abstraction for PHP",
+            "keywords": [
+                "WebDAV",
+                "aws",
+                "cloud",
+                "file",
+                "files",
+                "filesystem",
+                "filesystems",
+                "ftp",
+                "s3",
+                "sftp",
+                "storage"
+            ],
+            "support": {
+                "issues": "https://github.com/thephpleague/flysystem/issues",
+                "source": "https://github.com/thephpleague/flysystem/tree/3.33.0"
+            },
+            "time": "2026-03-25T07:59:30+00:00"
+        },
+        {
+            "name": "league/flysystem-local",
+            "version": "3.31.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/thephpleague/flysystem-local.git",
+                "reference": "2f669db18a4c20c755c2bb7d3a7b0b2340488079"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/thephpleague/flysystem-local/zipball/2f669db18a4c20c755c2bb7d3a7b0b2340488079",
+                "reference": "2f669db18a4c20c755c2bb7d3a7b0b2340488079",
+                "shasum": ""
+            },
+            "require": {
+                "ext-fileinfo": "*",
+                "league/flysystem": "^3.0.0",
+                "league/mime-type-detection": "^1.0.0",
+                "php": "^8.0.2"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "League\\Flysystem\\Local\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Frank de Jonge",
+                    "email": "info@frankdejonge.nl"
+                }
+            ],
+            "description": "Local filesystem adapter for Flysystem.",
+            "keywords": [
+                "Flysystem",
+                "file",
+                "files",
+                "filesystem",
+                "local"
+            ],
+            "support": {
+                "source": "https://github.com/thephpleague/flysystem-local/tree/3.31.0"
+            },
+            "time": "2026-01-23T15:30:45+00:00"
+        },
+        {
+            "name": "league/mime-type-detection",
+            "version": "1.16.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/thephpleague/mime-type-detection.git",
+                "reference": "2d6702ff215bf922936ccc1ad31007edc76451b9"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/thephpleague/mime-type-detection/zipball/2d6702ff215bf922936ccc1ad31007edc76451b9",
+                "reference": "2d6702ff215bf922936ccc1ad31007edc76451b9",
+                "shasum": ""
+            },
+            "require": {
+                "ext-fileinfo": "*",
+                "php": "^7.4 || ^8.0"
+            },
+            "require-dev": {
+                "friendsofphp/php-cs-fixer": "^3.2",
+                "phpstan/phpstan": "^0.12.68",
+                "phpunit/phpunit": "^8.5.8 || ^9.3 || ^10.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "League\\MimeTypeDetection\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Frank de Jonge",
+                    "email": "info@frankdejonge.nl"
+                }
+            ],
+            "description": "Mime-type detection for Flysystem",
+            "support": {
+                "issues": "https://github.com/thephpleague/mime-type-detection/issues",
+                "source": "https://github.com/thephpleague/mime-type-detection/tree/1.16.0"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/frankdejonge",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/league/flysystem",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2024-09-21T08:32:55+00:00"
+        },
+        {
+            "name": "league/uri",
+            "version": "7.8.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/thephpleague/uri.git",
+                "reference": "08cf38e3924d4f56238125547b5720496fac8fd4"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/thephpleague/uri/zipball/08cf38e3924d4f56238125547b5720496fac8fd4",
+                "reference": "08cf38e3924d4f56238125547b5720496fac8fd4",
+                "shasum": ""
+            },
+            "require": {
+                "league/uri-interfaces": "^7.8.1",
+                "php": "^8.1",
+                "psr/http-factory": "^1"
+            },
+            "conflict": {
+                "league/uri-schemes": "^1.0"
+            },
+            "suggest": {
+                "ext-bcmath": "to improve IPV4 host parsing",
+                "ext-dom": "to convert the URI into an HTML anchor tag",
+                "ext-fileinfo": "to create Data URI from file contennts",
+                "ext-gmp": "to improve IPV4 host parsing",
+                "ext-intl": "to handle IDN host with the best performance",
+                "ext-uri": "to use the PHP native URI class",
+                "jeremykendall/php-domain-parser": "to further parse the URI host and resolve its Public Suffix and Top Level Domain",
+                "league/uri-components": "to provide additional tools to manipulate URI objects components",
+                "league/uri-polyfill": "to backport the PHP URI extension for older versions of PHP",
+                "php-64bit": "to improve IPV4 host parsing",
+                "rowbot/url": "to handle URLs using the WHATWG URL Living Standard specification",
+                "symfony/polyfill-intl-idn": "to handle IDN host via the Symfony polyfill if ext-intl is not present"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "7.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "League\\Uri\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Ignace Nyamagana Butera",
+                    "email": "nyamsprod@gmail.com",
+                    "homepage": "https://nyamsprod.com"
+                }
+            ],
+            "description": "URI manipulation library",
+            "homepage": "https://uri.thephpleague.com",
+            "keywords": [
+                "URN",
+                "data-uri",
+                "file-uri",
+                "ftp",
+                "hostname",
+                "http",
+                "https",
+                "middleware",
+                "parse_str",
+                "parse_url",
+                "psr-7",
+                "query-string",
+                "querystring",
+                "rfc2141",
+                "rfc3986",
+                "rfc3987",
+                "rfc6570",
+                "rfc8141",
+                "uri",
+                "uri-template",
+                "url",
+                "ws"
+            ],
+            "support": {
+                "docs": "https://uri.thephpleague.com",
+                "forum": "https://thephpleague.slack.com",
+                "issues": "https://github.com/thephpleague/uri-src/issues",
+                "source": "https://github.com/thephpleague/uri/tree/7.8.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sponsors/nyamsprod",
+                    "type": "github"
+                }
+            ],
+            "time": "2026-03-15T20:22:25+00:00"
+        },
+        {
+            "name": "league/uri-interfaces",
+            "version": "7.8.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/thephpleague/uri-interfaces.git",
+                "reference": "85d5c77c5d6d3af6c54db4a78246364908f3c928"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/thephpleague/uri-interfaces/zipball/85d5c77c5d6d3af6c54db4a78246364908f3c928",
+                "reference": "85d5c77c5d6d3af6c54db4a78246364908f3c928",
+                "shasum": ""
+            },
+            "require": {
+                "ext-filter": "*",
+                "php": "^8.1",
+                "psr/http-message": "^1.1 || ^2.0"
+            },
+            "suggest": {
+                "ext-bcmath": "to improve IPV4 host parsing",
+                "ext-gmp": "to improve IPV4 host parsing",
+                "ext-intl": "to handle IDN host with the best performance",
+                "php-64bit": "to improve IPV4 host parsing",
+                "rowbot/url": "to handle URLs using the WHATWG URL Living Standard specification",
+                "symfony/polyfill-intl-idn": "to handle IDN host via the Symfony polyfill if ext-intl is not present"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "7.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "League\\Uri\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Ignace Nyamagana Butera",
+                    "email": "nyamsprod@gmail.com",
+                    "homepage": "https://nyamsprod.com"
+                }
+            ],
+            "description": "Common tools for parsing and resolving RFC3987/RFC3986 URI",
+            "homepage": "https://uri.thephpleague.com",
+            "keywords": [
+                "data-uri",
+                "file-uri",
+                "ftp",
+                "hostname",
+                "http",
+                "https",
+                "parse_str",
+                "parse_url",
+                "psr-7",
+                "query-string",
+                "querystring",
+                "rfc3986",
+                "rfc3987",
+                "rfc6570",
+                "uri",
+                "url",
+                "ws"
+            ],
+            "support": {
+                "docs": "https://uri.thephpleague.com",
+                "forum": "https://thephpleague.slack.com",
+                "issues": "https://github.com/thephpleague/uri-src/issues",
+                "source": "https://github.com/thephpleague/uri-interfaces/tree/7.8.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sponsors/nyamsprod",
+                    "type": "github"
+                }
+            ],
+            "time": "2026-03-08T20:05:35+00:00"
+        },
+        {
+            "name": "monolog/monolog",
+            "version": "3.10.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/Seldaek/monolog.git",
+                "reference": "b321dd6749f0bf7189444158a3ce785cc16d69b0"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/Seldaek/monolog/zipball/b321dd6749f0bf7189444158a3ce785cc16d69b0",
+                "reference": "b321dd6749f0bf7189444158a3ce785cc16d69b0",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.1",
+                "psr/log": "^2.0 || ^3.0"
+            },
+            "provide": {
+                "psr/log-implementation": "3.0.0"
+            },
+            "require-dev": {
+                "aws/aws-sdk-php": "^3.0",
+                "doctrine/couchdb": "~1.0@dev",
+                "elasticsearch/elasticsearch": "^7 || ^8",
+                "ext-json": "*",
+                "graylog2/gelf-php": "^1.4.2 || ^2.0",
+                "guzzlehttp/guzzle": "^7.4.5",
+                "guzzlehttp/psr7": "^2.2",
+                "mongodb/mongodb": "^1.8 || ^2.0",
+                "php-amqplib/php-amqplib": "~2.4 || ^3",
+                "php-console/php-console": "^3.1.8",
+                "phpstan/phpstan": "^2",
+                "phpstan/phpstan-deprecation-rules": "^2",
+                "phpstan/phpstan-strict-rules": "^2",
+                "phpunit/phpunit": "^10.5.17 || ^11.0.7",
+                "predis/predis": "^1.1 || ^2",
+                "rollbar/rollbar": "^4.0",
+                "ruflin/elastica": "^7 || ^8",
+                "symfony/mailer": "^5.4 || ^6",
+                "symfony/mime": "^5.4 || ^6"
+            },
+            "suggest": {
+                "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB",
+                "doctrine/couchdb": "Allow sending log messages to a CouchDB server",
+                "elasticsearch/elasticsearch": "Allow sending log messages to an Elasticsearch server via official client",
+                "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+                "ext-curl": "Required to send log messages using the IFTTTHandler, the LogglyHandler, the SendGridHandler, the SlackWebhookHandler or the TelegramBotHandler",
+                "ext-mbstring": "Allow to work properly with unicode symbols",
+                "ext-mongodb": "Allow sending log messages to a MongoDB server (via driver)",
+                "ext-openssl": "Required to send log messages using SSL",
+                "ext-sockets": "Allow sending log messages to a Syslog server (via UDP driver)",
+                "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server",
+                "mongodb/mongodb": "Allow sending log messages to a MongoDB server (via library)",
+                "php-amqplib/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib",
+                "rollbar/rollbar": "Allow sending log messages to Rollbar",
+                "ruflin/elastica": "Allow sending log messages to an Elastic Search server"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "3.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Monolog\\": "src/Monolog"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Jordi Boggiano",
+                    "email": "j.boggiano@seld.be",
+                    "homepage": "https://seld.be"
+                }
+            ],
+            "description": "Sends your logs to files, sockets, inboxes, databases and various web services",
+            "homepage": "https://github.com/Seldaek/monolog",
+            "keywords": [
+                "log",
+                "logging",
+                "psr-3"
+            ],
+            "support": {
+                "issues": "https://github.com/Seldaek/monolog/issues",
+                "source": "https://github.com/Seldaek/monolog/tree/3.10.0"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/Seldaek",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/monolog/monolog",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-01-02T08:56:05+00:00"
+        },
+        {
+            "name": "nesbot/carbon",
+            "version": "3.11.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/CarbonPHP/carbon.git",
+                "reference": "6a7e652845bb018c668220c2a545aded8594fbbf"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/CarbonPHP/carbon/zipball/6a7e652845bb018c668220c2a545aded8594fbbf",
+                "reference": "6a7e652845bb018c668220c2a545aded8594fbbf",
+                "shasum": ""
+            },
+            "require": {
+                "carbonphp/carbon-doctrine-types": "<100.0",
+                "ext-json": "*",
+                "php": "^8.1",
+                "psr/clock": "^1.0",
+                "symfony/clock": "^6.3.12 || ^7.0 || ^8.0",
+                "symfony/polyfill-mbstring": "^1.0",
+                "symfony/translation": "^4.4.18 || ^5.2.1 || ^6.0 || ^7.0 || ^8.0"
+            },
+            "provide": {
+                "psr/clock-implementation": "1.0"
+            },
+            "require-dev": {
+                "doctrine/dbal": "^3.6.3 || ^4.0",
+                "doctrine/orm": "^2.15.2 || ^3.0",
+                "friendsofphp/php-cs-fixer": "^v3.87.1",
+                "kylekatarnls/multi-tester": "^2.5.3",
+                "phpmd/phpmd": "^2.15.0",
+                "phpstan/extension-installer": "^1.4.3",
+                "phpstan/phpstan": "^2.1.22",
+                "phpunit/phpunit": "^10.5.53",
+                "squizlabs/php_codesniffer": "^3.13.4 || ^4.0.0"
+            },
+            "bin": [
+                "bin/carbon"
+            ],
+            "type": "library",
+            "extra": {
+                "laravel": {
+                    "providers": [
+                        "Carbon\\Laravel\\ServiceProvider"
+                    ]
+                },
+                "phpstan": {
+                    "includes": [
+                        "extension.neon"
+                    ]
+                },
+                "branch-alias": {
+                    "dev-2.x": "2.x-dev",
+                    "dev-master": "3.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Carbon\\": "src/Carbon/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Brian Nesbitt",
+                    "email": "brian@nesbot.com",
+                    "homepage": "https://markido.com"
+                },
+                {
+                    "name": "kylekatarnls",
+                    "homepage": "https://github.com/kylekatarnls"
+                }
+            ],
+            "description": "An API extension for DateTime that supports 281 different languages.",
+            "homepage": "https://carbonphp.github.io/carbon/",
+            "keywords": [
+                "date",
+                "datetime",
+                "time"
+            ],
+            "support": {
+                "docs": "https://carbonphp.github.io/carbon/guide/getting-started/introduction.html",
+                "issues": "https://github.com/CarbonPHP/carbon/issues",
+                "source": "https://github.com/CarbonPHP/carbon"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sponsors/kylekatarnls",
+                    "type": "github"
+                },
+                {
+                    "url": "https://opencollective.com/Carbon#sponsor",
+                    "type": "opencollective"
+                },
+                {
+                    "url": "https://tidelift.com/subscription/pkg/packagist-nesbot-carbon?utm_source=packagist-nesbot-carbon&utm_medium=referral&utm_campaign=readme",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-03-11T17:23:39+00:00"
+        },
+        {
+            "name": "nette/schema",
+            "version": "v1.3.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/nette/schema.git",
+                "reference": "f0ab1a3cda782dbc5da270d28545236aa80c4002"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/nette/schema/zipball/f0ab1a3cda782dbc5da270d28545236aa80c4002",
+                "reference": "f0ab1a3cda782dbc5da270d28545236aa80c4002",
+                "shasum": ""
+            },
+            "require": {
+                "nette/utils": "^4.0",
+                "php": "8.1 - 8.5"
+            },
+            "require-dev": {
+                "nette/phpstan-rules": "^1.0",
+                "nette/tester": "^2.6",
+                "phpstan/extension-installer": "^1.4@stable",
+                "phpstan/phpstan": "^2.1.39@stable",
+                "tracy/tracy": "^2.8"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.3-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Nette\\": "src"
+                },
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause",
+                "GPL-2.0-only",
+                "GPL-3.0-only"
+            ],
+            "authors": [
+                {
+                    "name": "David Grudl",
+                    "homepage": "https://davidgrudl.com"
+                },
+                {
+                    "name": "Nette Community",
+                    "homepage": "https://nette.org/contributors"
+                }
+            ],
+            "description": "📐 Nette Schema: validating data structures against a given Schema.",
+            "homepage": "https://nette.org",
+            "keywords": [
+                "config",
+                "nette"
+            ],
+            "support": {
+                "issues": "https://github.com/nette/schema/issues",
+                "source": "https://github.com/nette/schema/tree/v1.3.5"
+            },
+            "time": "2026-02-23T03:47:12+00:00"
+        },
+        {
+            "name": "nette/utils",
+            "version": "v4.1.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/nette/utils.git",
+                "reference": "bb3ea637e3d131d72acc033cfc2746ee893349fe"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/nette/utils/zipball/bb3ea637e3d131d72acc033cfc2746ee893349fe",
+                "reference": "bb3ea637e3d131d72acc033cfc2746ee893349fe",
+                "shasum": ""
+            },
+            "require": {
+                "php": "8.2 - 8.5"
+            },
+            "conflict": {
+                "nette/finder": "<3",
+                "nette/schema": "<1.2.2"
+            },
+            "require-dev": {
+                "jetbrains/phpstorm-attributes": "^1.2",
+                "nette/phpstan-rules": "^1.0",
+                "nette/tester": "^2.5",
+                "phpstan/extension-installer": "^1.4@stable",
+                "phpstan/phpstan": "^2.1@stable",
+                "tracy/tracy": "^2.9"
+            },
+            "suggest": {
+                "ext-gd": "to use Image",
+                "ext-iconv": "to use Strings::webalize(), toAscii(), chr() and reverse()",
+                "ext-intl": "to use Strings::webalize(), toAscii(), normalize() and compare()",
+                "ext-json": "to use Nette\\Utils\\Json",
+                "ext-mbstring": "to use Strings::lower() etc...",
+                "ext-tokenizer": "to use Nette\\Utils\\Reflection::getUseStatements()"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "4.1-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Nette\\": "src"
+                },
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause",
+                "GPL-2.0-only",
+                "GPL-3.0-only"
+            ],
+            "authors": [
+                {
+                    "name": "David Grudl",
+                    "homepage": "https://davidgrudl.com"
+                },
+                {
+                    "name": "Nette Community",
+                    "homepage": "https://nette.org/contributors"
+                }
+            ],
+            "description": "🛠  Nette Utils: lightweight utilities for string & array manipulation, image handling, safe JSON encoding/decoding, validation, slug or strong password generating etc.",
+            "homepage": "https://nette.org",
+            "keywords": [
+                "array",
+                "core",
+                "datetime",
+                "images",
+                "json",
+                "nette",
+                "paginator",
+                "password",
+                "slugify",
+                "string",
+                "unicode",
+                "utf-8",
+                "utility",
+                "validation"
+            ],
+            "support": {
+                "issues": "https://github.com/nette/utils/issues",
+                "source": "https://github.com/nette/utils/tree/v4.1.3"
+            },
+            "time": "2026-02-13T03:05:33+00:00"
+        },
+        {
+            "name": "nikic/php-parser",
+            "version": "v5.7.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/nikic/PHP-Parser.git",
+                "reference": "dca41cd15c2ac9d055ad70dbfd011130757d1f82"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/nikic/PHP-Parser/zipball/dca41cd15c2ac9d055ad70dbfd011130757d1f82",
+                "reference": "dca41cd15c2ac9d055ad70dbfd011130757d1f82",
+                "shasum": ""
+            },
+            "require": {
+                "ext-ctype": "*",
+                "ext-json": "*",
+                "ext-tokenizer": "*",
+                "php": ">=7.4"
+            },
+            "require-dev": {
+                "ircmaxell/php-yacc": "^0.0.7",
+                "phpunit/phpunit": "^9.0"
+            },
+            "bin": [
+                "bin/php-parse"
+            ],
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "PhpParser\\": "lib/PhpParser"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Nikita Popov"
+                }
+            ],
+            "description": "A PHP parser written in PHP",
+            "keywords": [
+                "parser",
+                "php"
+            ],
+            "support": {
+                "issues": "https://github.com/nikic/PHP-Parser/issues",
+                "source": "https://github.com/nikic/PHP-Parser/tree/v5.7.0"
+            },
+            "time": "2025-12-06T11:56:16+00:00"
+        },
+        {
+            "name": "nunomaduro/termwind",
+            "version": "v2.4.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/nunomaduro/termwind.git",
+                "reference": "712a31b768f5daea284c2169a7d227031001b9a8"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/nunomaduro/termwind/zipball/712a31b768f5daea284c2169a7d227031001b9a8",
+                "reference": "712a31b768f5daea284c2169a7d227031001b9a8",
+                "shasum": ""
+            },
+            "require": {
+                "ext-mbstring": "*",
+                "php": "^8.2",
+                "symfony/console": "^7.4.4 || ^8.0.4"
+            },
+            "require-dev": {
+                "illuminate/console": "^11.47.0",
+                "laravel/pint": "^1.27.1",
+                "mockery/mockery": "^1.6.12",
+                "pestphp/pest": "^2.36.0 || ^3.8.4 || ^4.3.2",
+                "phpstan/phpstan": "^1.12.32",
+                "phpstan/phpstan-strict-rules": "^1.6.2",
+                "symfony/var-dumper": "^7.3.5 || ^8.0.4",
+                "thecodingmachine/phpstan-strict-rules": "^1.0.0"
+            },
+            "type": "library",
+            "extra": {
+                "laravel": {
+                    "providers": [
+                        "Termwind\\Laravel\\TermwindServiceProvider"
+                    ]
+                },
+                "branch-alias": {
+                    "dev-2.x": "2.x-dev"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "src/Functions.php"
+                ],
+                "psr-4": {
+                    "Termwind\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nuno Maduro",
+                    "email": "enunomaduro@gmail.com"
+                }
+            ],
+            "description": "It's like Tailwind CSS, but for the console.",
+            "keywords": [
+                "cli",
+                "console",
+                "css",
+                "package",
+                "php",
+                "style"
+            ],
+            "support": {
+                "issues": "https://github.com/nunomaduro/termwind/issues",
+                "source": "https://github.com/nunomaduro/termwind/tree/v2.4.0"
+            },
+            "funding": [
+                {
+                    "url": "https://www.paypal.com/paypalme/enunomaduro",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/nunomaduro",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/xiCO2k",
+                    "type": "github"
+                }
+            ],
+            "time": "2026-02-16T23:10:27+00:00"
+        },
+        {
+            "name": "phpoption/phpoption",
+            "version": "1.9.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/schmittjoh/php-option.git",
+                "reference": "75365b91986c2405cf5e1e012c5595cd487a98be"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/schmittjoh/php-option/zipball/75365b91986c2405cf5e1e012c5595cd487a98be",
+                "reference": "75365b91986c2405cf5e1e012c5595cd487a98be",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2.5 || ^8.0"
+            },
+            "require-dev": {
+                "bamarni/composer-bin-plugin": "^1.8.2",
+                "phpunit/phpunit": "^8.5.44 || ^9.6.25 || ^10.5.53 || ^11.5.34"
+            },
+            "type": "library",
+            "extra": {
+                "bamarni-bin": {
+                    "bin-links": true,
+                    "forward-command": false
+                },
+                "branch-alias": {
+                    "dev-master": "1.9-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "PhpOption\\": "src/PhpOption/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "Apache-2.0"
+            ],
+            "authors": [
+                {
+                    "name": "Johannes M. Schmitt",
+                    "email": "schmittjoh@gmail.com",
+                    "homepage": "https://github.com/schmittjoh"
+                },
+                {
+                    "name": "Graham Campbell",
+                    "email": "hello@gjcampbell.co.uk",
+                    "homepage": "https://github.com/GrahamCampbell"
+                }
+            ],
+            "description": "Option Type for PHP",
+            "keywords": [
+                "language",
+                "option",
+                "php",
+                "type"
+            ],
+            "support": {
+                "issues": "https://github.com/schmittjoh/php-option/issues",
+                "source": "https://github.com/schmittjoh/php-option/tree/1.9.5"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/GrahamCampbell",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/phpoption/phpoption",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-12-27T19:41:33+00:00"
+        },
+        {
+            "name": "psr/clock",
+            "version": "1.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/clock.git",
+                "reference": "e41a24703d4560fd0acb709162f73b8adfc3aa0d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/clock/zipball/e41a24703d4560fd0acb709162f73b8adfc3aa0d",
+                "reference": "e41a24703d4560fd0acb709162f73b8adfc3aa0d",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.0 || ^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Clock\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interface for reading the clock.",
+            "homepage": "https://github.com/php-fig/clock",
+            "keywords": [
+                "clock",
+                "now",
+                "psr",
+                "psr-20",
+                "time"
+            ],
+            "support": {
+                "issues": "https://github.com/php-fig/clock/issues",
+                "source": "https://github.com/php-fig/clock/tree/1.0.0"
+            },
+            "time": "2022-11-25T14:36:26+00:00"
+        },
+        {
+            "name": "psr/container",
+            "version": "2.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/container.git",
+                "reference": "c71ecc56dfe541dbd90c5360474fbc405f8d5963"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/container/zipball/c71ecc56dfe541dbd90c5360474fbc405f8d5963",
+                "reference": "c71ecc56dfe541dbd90c5360474fbc405f8d5963",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.4.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Container\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Common Container Interface (PHP FIG PSR-11)",
+            "homepage": "https://github.com/php-fig/container",
+            "keywords": [
+                "PSR-11",
+                "container",
+                "container-interface",
+                "container-interop",
+                "psr"
+            ],
+            "support": {
+                "issues": "https://github.com/php-fig/container/issues",
+                "source": "https://github.com/php-fig/container/tree/2.0.2"
+            },
+            "time": "2021-11-05T16:47:00+00:00"
+        },
+        {
+            "name": "psr/event-dispatcher",
+            "version": "1.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/event-dispatcher.git",
+                "reference": "dbefd12671e8a14ec7f180cab83036ed26714bb0"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/event-dispatcher/zipball/dbefd12671e8a14ec7f180cab83036ed26714bb0",
+                "reference": "dbefd12671e8a14ec7f180cab83036ed26714bb0",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\EventDispatcher\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "http://www.php-fig.org/"
+                }
+            ],
+            "description": "Standard interfaces for event handling.",
+            "keywords": [
+                "events",
+                "psr",
+                "psr-14"
+            ],
+            "support": {
+                "issues": "https://github.com/php-fig/event-dispatcher/issues",
+                "source": "https://github.com/php-fig/event-dispatcher/tree/1.0.0"
+            },
+            "time": "2019-01-08T18:20:26+00:00"
+        },
+        {
+            "name": "psr/http-client",
+            "version": "1.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/http-client.git",
+                "reference": "bb5906edc1c324c9a05aa0873d40117941e5fa90"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/http-client/zipball/bb5906edc1c324c9a05aa0873d40117941e5fa90",
+                "reference": "bb5906edc1c324c9a05aa0873d40117941e5fa90",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.0 || ^8.0",
+                "psr/http-message": "^1.0 || ^2.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Http\\Client\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interface for HTTP clients",
+            "homepage": "https://github.com/php-fig/http-client",
+            "keywords": [
+                "http",
+                "http-client",
+                "psr",
+                "psr-18"
+            ],
+            "support": {
+                "source": "https://github.com/php-fig/http-client"
+            },
+            "time": "2023-09-23T14:17:50+00:00"
+        },
+        {
+            "name": "psr/http-factory",
+            "version": "1.1.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/http-factory.git",
+                "reference": "2b4765fddfe3b508ac62f829e852b1501d3f6e8a"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/http-factory/zipball/2b4765fddfe3b508ac62f829e852b1501d3f6e8a",
+                "reference": "2b4765fddfe3b508ac62f829e852b1501d3f6e8a",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.1",
+                "psr/http-message": "^1.0 || ^2.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Http\\Message\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "PSR-17: Common interfaces for PSR-7 HTTP message factories",
+            "keywords": [
+                "factory",
+                "http",
+                "message",
+                "psr",
+                "psr-17",
+                "psr-7",
+                "request",
+                "response"
+            ],
+            "support": {
+                "source": "https://github.com/php-fig/http-factory"
+            },
+            "time": "2024-04-15T12:06:14+00:00"
+        },
+        {
+            "name": "psr/http-message",
+            "version": "2.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/http-message.git",
+                "reference": "402d35bcb92c70c026d1a6a9883f06b2ead23d71"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/http-message/zipball/402d35bcb92c70c026d1a6a9883f06b2ead23d71",
+                "reference": "402d35bcb92c70c026d1a6a9883f06b2ead23d71",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2 || ^8.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Http\\Message\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interface for HTTP messages",
+            "homepage": "https://github.com/php-fig/http-message",
+            "keywords": [
+                "http",
+                "http-message",
+                "psr",
+                "psr-7",
+                "request",
+                "response"
+            ],
+            "support": {
+                "source": "https://github.com/php-fig/http-message/tree/2.0"
+            },
+            "time": "2023-04-04T09:54:51+00:00"
+        },
+        {
+            "name": "psr/log",
+            "version": "3.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/log.git",
+                "reference": "f16e1d5863e37f8d8c2a01719f5b34baa2b714d3"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/log/zipball/f16e1d5863e37f8d8c2a01719f5b34baa2b714d3",
+                "reference": "f16e1d5863e37f8d8c2a01719f5b34baa2b714d3",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.0.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Log\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interface for logging libraries",
+            "homepage": "https://github.com/php-fig/log",
+            "keywords": [
+                "log",
+                "psr",
+                "psr-3"
+            ],
+            "support": {
+                "source": "https://github.com/php-fig/log/tree/3.0.2"
+            },
+            "time": "2024-09-11T13:17:53+00:00"
+        },
+        {
+            "name": "psr/simple-cache",
+            "version": "3.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/simple-cache.git",
+                "reference": "764e0b3939f5ca87cb904f570ef9be2d78a07865"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/simple-cache/zipball/764e0b3939f5ca87cb904f570ef9be2d78a07865",
+                "reference": "764e0b3939f5ca87cb904f570ef9be2d78a07865",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.0.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\SimpleCache\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interfaces for simple caching",
+            "keywords": [
+                "cache",
+                "caching",
+                "psr",
+                "psr-16",
+                "simple-cache"
+            ],
+            "support": {
+                "source": "https://github.com/php-fig/simple-cache/tree/3.0.0"
+            },
+            "time": "2021-10-29T13:26:27+00:00"
+        },
+        {
+            "name": "psy/psysh",
+            "version": "v0.12.22",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/bobthecow/psysh.git",
+                "reference": "3be75d5b9244936dd4ac62ade2bfb004d13acf0f"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/bobthecow/psysh/zipball/3be75d5b9244936dd4ac62ade2bfb004d13acf0f",
+                "reference": "3be75d5b9244936dd4ac62ade2bfb004d13acf0f",
+                "shasum": ""
+            },
+            "require": {
+                "ext-json": "*",
+                "ext-tokenizer": "*",
+                "nikic/php-parser": "^5.0 || ^4.0",
+                "php": "^8.0 || ^7.4",
+                "symfony/console": "^8.0 || ^7.0 || ^6.0 || ^5.0 || ^4.0 || ^3.4",
+                "symfony/var-dumper": "^8.0 || ^7.0 || ^6.0 || ^5.0 || ^4.0 || ^3.4"
+            },
+            "conflict": {
+                "symfony/console": "4.4.37 || 5.3.14 || 5.3.15 || 5.4.3 || 5.4.4 || 6.0.3 || 6.0.4"
+            },
+            "require-dev": {
+                "bamarni/composer-bin-plugin": "^1.2",
+                "composer/class-map-generator": "^1.6"
+            },
+            "suggest": {
+                "composer/class-map-generator": "Improved tab completion performance with better class discovery.",
+                "ext-pcntl": "Enabling the PCNTL extension makes PsySH a lot happier :)",
+                "ext-posix": "If you have PCNTL, you'll want the POSIX extension as well."
+            },
+            "bin": [
+                "bin/psysh"
+            ],
+            "type": "library",
+            "extra": {
+                "bamarni-bin": {
+                    "bin-links": false,
+                    "forward-command": false
+                },
+                "branch-alias": {
+                    "dev-main": "0.12.x-dev"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "src/functions.php"
+                ],
+                "psr-4": {
+                    "Psy\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Justin Hileman",
+                    "email": "justin@justinhileman.info"
+                }
+            ],
+            "description": "An interactive shell for modern PHP.",
+            "homepage": "https://psysh.org",
+            "keywords": [
+                "REPL",
+                "console",
+                "interactive",
+                "shell"
+            ],
+            "support": {
+                "issues": "https://github.com/bobthecow/psysh/issues",
+                "source": "https://github.com/bobthecow/psysh/tree/v0.12.22"
+            },
+            "time": "2026-03-22T23:03:24+00:00"
+        },
+        {
+            "name": "ralouphie/getallheaders",
+            "version": "3.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/ralouphie/getallheaders.git",
+                "reference": "120b605dfeb996808c31b6477290a714d356e822"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/ralouphie/getallheaders/zipball/120b605dfeb996808c31b6477290a714d356e822",
+                "reference": "120b605dfeb996808c31b6477290a714d356e822",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.6"
+            },
+            "require-dev": {
+                "php-coveralls/php-coveralls": "^2.1",
+                "phpunit/phpunit": "^5 || ^6.5"
+            },
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "src/getallheaders.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Ralph Khattar",
+                    "email": "ralph.khattar@gmail.com"
+                }
+            ],
+            "description": "A polyfill for getallheaders.",
+            "support": {
+                "issues": "https://github.com/ralouphie/getallheaders/issues",
+                "source": "https://github.com/ralouphie/getallheaders/tree/develop"
+            },
+            "time": "2019-03-08T08:55:37+00:00"
+        },
+        {
+            "name": "ramsey/collection",
+            "version": "2.1.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/ramsey/collection.git",
+                "reference": "344572933ad0181accbf4ba763e85a0306a8c5e2"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/ramsey/collection/zipball/344572933ad0181accbf4ba763e85a0306a8c5e2",
+                "reference": "344572933ad0181accbf4ba763e85a0306a8c5e2",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^8.1"
+            },
+            "require-dev": {
+                "captainhook/plugin-composer": "^5.3",
+                "ergebnis/composer-normalize": "^2.45",
+                "fakerphp/faker": "^1.24",
+                "hamcrest/hamcrest-php": "^2.0",
+                "jangregor/phpstan-prophecy": "^2.1",
+                "mockery/mockery": "^1.6",
+                "php-parallel-lint/php-console-highlighter": "^1.0",
+                "php-parallel-lint/php-parallel-lint": "^1.4",
+                "phpspec/prophecy-phpunit": "^2.3",
+                "phpstan/extension-installer": "^1.4",
+                "phpstan/phpstan": "^2.1",
+                "phpstan/phpstan-mockery": "^2.0",
+                "phpstan/phpstan-phpunit": "^2.0",
+                "phpunit/phpunit": "^10.5",
+                "ramsey/coding-standard": "^2.3",
+                "ramsey/conventional-commits": "^1.6",
+                "roave/security-advisories": "dev-latest"
+            },
+            "type": "library",
+            "extra": {
+                "captainhook": {
+                    "force-install": true
+                },
+                "ramsey/conventional-commits": {
+                    "configFile": "conventional-commits.json"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Ramsey\\Collection\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Ben Ramsey",
+                    "email": "ben@benramsey.com",
+                    "homepage": "https://benramsey.com"
+                }
+            ],
+            "description": "A PHP library for representing and manipulating collections.",
+            "keywords": [
+                "array",
+                "collection",
+                "hash",
+                "map",
+                "queue",
+                "set"
+            ],
+            "support": {
+                "issues": "https://github.com/ramsey/collection/issues",
+                "source": "https://github.com/ramsey/collection/tree/2.1.1"
+            },
+            "time": "2025-03-22T05:38:12+00:00"
+        },
+        {
+            "name": "ramsey/uuid",
+            "version": "4.9.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/ramsey/uuid.git",
+                "reference": "8429c78ca35a09f27565311b98101e2826affde0"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/ramsey/uuid/zipball/8429c78ca35a09f27565311b98101e2826affde0",
+                "reference": "8429c78ca35a09f27565311b98101e2826affde0",
+                "shasum": ""
+            },
+            "require": {
+                "brick/math": "^0.8.16 || ^0.9 || ^0.10 || ^0.11 || ^0.12 || ^0.13 || ^0.14",
+                "php": "^8.0",
+                "ramsey/collection": "^1.2 || ^2.0"
+            },
+            "replace": {
+                "rhumsaa/uuid": "self.version"
+            },
+            "require-dev": {
+                "captainhook/captainhook": "^5.25",
+                "captainhook/plugin-composer": "^5.3",
+                "dealerdirect/phpcodesniffer-composer-installer": "^1.0",
+                "ergebnis/composer-normalize": "^2.47",
+                "mockery/mockery": "^1.6",
+                "paragonie/random-lib": "^2",
+                "php-mock/php-mock": "^2.6",
+                "php-mock/php-mock-mockery": "^1.5",
+                "php-parallel-lint/php-parallel-lint": "^1.4.0",
+                "phpbench/phpbench": "^1.2.14",
+                "phpstan/extension-installer": "^1.4",
+                "phpstan/phpstan": "^2.1",
+                "phpstan/phpstan-mockery": "^2.0",
+                "phpstan/phpstan-phpunit": "^2.0",
+                "phpunit/phpunit": "^9.6",
+                "slevomat/coding-standard": "^8.18",
+                "squizlabs/php_codesniffer": "^3.13"
+            },
+            "suggest": {
+                "ext-bcmath": "Enables faster math with arbitrary-precision integers using BCMath.",
+                "ext-gmp": "Enables faster math with arbitrary-precision integers using GMP.",
+                "ext-uuid": "Enables the use of PeclUuidTimeGenerator and PeclUuidRandomGenerator.",
+                "paragonie/random-lib": "Provides RandomLib for use with the RandomLibAdapter",
+                "ramsey/uuid-doctrine": "Allows the use of Ramsey\\Uuid\\Uuid as Doctrine field type."
+            },
+            "type": "library",
+            "extra": {
+                "captainhook": {
+                    "force-install": true
+                }
+            },
+            "autoload": {
+                "files": [
+                    "src/functions.php"
+                ],
+                "psr-4": {
+                    "Ramsey\\Uuid\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "A PHP library for generating and working with universally unique identifiers (UUIDs).",
+            "keywords": [
+                "guid",
+                "identifier",
+                "uuid"
+            ],
+            "support": {
+                "issues": "https://github.com/ramsey/uuid/issues",
+                "source": "https://github.com/ramsey/uuid/tree/4.9.2"
+            },
+            "time": "2025-12-14T04:43:48+00:00"
+        },
+        {
+            "name": "symfony/clock",
+            "version": "v7.4.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/clock.git",
+                "reference": "9169f24776edde469914c1e7a1442a50f7a4e110"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/clock/zipball/9169f24776edde469914c1e7a1442a50f7a4e110",
+                "reference": "9169f24776edde469914c1e7a1442a50f7a4e110",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "psr/clock": "^1.0",
+                "symfony/polyfill-php83": "^1.28"
+            },
+            "provide": {
+                "psr/clock-implementation": "1.0"
+            },
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "Resources/now.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Component\\Clock\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Decouples applications from the system clock",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "clock",
+                "psr20",
+                "time"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/clock/tree/v7.4.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-11-12T15:39:26+00:00"
+        },
+        {
+            "name": "symfony/console",
+            "version": "v7.4.7",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/console.git",
+                "reference": "e1e6770440fb9c9b0cf725f81d1361ad1835329d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/console/zipball/e1e6770440fb9c9b0cf725f81d1361ad1835329d",
+                "reference": "e1e6770440fb9c9b0cf725f81d1361ad1835329d",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "symfony/deprecation-contracts": "^2.5|^3",
+                "symfony/polyfill-mbstring": "~1.0",
+                "symfony/service-contracts": "^2.5|^3",
+                "symfony/string": "^7.2|^8.0"
+            },
+            "conflict": {
+                "symfony/dependency-injection": "<6.4",
+                "symfony/dotenv": "<6.4",
+                "symfony/event-dispatcher": "<6.4",
+                "symfony/lock": "<6.4",
+                "symfony/process": "<6.4"
+            },
+            "provide": {
+                "psr/log-implementation": "1.0|2.0|3.0"
+            },
+            "require-dev": {
+                "psr/log": "^1|^2|^3",
+                "symfony/config": "^6.4|^7.0|^8.0",
+                "symfony/dependency-injection": "^6.4|^7.0|^8.0",
+                "symfony/event-dispatcher": "^6.4|^7.0|^8.0",
+                "symfony/http-foundation": "^6.4|^7.0|^8.0",
+                "symfony/http-kernel": "^6.4|^7.0|^8.0",
+                "symfony/lock": "^6.4|^7.0|^8.0",
+                "symfony/messenger": "^6.4|^7.0|^8.0",
+                "symfony/process": "^6.4|^7.0|^8.0",
+                "symfony/stopwatch": "^6.4|^7.0|^8.0",
+                "symfony/var-dumper": "^6.4|^7.0|^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Console\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Eases the creation of beautiful and testable command line interfaces",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "cli",
+                "command-line",
+                "console",
+                "terminal"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/console/tree/v7.4.7"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-03-06T14:06:20+00:00"
+        },
+        {
+            "name": "symfony/css-selector",
+            "version": "v7.4.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/css-selector.git",
+                "reference": "2e7c52c647b406e2107dd867db424a4dbac91864"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/css-selector/zipball/2e7c52c647b406e2107dd867db424a4dbac91864",
+                "reference": "2e7c52c647b406e2107dd867db424a4dbac91864",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\CssSelector\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Jean-François Simon",
+                    "email": "jeanfrancois.simon@sensiolabs.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Converts CSS selectors to XPath expressions",
+            "homepage": "https://symfony.com",
+            "support": {
+                "source": "https://github.com/symfony/css-selector/tree/v7.4.6"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-02-17T07:53:42+00:00"
+        },
+        {
+            "name": "symfony/deprecation-contracts",
+            "version": "v3.6.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/deprecation-contracts.git",
+                "reference": "63afe740e99a13ba87ec199bb07bbdee937a5b62"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/deprecation-contracts/zipball/63afe740e99a13ba87ec199bb07bbdee937a5b62",
+                "reference": "63afe740e99a13ba87ec199bb07bbdee937a5b62",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.1"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/contracts",
+                    "name": "symfony/contracts"
+                },
+                "branch-alias": {
+                    "dev-main": "3.6-dev"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "function.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "A generic function and convention to trigger deprecation notices",
+            "homepage": "https://symfony.com",
+            "support": {
+                "source": "https://github.com/symfony/deprecation-contracts/tree/v3.6.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2024-09-25T14:21:43+00:00"
+        },
+        {
+            "name": "symfony/error-handler",
+            "version": "v7.4.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/error-handler.git",
+                "reference": "8da531f364ddfee53e36092a7eebbbd0b775f6b8"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/error-handler/zipball/8da531f364ddfee53e36092a7eebbbd0b775f6b8",
+                "reference": "8da531f364ddfee53e36092a7eebbbd0b775f6b8",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "psr/log": "^1|^2|^3",
+                "symfony/polyfill-php85": "^1.32",
+                "symfony/var-dumper": "^6.4|^7.0|^8.0"
+            },
+            "conflict": {
+                "symfony/deprecation-contracts": "<2.5",
+                "symfony/http-kernel": "<6.4"
+            },
+            "require-dev": {
+                "symfony/console": "^6.4|^7.0|^8.0",
+                "symfony/deprecation-contracts": "^2.5|^3",
+                "symfony/http-kernel": "^6.4|^7.0|^8.0",
+                "symfony/serializer": "^6.4|^7.0|^8.0",
+                "symfony/webpack-encore-bundle": "^1.0|^2.0"
+            },
+            "bin": [
+                "Resources/bin/patch-type-declarations"
+            ],
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\ErrorHandler\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Provides tools to manage errors and ease debugging PHP code",
+            "homepage": "https://symfony.com",
+            "support": {
+                "source": "https://github.com/symfony/error-handler/tree/v7.4.4"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-01-20T16:42:42+00:00"
+        },
+        {
+            "name": "symfony/event-dispatcher",
+            "version": "v7.4.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/event-dispatcher.git",
+                "reference": "dc2c0eba1af673e736bb851d747d266108aea746"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/event-dispatcher/zipball/dc2c0eba1af673e736bb851d747d266108aea746",
+                "reference": "dc2c0eba1af673e736bb851d747d266108aea746",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "symfony/event-dispatcher-contracts": "^2.5|^3"
+            },
+            "conflict": {
+                "symfony/dependency-injection": "<6.4",
+                "symfony/service-contracts": "<2.5"
+            },
+            "provide": {
+                "psr/event-dispatcher-implementation": "1.0",
+                "symfony/event-dispatcher-implementation": "2.0|3.0"
+            },
+            "require-dev": {
+                "psr/log": "^1|^2|^3",
+                "symfony/config": "^6.4|^7.0|^8.0",
+                "symfony/dependency-injection": "^6.4|^7.0|^8.0",
+                "symfony/error-handler": "^6.4|^7.0|^8.0",
+                "symfony/expression-language": "^6.4|^7.0|^8.0",
+                "symfony/framework-bundle": "^6.4|^7.0|^8.0",
+                "symfony/http-foundation": "^6.4|^7.0|^8.0",
+                "symfony/service-contracts": "^2.5|^3",
+                "symfony/stopwatch": "^6.4|^7.0|^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\EventDispatcher\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Provides tools that allow your application components to communicate with each other by dispatching events and listening to them",
+            "homepage": "https://symfony.com",
+            "support": {
+                "source": "https://github.com/symfony/event-dispatcher/tree/v7.4.4"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-01-05T11:45:34+00:00"
+        },
+        {
+            "name": "symfony/event-dispatcher-contracts",
+            "version": "v3.6.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/event-dispatcher-contracts.git",
+                "reference": "59eb412e93815df44f05f342958efa9f46b1e586"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/event-dispatcher-contracts/zipball/59eb412e93815df44f05f342958efa9f46b1e586",
+                "reference": "59eb412e93815df44f05f342958efa9f46b1e586",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.1",
+                "psr/event-dispatcher": "^1"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/contracts",
+                    "name": "symfony/contracts"
+                },
+                "branch-alias": {
+                    "dev-main": "3.6-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Contracts\\EventDispatcher\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Generic abstractions related to dispatching event",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "abstractions",
+                "contracts",
+                "decoupling",
+                "interfaces",
+                "interoperability",
+                "standards"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/event-dispatcher-contracts/tree/v3.6.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2024-09-25T14:21:43+00:00"
+        },
+        {
+            "name": "symfony/finder",
+            "version": "v7.4.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/finder.git",
+                "reference": "8655bf1076b7a3a346cb11413ffdabff50c7ffcf"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/finder/zipball/8655bf1076b7a3a346cb11413ffdabff50c7ffcf",
+                "reference": "8655bf1076b7a3a346cb11413ffdabff50c7ffcf",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "symfony/filesystem": "^6.4|^7.0|^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Finder\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Finds files and directories via an intuitive fluent interface",
+            "homepage": "https://symfony.com",
+            "support": {
+                "source": "https://github.com/symfony/finder/tree/v7.4.6"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-01-29T09:40:50+00:00"
+        },
+        {
+            "name": "symfony/http-foundation",
+            "version": "v7.4.7",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/http-foundation.git",
+                "reference": "f94b3e7b7dafd40e666f0c9ff2084133bae41e81"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/http-foundation/zipball/f94b3e7b7dafd40e666f0c9ff2084133bae41e81",
+                "reference": "f94b3e7b7dafd40e666f0c9ff2084133bae41e81",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "symfony/deprecation-contracts": "^2.5|^3",
+                "symfony/polyfill-mbstring": "^1.1"
+            },
+            "conflict": {
+                "doctrine/dbal": "<3.6",
+                "symfony/cache": "<6.4.12|>=7.0,<7.1.5"
+            },
+            "require-dev": {
+                "doctrine/dbal": "^3.6|^4",
+                "predis/predis": "^1.1|^2.0",
+                "symfony/cache": "^6.4.12|^7.1.5|^8.0",
+                "symfony/clock": "^6.4|^7.0|^8.0",
+                "symfony/dependency-injection": "^6.4|^7.0|^8.0",
+                "symfony/expression-language": "^6.4|^7.0|^8.0",
+                "symfony/http-kernel": "^6.4|^7.0|^8.0",
+                "symfony/mime": "^6.4|^7.0|^8.0",
+                "symfony/rate-limiter": "^6.4|^7.0|^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\HttpFoundation\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Defines an object-oriented layer for the HTTP specification",
+            "homepage": "https://symfony.com",
+            "support": {
+                "source": "https://github.com/symfony/http-foundation/tree/v7.4.7"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-03-06T13:15:18+00:00"
+        },
+        {
+            "name": "symfony/http-kernel",
+            "version": "v7.4.7",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/http-kernel.git",
+                "reference": "3b3fcf386c809be990c922e10e4c620d6367cab1"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/http-kernel/zipball/3b3fcf386c809be990c922e10e4c620d6367cab1",
+                "reference": "3b3fcf386c809be990c922e10e4c620d6367cab1",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "psr/log": "^1|^2|^3",
+                "symfony/deprecation-contracts": "^2.5|^3",
+                "symfony/error-handler": "^6.4|^7.0|^8.0",
+                "symfony/event-dispatcher": "^7.3|^8.0",
+                "symfony/http-foundation": "^7.4|^8.0",
+                "symfony/polyfill-ctype": "^1.8"
+            },
+            "conflict": {
+                "symfony/browser-kit": "<6.4",
+                "symfony/cache": "<6.4",
+                "symfony/config": "<6.4",
+                "symfony/console": "<6.4",
+                "symfony/dependency-injection": "<6.4",
+                "symfony/doctrine-bridge": "<6.4",
+                "symfony/flex": "<2.10",
+                "symfony/form": "<6.4",
+                "symfony/http-client": "<6.4",
+                "symfony/http-client-contracts": "<2.5",
+                "symfony/mailer": "<6.4",
+                "symfony/messenger": "<6.4",
+                "symfony/translation": "<6.4",
+                "symfony/translation-contracts": "<2.5",
+                "symfony/twig-bridge": "<6.4",
+                "symfony/validator": "<6.4",
+                "symfony/var-dumper": "<6.4",
+                "twig/twig": "<3.12"
+            },
+            "provide": {
+                "psr/log-implementation": "1.0|2.0|3.0"
+            },
+            "require-dev": {
+                "psr/cache": "^1.0|^2.0|^3.0",
+                "symfony/browser-kit": "^6.4|^7.0|^8.0",
+                "symfony/clock": "^6.4|^7.0|^8.0",
+                "symfony/config": "^6.4|^7.0|^8.0",
+                "symfony/console": "^6.4|^7.0|^8.0",
+                "symfony/css-selector": "^6.4|^7.0|^8.0",
+                "symfony/dependency-injection": "^6.4.1|^7.0.1|^8.0",
+                "symfony/dom-crawler": "^6.4|^7.0|^8.0",
+                "symfony/expression-language": "^6.4|^7.0|^8.0",
+                "symfony/finder": "^6.4|^7.0|^8.0",
+                "symfony/http-client-contracts": "^2.5|^3",
+                "symfony/process": "^6.4|^7.0|^8.0",
+                "symfony/property-access": "^7.1|^8.0",
+                "symfony/routing": "^6.4|^7.0|^8.0",
+                "symfony/serializer": "^7.1|^8.0",
+                "symfony/stopwatch": "^6.4|^7.0|^8.0",
+                "symfony/translation": "^6.4|^7.0|^8.0",
+                "symfony/translation-contracts": "^2.5|^3",
+                "symfony/uid": "^6.4|^7.0|^8.0",
+                "symfony/validator": "^6.4|^7.0|^8.0",
+                "symfony/var-dumper": "^6.4|^7.0|^8.0",
+                "symfony/var-exporter": "^6.4|^7.0|^8.0",
+                "twig/twig": "^3.12"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\HttpKernel\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Provides a structured process for converting a Request into a Response",
+            "homepage": "https://symfony.com",
+            "support": {
+                "source": "https://github.com/symfony/http-kernel/tree/v7.4.7"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-03-06T16:33:18+00:00"
+        },
+        {
+            "name": "symfony/mailer",
+            "version": "v7.4.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/mailer.git",
+                "reference": "b02726f39a20bc65e30364f5c750c4ddbf1f58e9"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/mailer/zipball/b02726f39a20bc65e30364f5c750c4ddbf1f58e9",
+                "reference": "b02726f39a20bc65e30364f5c750c4ddbf1f58e9",
+                "shasum": ""
+            },
+            "require": {
+                "egulias/email-validator": "^2.1.10|^3|^4",
+                "php": ">=8.2",
+                "psr/event-dispatcher": "^1",
+                "psr/log": "^1|^2|^3",
+                "symfony/event-dispatcher": "^6.4|^7.0|^8.0",
+                "symfony/mime": "^7.2|^8.0",
+                "symfony/service-contracts": "^2.5|^3"
+            },
+            "conflict": {
+                "symfony/http-client-contracts": "<2.5",
+                "symfony/http-kernel": "<6.4",
+                "symfony/messenger": "<6.4",
+                "symfony/mime": "<6.4",
+                "symfony/twig-bridge": "<6.4"
+            },
+            "require-dev": {
+                "symfony/console": "^6.4|^7.0|^8.0",
+                "symfony/http-client": "^6.4|^7.0|^8.0",
+                "symfony/messenger": "^6.4|^7.0|^8.0",
+                "symfony/twig-bridge": "^6.4|^7.0|^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Mailer\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Helps sending emails",
+            "homepage": "https://symfony.com",
+            "support": {
+                "source": "https://github.com/symfony/mailer/tree/v7.4.6"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-02-25T16:50:00+00:00"
+        },
+        {
+            "name": "symfony/mime",
+            "version": "v7.4.7",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/mime.git",
+                "reference": "da5ab4fde3f6c88ab06e96185b9922f48b677cd1"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/mime/zipball/da5ab4fde3f6c88ab06e96185b9922f48b677cd1",
+                "reference": "da5ab4fde3f6c88ab06e96185b9922f48b677cd1",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "symfony/deprecation-contracts": "^2.5|^3",
+                "symfony/polyfill-intl-idn": "^1.10",
+                "symfony/polyfill-mbstring": "^1.0"
+            },
+            "conflict": {
+                "egulias/email-validator": "~3.0.0",
+                "phpdocumentor/reflection-docblock": "<5.2|>=7",
+                "phpdocumentor/type-resolver": "<1.5.1",
+                "symfony/mailer": "<6.4",
+                "symfony/serializer": "<6.4.3|>7.0,<7.0.3"
+            },
+            "require-dev": {
+                "egulias/email-validator": "^2.1.10|^3.1|^4",
+                "league/html-to-markdown": "^5.0",
+                "phpdocumentor/reflection-docblock": "^5.2|^6.0",
+                "symfony/dependency-injection": "^6.4|^7.0|^8.0",
+                "symfony/process": "^6.4|^7.0|^8.0",
+                "symfony/property-access": "^6.4|^7.0|^8.0",
+                "symfony/property-info": "^6.4|^7.0|^8.0",
+                "symfony/serializer": "^6.4.3|^7.0.3|^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Mime\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Allows manipulating MIME messages",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "mime",
+                "mime-type"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/mime/tree/v7.4.7"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-03-05T15:24:09+00:00"
+        },
+        {
+            "name": "symfony/polyfill-ctype",
+            "version": "v1.33.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-ctype.git",
+                "reference": "a3cc8b044a6ea513310cbd48ef7333b384945638"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-ctype/zipball/a3cc8b044a6ea513310cbd48ef7333b384945638",
+                "reference": "a3cc8b044a6ea513310cbd48ef7333b384945638",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2"
+            },
+            "provide": {
+                "ext-ctype": "*"
+            },
+            "suggest": {
+                "ext-ctype": "For best performance"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/polyfill",
+                    "name": "symfony/polyfill"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Polyfill\\Ctype\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Gert de Pagter",
+                    "email": "BackEndTea@gmail.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill for ctype functions",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "ctype",
+                "polyfill",
+                "portable"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/polyfill-ctype/tree/v1.33.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2024-09-09T11:45:10+00:00"
+        },
+        {
+            "name": "symfony/polyfill-intl-grapheme",
+            "version": "v1.33.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-intl-grapheme.git",
+                "reference": "380872130d3a5dd3ace2f4010d95125fde5d5c70"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-intl-grapheme/zipball/380872130d3a5dd3ace2f4010d95125fde5d5c70",
+                "reference": "380872130d3a5dd3ace2f4010d95125fde5d5c70",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2"
+            },
+            "suggest": {
+                "ext-intl": "For best performance"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/polyfill",
+                    "name": "symfony/polyfill"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Polyfill\\Intl\\Grapheme\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill for intl's grapheme_* functions",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "grapheme",
+                "intl",
+                "polyfill",
+                "portable",
+                "shim"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/polyfill-intl-grapheme/tree/v1.33.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-06-27T09:58:17+00:00"
+        },
+        {
+            "name": "symfony/polyfill-intl-idn",
+            "version": "v1.33.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-intl-idn.git",
+                "reference": "9614ac4d8061dc257ecc64cba1b140873dce8ad3"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-intl-idn/zipball/9614ac4d8061dc257ecc64cba1b140873dce8ad3",
+                "reference": "9614ac4d8061dc257ecc64cba1b140873dce8ad3",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2",
+                "symfony/polyfill-intl-normalizer": "^1.10"
+            },
+            "suggest": {
+                "ext-intl": "For best performance"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/polyfill",
+                    "name": "symfony/polyfill"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Polyfill\\Intl\\Idn\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Laurent Bassin",
+                    "email": "laurent@bassin.info"
+                },
+                {
+                    "name": "Trevor Rowbotham",
+                    "email": "trevor.rowbotham@pm.me"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill for intl's idn_to_ascii and idn_to_utf8 functions",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "idn",
+                "intl",
+                "polyfill",
+                "portable",
+                "shim"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/polyfill-intl-idn/tree/v1.33.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2024-09-10T14:38:51+00:00"
+        },
+        {
+            "name": "symfony/polyfill-intl-normalizer",
+            "version": "v1.33.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-intl-normalizer.git",
+                "reference": "3833d7255cc303546435cb650316bff708a1c75c"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-intl-normalizer/zipball/3833d7255cc303546435cb650316bff708a1c75c",
+                "reference": "3833d7255cc303546435cb650316bff708a1c75c",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2"
+            },
+            "suggest": {
+                "ext-intl": "For best performance"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/polyfill",
+                    "name": "symfony/polyfill"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Polyfill\\Intl\\Normalizer\\": ""
+                },
+                "classmap": [
+                    "Resources/stubs"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill for intl's Normalizer class and related functions",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "intl",
+                "normalizer",
+                "polyfill",
+                "portable",
+                "shim"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/polyfill-intl-normalizer/tree/v1.33.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2024-09-09T11:45:10+00:00"
+        },
+        {
+            "name": "symfony/polyfill-mbstring",
+            "version": "v1.33.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-mbstring.git",
+                "reference": "6d857f4d76bd4b343eac26d6b539585d2bc56493"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-mbstring/zipball/6d857f4d76bd4b343eac26d6b539585d2bc56493",
+                "reference": "6d857f4d76bd4b343eac26d6b539585d2bc56493",
+                "shasum": ""
+            },
+            "require": {
+                "ext-iconv": "*",
+                "php": ">=7.2"
+            },
+            "provide": {
+                "ext-mbstring": "*"
+            },
+            "suggest": {
+                "ext-mbstring": "For best performance"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/polyfill",
+                    "name": "symfony/polyfill"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Polyfill\\Mbstring\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill for the Mbstring extension",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "mbstring",
+                "polyfill",
+                "portable",
+                "shim"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/polyfill-mbstring/tree/v1.33.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2024-12-23T08:48:59+00:00"
+        },
+        {
+            "name": "symfony/polyfill-php80",
+            "version": "v1.33.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-php80.git",
+                "reference": "0cc9dd0f17f61d8131e7df6b84bd344899fe2608"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-php80/zipball/0cc9dd0f17f61d8131e7df6b84bd344899fe2608",
+                "reference": "0cc9dd0f17f61d8131e7df6b84bd344899fe2608",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/polyfill",
+                    "name": "symfony/polyfill"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Polyfill\\Php80\\": ""
+                },
+                "classmap": [
+                    "Resources/stubs"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Ion Bazan",
+                    "email": "ion.bazan@gmail.com"
+                },
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill backporting some PHP 8.0+ features to lower PHP versions",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "polyfill",
+                "portable",
+                "shim"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/polyfill-php80/tree/v1.33.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-01-02T08:10:11+00:00"
+        },
+        {
+            "name": "symfony/polyfill-php83",
+            "version": "v1.33.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-php83.git",
+                "reference": "17f6f9a6b1735c0f163024d959f700cfbc5155e5"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-php83/zipball/17f6f9a6b1735c0f163024d959f700cfbc5155e5",
+                "reference": "17f6f9a6b1735c0f163024d959f700cfbc5155e5",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/polyfill",
+                    "name": "symfony/polyfill"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Polyfill\\Php83\\": ""
+                },
+                "classmap": [
+                    "Resources/stubs"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill backporting some PHP 8.3+ features to lower PHP versions",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "polyfill",
+                "portable",
+                "shim"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/polyfill-php83/tree/v1.33.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-07-08T02:45:35+00:00"
+        },
+        {
+            "name": "symfony/polyfill-php84",
+            "version": "v1.33.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-php84.git",
+                "reference": "d8ced4d875142b6a7426000426b8abc631d6b191"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-php84/zipball/d8ced4d875142b6a7426000426b8abc631d6b191",
+                "reference": "d8ced4d875142b6a7426000426b8abc631d6b191",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/polyfill",
+                    "name": "symfony/polyfill"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Polyfill\\Php84\\": ""
+                },
+                "classmap": [
+                    "Resources/stubs"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill backporting some PHP 8.4+ features to lower PHP versions",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "polyfill",
+                "portable",
+                "shim"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/polyfill-php84/tree/v1.33.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-06-24T13:30:11+00:00"
+        },
+        {
+            "name": "symfony/polyfill-php85",
+            "version": "v1.33.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-php85.git",
+                "reference": "d4e5fcd4ab3d998ab16c0db48e6cbb9a01993f91"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-php85/zipball/d4e5fcd4ab3d998ab16c0db48e6cbb9a01993f91",
+                "reference": "d4e5fcd4ab3d998ab16c0db48e6cbb9a01993f91",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/polyfill",
+                    "name": "symfony/polyfill"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Polyfill\\Php85\\": ""
+                },
+                "classmap": [
+                    "Resources/stubs"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill backporting some PHP 8.5+ features to lower PHP versions",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "polyfill",
+                "portable",
+                "shim"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/polyfill-php85/tree/v1.33.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-06-23T16:12:55+00:00"
+        },
+        {
+            "name": "symfony/polyfill-uuid",
+            "version": "v1.33.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-uuid.git",
+                "reference": "21533be36c24be3f4b1669c4725c7d1d2bab4ae2"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-uuid/zipball/21533be36c24be3f4b1669c4725c7d1d2bab4ae2",
+                "reference": "21533be36c24be3f4b1669c4725c7d1d2bab4ae2",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2"
+            },
+            "provide": {
+                "ext-uuid": "*"
+            },
+            "suggest": {
+                "ext-uuid": "For best performance"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/polyfill",
+                    "name": "symfony/polyfill"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Polyfill\\Uuid\\": ""
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Grégoire Pineau",
+                    "email": "lyrixx@lyrixx.info"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill for uuid functions",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "polyfill",
+                "portable",
+                "uuid"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/polyfill-uuid/tree/v1.33.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2024-09-09T11:45:10+00:00"
+        },
+        {
+            "name": "symfony/process",
+            "version": "v7.4.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/process.git",
+                "reference": "608476f4604102976d687c483ac63a79ba18cc97"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/process/zipball/608476f4604102976d687c483ac63a79ba18cc97",
+                "reference": "608476f4604102976d687c483ac63a79ba18cc97",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Process\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Executes commands in sub-processes",
+            "homepage": "https://symfony.com",
+            "support": {
+                "source": "https://github.com/symfony/process/tree/v7.4.5"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-01-26T15:07:59+00:00"
+        },
+        {
+            "name": "symfony/routing",
+            "version": "v7.4.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/routing.git",
+                "reference": "238d749c56b804b31a9bf3e26519d93b65a60938"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/routing/zipball/238d749c56b804b31a9bf3e26519d93b65a60938",
+                "reference": "238d749c56b804b31a9bf3e26519d93b65a60938",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "symfony/deprecation-contracts": "^2.5|^3"
+            },
+            "conflict": {
+                "symfony/config": "<6.4",
+                "symfony/dependency-injection": "<6.4",
+                "symfony/yaml": "<6.4"
+            },
+            "require-dev": {
+                "psr/log": "^1|^2|^3",
+                "symfony/config": "^6.4|^7.0|^8.0",
+                "symfony/dependency-injection": "^6.4|^7.0|^8.0",
+                "symfony/expression-language": "^6.4|^7.0|^8.0",
+                "symfony/http-foundation": "^6.4|^7.0|^8.0",
+                "symfony/yaml": "^6.4|^7.0|^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Routing\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Maps an HTTP request to a set of configuration variables",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "router",
+                "routing",
+                "uri",
+                "url"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/routing/tree/v7.4.6"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-02-25T16:50:00+00:00"
+        },
+        {
+            "name": "symfony/service-contracts",
+            "version": "v3.6.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/service-contracts.git",
+                "reference": "45112560a3ba2d715666a509a0bc9521d10b6c43"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/service-contracts/zipball/45112560a3ba2d715666a509a0bc9521d10b6c43",
+                "reference": "45112560a3ba2d715666a509a0bc9521d10b6c43",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.1",
+                "psr/container": "^1.1|^2.0",
+                "symfony/deprecation-contracts": "^2.5|^3"
+            },
+            "conflict": {
+                "ext-psr": "<1.1|>=2"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/contracts",
+                    "name": "symfony/contracts"
+                },
+                "branch-alias": {
+                    "dev-main": "3.6-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Contracts\\Service\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Test/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Generic abstractions related to writing services",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "abstractions",
+                "contracts",
+                "decoupling",
+                "interfaces",
+                "interoperability",
+                "standards"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/service-contracts/tree/v3.6.1"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-07-15T11:30:57+00:00"
+        },
+        {
+            "name": "symfony/string",
+            "version": "v7.4.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/string.git",
+                "reference": "9f209231affa85aa930a5e46e6eb03381424b30b"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/string/zipball/9f209231affa85aa930a5e46e6eb03381424b30b",
+                "reference": "9f209231affa85aa930a5e46e6eb03381424b30b",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "symfony/deprecation-contracts": "^2.5|^3.0",
+                "symfony/polyfill-ctype": "~1.8",
+                "symfony/polyfill-intl-grapheme": "~1.33",
+                "symfony/polyfill-intl-normalizer": "~1.0",
+                "symfony/polyfill-mbstring": "~1.0"
+            },
+            "conflict": {
+                "symfony/translation-contracts": "<2.5"
+            },
+            "require-dev": {
+                "symfony/emoji": "^7.1|^8.0",
+                "symfony/http-client": "^6.4|^7.0|^8.0",
+                "symfony/intl": "^6.4|^7.0|^8.0",
+                "symfony/translation-contracts": "^2.5|^3.0",
+                "symfony/var-exporter": "^6.4|^7.0|^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "Resources/functions.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Component\\String\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Provides an object-oriented API to strings and deals with bytes, UTF-8 code points and grapheme clusters in a unified way",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "grapheme",
+                "i18n",
+                "string",
+                "unicode",
+                "utf-8",
+                "utf8"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/string/tree/v7.4.6"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-02-09T09:33:46+00:00"
+        },
+        {
+            "name": "symfony/translation",
+            "version": "v7.4.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/translation.git",
+                "reference": "1888cf064399868af3784b9e043240f1d89d25ce"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/translation/zipball/1888cf064399868af3784b9e043240f1d89d25ce",
+                "reference": "1888cf064399868af3784b9e043240f1d89d25ce",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "symfony/deprecation-contracts": "^2.5|^3",
+                "symfony/polyfill-mbstring": "~1.0",
+                "symfony/translation-contracts": "^2.5.3|^3.3"
+            },
+            "conflict": {
+                "nikic/php-parser": "<5.0",
+                "symfony/config": "<6.4",
+                "symfony/console": "<6.4",
+                "symfony/dependency-injection": "<6.4",
+                "symfony/http-client-contracts": "<2.5",
+                "symfony/http-kernel": "<6.4",
+                "symfony/service-contracts": "<2.5",
+                "symfony/twig-bundle": "<6.4",
+                "symfony/yaml": "<6.4"
+            },
+            "provide": {
+                "symfony/translation-implementation": "2.3|3.0"
+            },
+            "require-dev": {
+                "nikic/php-parser": "^5.0",
+                "psr/log": "^1|^2|^3",
+                "symfony/config": "^6.4|^7.0|^8.0",
+                "symfony/console": "^6.4|^7.0|^8.0",
+                "symfony/dependency-injection": "^6.4|^7.0|^8.0",
+                "symfony/finder": "^6.4|^7.0|^8.0",
+                "symfony/http-client-contracts": "^2.5|^3.0",
+                "symfony/http-kernel": "^6.4|^7.0|^8.0",
+                "symfony/intl": "^6.4|^7.0|^8.0",
+                "symfony/polyfill-intl-icu": "^1.21",
+                "symfony/routing": "^6.4|^7.0|^8.0",
+                "symfony/service-contracts": "^2.5|^3",
+                "symfony/yaml": "^6.4|^7.0|^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "Resources/functions.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Component\\Translation\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Provides tools to internationalize your application",
+            "homepage": "https://symfony.com",
+            "support": {
+                "source": "https://github.com/symfony/translation/tree/v7.4.6"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-02-17T07:53:42+00:00"
+        },
+        {
+            "name": "symfony/translation-contracts",
+            "version": "v3.6.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/translation-contracts.git",
+                "reference": "65a8bc82080447fae78373aa10f8d13b38338977"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/translation-contracts/zipball/65a8bc82080447fae78373aa10f8d13b38338977",
+                "reference": "65a8bc82080447fae78373aa10f8d13b38338977",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.1"
+            },
+            "type": "library",
+            "extra": {
+                "thanks": {
+                    "url": "https://github.com/symfony/contracts",
+                    "name": "symfony/contracts"
+                },
+                "branch-alias": {
+                    "dev-main": "3.6-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Contracts\\Translation\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Test/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Generic abstractions related to translation",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "abstractions",
+                "contracts",
+                "decoupling",
+                "interfaces",
+                "interoperability",
+                "standards"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/translation-contracts/tree/v3.6.1"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-07-15T13:41:35+00:00"
+        },
+        {
+            "name": "symfony/uid",
+            "version": "v7.4.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/uid.git",
+                "reference": "7719ce8aba76be93dfe249192f1fbfa52c588e36"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/uid/zipball/7719ce8aba76be93dfe249192f1fbfa52c588e36",
+                "reference": "7719ce8aba76be93dfe249192f1fbfa52c588e36",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "symfony/polyfill-uuid": "^1.15"
+            },
+            "require-dev": {
+                "symfony/console": "^6.4|^7.0|^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Uid\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Grégoire Pineau",
+                    "email": "lyrixx@lyrixx.info"
+                },
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Provides an object-oriented API to generate and represent UIDs",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "UID",
+                "ulid",
+                "uuid"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/uid/tree/v7.4.4"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-01-03T23:30:35+00:00"
+        },
+        {
+            "name": "symfony/var-dumper",
+            "version": "v7.4.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/var-dumper.git",
+                "reference": "045321c440ac18347b136c63d2e9bf28a2dc0291"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/var-dumper/zipball/045321c440ac18347b136c63d2e9bf28a2dc0291",
+                "reference": "045321c440ac18347b136c63d2e9bf28a2dc0291",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "symfony/deprecation-contracts": "^2.5|^3",
+                "symfony/polyfill-mbstring": "~1.0"
+            },
+            "conflict": {
+                "symfony/console": "<6.4"
+            },
+            "require-dev": {
+                "symfony/console": "^6.4|^7.0|^8.0",
+                "symfony/http-kernel": "^6.4|^7.0|^8.0",
+                "symfony/process": "^6.4|^7.0|^8.0",
+                "symfony/uid": "^6.4|^7.0|^8.0",
+                "twig/twig": "^3.12"
+            },
+            "bin": [
+                "Resources/bin/var-dump-server"
+            ],
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "Resources/functions/dump.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Component\\VarDumper\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Provides mechanisms for walking through any arbitrary PHP variable",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "debug",
+                "dump"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/var-dumper/tree/v7.4.6"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-02-15T10:53:20+00:00"
+        },
+        {
+            "name": "tijsverkoyen/css-to-inline-styles",
+            "version": "v2.4.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/tijsverkoyen/CssToInlineStyles.git",
+                "reference": "f0292ccf0ec75843d65027214426b6b163b48b41"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/tijsverkoyen/CssToInlineStyles/zipball/f0292ccf0ec75843d65027214426b6b163b48b41",
+                "reference": "f0292ccf0ec75843d65027214426b6b163b48b41",
+                "shasum": ""
+            },
+            "require": {
+                "ext-dom": "*",
+                "ext-libxml": "*",
+                "php": "^7.4 || ^8.0",
+                "symfony/css-selector": "^5.4 || ^6.0 || ^7.0 || ^8.0"
+            },
+            "require-dev": {
+                "phpstan/phpstan": "^2.0",
+                "phpstan/phpstan-phpunit": "^2.0",
+                "phpunit/phpunit": "^8.5.21 || ^9.5.10"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "TijsVerkoyen\\CssToInlineStyles\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Tijs Verkoyen",
+                    "email": "css_to_inline_styles@verkoyen.eu",
+                    "role": "Developer"
+                }
+            ],
+            "description": "CssToInlineStyles is a class that enables you to convert HTML-pages/files into HTML-pages/files with inline styles. This is very useful when you're sending emails.",
+            "homepage": "https://github.com/tijsverkoyen/CssToInlineStyles",
+            "support": {
+                "issues": "https://github.com/tijsverkoyen/CssToInlineStyles/issues",
+                "source": "https://github.com/tijsverkoyen/CssToInlineStyles/tree/v2.4.0"
+            },
+            "time": "2025-12-02T11:56:42+00:00"
+        },
+        {
+            "name": "vlucas/phpdotenv",
+            "version": "v5.6.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/vlucas/phpdotenv.git",
+                "reference": "955e7815d677a3eaa7075231212f2110983adecc"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/vlucas/phpdotenv/zipball/955e7815d677a3eaa7075231212f2110983adecc",
+                "reference": "955e7815d677a3eaa7075231212f2110983adecc",
+                "shasum": ""
+            },
+            "require": {
+                "ext-pcre": "*",
+                "graham-campbell/result-type": "^1.1.4",
+                "php": "^7.2.5 || ^8.0",
+                "phpoption/phpoption": "^1.9.5",
+                "symfony/polyfill-ctype": "^1.26",
+                "symfony/polyfill-mbstring": "^1.26",
+                "symfony/polyfill-php80": "^1.26"
+            },
+            "require-dev": {
+                "bamarni/composer-bin-plugin": "^1.8.2",
+                "ext-filter": "*",
+                "phpunit/phpunit": "^8.5.34 || ^9.6.13 || ^10.4.2"
+            },
+            "suggest": {
+                "ext-filter": "Required to use the boolean validator."
+            },
+            "type": "library",
+            "extra": {
+                "bamarni-bin": {
+                    "bin-links": true,
+                    "forward-command": false
+                },
+                "branch-alias": {
+                    "dev-master": "5.6-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Dotenv\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Graham Campbell",
+                    "email": "hello@gjcampbell.co.uk",
+                    "homepage": "https://github.com/GrahamCampbell"
+                },
+                {
+                    "name": "Vance Lucas",
+                    "email": "vance@vancelucas.com",
+                    "homepage": "https://github.com/vlucas"
+                }
+            ],
+            "description": "Loads environment variables from `.env` to `getenv()`, `$_ENV` and `$_SERVER` automagically.",
+            "keywords": [
+                "dotenv",
+                "env",
+                "environment"
+            ],
+            "support": {
+                "issues": "https://github.com/vlucas/phpdotenv/issues",
+                "source": "https://github.com/vlucas/phpdotenv/tree/v5.6.3"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/GrahamCampbell",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/vlucas/phpdotenv",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-12-27T19:49:13+00:00"
+        },
+        {
+            "name": "voku/portable-ascii",
+            "version": "2.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/voku/portable-ascii.git",
+                "reference": "b1d923f88091c6bf09699efcd7c8a1b1bfd7351d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/voku/portable-ascii/zipball/b1d923f88091c6bf09699efcd7c8a1b1bfd7351d",
+                "reference": "b1d923f88091c6bf09699efcd7c8a1b1bfd7351d",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.0.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "~6.0 || ~7.0 || ~9.0"
+            },
+            "suggest": {
+                "ext-intl": "Use Intl for transliterator_transliterate() support"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "voku\\": "src/voku/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Lars Moelleken",
+                    "homepage": "https://www.moelleken.org/"
+                }
+            ],
+            "description": "Portable ASCII library - performance optimized (ascii) string functions for php.",
+            "homepage": "https://github.com/voku/portable-ascii",
+            "keywords": [
+                "ascii",
+                "clean",
+                "php"
+            ],
+            "support": {
+                "issues": "https://github.com/voku/portable-ascii/issues",
+                "source": "https://github.com/voku/portable-ascii/tree/2.0.3"
+            },
+            "funding": [
+                {
+                    "url": "https://www.paypal.me/moelleken",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/voku",
+                    "type": "github"
+                },
+                {
+                    "url": "https://opencollective.com/portable-ascii",
+                    "type": "open_collective"
+                },
+                {
+                    "url": "https://www.patreon.com/voku",
+                    "type": "patreon"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/voku/portable-ascii",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2024-11-21T01:49:47+00:00"
+        }
+    ],
+    "packages-dev": [
+        {
+            "name": "fakerphp/faker",
+            "version": "v1.24.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/FakerPHP/Faker.git",
+                "reference": "e0ee18eb1e6dc3cda3ce9fd97e5a0689a88a64b5"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/FakerPHP/Faker/zipball/e0ee18eb1e6dc3cda3ce9fd97e5a0689a88a64b5",
+                "reference": "e0ee18eb1e6dc3cda3ce9fd97e5a0689a88a64b5",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.4 || ^8.0",
+                "psr/container": "^1.0 || ^2.0",
+                "symfony/deprecation-contracts": "^2.2 || ^3.0"
+            },
+            "conflict": {
+                "fzaninotto/faker": "*"
+            },
+            "require-dev": {
+                "bamarni/composer-bin-plugin": "^1.4.1",
+                "doctrine/persistence": "^1.3 || ^2.0",
+                "ext-intl": "*",
+                "phpunit/phpunit": "^9.5.26",
+                "symfony/phpunit-bridge": "^5.4.16"
+            },
+            "suggest": {
+                "doctrine/orm": "Required to use Faker\\ORM\\Doctrine",
+                "ext-curl": "Required by Faker\\Provider\\Image to download images.",
+                "ext-dom": "Required by Faker\\Provider\\HtmlLorem for generating random HTML.",
+                "ext-iconv": "Required by Faker\\Provider\\ru_RU\\Text::realText() for generating real Russian text.",
+                "ext-mbstring": "Required for multibyte Unicode string functionality."
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Faker\\": "src/Faker/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "François Zaninotto"
+                }
+            ],
+            "description": "Faker is a PHP library that generates fake data for you.",
+            "keywords": [
+                "data",
+                "faker",
+                "fixtures"
+            ],
+            "support": {
+                "issues": "https://github.com/FakerPHP/Faker/issues",
+                "source": "https://github.com/FakerPHP/Faker/tree/v1.24.1"
+            },
+            "time": "2024-11-21T13:46:39+00:00"
+        },
+        {
+            "name": "filp/whoops",
+            "version": "2.18.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/filp/whoops.git",
+                "reference": "d2102955e48b9fd9ab24280a7ad12ed552752c4d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/filp/whoops/zipball/d2102955e48b9fd9ab24280a7ad12ed552752c4d",
+                "reference": "d2102955e48b9fd9ab24280a7ad12ed552752c4d",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.1 || ^8.0",
+                "psr/log": "^1.0.1 || ^2.0 || ^3.0"
+            },
+            "require-dev": {
+                "mockery/mockery": "^1.0",
+                "phpunit/phpunit": "^7.5.20 || ^8.5.8 || ^9.3.3",
+                "symfony/var-dumper": "^4.0 || ^5.0"
+            },
+            "suggest": {
+                "symfony/var-dumper": "Pretty print complex values better with var-dumper available",
+                "whoops/soap": "Formats errors as SOAP responses"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.7-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Whoops\\": "src/Whoops/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Filipe Dobreira",
+                    "homepage": "https://github.com/filp",
+                    "role": "Developer"
+                }
+            ],
+            "description": "php error handling for cool kids",
+            "homepage": "https://filp.github.io/whoops/",
+            "keywords": [
+                "error",
+                "exception",
+                "handling",
+                "library",
+                "throwable",
+                "whoops"
+            ],
+            "support": {
+                "issues": "https://github.com/filp/whoops/issues",
+                "source": "https://github.com/filp/whoops/tree/2.18.4"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/denis-sokolov",
+                    "type": "github"
+                }
+            ],
+            "time": "2025-08-08T12:00:00+00:00"
+        },
+        {
+            "name": "hamcrest/hamcrest-php",
+            "version": "v2.1.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/hamcrest/hamcrest-php.git",
+                "reference": "f8b1c0173b22fa6ec77a81fe63e5b01eba7e6487"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/hamcrest/hamcrest-php/zipball/f8b1c0173b22fa6ec77a81fe63e5b01eba7e6487",
+                "reference": "f8b1c0173b22fa6ec77a81fe63e5b01eba7e6487",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.4|^8.0"
+            },
+            "replace": {
+                "cordoval/hamcrest-php": "*",
+                "davedevelopment/hamcrest-php": "*",
+                "kodova/hamcrest-php": "*"
+            },
+            "require-dev": {
+                "phpunit/php-file-iterator": "^1.4 || ^2.0 || ^3.0",
+                "phpunit/phpunit": "^4.8.36 || ^5.7 || ^6.5 || ^7.0 || ^8.0 || ^9.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.1-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "hamcrest"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "description": "This is the PHP port of Hamcrest Matchers",
+            "keywords": [
+                "test"
+            ],
+            "support": {
+                "issues": "https://github.com/hamcrest/hamcrest-php/issues",
+                "source": "https://github.com/hamcrest/hamcrest-php/tree/v2.1.1"
+            },
+            "time": "2025-04-30T06:54:44+00:00"
+        },
+        {
+            "name": "laravel/breeze",
+            "version": "v2.4.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/laravel/breeze.git",
+                "reference": "28cefeaf6af20177ddf5cc7b93e87e4ad79d533f"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/laravel/breeze/zipball/28cefeaf6af20177ddf5cc7b93e87e4ad79d533f",
+                "reference": "28cefeaf6af20177ddf5cc7b93e87e4ad79d533f",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/console": "^11.0|^12.0|^13.0",
+                "illuminate/filesystem": "^11.0|^12.0|^13.0",
+                "illuminate/support": "^11.0|^12.0|^13.0",
+                "illuminate/validation": "^11.0|^12.0|^13.0",
+                "php": "^8.2.0",
+                "symfony/console": "^7.0|^8.0"
+            },
+            "require-dev": {
+                "laravel/framework": "^11.0|^12.0|^13.0",
+                "orchestra/testbench-core": "^9.0|^10.0|^11.0",
+                "phpstan/phpstan": "^2.0"
+            },
+            "type": "library",
+            "extra": {
+                "laravel": {
+                    "providers": [
+                        "Laravel\\Breeze\\BreezeServiceProvider"
+                    ]
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Laravel\\Breeze\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "Minimal Laravel authentication scaffolding with Blade and Tailwind.",
+            "keywords": [
+                "auth",
+                "laravel"
+            ],
+            "support": {
+                "issues": "https://github.com/laravel/breeze/issues",
+                "source": "https://github.com/laravel/breeze"
+            },
+            "time": "2026-03-10T19:59:01+00:00"
+        },
+        {
+            "name": "laravel/pail",
+            "version": "v1.2.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/laravel/pail.git",
+                "reference": "aa71a01c309e7f66bc2ec4fb1a59291b82eb4abf"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/laravel/pail/zipball/aa71a01c309e7f66bc2ec4fb1a59291b82eb4abf",
+                "reference": "aa71a01c309e7f66bc2ec4fb1a59291b82eb4abf",
+                "shasum": ""
+            },
+            "require": {
+                "ext-mbstring": "*",
+                "illuminate/console": "^10.24|^11.0|^12.0|^13.0",
+                "illuminate/contracts": "^10.24|^11.0|^12.0|^13.0",
+                "illuminate/log": "^10.24|^11.0|^12.0|^13.0",
+                "illuminate/process": "^10.24|^11.0|^12.0|^13.0",
+                "illuminate/support": "^10.24|^11.0|^12.0|^13.0",
+                "nunomaduro/termwind": "^1.15|^2.0",
+                "php": "^8.2",
+                "symfony/console": "^6.0|^7.0|^8.0"
+            },
+            "require-dev": {
+                "laravel/framework": "^10.24|^11.0|^12.0|^13.0",
+                "laravel/pint": "^1.13",
+                "orchestra/testbench-core": "^8.13|^9.17|^10.8|^11.0",
+                "pestphp/pest": "^2.20|^3.0|^4.0",
+                "pestphp/pest-plugin-type-coverage": "^2.3|^3.0|^4.0",
+                "phpstan/phpstan": "^1.12.27",
+                "symfony/var-dumper": "^6.3|^7.0|^8.0",
+                "symfony/yaml": "^6.3|^7.0|^8.0"
+            },
+            "type": "library",
+            "extra": {
+                "laravel": {
+                    "providers": [
+                        "Laravel\\Pail\\PailServiceProvider"
+                    ]
+                },
+                "branch-alias": {
+                    "dev-main": "1.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Laravel\\Pail\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                },
+                {
+                    "name": "Nuno Maduro",
+                    "email": "enunomaduro@gmail.com"
+                }
+            ],
+            "description": "Easily delve into your Laravel application's log files directly from the command line.",
+            "homepage": "https://github.com/laravel/pail",
+            "keywords": [
+                "dev",
+                "laravel",
+                "logs",
+                "php",
+                "tail"
+            ],
+            "support": {
+                "issues": "https://github.com/laravel/pail/issues",
+                "source": "https://github.com/laravel/pail"
+            },
+            "time": "2026-02-09T13:44:54+00:00"
+        },
+        {
+            "name": "laravel/pint",
+            "version": "v1.29.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/laravel/pint.git",
+                "reference": "bdec963f53172c5e36330f3a400604c69bf02d39"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/laravel/pint/zipball/bdec963f53172c5e36330f3a400604c69bf02d39",
+                "reference": "bdec963f53172c5e36330f3a400604c69bf02d39",
+                "shasum": ""
+            },
+            "require": {
+                "ext-json": "*",
+                "ext-mbstring": "*",
+                "ext-tokenizer": "*",
+                "ext-xml": "*",
+                "php": "^8.2.0"
+            },
+            "require-dev": {
+                "friendsofphp/php-cs-fixer": "^3.94.2",
+                "illuminate/view": "^12.54.1",
+                "larastan/larastan": "^3.9.3",
+                "laravel-zero/framework": "^12.0.5",
+                "mockery/mockery": "^1.6.12",
+                "nunomaduro/termwind": "^2.4.0",
+                "pestphp/pest": "^3.8.6",
+                "shipfastlabs/agent-detector": "^1.1.0"
+            },
+            "bin": [
+                "builds/pint"
+            ],
+            "type": "project",
+            "autoload": {
+                "psr-4": {
+                    "App\\": "app/",
+                    "Database\\Seeders\\": "database/seeders/",
+                    "Database\\Factories\\": "database/factories/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nuno Maduro",
+                    "email": "enunomaduro@gmail.com"
+                }
+            ],
+            "description": "An opinionated code formatter for PHP.",
+            "homepage": "https://laravel.com",
+            "keywords": [
+                "dev",
+                "format",
+                "formatter",
+                "lint",
+                "linter",
+                "php"
+            ],
+            "support": {
+                "issues": "https://github.com/laravel/pint/issues",
+                "source": "https://github.com/laravel/pint"
+            },
+            "time": "2026-03-12T15:51:39+00:00"
+        },
+        {
+            "name": "laravel/sail",
+            "version": "v1.55.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/laravel/sail.git",
+                "reference": "67dc1b72da4e066a2fb54c1c7582fd2f140ea191"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/laravel/sail/zipball/67dc1b72da4e066a2fb54c1c7582fd2f140ea191",
+                "reference": "67dc1b72da4e066a2fb54c1c7582fd2f140ea191",
+                "shasum": ""
+            },
+            "require": {
+                "illuminate/console": "^9.52.16|^10.0|^11.0|^12.0|^13.0",
+                "illuminate/contracts": "^9.52.16|^10.0|^11.0|^12.0|^13.0",
+                "illuminate/support": "^9.52.16|^10.0|^11.0|^12.0|^13.0",
+                "php": "^8.0",
+                "symfony/console": "^6.0|^7.0|^8.0",
+                "symfony/yaml": "^6.0|^7.0|^8.0"
+            },
+            "require-dev": {
+                "orchestra/testbench": "^7.0|^8.0|^9.0|^10.0|^11.0",
+                "phpstan/phpstan": "^2.0"
+            },
+            "bin": [
+                "bin/sail"
+            ],
+            "type": "library",
+            "extra": {
+                "laravel": {
+                    "providers": [
+                        "Laravel\\Sail\\SailServiceProvider"
+                    ]
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Laravel\\Sail\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                }
+            ],
+            "description": "Docker files for running a basic Laravel application.",
+            "keywords": [
+                "docker",
+                "laravel"
+            ],
+            "support": {
+                "issues": "https://github.com/laravel/sail/issues",
+                "source": "https://github.com/laravel/sail"
+            },
+            "time": "2026-03-23T15:56:34+00:00"
+        },
+        {
+            "name": "mockery/mockery",
+            "version": "1.6.12",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/mockery/mockery.git",
+                "reference": "1f4efdd7d3beafe9807b08156dfcb176d18f1699"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/mockery/mockery/zipball/1f4efdd7d3beafe9807b08156dfcb176d18f1699",
+                "reference": "1f4efdd7d3beafe9807b08156dfcb176d18f1699",
+                "shasum": ""
+            },
+            "require": {
+                "hamcrest/hamcrest-php": "^2.0.1",
+                "lib-pcre": ">=7.0",
+                "php": ">=7.3"
+            },
+            "conflict": {
+                "phpunit/phpunit": "<8.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^8.5 || ^9.6.17",
+                "symplify/easy-coding-standard": "^12.1.14"
+            },
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "library/helpers.php",
+                    "library/Mockery.php"
+                ],
+                "psr-4": {
+                    "Mockery\\": "library/Mockery"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Pádraic Brady",
+                    "email": "padraic.brady@gmail.com",
+                    "homepage": "https://github.com/padraic",
+                    "role": "Author"
+                },
+                {
+                    "name": "Dave Marshall",
+                    "email": "dave.marshall@atstsolutions.co.uk",
+                    "homepage": "https://davedevelopment.co.uk",
+                    "role": "Developer"
+                },
+                {
+                    "name": "Nathanael Esayeas",
+                    "email": "nathanael.esayeas@protonmail.com",
+                    "homepage": "https://github.com/ghostwriter",
+                    "role": "Lead Developer"
+                }
+            ],
+            "description": "Mockery is a simple yet flexible PHP mock object framework",
+            "homepage": "https://github.com/mockery/mockery",
+            "keywords": [
+                "BDD",
+                "TDD",
+                "library",
+                "mock",
+                "mock objects",
+                "mockery",
+                "stub",
+                "test",
+                "test double",
+                "testing"
+            ],
+            "support": {
+                "docs": "https://docs.mockery.io/",
+                "issues": "https://github.com/mockery/mockery/issues",
+                "rss": "https://github.com/mockery/mockery/releases.atom",
+                "security": "https://github.com/mockery/mockery/security/advisories",
+                "source": "https://github.com/mockery/mockery"
+            },
+            "time": "2024-05-16T03:13:13+00:00"
+        },
+        {
+            "name": "myclabs/deep-copy",
+            "version": "1.13.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/myclabs/DeepCopy.git",
+                "reference": "07d290f0c47959fd5eed98c95ee5602db07e0b6a"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/myclabs/DeepCopy/zipball/07d290f0c47959fd5eed98c95ee5602db07e0b6a",
+                "reference": "07d290f0c47959fd5eed98c95ee5602db07e0b6a",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.1 || ^8.0"
+            },
+            "conflict": {
+                "doctrine/collections": "<1.6.8",
+                "doctrine/common": "<2.13.3 || >=3 <3.2.2"
+            },
+            "require-dev": {
+                "doctrine/collections": "^1.6.8",
+                "doctrine/common": "^2.13.3 || ^3.2.2",
+                "phpspec/prophecy": "^1.10",
+                "phpunit/phpunit": "^7.5.20 || ^8.5.23 || ^9.5.13"
+            },
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "src/DeepCopy/deep_copy.php"
+                ],
+                "psr-4": {
+                    "DeepCopy\\": "src/DeepCopy/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "Create deep copies (clones) of your objects",
+            "keywords": [
+                "clone",
+                "copy",
+                "duplicate",
+                "object",
+                "object graph"
+            ],
+            "support": {
+                "issues": "https://github.com/myclabs/DeepCopy/issues",
+                "source": "https://github.com/myclabs/DeepCopy/tree/1.13.4"
+            },
+            "funding": [
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/myclabs/deep-copy",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-08-01T08:46:24+00:00"
+        },
+        {
+            "name": "nunomaduro/collision",
+            "version": "v8.9.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/nunomaduro/collision.git",
+                "reference": "a1ed3fa530fd60bc515f9303e8520fcb7d4bd935"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/nunomaduro/collision/zipball/a1ed3fa530fd60bc515f9303e8520fcb7d4bd935",
+                "reference": "a1ed3fa530fd60bc515f9303e8520fcb7d4bd935",
+                "shasum": ""
+            },
+            "require": {
+                "filp/whoops": "^2.18.4",
+                "nunomaduro/termwind": "^2.4.0",
+                "php": "^8.2.0",
+                "symfony/console": "^7.4.4 || ^8.0.4"
+            },
+            "conflict": {
+                "laravel/framework": "<11.48.0 || >=14.0.0",
+                "phpunit/phpunit": "<11.5.50 || >=14.0.0"
+            },
+            "require-dev": {
+                "brianium/paratest": "^7.8.5",
+                "larastan/larastan": "^3.9.2",
+                "laravel/framework": "^11.48.0 || ^12.52.0",
+                "laravel/pint": "^1.27.1",
+                "orchestra/testbench-core": "^9.12.0 || ^10.9.0",
+                "pestphp/pest": "^3.8.5 || ^4.4.1 || ^5.0.0",
+                "sebastian/environment": "^7.2.1 || ^8.0.3 || ^9.0.0"
+            },
+            "type": "library",
+            "extra": {
+                "laravel": {
+                    "providers": [
+                        "NunoMaduro\\Collision\\Adapters\\Laravel\\CollisionServiceProvider"
+                    ]
+                },
+                "branch-alias": {
+                    "dev-8.x": "8.x-dev"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "./src/Adapters/Phpunit/Autoload.php"
+                ],
+                "psr-4": {
+                    "NunoMaduro\\Collision\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Nuno Maduro",
+                    "email": "enunomaduro@gmail.com"
+                }
+            ],
+            "description": "Cli error handling for console/command-line PHP applications.",
+            "keywords": [
+                "artisan",
+                "cli",
+                "command-line",
+                "console",
+                "dev",
+                "error",
+                "handling",
+                "laravel",
+                "laravel-zero",
+                "php",
+                "symfony"
+            ],
+            "support": {
+                "issues": "https://github.com/nunomaduro/collision/issues",
+                "source": "https://github.com/nunomaduro/collision"
+            },
+            "funding": [
+                {
+                    "url": "https://www.paypal.com/paypalme/enunomaduro",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/nunomaduro",
+                    "type": "github"
+                },
+                {
+                    "url": "https://www.patreon.com/nunomaduro",
+                    "type": "patreon"
+                }
+            ],
+            "time": "2026-02-17T17:33:08+00:00"
+        },
+        {
+            "name": "phar-io/manifest",
+            "version": "2.0.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phar-io/manifest.git",
+                "reference": "54750ef60c58e43759730615a392c31c80e23176"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phar-io/manifest/zipball/54750ef60c58e43759730615a392c31c80e23176",
+                "reference": "54750ef60c58e43759730615a392c31c80e23176",
+                "shasum": ""
+            },
+            "require": {
+                "ext-dom": "*",
+                "ext-libxml": "*",
+                "ext-phar": "*",
+                "ext-xmlwriter": "*",
+                "phar-io/version": "^3.0.1",
+                "php": "^7.2 || ^8.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0.x-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Arne Blankerts",
+                    "email": "arne@blankerts.de",
+                    "role": "Developer"
+                },
+                {
+                    "name": "Sebastian Heuer",
+                    "email": "sebastian@phpeople.de",
+                    "role": "Developer"
+                },
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "Developer"
+                }
+            ],
+            "description": "Component for reading phar.io manifest information from a PHP Archive (PHAR)",
+            "support": {
+                "issues": "https://github.com/phar-io/manifest/issues",
+                "source": "https://github.com/phar-io/manifest/tree/2.0.4"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/theseer",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-03-03T12:33:53+00:00"
+        },
+        {
+            "name": "phar-io/version",
+            "version": "3.2.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phar-io/version.git",
+                "reference": "4f7fd7836c6f332bb2933569e566a0d6c4cbed74"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phar-io/version/zipball/4f7fd7836c6f332bb2933569e566a0d6c4cbed74",
+                "reference": "4f7fd7836c6f332bb2933569e566a0d6c4cbed74",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2 || ^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Arne Blankerts",
+                    "email": "arne@blankerts.de",
+                    "role": "Developer"
+                },
+                {
+                    "name": "Sebastian Heuer",
+                    "email": "sebastian@phpeople.de",
+                    "role": "Developer"
+                },
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "Developer"
+                }
+            ],
+            "description": "Library for handling version information and constraints",
+            "support": {
+                "issues": "https://github.com/phar-io/version/issues",
+                "source": "https://github.com/phar-io/version/tree/3.2.1"
+            },
+            "time": "2022-02-21T01:04:05+00:00"
+        },
+        {
+            "name": "phpunit/php-code-coverage",
+            "version": "11.0.12",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-code-coverage.git",
+                "reference": "2c1ed04922802c15e1de5d7447b4856de949cf56"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-code-coverage/zipball/2c1ed04922802c15e1de5d7447b4856de949cf56",
+                "reference": "2c1ed04922802c15e1de5d7447b4856de949cf56",
+                "shasum": ""
+            },
+            "require": {
+                "ext-dom": "*",
+                "ext-libxml": "*",
+                "ext-xmlwriter": "*",
+                "nikic/php-parser": "^5.7.0",
+                "php": ">=8.2",
+                "phpunit/php-file-iterator": "^5.1.0",
+                "phpunit/php-text-template": "^4.0.1",
+                "sebastian/code-unit-reverse-lookup": "^4.0.1",
+                "sebastian/complexity": "^4.0.1",
+                "sebastian/environment": "^7.2.1",
+                "sebastian/lines-of-code": "^3.0.1",
+                "sebastian/version": "^5.0.2",
+                "theseer/tokenizer": "^1.3.1"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.5.46"
+            },
+            "suggest": {
+                "ext-pcov": "PHP extension that provides line coverage",
+                "ext-xdebug": "PHP extension that provides line coverage as well as branch and path coverage"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "11.0.x-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library that provides collection, processing, and rendering functionality for PHP code coverage information.",
+            "homepage": "https://github.com/sebastianbergmann/php-code-coverage",
+            "keywords": [
+                "coverage",
+                "testing",
+                "xunit"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/php-code-coverage/issues",
+                "security": "https://github.com/sebastianbergmann/php-code-coverage/security/policy",
+                "source": "https://github.com/sebastianbergmann/php-code-coverage/tree/11.0.12"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                },
+                {
+                    "url": "https://liberapay.com/sebastianbergmann",
+                    "type": "liberapay"
+                },
+                {
+                    "url": "https://thanks.dev/u/gh/sebastianbergmann",
+                    "type": "thanks_dev"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/phpunit/php-code-coverage",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-12-24T07:01:01+00:00"
+        },
+        {
+            "name": "phpunit/php-file-iterator",
+            "version": "5.1.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-file-iterator.git",
+                "reference": "2f3a64888c814fc235386b7387dd5b5ed92ad903"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-file-iterator/zipball/2f3a64888c814fc235386b7387dd5b5ed92ad903",
+                "reference": "2f3a64888c814fc235386b7387dd5b5ed92ad903",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "5.1-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "FilterIterator implementation that filters files based on a list of suffixes.",
+            "homepage": "https://github.com/sebastianbergmann/php-file-iterator/",
+            "keywords": [
+                "filesystem",
+                "iterator"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/php-file-iterator/issues",
+                "security": "https://github.com/sebastianbergmann/php-file-iterator/security/policy",
+                "source": "https://github.com/sebastianbergmann/php-file-iterator/tree/5.1.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                },
+                {
+                    "url": "https://liberapay.com/sebastianbergmann",
+                    "type": "liberapay"
+                },
+                {
+                    "url": "https://thanks.dev/u/gh/sebastianbergmann",
+                    "type": "thanks_dev"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/phpunit/php-file-iterator",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-02-02T13:52:54+00:00"
+        },
+        {
+            "name": "phpunit/php-invoker",
+            "version": "5.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-invoker.git",
+                "reference": "c1ca3814734c07492b3d4c5f794f4b0995333da2"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-invoker/zipball/c1ca3814734c07492b3d4c5f794f4b0995333da2",
+                "reference": "c1ca3814734c07492b3d4c5f794f4b0995333da2",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "ext-pcntl": "*",
+                "phpunit/phpunit": "^11.0"
+            },
+            "suggest": {
+                "ext-pcntl": "*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "5.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Invoke callables with a timeout",
+            "homepage": "https://github.com/sebastianbergmann/php-invoker/",
+            "keywords": [
+                "process"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/php-invoker/issues",
+                "security": "https://github.com/sebastianbergmann/php-invoker/security/policy",
+                "source": "https://github.com/sebastianbergmann/php-invoker/tree/5.0.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-07-03T05:07:44+00:00"
+        },
+        {
+            "name": "phpunit/php-text-template",
+            "version": "4.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-text-template.git",
+                "reference": "3e0404dc6b300e6bf56415467ebcb3fe4f33e964"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-text-template/zipball/3e0404dc6b300e6bf56415467ebcb3fe4f33e964",
+                "reference": "3e0404dc6b300e6bf56415467ebcb3fe4f33e964",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "4.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Simple template engine.",
+            "homepage": "https://github.com/sebastianbergmann/php-text-template/",
+            "keywords": [
+                "template"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/php-text-template/issues",
+                "security": "https://github.com/sebastianbergmann/php-text-template/security/policy",
+                "source": "https://github.com/sebastianbergmann/php-text-template/tree/4.0.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-07-03T05:08:43+00:00"
+        },
+        {
+            "name": "phpunit/php-timer",
+            "version": "7.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-timer.git",
+                "reference": "3b415def83fbcb41f991d9ebf16ae4ad8b7837b3"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-timer/zipball/3b415def83fbcb41f991d9ebf16ae4ad8b7837b3",
+                "reference": "3b415def83fbcb41f991d9ebf16ae4ad8b7837b3",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "7.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Utility class for timing",
+            "homepage": "https://github.com/sebastianbergmann/php-timer/",
+            "keywords": [
+                "timer"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/php-timer/issues",
+                "security": "https://github.com/sebastianbergmann/php-timer/security/policy",
+                "source": "https://github.com/sebastianbergmann/php-timer/tree/7.0.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-07-03T05:09:35+00:00"
+        },
+        {
+            "name": "phpunit/phpunit",
+            "version": "11.5.55",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/phpunit.git",
+                "reference": "adc7262fccc12de2b30f12a8aa0b33775d814f00"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/phpunit/zipball/adc7262fccc12de2b30f12a8aa0b33775d814f00",
+                "reference": "adc7262fccc12de2b30f12a8aa0b33775d814f00",
+                "shasum": ""
+            },
+            "require": {
+                "ext-dom": "*",
+                "ext-json": "*",
+                "ext-libxml": "*",
+                "ext-mbstring": "*",
+                "ext-xml": "*",
+                "ext-xmlwriter": "*",
+                "myclabs/deep-copy": "^1.13.4",
+                "phar-io/manifest": "^2.0.4",
+                "phar-io/version": "^3.2.1",
+                "php": ">=8.2",
+                "phpunit/php-code-coverage": "^11.0.12",
+                "phpunit/php-file-iterator": "^5.1.1",
+                "phpunit/php-invoker": "^5.0.1",
+                "phpunit/php-text-template": "^4.0.1",
+                "phpunit/php-timer": "^7.0.1",
+                "sebastian/cli-parser": "^3.0.2",
+                "sebastian/code-unit": "^3.0.3",
+                "sebastian/comparator": "^6.3.3",
+                "sebastian/diff": "^6.0.2",
+                "sebastian/environment": "^7.2.1",
+                "sebastian/exporter": "^6.3.2",
+                "sebastian/global-state": "^7.0.2",
+                "sebastian/object-enumerator": "^6.0.1",
+                "sebastian/recursion-context": "^6.0.3",
+                "sebastian/type": "^5.1.3",
+                "sebastian/version": "^5.0.2",
+                "staabm/side-effects-detector": "^1.0.5"
+            },
+            "suggest": {
+                "ext-soap": "To be able to generate mocks based on WSDL files"
+            },
+            "bin": [
+                "phpunit"
+            ],
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "11.5-dev"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "src/Framework/Assert/Functions.php"
+                ],
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "The PHP Unit Testing framework.",
+            "homepage": "https://phpunit.de/",
+            "keywords": [
+                "phpunit",
+                "testing",
+                "xunit"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/phpunit/issues",
+                "security": "https://github.com/sebastianbergmann/phpunit/security/policy",
+                "source": "https://github.com/sebastianbergmann/phpunit/tree/11.5.55"
+            },
+            "funding": [
+                {
+                    "url": "https://phpunit.de/sponsors.html",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                },
+                {
+                    "url": "https://liberapay.com/sebastianbergmann",
+                    "type": "liberapay"
+                },
+                {
+                    "url": "https://thanks.dev/u/gh/sebastianbergmann",
+                    "type": "thanks_dev"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/phpunit/phpunit",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-02-18T12:37:06+00:00"
+        },
+        {
+            "name": "sebastian/cli-parser",
+            "version": "3.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/cli-parser.git",
+                "reference": "15c5dd40dc4f38794d383bb95465193f5e0ae180"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/cli-parser/zipball/15c5dd40dc4f38794d383bb95465193f5e0ae180",
+                "reference": "15c5dd40dc4f38794d383bb95465193f5e0ae180",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library for parsing CLI options",
+            "homepage": "https://github.com/sebastianbergmann/cli-parser",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/cli-parser/issues",
+                "security": "https://github.com/sebastianbergmann/cli-parser/security/policy",
+                "source": "https://github.com/sebastianbergmann/cli-parser/tree/3.0.2"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-07-03T04:41:36+00:00"
+        },
+        {
+            "name": "sebastian/code-unit",
+            "version": "3.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/code-unit.git",
+                "reference": "54391c61e4af8078e5b276ab082b6d3c54c9ad64"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/code-unit/zipball/54391c61e4af8078e5b276ab082b6d3c54c9ad64",
+                "reference": "54391c61e4af8078e5b276ab082b6d3c54c9ad64",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.5"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Collection of value objects that represent the PHP code units",
+            "homepage": "https://github.com/sebastianbergmann/code-unit",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/code-unit/issues",
+                "security": "https://github.com/sebastianbergmann/code-unit/security/policy",
+                "source": "https://github.com/sebastianbergmann/code-unit/tree/3.0.3"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2025-03-19T07:56:08+00:00"
+        },
+        {
+            "name": "sebastian/code-unit-reverse-lookup",
+            "version": "4.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/code-unit-reverse-lookup.git",
+                "reference": "183a9b2632194febd219bb9246eee421dad8d45e"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/code-unit-reverse-lookup/zipball/183a9b2632194febd219bb9246eee421dad8d45e",
+                "reference": "183a9b2632194febd219bb9246eee421dad8d45e",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "4.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Looks up which function or method a line of code belongs to",
+            "homepage": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/issues",
+                "security": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/security/policy",
+                "source": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/tree/4.0.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-07-03T04:45:54+00:00"
+        },
+        {
+            "name": "sebastian/comparator",
+            "version": "6.3.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/comparator.git",
+                "reference": "2c95e1e86cb8dd41beb8d502057d1081ccc8eca9"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/comparator/zipball/2c95e1e86cb8dd41beb8d502057d1081ccc8eca9",
+                "reference": "2c95e1e86cb8dd41beb8d502057d1081ccc8eca9",
+                "shasum": ""
+            },
+            "require": {
+                "ext-dom": "*",
+                "ext-mbstring": "*",
+                "php": ">=8.2",
+                "sebastian/diff": "^6.0",
+                "sebastian/exporter": "^6.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.4"
+            },
+            "suggest": {
+                "ext-bcmath": "For comparing BcMath\\Number objects"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "6.3-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                },
+                {
+                    "name": "Jeff Welch",
+                    "email": "whatthejeff@gmail.com"
+                },
+                {
+                    "name": "Volker Dusch",
+                    "email": "github@wallbash.com"
+                },
+                {
+                    "name": "Bernhard Schussek",
+                    "email": "bschussek@2bepublished.at"
+                }
+            ],
+            "description": "Provides the functionality to compare PHP values for equality",
+            "homepage": "https://github.com/sebastianbergmann/comparator",
+            "keywords": [
+                "comparator",
+                "compare",
+                "equality"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/comparator/issues",
+                "security": "https://github.com/sebastianbergmann/comparator/security/policy",
+                "source": "https://github.com/sebastianbergmann/comparator/tree/6.3.3"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                },
+                {
+                    "url": "https://liberapay.com/sebastianbergmann",
+                    "type": "liberapay"
+                },
+                {
+                    "url": "https://thanks.dev/u/gh/sebastianbergmann",
+                    "type": "thanks_dev"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/sebastian/comparator",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-01-24T09:26:40+00:00"
+        },
+        {
+            "name": "sebastian/complexity",
+            "version": "4.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/complexity.git",
+                "reference": "ee41d384ab1906c68852636b6de493846e13e5a0"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/complexity/zipball/ee41d384ab1906c68852636b6de493846e13e5a0",
+                "reference": "ee41d384ab1906c68852636b6de493846e13e5a0",
+                "shasum": ""
+            },
+            "require": {
+                "nikic/php-parser": "^5.0",
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "4.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library for calculating the complexity of PHP code units",
+            "homepage": "https://github.com/sebastianbergmann/complexity",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/complexity/issues",
+                "security": "https://github.com/sebastianbergmann/complexity/security/policy",
+                "source": "https://github.com/sebastianbergmann/complexity/tree/4.0.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-07-03T04:49:50+00:00"
+        },
+        {
+            "name": "sebastian/diff",
+            "version": "6.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/diff.git",
+                "reference": "b4ccd857127db5d41a5b676f24b51371d76d8544"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/diff/zipball/b4ccd857127db5d41a5b676f24b51371d76d8544",
+                "reference": "b4ccd857127db5d41a5b676f24b51371d76d8544",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.0",
+                "symfony/process": "^4.2 || ^5"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "6.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                },
+                {
+                    "name": "Kore Nordmann",
+                    "email": "mail@kore-nordmann.de"
+                }
+            ],
+            "description": "Diff implementation",
+            "homepage": "https://github.com/sebastianbergmann/diff",
+            "keywords": [
+                "diff",
+                "udiff",
+                "unidiff",
+                "unified diff"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/diff/issues",
+                "security": "https://github.com/sebastianbergmann/diff/security/policy",
+                "source": "https://github.com/sebastianbergmann/diff/tree/6.0.2"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-07-03T04:53:05+00:00"
+        },
+        {
+            "name": "sebastian/environment",
+            "version": "7.2.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/environment.git",
+                "reference": "a5c75038693ad2e8d4b6c15ba2403532647830c4"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/environment/zipball/a5c75038693ad2e8d4b6c15ba2403532647830c4",
+                "reference": "a5c75038693ad2e8d4b6c15ba2403532647830c4",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.3"
+            },
+            "suggest": {
+                "ext-posix": "*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "7.2-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Provides functionality to handle HHVM/PHP environments",
+            "homepage": "https://github.com/sebastianbergmann/environment",
+            "keywords": [
+                "Xdebug",
+                "environment",
+                "hhvm"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/environment/issues",
+                "security": "https://github.com/sebastianbergmann/environment/security/policy",
+                "source": "https://github.com/sebastianbergmann/environment/tree/7.2.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                },
+                {
+                    "url": "https://liberapay.com/sebastianbergmann",
+                    "type": "liberapay"
+                },
+                {
+                    "url": "https://thanks.dev/u/gh/sebastianbergmann",
+                    "type": "thanks_dev"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/sebastian/environment",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-05-21T11:55:47+00:00"
+        },
+        {
+            "name": "sebastian/exporter",
+            "version": "6.3.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/exporter.git",
+                "reference": "70a298763b40b213ec087c51c739efcaa90bcd74"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/exporter/zipball/70a298763b40b213ec087c51c739efcaa90bcd74",
+                "reference": "70a298763b40b213ec087c51c739efcaa90bcd74",
+                "shasum": ""
+            },
+            "require": {
+                "ext-mbstring": "*",
+                "php": ">=8.2",
+                "sebastian/recursion-context": "^6.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "6.3-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                },
+                {
+                    "name": "Jeff Welch",
+                    "email": "whatthejeff@gmail.com"
+                },
+                {
+                    "name": "Volker Dusch",
+                    "email": "github@wallbash.com"
+                },
+                {
+                    "name": "Adam Harvey",
+                    "email": "aharvey@php.net"
+                },
+                {
+                    "name": "Bernhard Schussek",
+                    "email": "bschussek@gmail.com"
+                }
+            ],
+            "description": "Provides the functionality to export PHP variables for visualization",
+            "homepage": "https://www.github.com/sebastianbergmann/exporter",
+            "keywords": [
+                "export",
+                "exporter"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/exporter/issues",
+                "security": "https://github.com/sebastianbergmann/exporter/security/policy",
+                "source": "https://github.com/sebastianbergmann/exporter/tree/6.3.2"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                },
+                {
+                    "url": "https://liberapay.com/sebastianbergmann",
+                    "type": "liberapay"
+                },
+                {
+                    "url": "https://thanks.dev/u/gh/sebastianbergmann",
+                    "type": "thanks_dev"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/sebastian/exporter",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-09-24T06:12:51+00:00"
+        },
+        {
+            "name": "sebastian/global-state",
+            "version": "7.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/global-state.git",
+                "reference": "3be331570a721f9a4b5917f4209773de17f747d7"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/global-state/zipball/3be331570a721f9a4b5917f4209773de17f747d7",
+                "reference": "3be331570a721f9a4b5917f4209773de17f747d7",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "sebastian/object-reflector": "^4.0",
+                "sebastian/recursion-context": "^6.0"
+            },
+            "require-dev": {
+                "ext-dom": "*",
+                "phpunit/phpunit": "^11.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "7.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Snapshotting of global state",
+            "homepage": "https://www.github.com/sebastianbergmann/global-state",
+            "keywords": [
+                "global state"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/global-state/issues",
+                "security": "https://github.com/sebastianbergmann/global-state/security/policy",
+                "source": "https://github.com/sebastianbergmann/global-state/tree/7.0.2"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-07-03T04:57:36+00:00"
+        },
+        {
+            "name": "sebastian/lines-of-code",
+            "version": "3.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/lines-of-code.git",
+                "reference": "d36ad0d782e5756913e42ad87cb2890f4ffe467a"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/lines-of-code/zipball/d36ad0d782e5756913e42ad87cb2890f4ffe467a",
+                "reference": "d36ad0d782e5756913e42ad87cb2890f4ffe467a",
+                "shasum": ""
+            },
+            "require": {
+                "nikic/php-parser": "^5.0",
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library for counting the lines of code in PHP source code",
+            "homepage": "https://github.com/sebastianbergmann/lines-of-code",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/lines-of-code/issues",
+                "security": "https://github.com/sebastianbergmann/lines-of-code/security/policy",
+                "source": "https://github.com/sebastianbergmann/lines-of-code/tree/3.0.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-07-03T04:58:38+00:00"
+        },
+        {
+            "name": "sebastian/object-enumerator",
+            "version": "6.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/object-enumerator.git",
+                "reference": "f5b498e631a74204185071eb41f33f38d64608aa"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/object-enumerator/zipball/f5b498e631a74204185071eb41f33f38d64608aa",
+                "reference": "f5b498e631a74204185071eb41f33f38d64608aa",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "sebastian/object-reflector": "^4.0",
+                "sebastian/recursion-context": "^6.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "6.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Traverses array structures and object graphs to enumerate all referenced objects",
+            "homepage": "https://github.com/sebastianbergmann/object-enumerator/",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/object-enumerator/issues",
+                "security": "https://github.com/sebastianbergmann/object-enumerator/security/policy",
+                "source": "https://github.com/sebastianbergmann/object-enumerator/tree/6.0.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-07-03T05:00:13+00:00"
+        },
+        {
+            "name": "sebastian/object-reflector",
+            "version": "4.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/object-reflector.git",
+                "reference": "6e1a43b411b2ad34146dee7524cb13a068bb35f9"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/object-reflector/zipball/6e1a43b411b2ad34146dee7524cb13a068bb35f9",
+                "reference": "6e1a43b411b2ad34146dee7524cb13a068bb35f9",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "4.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Allows reflection of object attributes, including inherited and non-public ones",
+            "homepage": "https://github.com/sebastianbergmann/object-reflector/",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/object-reflector/issues",
+                "security": "https://github.com/sebastianbergmann/object-reflector/security/policy",
+                "source": "https://github.com/sebastianbergmann/object-reflector/tree/4.0.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-07-03T05:01:32+00:00"
+        },
+        {
+            "name": "sebastian/recursion-context",
+            "version": "6.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/recursion-context.git",
+                "reference": "f6458abbf32a6c8174f8f26261475dc133b3d9dc"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/recursion-context/zipball/f6458abbf32a6c8174f8f26261475dc133b3d9dc",
+                "reference": "f6458abbf32a6c8174f8f26261475dc133b3d9dc",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "6.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                },
+                {
+                    "name": "Jeff Welch",
+                    "email": "whatthejeff@gmail.com"
+                },
+                {
+                    "name": "Adam Harvey",
+                    "email": "aharvey@php.net"
+                }
+            ],
+            "description": "Provides functionality to recursively process PHP variables",
+            "homepage": "https://github.com/sebastianbergmann/recursion-context",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/recursion-context/issues",
+                "security": "https://github.com/sebastianbergmann/recursion-context/security/policy",
+                "source": "https://github.com/sebastianbergmann/recursion-context/tree/6.0.3"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                },
+                {
+                    "url": "https://liberapay.com/sebastianbergmann",
+                    "type": "liberapay"
+                },
+                {
+                    "url": "https://thanks.dev/u/gh/sebastianbergmann",
+                    "type": "thanks_dev"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/sebastian/recursion-context",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-08-13T04:42:22+00:00"
+        },
+        {
+            "name": "sebastian/type",
+            "version": "5.1.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/type.git",
+                "reference": "f77d2d4e78738c98d9a68d2596fe5e8fa380f449"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/type/zipball/f77d2d4e78738c98d9a68d2596fe5e8fa380f449",
+                "reference": "f77d2d4e78738c98d9a68d2596fe5e8fa380f449",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^11.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "5.1-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Collection of value objects that represent the types of the PHP type system",
+            "homepage": "https://github.com/sebastianbergmann/type",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/type/issues",
+                "security": "https://github.com/sebastianbergmann/type/security/policy",
+                "source": "https://github.com/sebastianbergmann/type/tree/5.1.3"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                },
+                {
+                    "url": "https://liberapay.com/sebastianbergmann",
+                    "type": "liberapay"
+                },
+                {
+                    "url": "https://thanks.dev/u/gh/sebastianbergmann",
+                    "type": "thanks_dev"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/sebastian/type",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2025-08-09T06:55:48+00:00"
+        },
+        {
+            "name": "sebastian/version",
+            "version": "5.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/version.git",
+                "reference": "c687e3387b99f5b03b6caa64c74b63e2936ff874"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/version/zipball/c687e3387b99f5b03b6caa64c74b63e2936ff874",
+                "reference": "c687e3387b99f5b03b6caa64c74b63e2936ff874",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "5.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library that helps with managing the version number of Git-hosted PHP projects",
+            "homepage": "https://github.com/sebastianbergmann/version",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/version/issues",
+                "security": "https://github.com/sebastianbergmann/version/security/policy",
+                "source": "https://github.com/sebastianbergmann/version/tree/5.0.2"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-10-09T05:16:32+00:00"
+        },
+        {
+            "name": "staabm/side-effects-detector",
+            "version": "1.0.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/staabm/side-effects-detector.git",
+                "reference": "d8334211a140ce329c13726d4a715adbddd0a163"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/staabm/side-effects-detector/zipball/d8334211a140ce329c13726d4a715adbddd0a163",
+                "reference": "d8334211a140ce329c13726d4a715adbddd0a163",
+                "shasum": ""
+            },
+            "require": {
+                "ext-tokenizer": "*",
+                "php": "^7.4 || ^8.0"
+            },
+            "require-dev": {
+                "phpstan/extension-installer": "^1.4.3",
+                "phpstan/phpstan": "^1.12.6",
+                "phpunit/phpunit": "^9.6.21",
+                "symfony/var-dumper": "^5.4.43",
+                "tomasvotruba/type-coverage": "1.0.0",
+                "tomasvotruba/unused-public": "1.0.0"
+            },
+            "type": "library",
+            "autoload": {
+                "classmap": [
+                    "lib/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "A static analysis tool to detect side effects in PHP code",
+            "keywords": [
+                "static analysis"
+            ],
+            "support": {
+                "issues": "https://github.com/staabm/side-effects-detector/issues",
+                "source": "https://github.com/staabm/side-effects-detector/tree/1.0.5"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/staabm",
+                    "type": "github"
+                }
+            ],
+            "time": "2024-10-20T05:08:20+00:00"
+        },
+        {
+            "name": "symfony/yaml",
+            "version": "v7.4.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/yaml.git",
+                "reference": "58751048de17bae71c5aa0d13cb19d79bca26391"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/yaml/zipball/58751048de17bae71c5aa0d13cb19d79bca26391",
+                "reference": "58751048de17bae71c5aa0d13cb19d79bca26391",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.2",
+                "symfony/deprecation-contracts": "^2.5|^3",
+                "symfony/polyfill-ctype": "^1.8"
+            },
+            "conflict": {
+                "symfony/console": "<6.4"
+            },
+            "require-dev": {
+                "symfony/console": "^6.4|^7.0|^8.0"
+            },
+            "bin": [
+                "Resources/bin/yaml-lint"
+            ],
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Symfony\\Component\\Yaml\\": ""
+                },
+                "exclude-from-classmap": [
+                    "/Tests/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Fabien Potencier",
+                    "email": "fabien@symfony.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Loads and dumps YAML files",
+            "homepage": "https://symfony.com",
+            "support": {
+                "source": "https://github.com/symfony/yaml/tree/v7.4.6"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/nicolas-grekas",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2026-02-09T09:33:46+00:00"
+        },
+        {
+            "name": "theseer/tokenizer",
+            "version": "1.3.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/theseer/tokenizer.git",
+                "reference": "b7489ce515e168639d17feec34b8847c326b0b3c"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/theseer/tokenizer/zipball/b7489ce515e168639d17feec34b8847c326b0b3c",
+                "reference": "b7489ce515e168639d17feec34b8847c326b0b3c",
+                "shasum": ""
+            },
+            "require": {
+                "ext-dom": "*",
+                "ext-tokenizer": "*",
+                "ext-xmlwriter": "*",
+                "php": "^7.2 || ^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Arne Blankerts",
+                    "email": "arne@blankerts.de",
+                    "role": "Developer"
+                }
+            ],
+            "description": "A small library for converting tokenized PHP source code into XML and potentially other formats",
+            "support": {
+                "issues": "https://github.com/theseer/tokenizer/issues",
+                "source": "https://github.com/theseer/tokenizer/tree/1.3.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/theseer",
+                    "type": "github"
+                }
+            ],
+            "time": "2025-11-17T20:03:58+00:00"
+        }
+    ],
+    "aliases": [],
+    "minimum-stability": "stable",
+    "stability-flags": {},
+    "prefer-stable": true,
+    "prefer-lowest": false,
+    "platform": {
+        "php": "^8.2"
+    },
+    "platform-dev": {},
+    "plugin-api-version": "2.9.0"
+}
diff --git a/composer.phar b/composer.phar
new file mode 100644
index 0000000..3d1b983
Binary files /dev/null and b/composer.phar differ
diff --git a/config/app.php b/config/app.php
new file mode 100644
index 0000000..423eed5
--- /dev/null
+++ b/config/app.php
@@ -0,0 +1,126 @@
+<?php
+
+return [
+
+    /*
+    |--------------------------------------------------------------------------
+    | Application Name
+    |--------------------------------------------------------------------------
+    |
+    | This value is the name of your application, which will be used when the
+    | framework needs to place the application's name in a notification or
+    | other UI elements where an application name needs to be displayed.
+    |
+    */
+
+    'name' => env('APP_NAME', 'Laravel'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Application Environment
+    |--------------------------------------------------------------------------
+    |
+    | This value determines the "environment" your application is currently
+    | running in. This may determine how you prefer to configure various
+    | services the application utilizes. Set this in your ".env" file.
+    |
+    */
+
+    'env' => env('APP_ENV', 'production'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Application Debug Mode
+    |--------------------------------------------------------------------------
+    |
+    | When your application is in debug mode, detailed error messages with
+    | stack traces will be shown on every error that occurs within your
+    | application. If disabled, a simple generic error page is shown.
+    |
+    */
+
+    'debug' => (bool) env('APP_DEBUG', false),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Application URL
+    |--------------------------------------------------------------------------
+    |
+    | This URL is used by the console to properly generate URLs when using
+    | the Artisan command line tool. You should set this to the root of
+    | the application so that it's available within Artisan commands.
+    |
+    */
+
+    'url' => env('APP_URL', 'http://localhost'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Application Timezone
+    |--------------------------------------------------------------------------
+    |
+    | Here you may specify the default timezone for your application, which
+    | will be used by the PHP date and date-time functions. The timezone
+    | is set to "UTC" by default as it is suitable for most use cases.
+    |
+    */
+
+    'timezone' => 'UTC',
+
+    /*
+    |--------------------------------------------------------------------------
+    | Application Locale Configuration
+    |--------------------------------------------------------------------------
+    |
+    | The application locale determines the default locale that will be used
+    | by Laravel's translation / localization methods. This option can be
+    | set to any locale for which you plan to have translation strings.
+    |
+    */
+
+    'locale' => env('APP_LOCALE', 'en'),
+
+    'fallback_locale' => env('APP_FALLBACK_LOCALE', 'en'),
+
+    'faker_locale' => env('APP_FAKER_LOCALE', 'en_US'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Encryption Key
+    |--------------------------------------------------------------------------
+    |
+    | This key is utilized by Laravel's encryption services and should be set
+    | to a random, 32 character string to ensure that all encrypted values
+    | are secure. You should do this prior to deploying the application.
+    |
+    */
+
+    'cipher' => 'AES-256-CBC',
+
+    'key' => env('APP_KEY'),
+
+    'previous_keys' => [
+        ...array_filter(
+            explode(',', (string) env('APP_PREVIOUS_KEYS', ''))
+        ),
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Maintenance Mode Driver
+    |--------------------------------------------------------------------------
+    |
+    | These configuration options determine the driver used to determine and
+    | manage Laravel's "maintenance mode" status. The "cache" driver will
+    | allow maintenance mode to be controlled across multiple machines.
+    |
+    | Supported drivers: "file", "cache"
+    |
+    */
+
+    'maintenance' => [
+        'driver' => env('APP_MAINTENANCE_DRIVER', 'file'),
+        'store' => env('APP_MAINTENANCE_STORE', 'database'),
+    ],
+
+];
diff --git a/config/auth.php b/config/auth.php
new file mode 100644
index 0000000..d7568ff
--- /dev/null
+++ b/config/auth.php
@@ -0,0 +1,117 @@
+<?php
+
+use App\Models\User;
+
+return [
+
+    /*
+    |--------------------------------------------------------------------------
+    | Authentication Defaults
+    |--------------------------------------------------------------------------
+    |
+    | This option defines the default authentication "guard" and password
+    | reset "broker" for your application. You may change these values
+    | as required, but they're a perfect start for most applications.
+    |
+    */
+
+    'defaults' => [
+        'guard' => env('AUTH_GUARD', 'web'),
+        'passwords' => env('AUTH_PASSWORD_BROKER', 'users'),
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Authentication Guards
+    |--------------------------------------------------------------------------
+    |
+    | Next, you may define every authentication guard for your application.
+    | Of course, a great default configuration has been defined for you
+    | which utilizes session storage plus the Eloquent user provider.
+    |
+    | All authentication guards have a user provider, which defines how the
+    | users are actually retrieved out of your database or other storage
+    | system used by the application. Typically, Eloquent is utilized.
+    |
+    | Supported: "session"
+    |
+    */
+
+    'guards' => [
+        'web' => [
+            'driver' => 'session',
+            'provider' => 'users',
+        ],
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | User Providers
+    |--------------------------------------------------------------------------
+    |
+    | All authentication guards have a user provider, which defines how the
+    | users are actually retrieved out of your database or other storage
+    | system used by the application. Typically, Eloquent is utilized.
+    |
+    | If you have multiple user tables or models you may configure multiple
+    | providers to represent the model / table. These providers may then
+    | be assigned to any extra authentication guards you have defined.
+    |
+    | Supported: "database", "eloquent"
+    |
+    */
+
+    'providers' => [
+        'users' => [
+            'driver' => 'eloquent',
+            'model' => env('AUTH_MODEL', User::class),
+        ],
+
+        // 'users' => [
+        //     'driver' => 'database',
+        //     'table' => 'users',
+        // ],
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Resetting Passwords
+    |--------------------------------------------------------------------------
+    |
+    | These configuration options specify the behavior of Laravel's password
+    | reset functionality, including the table utilized for token storage
+    | and the user provider that is invoked to actually retrieve users.
+    |
+    | The expiry time is the number of minutes that each reset token will be
+    | considered valid. This security feature keeps tokens short-lived so
+    | they have less time to be guessed. You may change this as needed.
+    |
+    | The throttle setting is the number of seconds a user must wait before
+    | generating more password reset tokens. This prevents the user from
+    | quickly generating a very large amount of password reset tokens.
+    |
+    */
+
+    'passwords' => [
+        'users' => [
+            'provider' => 'users',
+            'table' => env('AUTH_PASSWORD_RESET_TOKEN_TABLE', 'password_reset_tokens'),
+            'expire' => 60,
+            'throttle' => 60,
+        ],
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Password Confirmation Timeout
+    |--------------------------------------------------------------------------
+    |
+    | Here you may define the number of seconds before a password confirmation
+    | window expires and users are asked to re-enter their password via the
+    | confirmation screen. By default, the timeout lasts for three hours.
+    |
+    */
+
+    'password_timeout' => env('AUTH_PASSWORD_TIMEOUT', 10800),
+
+];
diff --git a/config/cache.php b/config/cache.php
new file mode 100644
index 0000000..b32aead
--- /dev/null
+++ b/config/cache.php
@@ -0,0 +1,117 @@
+<?php
+
+use Illuminate\Support\Str;
+
+return [
+
+    /*
+    |--------------------------------------------------------------------------
+    | Default Cache Store
+    |--------------------------------------------------------------------------
+    |
+    | This option controls the default cache store that will be used by the
+    | framework. This connection is utilized if another isn't explicitly
+    | specified when running a cache operation inside the application.
+    |
+    */
+
+    'default' => env('CACHE_STORE', 'database'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Cache Stores
+    |--------------------------------------------------------------------------
+    |
+    | Here you may define all of the cache "stores" for your application as
+    | well as their drivers. You may even define multiple stores for the
+    | same cache driver to group types of items stored in your caches.
+    |
+    | Supported drivers: "array", "database", "file", "memcached",
+    |                    "redis", "dynamodb", "octane",
+    |                    "failover", "null"
+    |
+    */
+
+    'stores' => [
+
+        'array' => [
+            'driver' => 'array',
+            'serialize' => false,
+        ],
+
+        'database' => [
+            'driver' => 'database',
+            'connection' => env('DB_CACHE_CONNECTION'),
+            'table' => env('DB_CACHE_TABLE', 'cache'),
+            'lock_connection' => env('DB_CACHE_LOCK_CONNECTION'),
+            'lock_table' => env('DB_CACHE_LOCK_TABLE'),
+        ],
+
+        'file' => [
+            'driver' => 'file',
+            'path' => storage_path('framework/cache/data'),
+            'lock_path' => storage_path('framework/cache/data'),
+        ],
+
+        'memcached' => [
+            'driver' => 'memcached',
+            'persistent_id' => env('MEMCACHED_PERSISTENT_ID'),
+            'sasl' => [
+                env('MEMCACHED_USERNAME'),
+                env('MEMCACHED_PASSWORD'),
+            ],
+            'options' => [
+                // Memcached::OPT_CONNECT_TIMEOUT => 2000,
+            ],
+            'servers' => [
+                [
+                    'host' => env('MEMCACHED_HOST', '127.0.0.1'),
+                    'port' => env('MEMCACHED_PORT', 11211),
+                    'weight' => 100,
+                ],
+            ],
+        ],
+
+        'redis' => [
+            'driver' => 'redis',
+            'connection' => env('REDIS_CACHE_CONNECTION', 'cache'),
+            'lock_connection' => env('REDIS_CACHE_LOCK_CONNECTION', 'default'),
+        ],
+
+        'dynamodb' => [
+            'driver' => 'dynamodb',
+            'key' => env('AWS_ACCESS_KEY_ID'),
+            'secret' => env('AWS_SECRET_ACCESS_KEY'),
+            'region' => env('AWS_DEFAULT_REGION', 'us-east-1'),
+            'table' => env('DYNAMODB_CACHE_TABLE', 'cache'),
+            'endpoint' => env('DYNAMODB_ENDPOINT'),
+        ],
+
+        'octane' => [
+            'driver' => 'octane',
+        ],
+
+        'failover' => [
+            'driver' => 'failover',
+            'stores' => [
+                'database',
+                'array',
+            ],
+        ],
+
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Cache Key Prefix
+    |--------------------------------------------------------------------------
+    |
+    | When utilizing the APC, database, memcached, Redis, and DynamoDB cache
+    | stores, there might be other applications using the same cache. For
+    | that reason, you may prefix every cache key to avoid collisions.
+    |
+    */
+
+    'prefix' => env('CACHE_PREFIX', Str::slug((string) env('APP_NAME', 'laravel')).'-cache-'),
+
+];
diff --git a/config/database.php b/config/database.php
new file mode 100644
index 0000000..64709ce
--- /dev/null
+++ b/config/database.php
@@ -0,0 +1,184 @@
+<?php
+
+use Illuminate\Support\Str;
+use Pdo\Mysql;
+
+return [
+
+    /*
+    |--------------------------------------------------------------------------
+    | Default Database Connection Name
+    |--------------------------------------------------------------------------
+    |
+    | Here you may specify which of the database connections below you wish
+    | to use as your default connection for database operations. This is
+    | the connection which will be utilized unless another connection
+    | is explicitly specified when you execute a query / statement.
+    |
+    */
+
+    'default' => env('DB_CONNECTION', 'sqlite'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Database Connections
+    |--------------------------------------------------------------------------
+    |
+    | Below are all of the database connections defined for your application.
+    | An example configuration is provided for each database system which
+    | is supported by Laravel. You're free to add / remove connections.
+    |
+    */
+
+    'connections' => [
+
+        'sqlite' => [
+            'driver' => 'sqlite',
+            'url' => env('DB_URL'),
+            'database' => env('DB_DATABASE', database_path('database.sqlite')),
+            'prefix' => '',
+            'foreign_key_constraints' => env('DB_FOREIGN_KEYS', true),
+            'busy_timeout' => null,
+            'journal_mode' => null,
+            'synchronous' => null,
+            'transaction_mode' => 'DEFERRED',
+        ],
+
+        'mysql' => [
+            'driver' => 'mysql',
+            'url' => env('DB_URL'),
+            'host' => env('DB_HOST', '127.0.0.1'),
+            'port' => env('DB_PORT', '3306'),
+            'database' => env('DB_DATABASE', 'laravel'),
+            'username' => env('DB_USERNAME', 'root'),
+            'password' => env('DB_PASSWORD', ''),
+            'unix_socket' => env('DB_SOCKET', ''),
+            'charset' => env('DB_CHARSET', 'utf8mb4'),
+            'collation' => env('DB_COLLATION', 'utf8mb4_unicode_ci'),
+            'prefix' => '',
+            'prefix_indexes' => true,
+            'strict' => true,
+            'engine' => null,
+            'options' => extension_loaded('pdo_mysql') ? array_filter([
+                (PHP_VERSION_ID >= 80500 ? Mysql::ATTR_SSL_CA : PDO::MYSQL_ATTR_SSL_CA) => env('MYSQL_ATTR_SSL_CA'),
+            ]) : [],
+        ],
+
+        'mariadb' => [
+            'driver' => 'mariadb',
+            'url' => env('DB_URL'),
+            'host' => env('DB_HOST', '127.0.0.1'),
+            'port' => env('DB_PORT', '3306'),
+            'database' => env('DB_DATABASE', 'laravel'),
+            'username' => env('DB_USERNAME', 'root'),
+            'password' => env('DB_PASSWORD', ''),
+            'unix_socket' => env('DB_SOCKET', ''),
+            'charset' => env('DB_CHARSET', 'utf8mb4'),
+            'collation' => env('DB_COLLATION', 'utf8mb4_unicode_ci'),
+            'prefix' => '',
+            'prefix_indexes' => true,
+            'strict' => true,
+            'engine' => null,
+            'options' => extension_loaded('pdo_mysql') ? array_filter([
+                (PHP_VERSION_ID >= 80500 ? Mysql::ATTR_SSL_CA : PDO::MYSQL_ATTR_SSL_CA) => env('MYSQL_ATTR_SSL_CA'),
+            ]) : [],
+        ],
+
+        'pgsql' => [
+            'driver' => 'pgsql',
+            'url' => env('DB_URL'),
+            'host' => env('DB_HOST', '127.0.0.1'),
+            'port' => env('DB_PORT', '5432'),
+            'database' => env('DB_DATABASE', 'laravel'),
+            'username' => env('DB_USERNAME', 'root'),
+            'password' => env('DB_PASSWORD', ''),
+            'charset' => env('DB_CHARSET', 'utf8'),
+            'prefix' => '',
+            'prefix_indexes' => true,
+            'search_path' => 'public',
+            'sslmode' => env('DB_SSLMODE', 'prefer'),
+        ],
+
+        'sqlsrv' => [
+            'driver' => 'sqlsrv',
+            'url' => env('DB_URL'),
+            'host' => env('DB_HOST', 'localhost'),
+            'port' => env('DB_PORT', '1433'),
+            'database' => env('DB_DATABASE', 'laravel'),
+            'username' => env('DB_USERNAME', 'root'),
+            'password' => env('DB_PASSWORD', ''),
+            'charset' => env('DB_CHARSET', 'utf8'),
+            'prefix' => '',
+            'prefix_indexes' => true,
+            // 'encrypt' => env('DB_ENCRYPT', 'yes'),
+            // 'trust_server_certificate' => env('DB_TRUST_SERVER_CERTIFICATE', 'false'),
+        ],
+
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Migration Repository Table
+    |--------------------------------------------------------------------------
+    |
+    | This table keeps track of all the migrations that have already run for
+    | your application. Using this information, we can determine which of
+    | the migrations on disk haven't actually been run on the database.
+    |
+    */
+
+    'migrations' => [
+        'table' => 'migrations',
+        'update_date_on_publish' => true,
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Redis Databases
+    |--------------------------------------------------------------------------
+    |
+    | Redis is an open source, fast, and advanced key-value store that also
+    | provides a richer body of commands than a typical key-value system
+    | such as Memcached. You may define your connection settings here.
+    |
+    */
+
+    'redis' => [
+
+        'client' => env('REDIS_CLIENT', 'phpredis'),
+
+        'options' => [
+            'cluster' => env('REDIS_CLUSTER', 'redis'),
+            'prefix' => env('REDIS_PREFIX', Str::slug((string) env('APP_NAME', 'laravel')).'-database-'),
+            'persistent' => env('REDIS_PERSISTENT', false),
+        ],
+
+        'default' => [
+            'url' => env('REDIS_URL'),
+            'host' => env('REDIS_HOST', '127.0.0.1'),
+            'username' => env('REDIS_USERNAME'),
+            'password' => env('REDIS_PASSWORD'),
+            'port' => env('REDIS_PORT', '6379'),
+            'database' => env('REDIS_DB', '0'),
+            'max_retries' => env('REDIS_MAX_RETRIES', 3),
+            'backoff_algorithm' => env('REDIS_BACKOFF_ALGORITHM', 'decorrelated_jitter'),
+            'backoff_base' => env('REDIS_BACKOFF_BASE', 100),
+            'backoff_cap' => env('REDIS_BACKOFF_CAP', 1000),
+        ],
+
+        'cache' => [
+            'url' => env('REDIS_URL'),
+            'host' => env('REDIS_HOST', '127.0.0.1'),
+            'username' => env('REDIS_USERNAME'),
+            'password' => env('REDIS_PASSWORD'),
+            'port' => env('REDIS_PORT', '6379'),
+            'database' => env('REDIS_CACHE_DB', '1'),
+            'max_retries' => env('REDIS_MAX_RETRIES', 3),
+            'backoff_algorithm' => env('REDIS_BACKOFF_ALGORITHM', 'decorrelated_jitter'),
+            'backoff_base' => env('REDIS_BACKOFF_BASE', 100),
+            'backoff_cap' => env('REDIS_BACKOFF_CAP', 1000),
+        ],
+
+    ],
+
+];
diff --git a/config/filesystems.php b/config/filesystems.php
new file mode 100644
index 0000000..37d8fca
--- /dev/null
+++ b/config/filesystems.php
@@ -0,0 +1,80 @@
+<?php
+
+return [
+
+    /*
+    |--------------------------------------------------------------------------
+    | Default Filesystem Disk
+    |--------------------------------------------------------------------------
+    |
+    | Here you may specify the default filesystem disk that should be used
+    | by the framework. The "local" disk, as well as a variety of cloud
+    | based disks are available to your application for file storage.
+    |
+    */
+
+    'default' => env('FILESYSTEM_DISK', 'local'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Filesystem Disks
+    |--------------------------------------------------------------------------
+    |
+    | Below you may configure as many filesystem disks as necessary, and you
+    | may even configure multiple disks for the same driver. Examples for
+    | most supported storage drivers are configured here for reference.
+    |
+    | Supported drivers: "local", "ftp", "sftp", "s3"
+    |
+    */
+
+    'disks' => [
+
+        'local' => [
+            'driver' => 'local',
+            'root' => storage_path('app/private'),
+            'serve' => true,
+            'throw' => false,
+            'report' => false,
+        ],
+
+        'public' => [
+            'driver' => 'local',
+            'root' => storage_path('app/public'),
+            'url' => rtrim(env('APP_URL', 'http://localhost'), '/').'/storage',
+            'visibility' => 'public',
+            'throw' => false,
+            'report' => false,
+        ],
+
+        's3' => [
+            'driver' => 's3',
+            'key' => env('AWS_ACCESS_KEY_ID'),
+            'secret' => env('AWS_SECRET_ACCESS_KEY'),
+            'region' => env('AWS_DEFAULT_REGION'),
+            'bucket' => env('AWS_BUCKET'),
+            'url' => env('AWS_URL'),
+            'endpoint' => env('AWS_ENDPOINT'),
+            'use_path_style_endpoint' => env('AWS_USE_PATH_STYLE_ENDPOINT', false),
+            'throw' => false,
+            'report' => false,
+        ],
+
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Symbolic Links
+    |--------------------------------------------------------------------------
+    |
+    | Here you may configure the symbolic links that will be created when the
+    | `storage:link` Artisan command is executed. The array keys should be
+    | the locations of the links and the values should be their targets.
+    |
+    */
+
+    'links' => [
+        public_path('storage') => storage_path('app/public'),
+    ],
+
+];
diff --git a/config/logging.php b/config/logging.php
new file mode 100644
index 0000000..b09cb25
--- /dev/null
+++ b/config/logging.php
@@ -0,0 +1,132 @@
+<?php
+
+use Monolog\Handler\NullHandler;
+use Monolog\Handler\StreamHandler;
+use Monolog\Handler\SyslogUdpHandler;
+use Monolog\Processor\PsrLogMessageProcessor;
+
+return [
+
+    /*
+    |--------------------------------------------------------------------------
+    | Default Log Channel
+    |--------------------------------------------------------------------------
+    |
+    | This option defines the default log channel that is utilized to write
+    | messages to your logs. The value provided here should match one of
+    | the channels present in the list of "channels" configured below.
+    |
+    */
+
+    'default' => env('LOG_CHANNEL', 'stack'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Deprecations Log Channel
+    |--------------------------------------------------------------------------
+    |
+    | This option controls the log channel that should be used to log warnings
+    | regarding deprecated PHP and library features. This allows you to get
+    | your application ready for upcoming major versions of dependencies.
+    |
+    */
+
+    'deprecations' => [
+        'channel' => env('LOG_DEPRECATIONS_CHANNEL', 'null'),
+        'trace' => env('LOG_DEPRECATIONS_TRACE', false),
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Log Channels
+    |--------------------------------------------------------------------------
+    |
+    | Here you may configure the log channels for your application. Laravel
+    | utilizes the Monolog PHP logging library, which includes a variety
+    | of powerful log handlers and formatters that you're free to use.
+    |
+    | Available drivers: "single", "daily", "slack", "syslog",
+    |                    "errorlog", "monolog", "custom", "stack"
+    |
+    */
+
+    'channels' => [
+
+        'stack' => [
+            'driver' => 'stack',
+            'channels' => explode(',', (string) env('LOG_STACK', 'single')),
+            'ignore_exceptions' => false,
+        ],
+
+        'single' => [
+            'driver' => 'single',
+            'path' => storage_path('logs/laravel.log'),
+            'level' => env('LOG_LEVEL', 'debug'),
+            'replace_placeholders' => true,
+        ],
+
+        'daily' => [
+            'driver' => 'daily',
+            'path' => storage_path('logs/laravel.log'),
+            'level' => env('LOG_LEVEL', 'debug'),
+            'days' => env('LOG_DAILY_DAYS', 14),
+            'replace_placeholders' => true,
+        ],
+
+        'slack' => [
+            'driver' => 'slack',
+            'url' => env('LOG_SLACK_WEBHOOK_URL'),
+            'username' => env('LOG_SLACK_USERNAME', env('APP_NAME', 'Laravel')),
+            'emoji' => env('LOG_SLACK_EMOJI', ':boom:'),
+            'level' => env('LOG_LEVEL', 'critical'),
+            'replace_placeholders' => true,
+        ],
+
+        'papertrail' => [
+            'driver' => 'monolog',
+            'level' => env('LOG_LEVEL', 'debug'),
+            'handler' => env('LOG_PAPERTRAIL_HANDLER', SyslogUdpHandler::class),
+            'handler_with' => [
+                'host' => env('PAPERTRAIL_URL'),
+                'port' => env('PAPERTRAIL_PORT'),
+                'connectionString' => 'tls://'.env('PAPERTRAIL_URL').':'.env('PAPERTRAIL_PORT'),
+            ],
+            'processors' => [PsrLogMessageProcessor::class],
+        ],
+
+        'stderr' => [
+            'driver' => 'monolog',
+            'level' => env('LOG_LEVEL', 'debug'),
+            'handler' => StreamHandler::class,
+            'handler_with' => [
+                'stream' => 'php://stderr',
+            ],
+            'formatter' => env('LOG_STDERR_FORMATTER'),
+            'processors' => [PsrLogMessageProcessor::class],
+        ],
+
+        'syslog' => [
+            'driver' => 'syslog',
+            'level' => env('LOG_LEVEL', 'debug'),
+            'facility' => env('LOG_SYSLOG_FACILITY', LOG_USER),
+            'replace_placeholders' => true,
+        ],
+
+        'errorlog' => [
+            'driver' => 'errorlog',
+            'level' => env('LOG_LEVEL', 'debug'),
+            'replace_placeholders' => true,
+        ],
+
+        'null' => [
+            'driver' => 'monolog',
+            'handler' => NullHandler::class,
+        ],
+
+        'emergency' => [
+            'path' => storage_path('logs/laravel.log'),
+        ],
+
+    ],
+
+];
diff --git a/config/mail.php b/config/mail.php
new file mode 100644
index 0000000..e32e88d
--- /dev/null
+++ b/config/mail.php
@@ -0,0 +1,118 @@
+<?php
+
+return [
+
+    /*
+    |--------------------------------------------------------------------------
+    | Default Mailer
+    |--------------------------------------------------------------------------
+    |
+    | This option controls the default mailer that is used to send all email
+    | messages unless another mailer is explicitly specified when sending
+    | the message. All additional mailers can be configured within the
+    | "mailers" array. Examples of each type of mailer are provided.
+    |
+    */
+
+    'default' => env('MAIL_MAILER', 'log'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Mailer Configurations
+    |--------------------------------------------------------------------------
+    |
+    | Here you may configure all of the mailers used by your application plus
+    | their respective settings. Several examples have been configured for
+    | you and you are free to add your own as your application requires.
+    |
+    | Laravel supports a variety of mail "transport" drivers that can be used
+    | when delivering an email. You may specify which one you're using for
+    | your mailers below. You may also add additional mailers if needed.
+    |
+    | Supported: "smtp", "sendmail", "mailgun", "ses", "ses-v2",
+    |            "postmark", "resend", "log", "array",
+    |            "failover", "roundrobin"
+    |
+    */
+
+    'mailers' => [
+
+        'smtp' => [
+            'transport' => 'smtp',
+            'scheme' => env('MAIL_SCHEME'),
+            'url' => env('MAIL_URL'),
+            'host' => env('MAIL_HOST', '127.0.0.1'),
+            'port' => env('MAIL_PORT', 2525),
+            'username' => env('MAIL_USERNAME'),
+            'password' => env('MAIL_PASSWORD'),
+            'timeout' => null,
+            'local_domain' => env('MAIL_EHLO_DOMAIN', parse_url((string) env('APP_URL', 'http://localhost'), PHP_URL_HOST)),
+        ],
+
+        'ses' => [
+            'transport' => 'ses',
+        ],
+
+        'postmark' => [
+            'transport' => 'postmark',
+            // 'message_stream_id' => env('POSTMARK_MESSAGE_STREAM_ID'),
+            // 'client' => [
+            //     'timeout' => 5,
+            // ],
+        ],
+
+        'resend' => [
+            'transport' => 'resend',
+        ],
+
+        'sendmail' => [
+            'transport' => 'sendmail',
+            'path' => env('MAIL_SENDMAIL_PATH', '/usr/sbin/sendmail -bs -i'),
+        ],
+
+        'log' => [
+            'transport' => 'log',
+            'channel' => env('MAIL_LOG_CHANNEL'),
+        ],
+
+        'array' => [
+            'transport' => 'array',
+        ],
+
+        'failover' => [
+            'transport' => 'failover',
+            'mailers' => [
+                'smtp',
+                'log',
+            ],
+            'retry_after' => 60,
+        ],
+
+        'roundrobin' => [
+            'transport' => 'roundrobin',
+            'mailers' => [
+                'ses',
+                'postmark',
+            ],
+            'retry_after' => 60,
+        ],
+
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Global "From" Address
+    |--------------------------------------------------------------------------
+    |
+    | You may wish for all emails sent by your application to be sent from
+    | the same address. Here you may specify a name and address that is
+    | used globally for all emails that are sent by your application.
+    |
+    */
+
+    'from' => [
+        'address' => env('MAIL_FROM_ADDRESS', 'hello@example.com'),
+        'name' => env('MAIL_FROM_NAME', env('APP_NAME', 'Laravel')),
+    ],
+
+];
diff --git a/config/queue.php b/config/queue.php
new file mode 100644
index 0000000..79c2c0a
--- /dev/null
+++ b/config/queue.php
@@ -0,0 +1,129 @@
+<?php
+
+return [
+
+    /*
+    |--------------------------------------------------------------------------
+    | Default Queue Connection Name
+    |--------------------------------------------------------------------------
+    |
+    | Laravel's queue supports a variety of backends via a single, unified
+    | API, giving you convenient access to each backend using identical
+    | syntax for each. The default queue connection is defined below.
+    |
+    */
+
+    'default' => env('QUEUE_CONNECTION', 'database'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Queue Connections
+    |--------------------------------------------------------------------------
+    |
+    | Here you may configure the connection options for every queue backend
+    | used by your application. An example configuration is provided for
+    | each backend supported by Laravel. You're also free to add more.
+    |
+    | Drivers: "sync", "database", "beanstalkd", "sqs", "redis",
+    |          "deferred", "background", "failover", "null"
+    |
+    */
+
+    'connections' => [
+
+        'sync' => [
+            'driver' => 'sync',
+        ],
+
+        'database' => [
+            'driver' => 'database',
+            'connection' => env('DB_QUEUE_CONNECTION'),
+            'table' => env('DB_QUEUE_TABLE', 'jobs'),
+            'queue' => env('DB_QUEUE', 'default'),
+            'retry_after' => (int) env('DB_QUEUE_RETRY_AFTER', 90),
+            'after_commit' => false,
+        ],
+
+        'beanstalkd' => [
+            'driver' => 'beanstalkd',
+            'host' => env('BEANSTALKD_QUEUE_HOST', 'localhost'),
+            'queue' => env('BEANSTALKD_QUEUE', 'default'),
+            'retry_after' => (int) env('BEANSTALKD_QUEUE_RETRY_AFTER', 90),
+            'block_for' => 0,
+            'after_commit' => false,
+        ],
+
+        'sqs' => [
+            'driver' => 'sqs',
+            'key' => env('AWS_ACCESS_KEY_ID'),
+            'secret' => env('AWS_SECRET_ACCESS_KEY'),
+            'prefix' => env('SQS_PREFIX', 'https://sqs.us-east-1.amazonaws.com/your-account-id'),
+            'queue' => env('SQS_QUEUE', 'default'),
+            'suffix' => env('SQS_SUFFIX'),
+            'region' => env('AWS_DEFAULT_REGION', 'us-east-1'),
+            'after_commit' => false,
+        ],
+
+        'redis' => [
+            'driver' => 'redis',
+            'connection' => env('REDIS_QUEUE_CONNECTION', 'default'),
+            'queue' => env('REDIS_QUEUE', 'default'),
+            'retry_after' => (int) env('REDIS_QUEUE_RETRY_AFTER', 90),
+            'block_for' => null,
+            'after_commit' => false,
+        ],
+
+        'deferred' => [
+            'driver' => 'deferred',
+        ],
+
+        'background' => [
+            'driver' => 'background',
+        ],
+
+        'failover' => [
+            'driver' => 'failover',
+            'connections' => [
+                'database',
+                'deferred',
+            ],
+        ],
+
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Job Batching
+    |--------------------------------------------------------------------------
+    |
+    | The following options configure the database and table that store job
+    | batching information. These options can be updated to any database
+    | connection and table which has been defined by your application.
+    |
+    */
+
+    'batching' => [
+        'database' => env('DB_CONNECTION', 'sqlite'),
+        'table' => 'job_batches',
+    ],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Failed Queue Jobs
+    |--------------------------------------------------------------------------
+    |
+    | These options configure the behavior of failed queue job logging so you
+    | can control how and where failed jobs are stored. Laravel ships with
+    | support for storing failed jobs in a simple file or in a database.
+    |
+    | Supported drivers: "database-uuids", "dynamodb", "file", "null"
+    |
+    */
+
+    'failed' => [
+        'driver' => env('QUEUE_FAILED_DRIVER', 'database-uuids'),
+        'database' => env('DB_CONNECTION', 'sqlite'),
+        'table' => 'failed_jobs',
+    ],
+
+];
diff --git a/config/services.php b/config/services.php
new file mode 100644
index 0000000..6a90eb8
--- /dev/null
+++ b/config/services.php
@@ -0,0 +1,38 @@
+<?php
+
+return [
+
+    /*
+    |--------------------------------------------------------------------------
+    | Third Party Services
+    |--------------------------------------------------------------------------
+    |
+    | This file is for storing the credentials for third party services such
+    | as Mailgun, Postmark, AWS and more. This file provides the de facto
+    | location for this type of information, allowing packages to have
+    | a conventional file to locate the various service credentials.
+    |
+    */
+
+    'postmark' => [
+        'key' => env('POSTMARK_API_KEY'),
+    ],
+
+    'resend' => [
+        'key' => env('RESEND_API_KEY'),
+    ],
+
+    'ses' => [
+        'key' => env('AWS_ACCESS_KEY_ID'),
+        'secret' => env('AWS_SECRET_ACCESS_KEY'),
+        'region' => env('AWS_DEFAULT_REGION', 'us-east-1'),
+    ],
+
+    'slack' => [
+        'notifications' => [
+            'bot_user_oauth_token' => env('SLACK_BOT_USER_OAUTH_TOKEN'),
+            'channel' => env('SLACK_BOT_USER_DEFAULT_CHANNEL'),
+        ],
+    ],
+
+];
diff --git a/config/session.php b/config/session.php
new file mode 100644
index 0000000..5b541b7
--- /dev/null
+++ b/config/session.php
@@ -0,0 +1,217 @@
+<?php
+
+use Illuminate\Support\Str;
+
+return [
+
+    /*
+    |--------------------------------------------------------------------------
+    | Default Session Driver
+    |--------------------------------------------------------------------------
+    |
+    | This option determines the default session driver that is utilized for
+    | incoming requests. Laravel supports a variety of storage options to
+    | persist session data. Database storage is a great default choice.
+    |
+    | Supported: "file", "cookie", "database", "memcached",
+    |            "redis", "dynamodb", "array"
+    |
+    */
+
+    'driver' => env('SESSION_DRIVER', 'database'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Session Lifetime
+    |--------------------------------------------------------------------------
+    |
+    | Here you may specify the number of minutes that you wish the session
+    | to be allowed to remain idle before it expires. If you want them
+    | to expire immediately when the browser is closed then you may
+    | indicate that via the expire_on_close configuration option.
+    |
+    */
+
+    'lifetime' => (int) env('SESSION_LIFETIME', 120),
+
+    'expire_on_close' => env('SESSION_EXPIRE_ON_CLOSE', false),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Session Encryption
+    |--------------------------------------------------------------------------
+    |
+    | This option allows you to easily specify that all of your session data
+    | should be encrypted before it's stored. All encryption is performed
+    | automatically by Laravel and you may use the session like normal.
+    |
+    */
+
+    'encrypt' => env('SESSION_ENCRYPT', false),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Session File Location
+    |--------------------------------------------------------------------------
+    |
+    | When utilizing the "file" session driver, the session files are placed
+    | on disk. The default storage location is defined here; however, you
+    | are free to provide another location where they should be stored.
+    |
+    */
+
+    'files' => storage_path('framework/sessions'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Session Database Connection
+    |--------------------------------------------------------------------------
+    |
+    | When using the "database" or "redis" session drivers, you may specify a
+    | connection that should be used to manage these sessions. This should
+    | correspond to a connection in your database configuration options.
+    |
+    */
+
+    'connection' => env('SESSION_CONNECTION'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Session Database Table
+    |--------------------------------------------------------------------------
+    |
+    | When using the "database" session driver, you may specify the table to
+    | be used to store sessions. Of course, a sensible default is defined
+    | for you; however, you're welcome to change this to another table.
+    |
+    */
+
+    'table' => env('SESSION_TABLE', 'sessions'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Session Cache Store
+    |--------------------------------------------------------------------------
+    |
+    | When using one of the framework's cache driven session backends, you may
+    | define the cache store which should be used to store the session data
+    | between requests. This must match one of your defined cache stores.
+    |
+    | Affects: "dynamodb", "memcached", "redis"
+    |
+    */
+
+    'store' => env('SESSION_STORE'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Session Sweeping Lottery
+    |--------------------------------------------------------------------------
+    |
+    | Some session drivers must manually sweep their storage location to get
+    | rid of old sessions from storage. Here are the chances that it will
+    | happen on a given request. By default, the odds are 2 out of 100.
+    |
+    */
+
+    'lottery' => [2, 100],
+
+    /*
+    |--------------------------------------------------------------------------
+    | Session Cookie Name
+    |--------------------------------------------------------------------------
+    |
+    | Here you may change the name of the session cookie that is created by
+    | the framework. Typically, you should not need to change this value
+    | since doing so does not grant a meaningful security improvement.
+    |
+    */
+
+    'cookie' => env(
+        'SESSION_COOKIE',
+        Str::slug((string) env('APP_NAME', 'laravel')).'-session'
+    ),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Session Cookie Path
+    |--------------------------------------------------------------------------
+    |
+    | The session cookie path determines the path for which the cookie will
+    | be regarded as available. Typically, this will be the root path of
+    | your application, but you're free to change this when necessary.
+    |
+    */
+
+    'path' => env('SESSION_PATH', '/'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Session Cookie Domain
+    |--------------------------------------------------------------------------
+    |
+    | This value determines the domain and subdomains the session cookie is
+    | available to. By default, the cookie will be available to the root
+    | domain without subdomains. Typically, this shouldn't be changed.
+    |
+    */
+
+    'domain' => env('SESSION_DOMAIN'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | HTTPS Only Cookies
+    |--------------------------------------------------------------------------
+    |
+    | By setting this option to true, session cookies will only be sent back
+    | to the server if the browser has a HTTPS connection. This will keep
+    | the cookie from being sent to you when it can't be done securely.
+    |
+    */
+
+    'secure' => env('SESSION_SECURE_COOKIE'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | HTTP Access Only
+    |--------------------------------------------------------------------------
+    |
+    | Setting this value to true will prevent JavaScript from accessing the
+    | value of the cookie and the cookie will only be accessible through
+    | the HTTP protocol. It's unlikely you should disable this option.
+    |
+    */
+
+    'http_only' => env('SESSION_HTTP_ONLY', true),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Same-Site Cookies
+    |--------------------------------------------------------------------------
+    |
+    | This option determines how your cookies behave when cross-site requests
+    | take place, and can be used to mitigate CSRF attacks. By default, we
+    | will set this value to "lax" to permit secure cross-site requests.
+    |
+    | See: https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Set-Cookie#samesitesamesite-value
+    |
+    | Supported: "lax", "strict", "none", null
+    |
+    */
+
+    'same_site' => env('SESSION_SAME_SITE', 'lax'),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Partitioned Cookies
+    |--------------------------------------------------------------------------
+    |
+    | Setting this value to true will tie the cookie to the top-level site for
+    | a cross-site context. Partitioned cookies are accepted by the browser
+    | when flagged "secure" and the Same-Site attribute is set to "none".
+    |
+    */
+
+    'partitioned' => env('SESSION_PARTITIONED_COOKIE', false),
+
+];
diff --git a/database/.gitignore b/database/.gitignore
new file mode 100644
index 0000000..9b19b93
--- /dev/null
+++ b/database/.gitignore
@@ -0,0 +1 @@
+*.sqlite*
diff --git a/database/factories/UserFactory.php b/database/factories/UserFactory.php
new file mode 100644
index 0000000..c4ceb07
--- /dev/null
+++ b/database/factories/UserFactory.php
@@ -0,0 +1,45 @@
+<?php
+
+namespace Database\Factories;
+
+use App\Models\User;
+use Illuminate\Database\Eloquent\Factories\Factory;
+use Illuminate\Support\Facades\Hash;
+use Illuminate\Support\Str;
+
+/**
+ * @extends Factory<User>
+ */
+class UserFactory extends Factory
+{
+    /**
+     * The current password being used by the factory.
+     */
+    protected static ?string $password;
+
+    /**
+     * Define the model's default state.
+     *
+     * @return array<string, mixed>
+     */
+    public function definition(): array
+    {
+        return [
+            'name' => fake()->name(),
+            'email' => fake()->unique()->safeEmail(),
+            'email_verified_at' => now(),
+            'password' => static::$password ??= Hash::make('password'),
+            'remember_token' => Str::random(10),
+        ];
+    }
+
+    /**
+     * Indicate that the model's email address should be unverified.
+     */
+    public function unverified(): static
+    {
+        return $this->state(fn (array $attributes) => [
+            'email_verified_at' => null,
+        ]);
+    }
+}
diff --git a/database/migrations/0001_01_01_000000_create_users_table.php b/database/migrations/0001_01_01_000000_create_users_table.php
new file mode 100644
index 0000000..05fb5d9
--- /dev/null
+++ b/database/migrations/0001_01_01_000000_create_users_table.php
@@ -0,0 +1,49 @@
+<?php
+
+use Illuminate\Database\Migrations\Migration;
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Support\Facades\Schema;
+
+return new class extends Migration
+{
+    /**
+     * Run the migrations.
+     */
+    public function up(): void
+    {
+        Schema::create('users', function (Blueprint $table) {
+            $table->id();
+            $table->string('name');
+            $table->string('email')->unique();
+            $table->timestamp('email_verified_at')->nullable();
+            $table->string('password');
+            $table->rememberToken();
+            $table->timestamps();
+        });
+
+        Schema::create('password_reset_tokens', function (Blueprint $table) {
+            $table->string('email')->primary();
+            $table->string('token');
+            $table->timestamp('created_at')->nullable();
+        });
+
+        Schema::create('sessions', function (Blueprint $table) {
+            $table->string('id')->primary();
+            $table->foreignId('user_id')->nullable()->index();
+            $table->string('ip_address', 45)->nullable();
+            $table->text('user_agent')->nullable();
+            $table->longText('payload');
+            $table->integer('last_activity')->index();
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     */
+    public function down(): void
+    {
+        Schema::dropIfExists('users');
+        Schema::dropIfExists('password_reset_tokens');
+        Schema::dropIfExists('sessions');
+    }
+};
diff --git a/database/migrations/0001_01_01_000001_create_cache_table.php b/database/migrations/0001_01_01_000001_create_cache_table.php
new file mode 100644
index 0000000..ed758bd
--- /dev/null
+++ b/database/migrations/0001_01_01_000001_create_cache_table.php
@@ -0,0 +1,35 @@
+<?php
+
+use Illuminate\Database\Migrations\Migration;
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Support\Facades\Schema;
+
+return new class extends Migration
+{
+    /**
+     * Run the migrations.
+     */
+    public function up(): void
+    {
+        Schema::create('cache', function (Blueprint $table) {
+            $table->string('key')->primary();
+            $table->mediumText('value');
+            $table->integer('expiration')->index();
+        });
+
+        Schema::create('cache_locks', function (Blueprint $table) {
+            $table->string('key')->primary();
+            $table->string('owner');
+            $table->integer('expiration')->index();
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     */
+    public function down(): void
+    {
+        Schema::dropIfExists('cache');
+        Schema::dropIfExists('cache_locks');
+    }
+};
diff --git a/database/migrations/0001_01_01_000002_create_jobs_table.php b/database/migrations/0001_01_01_000002_create_jobs_table.php
new file mode 100644
index 0000000..425e705
--- /dev/null
+++ b/database/migrations/0001_01_01_000002_create_jobs_table.php
@@ -0,0 +1,57 @@
+<?php
+
+use Illuminate\Database\Migrations\Migration;
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Support\Facades\Schema;
+
+return new class extends Migration
+{
+    /**
+     * Run the migrations.
+     */
+    public function up(): void
+    {
+        Schema::create('jobs', function (Blueprint $table) {
+            $table->id();
+            $table->string('queue')->index();
+            $table->longText('payload');
+            $table->unsignedTinyInteger('attempts');
+            $table->unsignedInteger('reserved_at')->nullable();
+            $table->unsignedInteger('available_at');
+            $table->unsignedInteger('created_at');
+        });
+
+        Schema::create('job_batches', function (Blueprint $table) {
+            $table->string('id')->primary();
+            $table->string('name');
+            $table->integer('total_jobs');
+            $table->integer('pending_jobs');
+            $table->integer('failed_jobs');
+            $table->longText('failed_job_ids');
+            $table->mediumText('options')->nullable();
+            $table->integer('cancelled_at')->nullable();
+            $table->integer('created_at');
+            $table->integer('finished_at')->nullable();
+        });
+
+        Schema::create('failed_jobs', function (Blueprint $table) {
+            $table->id();
+            $table->string('uuid')->unique();
+            $table->text('connection');
+            $table->text('queue');
+            $table->longText('payload');
+            $table->longText('exception');
+            $table->timestamp('failed_at')->useCurrent();
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     */
+    public function down(): void
+    {
+        Schema::dropIfExists('jobs');
+        Schema::dropIfExists('job_batches');
+        Schema::dropIfExists('failed_jobs');
+    }
+};
diff --git a/database/migrations/2026_03_27_000100_create_stores_table.php b/database/migrations/2026_03_27_000100_create_stores_table.php
new file mode 100644
index 0000000..f426b1d
--- /dev/null
+++ b/database/migrations/2026_03_27_000100_create_stores_table.php
@@ -0,0 +1,30 @@
+<?php
+
+use Illuminate\Database\Migrations\Migration;
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Support\Facades\Schema;
+
+return new class extends Migration
+{
+    /**
+     * Run the migrations.
+     */
+    public function up(): void
+    {
+        Schema::create('stores', function (Blueprint $table) {
+            $table->id();
+            $table->string('name');
+            $table->string('normalized_name')->unique();
+            $table->foreignId('created_by')->nullable()->constrained('users')->nullOnDelete();
+            $table->timestamps();
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     */
+    public function down(): void
+    {
+        Schema::dropIfExists('stores');
+    }
+};
diff --git a/database/migrations/2026_03_27_000200_create_shopping_items_table.php b/database/migrations/2026_03_27_000200_create_shopping_items_table.php
new file mode 100644
index 0000000..69c935c
--- /dev/null
+++ b/database/migrations/2026_03_27_000200_create_shopping_items_table.php
@@ -0,0 +1,36 @@
+<?php
+
+use Illuminate\Database\Migrations\Migration;
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Support\Facades\Schema;
+
+return new class extends Migration
+{
+    /**
+     * Run the migrations.
+     */
+    public function up(): void
+    {
+        Schema::create('shopping_items', function (Blueprint $table) {
+            $table->id();
+            $table->foreignId('user_id')->constrained()->cascadeOnDelete();
+            $table->string('product_name');
+            $table->string('quantity')->nullable();
+            $table->foreignId('store_id')->nullable()->constrained('stores')->nullOnDelete();
+            $table->boolean('is_done')->default(false)->index();
+            $table->timestamp('done_at')->nullable();
+            $table->timestamps();
+
+            $table->index(['user_id', 'is_done']);
+            $table->index(['user_id', 'store_id']);
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     */
+    public function down(): void
+    {
+        Schema::dropIfExists('shopping_items');
+    }
+};
diff --git a/database/migrations/2026_03_27_000300_create_item_price_logs_table.php b/database/migrations/2026_03_27_000300_create_item_price_logs_table.php
new file mode 100644
index 0000000..e7d05bb
--- /dev/null
+++ b/database/migrations/2026_03_27_000300_create_item_price_logs_table.php
@@ -0,0 +1,37 @@
+<?php
+
+use Illuminate\Database\Migrations\Migration;
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Support\Facades\Schema;
+
+return new class extends Migration
+{
+    /**
+     * Run the migrations.
+     */
+    public function up(): void
+    {
+        Schema::create('item_price_logs', function (Blueprint $table) {
+            $table->id();
+            $table->foreignId('shopping_item_id')->constrained()->cascadeOnDelete();
+            $table->foreignId('store_id')->nullable()->constrained('stores')->nullOnDelete();
+            $table->decimal('price_decimal', 10, 2);
+            $table->char('currency', 3)->default('EUR');
+            $table->timestamp('logged_at')->useCurrent();
+            $table->string('photo_path')->nullable();
+            $table->string('source', 20)->default('manual');
+            $table->timestamps();
+
+            $table->index(['shopping_item_id', 'logged_at']);
+            $table->index(['store_id', 'logged_at']);
+        });
+    }
+
+    /**
+     * Reverse the migrations.
+     */
+    public function down(): void
+    {
+        Schema::dropIfExists('item_price_logs');
+    }
+};
diff --git a/database/seeders/DatabaseSeeder.php b/database/seeders/DatabaseSeeder.php
new file mode 100644
index 0000000..5bc2d0a
--- /dev/null
+++ b/database/seeders/DatabaseSeeder.php
@@ -0,0 +1,21 @@
+<?php
+
+namespace Database\Seeders;
+
+use Illuminate\Database\Console\Seeds\WithoutModelEvents;
+use Illuminate\Database\Seeder;
+
+class DatabaseSeeder extends Seeder
+{
+    use WithoutModelEvents;
+
+    /**
+     * Seed the application's database.
+     */
+    public function run(): void
+    {
+        $this->call([
+            StoreSeeder::class,
+        ]);
+    }
+}
diff --git a/database/seeders/StoreSeeder.php b/database/seeders/StoreSeeder.php
new file mode 100644
index 0000000..06ea9bc
--- /dev/null
+++ b/database/seeders/StoreSeeder.php
@@ -0,0 +1,30 @@
+<?php
+
+namespace Database\Seeders;
+
+use App\Models\Store;
+use Illuminate\Database\Seeder;
+
+class StoreSeeder extends Seeder
+{
+    /**
+     * Run the database seeds.
+     */
+    public function run(): void
+    {
+        $stores = [
+            'Billa',
+            'Spar',
+            'Hofer',
+            'Lidl',
+            'DM',
+        ];
+
+        foreach ($stores as $name) {
+            Store::firstOrCreate(
+                ['normalized_name' => mb_strtolower($name)],
+                ['name' => $name]
+            );
+        }
+    }
+}
diff --git a/deploy.sh b/deploy.sh
new file mode 100644
index 0000000..5ac2183
--- /dev/null
+++ b/deploy.sh
@@ -0,0 +1,71 @@
+#!/usr/bin/env bash
+set -Eeuo pipefail
+
+# Usage:
+#   ./deploy.sh
+# Optional env vars:
+#   APP_DIR=/var/www/einkauf
+#   PHP_BIN=/usr/bin/php
+#   COMPOSER_BIN=/usr/local/bin/composer
+#   NPM_BIN=/usr/bin/npm
+#   RUN_SEED=true
+
+APP_DIR="${APP_DIR:-/var/www/einkauf}"
+PHP_BIN="${PHP_BIN:-/usr/bin/php}"
+COMPOSER_BIN="${COMPOSER_BIN:-/usr/local/bin/composer}"
+NPM_BIN="${NPM_BIN:-/usr/bin/npm}"
+RUN_SEED="${RUN_SEED:-false}"
+
+cd "${APP_DIR}"
+
+echo "==> Deploy startet in ${APP_DIR}"
+
+if [ ! -f "artisan" ]; then
+  echo "Fehler: artisan nicht gefunden in ${APP_DIR}" >&2
+  exit 1
+fi
+
+echo "==> Wartungsmodus aktivieren"
+"${PHP_BIN}" artisan down --refresh=15 --retry=60 --secret="deploy-bypass" || true
+
+cleanup() {
+  echo "==> Wartungsmodus deaktivieren"
+  "${PHP_BIN}" artisan up || true
+}
+trap cleanup EXIT
+
+echo "==> Code aktualisieren"
+git fetch --all --prune
+git reset --hard origin/main
+
+echo "==> PHP-Abhaengigkeiten installieren"
+"${COMPOSER_BIN}" install --no-dev --prefer-dist --optimize-autoloader --no-interaction
+
+echo "==> Frontend-Abhaengigkeiten installieren"
+"${NPM_BIN}" ci
+
+echo "==> Frontend builden"
+"${NPM_BIN}" run build
+
+echo "==> Datenbank migrieren"
+"${PHP_BIN}" artisan migrate --force
+
+if [ "${RUN_SEED}" = "true" ]; then
+  echo "==> Seeder ausfuehren"
+  "${PHP_BIN}" artisan db:seed --force
+fi
+
+echo "==> Storage-Link sicherstellen"
+"${PHP_BIN}" artisan storage:link || true
+
+echo "==> Caches aufbauen"
+"${PHP_BIN}" artisan optimize:clear
+"${PHP_BIN}" artisan config:cache
+"${PHP_BIN}" artisan route:cache
+"${PHP_BIN}" artisan view:cache
+
+echo "==> Rechte setzen"
+chown -R www-data:www-data "${APP_DIR}"
+chmod -R ug+rwX "${APP_DIR}/storage" "${APP_DIR}/bootstrap/cache"
+
+echo "==> Deploy erfolgreich"
diff --git a/html/.htaccess b/html/.htaccess
new file mode 100644
index 0000000..b574a59
--- /dev/null
+++ b/html/.htaccess
@@ -0,0 +1,25 @@
+<IfModule mod_rewrite.c>
+    <IfModule mod_negotiation.c>
+        Options -MultiViews -Indexes
+    </IfModule>
+
+    RewriteEngine On
+
+    # Handle Authorization Header
+    RewriteCond %{HTTP:Authorization} .
+    RewriteRule .* - [E=HTTP_AUTHORIZATION:%{HTTP:Authorization}]
+
+    # Handle X-XSRF-Token Header
+    RewriteCond %{HTTP:x-xsrf-token} .
+    RewriteRule .* - [E=HTTP_X_XSRF_TOKEN:%{HTTP:X-XSRF-Token}]
+
+    # Redirect Trailing Slashes If Not A Folder...
+    RewriteCond %{REQUEST_FILENAME} !-d
+    RewriteCond %{REQUEST_URI} (.+)/$
+    RewriteRule ^ %1 [L,R=301]
+
+    # Send Requests To Front Controller...
+    RewriteCond %{REQUEST_FILENAME} !-d
+    RewriteCond %{REQUEST_FILENAME} !-f
+    RewriteRule ^ index.php [L]
+</IfModule>
diff --git a/html/build/assets/app-BIJoUbyE.js b/html/build/assets/app-BIJoUbyE.js
new file mode 100644
index 0000000..7b10873
--- /dev/null
+++ b/html/build/assets/app-BIJoUbyE.js
@@ -0,0 +1,10 @@
+function er(e,t){return function(){return e.apply(t,arguments)}}const{toString:Di}=Object.prototype,{getPrototypeOf:Ht}=Object,{iterator:rt,toStringTag:tr}=Symbol,it=(e=>t=>{const n=Di.call(t);return e[n]||(e[n]=n.slice(8,-1).toLowerCase())})(Object.create(null)),B=e=>(e=e.toLowerCase(),t=>it(t)===e),st=e=>t=>typeof t===e,{isArray:_e}=Array,pe=st("undefined");function Fe(e){return e!==null&&!pe(e)&&e.constructor!==null&&!pe(e.constructor)&&M(e.constructor.isBuffer)&&e.constructor.isBuffer(e)}const nr=B("ArrayBuffer");function Bi(e){let t;return typeof ArrayBuffer<"u"&&ArrayBuffer.isView?t=ArrayBuffer.isView(e):t=e&&e.buffer&&nr(e.buffer),t}const $i=st("string"),M=st("function"),rr=st("number"),Le=e=>e!==null&&typeof e=="object",Ui=e=>e===!0||e===!1,Xe=e=>{if(it(e)!=="object")return!1;const t=Ht(e);return(t===null||t===Object.prototype||Object.getPrototypeOf(t)===null)&&!(tr in e)&&!(rt in e)},ki=e=>{if(!Le(e)||Fe(e))return!1;try{return Object.keys(e).length===0&&Object.getPrototypeOf(e)===Object.prototype}catch{return!1}},qi=B("Date"),Hi=B("File"),zi=e=>!!(e&&typeof e.uri<"u"),Ki=e=>e&&typeof e.getParts<"u",Wi=B("Blob"),Ji=B("FileList"),Vi=e=>Le(e)&&M(e.pipe);function Xi(){return typeof globalThis<"u"?globalThis:typeof self<"u"?self:typeof window<"u"?window:typeof global<"u"?global:{}}const Sn=Xi(),An=typeof Sn.FormData<"u"?Sn.FormData:void 0,Gi=e=>{let t;return e&&(An&&e instanceof An||M(e.append)&&((t=it(e))==="formdata"||t==="object"&&M(e.toString)&&e.toString()==="[object FormData]"))},Yi=B("URLSearchParams"),[Zi,Qi,es,ts]=["ReadableStream","Request","Response","Headers"].map(B),ns=e=>e.trim?e.trim():e.replace(/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,"");function Ie(e,t,{allOwnKeys:n=!1}={}){if(e===null||typeof e>"u")return;let r,i;if(typeof e!="object"&&(e=[e]),_e(e))for(r=0,i=e.length;r<i;r++)t.call(null,e[r],r,e);else{if(Fe(e))return;const s=n?Object.getOwnPropertyNames(e):Object.keys(e),o=s.length;let a;for(r=0;r<o;r++)a=s[r],t.call(null,e[a],a,e)}}function ir(e,t){if(Fe(e))return null;t=t.toLowerCase();const n=Object.keys(e);let r=n.length,i;for(;r-- >0;)if(i=n[r],t===i.toLowerCase())return i;return null}const G=typeof globalThis<"u"?globalThis:typeof self<"u"?self:typeof window<"u"?window:global,sr=e=>!pe(e)&&e!==G;function At(){const{caseless:e,skipUndefined:t}=sr(this)&&this||{},n={},r=(i,s)=>{if(s==="__proto__"||s==="constructor"||s==="prototype")return;const o=e&&ir(n,s)||s;Xe(n[o])&&Xe(i)?n[o]=At(n[o],i):Xe(i)?n[o]=At({},i):_e(i)?n[o]=i.slice():(!t||!pe(i))&&(n[o]=i)};for(let i=0,s=arguments.length;i<s;i++)arguments[i]&&Ie(arguments[i],r);return n}const rs=(e,t,n,{allOwnKeys:r}={})=>(Ie(t,(i,s)=>{n&&M(i)?Object.defineProperty(e,s,{value:er(i,n),writable:!0,enumerable:!0,configurable:!0}):Object.defineProperty(e,s,{value:i,writable:!0,enumerable:!0,configurable:!0})},{allOwnKeys:r}),e),is=e=>(e.charCodeAt(0)===65279&&(e=e.slice(1)),e),ss=(e,t,n,r)=>{e.prototype=Object.create(t.prototype,r),Object.defineProperty(e.prototype,"constructor",{value:e,writable:!0,enumerable:!1,configurable:!0}),Object.defineProperty(e,"super",{value:t.prototype}),n&&Object.assign(e.prototype,n)},os=(e,t,n,r)=>{let i,s,o;const a={};if(t=t||{},e==null)return t;do{for(i=Object.getOwnPropertyNames(e),s=i.length;s-- >0;)o=i[s],(!r||r(o,e,t))&&!a[o]&&(t[o]=e[o],a[o]=!0);e=n!==!1&&Ht(e)}while(e&&(!n||n(e,t))&&e!==Object.prototype);return t},as=(e,t,n)=>{e=String(e),(n===void 0||n>e.length)&&(n=e.length),n-=t.length;const r=e.indexOf(t,n);return r!==-1&&r===n},cs=e=>{if(!e)return null;if(_e(e))return e;let t=e.length;if(!rr(t))return null;const n=new Array(t);for(;t-- >0;)n[t]=e[t];return n},us=(e=>t=>e&&t instanceof e)(typeof Uint8Array<"u"&&Ht(Uint8Array)),ls=(e,t)=>{const r=(e&&e[rt]).call(e);let i;for(;(i=r.next())&&!i.done;){const s=i.value;t.call(e,s[0],s[1])}},fs=(e,t)=>{let n;const r=[];for(;(n=e.exec(t))!==null;)r.push(n);return r},ds=B("HTMLFormElement"),ps=e=>e.toLowerCase().replace(/[-_\s]([a-z\d])(\w*)/g,function(n,r,i){return r.toUpperCase()+i}),On=(({hasOwnProperty:e})=>(t,n)=>e.call(t,n))(Object.prototype),hs=B("RegExp"),or=(e,t)=>{const n=Object.getOwnPropertyDescriptors(e),r={};Ie(n,(i,s)=>{let o;(o=t(i,s,e))!==!1&&(r[s]=o||i)}),Object.defineProperties(e,r)},_s=e=>{or(e,(t,n)=>{if(M(e)&&["arguments","caller","callee"].indexOf(n)!==-1)return!1;const r=e[n];if(M(r)){if(t.enumerable=!1,"writable"in t){t.writable=!1;return}t.set||(t.set=()=>{throw Error("Can not rewrite read-only method '"+n+"'")})}})},ms=(e,t)=>{const n={},r=i=>{i.forEach(s=>{n[s]=!0})};return _e(e)?r(e):r(String(e).split(t)),n},gs=()=>{},ys=(e,t)=>e!=null&&Number.isFinite(e=+e)?e:t;function bs(e){return!!(e&&M(e.append)&&e[tr]==="FormData"&&e[rt])}const ws=e=>{const t=new Array(10),n=(r,i)=>{if(Le(r)){if(t.indexOf(r)>=0)return;if(Fe(r))return r;if(!("toJSON"in r)){t[i]=r;const s=_e(r)?[]:{};return Ie(r,(o,a)=>{const c=n(o,i+1);!pe(c)&&(s[a]=c)}),t[i]=void 0,s}}return r};return n(e,0)},xs=B("AsyncFunction"),Es=e=>e&&(Le(e)||M(e))&&M(e.then)&&M(e.catch),ar=((e,t)=>e?setImmediate:t?((n,r)=>(G.addEventListener("message",({source:i,data:s})=>{i===G&&s===n&&r.length&&r.shift()()},!1),i=>{r.push(i),G.postMessage(n,"*")}))(`axios@${Math.random()}`,[]):n=>setTimeout(n))(typeof setImmediate=="function",M(G.postMessage)),Ss=typeof queueMicrotask<"u"?queueMicrotask.bind(G):typeof process<"u"&&process.nextTick||ar,As=e=>e!=null&&M(e[rt]),f={isArray:_e,isArrayBuffer:nr,isBuffer:Fe,isFormData:Gi,isArrayBufferView:Bi,isString:$i,isNumber:rr,isBoolean:Ui,isObject:Le,isPlainObject:Xe,isEmptyObject:ki,isReadableStream:Zi,isRequest:Qi,isResponse:es,isHeaders:ts,isUndefined:pe,isDate:qi,isFile:Hi,isReactNativeBlob:zi,isReactNative:Ki,isBlob:Wi,isRegExp:hs,isFunction:M,isStream:Vi,isURLSearchParams:Yi,isTypedArray:us,isFileList:Ji,forEach:Ie,merge:At,extend:rs,trim:ns,stripBOM:is,inherits:ss,toFlatObject:os,kindOf:it,kindOfTest:B,endsWith:as,toArray:cs,forEachEntry:ls,matchAll:fs,isHTMLForm:ds,hasOwnProperty:On,hasOwnProp:On,reduceDescriptors:or,freezeMethods:_s,toObjectSet:ms,toCamelCase:ps,noop:gs,toFiniteNumber:ys,findKey:ir,global:G,isContextDefined:sr,isSpecCompliantForm:bs,toJSONObject:ws,isAsyncFn:xs,isThenable:Es,setImmediate:ar,asap:Ss,isIterable:As};let g=class cr extends Error{static from(t,n,r,i,s,o){const a=new cr(t.message,n||t.code,r,i,s);return a.cause=t,a.name=t.name,t.status!=null&&a.status==null&&(a.status=t.status),o&&Object.assign(a,o),a}constructor(t,n,r,i,s){super(t),Object.defineProperty(this,"message",{value:t,enumerable:!0,writable:!0,configurable:!0}),this.name="AxiosError",this.isAxiosError=!0,n&&(this.code=n),r&&(this.config=r),i&&(this.request=i),s&&(this.response=s,this.status=s.status)}toJSON(){return{message:this.message,name:this.name,description:this.description,number:this.number,fileName:this.fileName,lineNumber:this.lineNumber,columnNumber:this.columnNumber,stack:this.stack,config:f.toJSONObject(this.config),code:this.code,status:this.status}}};g.ERR_BAD_OPTION_VALUE="ERR_BAD_OPTION_VALUE";g.ERR_BAD_OPTION="ERR_BAD_OPTION";g.ECONNABORTED="ECONNABORTED";g.ETIMEDOUT="ETIMEDOUT";g.ERR_NETWORK="ERR_NETWORK";g.ERR_FR_TOO_MANY_REDIRECTS="ERR_FR_TOO_MANY_REDIRECTS";g.ERR_DEPRECATED="ERR_DEPRECATED";g.ERR_BAD_RESPONSE="ERR_BAD_RESPONSE";g.ERR_BAD_REQUEST="ERR_BAD_REQUEST";g.ERR_CANCELED="ERR_CANCELED";g.ERR_NOT_SUPPORT="ERR_NOT_SUPPORT";g.ERR_INVALID_URL="ERR_INVALID_URL";const Os=null;function Ot(e){return f.isPlainObject(e)||f.isArray(e)}function ur(e){return f.endsWith(e,"[]")?e.slice(0,-2):e}function mt(e,t,n){return e?e.concat(t).map(function(i,s){return i=ur(i),!n&&s?"["+i+"]":i}).join(n?".":""):t}function Rs(e){return f.isArray(e)&&!e.some(Ot)}const vs=f.toFlatObject(f,{},null,function(t){return/^is[A-Z]/.test(t)});function ot(e,t,n){if(!f.isObject(e))throw new TypeError("target must be an object");t=t||new FormData,n=f.toFlatObject(n,{metaTokens:!0,dots:!1,indexes:!1},!1,function(_,d){return!f.isUndefined(d[_])});const r=n.metaTokens,i=n.visitor||l,s=n.dots,o=n.indexes,c=(n.Blob||typeof Blob<"u"&&Blob)&&f.isSpecCompliantForm(t);if(!f.isFunction(i))throw new TypeError("visitor must be a function");function u(p){if(p===null)return"";if(f.isDate(p))return p.toISOString();if(f.isBoolean(p))return p.toString();if(!c&&f.isBlob(p))throw new g("Blob is not supported. Use a Buffer instead.");return f.isArrayBuffer(p)||f.isTypedArray(p)?c&&typeof Blob=="function"?new Blob([p]):Buffer.from(p):p}function l(p,_,d){let m=p;if(f.isReactNative(t)&&f.isReactNativeBlob(p))return t.append(mt(d,_,s),u(p)),!1;if(p&&!d&&typeof p=="object"){if(f.endsWith(_,"{}"))_=r?_:_.slice(0,-2),p=JSON.stringify(p);else if(f.isArray(p)&&Rs(p)||(f.isFileList(p)||f.endsWith(_,"[]"))&&(m=f.toArray(p)))return _=ur(_),m.forEach(function(b,E){!(f.isUndefined(b)||b===null)&&t.append(o===!0?mt([_],E,s):o===null?_:_+"[]",u(b))}),!1}return Ot(p)?!0:(t.append(mt(d,_,s),u(p)),!1)}const h=[],y=Object.assign(vs,{defaultVisitor:l,convertValue:u,isVisitable:Ot});function x(p,_){if(!f.isUndefined(p)){if(h.indexOf(p)!==-1)throw Error("Circular reference detected in "+_.join("."));h.push(p),f.forEach(p,function(m,w){(!(f.isUndefined(m)||m===null)&&i.call(t,m,f.isString(w)?w.trim():w,_,y))===!0&&x(m,_?_.concat(w):[w])}),h.pop()}}if(!f.isObject(e))throw new TypeError("data must be an object");return x(e),t}function Rn(e){const t={"!":"%21","'":"%27","(":"%28",")":"%29","~":"%7E","%20":"+","%00":"\0"};return encodeURIComponent(e).replace(/[!'()~]|%20|%00/g,function(r){return t[r]})}function zt(e,t){this._pairs=[],e&&ot(e,this,t)}const lr=zt.prototype;lr.append=function(t,n){this._pairs.push([t,n])};lr.toString=function(t){const n=t?function(r){return t.call(this,r,Rn)}:Rn;return this._pairs.map(function(i){return n(i[0])+"="+n(i[1])},"").join("&")};function Ts(e){return encodeURIComponent(e).replace(/%3A/gi,":").replace(/%24/g,"$").replace(/%2C/gi,",").replace(/%20/g,"+")}function fr(e,t,n){if(!t)return e;const r=n&&n.encode||Ts,i=f.isFunction(n)?{serialize:n}:n,s=i&&i.serialize;let o;if(s?o=s(t,i):o=f.isURLSearchParams(t)?t.toString():new zt(t,i).toString(r),o){const a=e.indexOf("#");a!==-1&&(e=e.slice(0,a)),e+=(e.indexOf("?")===-1?"?":"&")+o}return e}class vn{constructor(){this.handlers=[]}use(t,n,r){return this.handlers.push({fulfilled:t,rejected:n,synchronous:r?r.synchronous:!1,runWhen:r?r.runWhen:null}),this.handlers.length-1}eject(t){this.handlers[t]&&(this.handlers[t]=null)}clear(){this.handlers&&(this.handlers=[])}forEach(t){f.forEach(this.handlers,function(r){r!==null&&t(r)})}}const Kt={silentJSONParsing:!0,forcedJSONParsing:!0,clarifyTimeoutError:!1,legacyInterceptorReqResOrdering:!0},Cs=typeof URLSearchParams<"u"?URLSearchParams:zt,Ps=typeof FormData<"u"?FormData:null,Ns=typeof Blob<"u"?Blob:null,Ms={isBrowser:!0,classes:{URLSearchParams:Cs,FormData:Ps,Blob:Ns},protocols:["http","https","file","blob","url","data"]},Wt=typeof window<"u"&&typeof document<"u",Rt=typeof navigator=="object"&&navigator||void 0,Fs=Wt&&(!Rt||["ReactNative","NativeScript","NS"].indexOf(Rt.product)<0),Ls=typeof WorkerGlobalScope<"u"&&self instanceof WorkerGlobalScope&&typeof self.importScripts=="function",Is=Wt&&window.location.href||"http://localhost",js=Object.freeze(Object.defineProperty({__proto__:null,hasBrowserEnv:Wt,hasStandardBrowserEnv:Fs,hasStandardBrowserWebWorkerEnv:Ls,navigator:Rt,origin:Is},Symbol.toStringTag,{value:"Module"})),T={...js,...Ms};function Ds(e,t){return ot(e,new T.classes.URLSearchParams,{visitor:function(n,r,i,s){return T.isNode&&f.isBuffer(n)?(this.append(r,n.toString("base64")),!1):s.defaultVisitor.apply(this,arguments)},...t})}function Bs(e){return f.matchAll(/\w+|\[(\w*)]/g,e).map(t=>t[0]==="[]"?"":t[1]||t[0])}function $s(e){const t={},n=Object.keys(e);let r;const i=n.length;let s;for(r=0;r<i;r++)s=n[r],t[s]=e[s];return t}function dr(e){function t(n,r,i,s){let o=n[s++];if(o==="__proto__")return!0;const a=Number.isFinite(+o),c=s>=n.length;return o=!o&&f.isArray(i)?i.length:o,c?(f.hasOwnProp(i,o)?i[o]=[i[o],r]:i[o]=r,!a):((!i[o]||!f.isObject(i[o]))&&(i[o]=[]),t(n,r,i[o],s)&&f.isArray(i[o])&&(i[o]=$s(i[o])),!a)}if(f.isFormData(e)&&f.isFunction(e.entries)){const n={};return f.forEachEntry(e,(r,i)=>{t(Bs(r),i,n,0)}),n}return null}function Us(e,t,n){if(f.isString(e))try{return(t||JSON.parse)(e),f.trim(e)}catch(r){if(r.name!=="SyntaxError")throw r}return(n||JSON.stringify)(e)}const je={transitional:Kt,adapter:["xhr","http","fetch"],transformRequest:[function(t,n){const r=n.getContentType()||"",i=r.indexOf("application/json")>-1,s=f.isObject(t);if(s&&f.isHTMLForm(t)&&(t=new FormData(t)),f.isFormData(t))return i?JSON.stringify(dr(t)):t;if(f.isArrayBuffer(t)||f.isBuffer(t)||f.isStream(t)||f.isFile(t)||f.isBlob(t)||f.isReadableStream(t))return t;if(f.isArrayBufferView(t))return t.buffer;if(f.isURLSearchParams(t))return n.setContentType("application/x-www-form-urlencoded;charset=utf-8",!1),t.toString();let a;if(s){if(r.indexOf("application/x-www-form-urlencoded")>-1)return Ds(t,this.formSerializer).toString();if((a=f.isFileList(t))||r.indexOf("multipart/form-data")>-1){const c=this.env&&this.env.FormData;return ot(a?{"files[]":t}:t,c&&new c,this.formSerializer)}}return s||i?(n.setContentType("application/json",!1),Us(t)):t}],transformResponse:[function(t){const n=this.transitional||je.transitional,r=n&&n.forcedJSONParsing,i=this.responseType==="json";if(f.isResponse(t)||f.isReadableStream(t))return t;if(t&&f.isString(t)&&(r&&!this.responseType||i)){const o=!(n&&n.silentJSONParsing)&&i;try{return JSON.parse(t,this.parseReviver)}catch(a){if(o)throw a.name==="SyntaxError"?g.from(a,g.ERR_BAD_RESPONSE,this,null,this.response):a}}return t}],timeout:0,xsrfCookieName:"XSRF-TOKEN",xsrfHeaderName:"X-XSRF-TOKEN",maxContentLength:-1,maxBodyLength:-1,env:{FormData:T.classes.FormData,Blob:T.classes.Blob},validateStatus:function(t){return t>=200&&t<300},headers:{common:{Accept:"application/json, text/plain, */*","Content-Type":void 0}}};f.forEach(["delete","get","head","post","put","patch"],e=>{je.headers[e]={}});const ks=f.toObjectSet(["age","authorization","content-length","content-type","etag","expires","from","host","if-modified-since","if-unmodified-since","last-modified","location","max-forwards","proxy-authorization","referer","retry-after","user-agent"]),qs=e=>{const t={};let n,r,i;return e&&e.split(`
+`).forEach(function(o){i=o.indexOf(":"),n=o.substring(0,i).trim().toLowerCase(),r=o.substring(i+1).trim(),!(!n||t[n]&&ks[n])&&(n==="set-cookie"?t[n]?t[n].push(r):t[n]=[r]:t[n]=t[n]?t[n]+", "+r:r)}),t},Tn=Symbol("internals");function Se(e){return e&&String(e).trim().toLowerCase()}function Ge(e){return e===!1||e==null?e:f.isArray(e)?e.map(Ge):String(e)}function Hs(e){const t=Object.create(null),n=/([^\s,;=]+)\s*(?:=\s*([^,;]+))?/g;let r;for(;r=n.exec(e);)t[r[1]]=r[2];return t}const zs=e=>/^[-_a-zA-Z0-9^`|~,!#$%&'*+.]+$/.test(e.trim());function gt(e,t,n,r,i){if(f.isFunction(r))return r.call(this,t,n);if(i&&(t=n),!!f.isString(t)){if(f.isString(r))return t.indexOf(r)!==-1;if(f.isRegExp(r))return r.test(t)}}function Ks(e){return e.trim().toLowerCase().replace(/([a-z\d])(\w*)/g,(t,n,r)=>n.toUpperCase()+r)}function Ws(e,t){const n=f.toCamelCase(" "+t);["get","set","has"].forEach(r=>{Object.defineProperty(e,r+n,{value:function(i,s,o){return this[r].call(this,t,i,s,o)},configurable:!0})})}let F=class{constructor(t){t&&this.set(t)}set(t,n,r){const i=this;function s(a,c,u){const l=Se(c);if(!l)throw new Error("header name must be a non-empty string");const h=f.findKey(i,l);(!h||i[h]===void 0||u===!0||u===void 0&&i[h]!==!1)&&(i[h||c]=Ge(a))}const o=(a,c)=>f.forEach(a,(u,l)=>s(u,l,c));if(f.isPlainObject(t)||t instanceof this.constructor)o(t,n);else if(f.isString(t)&&(t=t.trim())&&!zs(t))o(qs(t),n);else if(f.isObject(t)&&f.isIterable(t)){let a={},c,u;for(const l of t){if(!f.isArray(l))throw TypeError("Object iterator must return a key-value pair");a[u=l[0]]=(c=a[u])?f.isArray(c)?[...c,l[1]]:[c,l[1]]:l[1]}o(a,n)}else t!=null&&s(n,t,r);return this}get(t,n){if(t=Se(t),t){const r=f.findKey(this,t);if(r){const i=this[r];if(!n)return i;if(n===!0)return Hs(i);if(f.isFunction(n))return n.call(this,i,r);if(f.isRegExp(n))return n.exec(i);throw new TypeError("parser must be boolean|regexp|function")}}}has(t,n){if(t=Se(t),t){const r=f.findKey(this,t);return!!(r&&this[r]!==void 0&&(!n||gt(this,this[r],r,n)))}return!1}delete(t,n){const r=this;let i=!1;function s(o){if(o=Se(o),o){const a=f.findKey(r,o);a&&(!n||gt(r,r[a],a,n))&&(delete r[a],i=!0)}}return f.isArray(t)?t.forEach(s):s(t),i}clear(t){const n=Object.keys(this);let r=n.length,i=!1;for(;r--;){const s=n[r];(!t||gt(this,this[s],s,t,!0))&&(delete this[s],i=!0)}return i}normalize(t){const n=this,r={};return f.forEach(this,(i,s)=>{const o=f.findKey(r,s);if(o){n[o]=Ge(i),delete n[s];return}const a=t?Ks(s):String(s).trim();a!==s&&delete n[s],n[a]=Ge(i),r[a]=!0}),this}concat(...t){return this.constructor.concat(this,...t)}toJSON(t){const n=Object.create(null);return f.forEach(this,(r,i)=>{r!=null&&r!==!1&&(n[i]=t&&f.isArray(r)?r.join(", "):r)}),n}[Symbol.iterator](){return Object.entries(this.toJSON())[Symbol.iterator]()}toString(){return Object.entries(this.toJSON()).map(([t,n])=>t+": "+n).join(`
+`)}getSetCookie(){return this.get("set-cookie")||[]}get[Symbol.toStringTag](){return"AxiosHeaders"}static from(t){return t instanceof this?t:new this(t)}static concat(t,...n){const r=new this(t);return n.forEach(i=>r.set(i)),r}static accessor(t){const r=(this[Tn]=this[Tn]={accessors:{}}).accessors,i=this.prototype;function s(o){const a=Se(o);r[a]||(Ws(i,o),r[a]=!0)}return f.isArray(t)?t.forEach(s):s(t),this}};F.accessor(["Content-Type","Content-Length","Accept","Accept-Encoding","User-Agent","Authorization"]);f.reduceDescriptors(F.prototype,({value:e},t)=>{let n=t[0].toUpperCase()+t.slice(1);return{get:()=>e,set(r){this[n]=r}}});f.freezeMethods(F);function yt(e,t){const n=this||je,r=t||n,i=F.from(r.headers);let s=r.data;return f.forEach(e,function(a){s=a.call(n,s,i.normalize(),t?t.status:void 0)}),i.normalize(),s}function pr(e){return!!(e&&e.__CANCEL__)}let De=class extends g{constructor(t,n,r){super(t??"canceled",g.ERR_CANCELED,n,r),this.name="CanceledError",this.__CANCEL__=!0}};function hr(e,t,n){const r=n.config.validateStatus;!n.status||!r||r(n.status)?e(n):t(new g("Request failed with status code "+n.status,[g.ERR_BAD_REQUEST,g.ERR_BAD_RESPONSE][Math.floor(n.status/100)-4],n.config,n.request,n))}function Js(e){const t=/^([-+\w]{1,25})(:?\/\/|:)/.exec(e);return t&&t[1]||""}function Vs(e,t){e=e||10;const n=new Array(e),r=new Array(e);let i=0,s=0,o;return t=t!==void 0?t:1e3,function(c){const u=Date.now(),l=r[s];o||(o=u),n[i]=c,r[i]=u;let h=s,y=0;for(;h!==i;)y+=n[h++],h=h%e;if(i=(i+1)%e,i===s&&(s=(s+1)%e),u-o<t)return;const x=l&&u-l;return x?Math.round(y*1e3/x):void 0}}function Xs(e,t){let n=0,r=1e3/t,i,s;const o=(u,l=Date.now())=>{n=l,i=null,s&&(clearTimeout(s),s=null),e(...u)};return[(...u)=>{const l=Date.now(),h=l-n;h>=r?o(u,l):(i=u,s||(s=setTimeout(()=>{s=null,o(i)},r-h)))},()=>i&&o(i)]}const Qe=(e,t,n=3)=>{let r=0;const i=Vs(50,250);return Xs(s=>{const o=s.loaded,a=s.lengthComputable?s.total:void 0,c=o-r,u=i(c),l=o<=a;r=o;const h={loaded:o,total:a,progress:a?o/a:void 0,bytes:c,rate:u||void 0,estimated:u&&a&&l?(a-o)/u:void 0,event:s,lengthComputable:a!=null,[t?"download":"upload"]:!0};e(h)},n)},Cn=(e,t)=>{const n=e!=null;return[r=>t[0]({lengthComputable:n,total:e,loaded:r}),t[1]]},Pn=e=>(...t)=>f.asap(()=>e(...t)),Gs=T.hasStandardBrowserEnv?((e,t)=>n=>(n=new URL(n,T.origin),e.protocol===n.protocol&&e.host===n.host&&(t||e.port===n.port)))(new URL(T.origin),T.navigator&&/(msie|trident)/i.test(T.navigator.userAgent)):()=>!0,Ys=T.hasStandardBrowserEnv?{write(e,t,n,r,i,s,o){if(typeof document>"u")return;const a=[`${e}=${encodeURIComponent(t)}`];f.isNumber(n)&&a.push(`expires=${new Date(n).toUTCString()}`),f.isString(r)&&a.push(`path=${r}`),f.isString(i)&&a.push(`domain=${i}`),s===!0&&a.push("secure"),f.isString(o)&&a.push(`SameSite=${o}`),document.cookie=a.join("; ")},read(e){if(typeof document>"u")return null;const t=document.cookie.match(new RegExp("(?:^|; )"+e+"=([^;]*)"));return t?decodeURIComponent(t[1]):null},remove(e){this.write(e,"",Date.now()-864e5,"/")}}:{write(){},read(){return null},remove(){}};function Zs(e){return typeof e!="string"?!1:/^([a-z][a-z\d+\-.]*:)?\/\//i.test(e)}function Qs(e,t){return t?e.replace(/\/?\/$/,"")+"/"+t.replace(/^\/+/,""):e}function _r(e,t,n){let r=!Zs(t);return e&&(r||n==!1)?Qs(e,t):t}const Nn=e=>e instanceof F?{...e}:e;function re(e,t){t=t||{};const n={};function r(u,l,h,y){return f.isPlainObject(u)&&f.isPlainObject(l)?f.merge.call({caseless:y},u,l):f.isPlainObject(l)?f.merge({},l):f.isArray(l)?l.slice():l}function i(u,l,h,y){if(f.isUndefined(l)){if(!f.isUndefined(u))return r(void 0,u,h,y)}else return r(u,l,h,y)}function s(u,l){if(!f.isUndefined(l))return r(void 0,l)}function o(u,l){if(f.isUndefined(l)){if(!f.isUndefined(u))return r(void 0,u)}else return r(void 0,l)}function a(u,l,h){if(h in t)return r(u,l);if(h in e)return r(void 0,u)}const c={url:s,method:s,data:s,baseURL:o,transformRequest:o,transformResponse:o,paramsSerializer:o,timeout:o,timeoutMessage:o,withCredentials:o,withXSRFToken:o,adapter:o,responseType:o,xsrfCookieName:o,xsrfHeaderName:o,onUploadProgress:o,onDownloadProgress:o,decompress:o,maxContentLength:o,maxBodyLength:o,beforeRedirect:o,transport:o,httpAgent:o,httpsAgent:o,cancelToken:o,socketPath:o,responseEncoding:o,validateStatus:a,headers:(u,l,h)=>i(Nn(u),Nn(l),h,!0)};return f.forEach(Object.keys({...e,...t}),function(l){if(l==="__proto__"||l==="constructor"||l==="prototype")return;const h=f.hasOwnProp(c,l)?c[l]:i,y=h(e[l],t[l],l);f.isUndefined(y)&&h!==a||(n[l]=y)}),n}const mr=e=>{const t=re({},e);let{data:n,withXSRFToken:r,xsrfHeaderName:i,xsrfCookieName:s,headers:o,auth:a}=t;if(t.headers=o=F.from(o),t.url=fr(_r(t.baseURL,t.url,t.allowAbsoluteUrls),e.params,e.paramsSerializer),a&&o.set("Authorization","Basic "+btoa((a.username||"")+":"+(a.password?unescape(encodeURIComponent(a.password)):""))),f.isFormData(n)){if(T.hasStandardBrowserEnv||T.hasStandardBrowserWebWorkerEnv)o.setContentType(void 0);else if(f.isFunction(n.getHeaders)){const c=n.getHeaders(),u=["content-type","content-length"];Object.entries(c).forEach(([l,h])=>{u.includes(l.toLowerCase())&&o.set(l,h)})}}if(T.hasStandardBrowserEnv&&(r&&f.isFunction(r)&&(r=r(t)),r||r!==!1&&Gs(t.url))){const c=i&&s&&Ys.read(s);c&&o.set(i,c)}return t},eo=typeof XMLHttpRequest<"u",to=eo&&function(e){return new Promise(function(n,r){const i=mr(e);let s=i.data;const o=F.from(i.headers).normalize();let{responseType:a,onUploadProgress:c,onDownloadProgress:u}=i,l,h,y,x,p;function _(){x&&x(),p&&p(),i.cancelToken&&i.cancelToken.unsubscribe(l),i.signal&&i.signal.removeEventListener("abort",l)}let d=new XMLHttpRequest;d.open(i.method.toUpperCase(),i.url,!0),d.timeout=i.timeout;function m(){if(!d)return;const b=F.from("getAllResponseHeaders"in d&&d.getAllResponseHeaders()),v={data:!a||a==="text"||a==="json"?d.responseText:d.response,status:d.status,statusText:d.statusText,headers:b,config:e,request:d};hr(function(C){n(C),_()},function(C){r(C),_()},v),d=null}"onloadend"in d?d.onloadend=m:d.onreadystatechange=function(){!d||d.readyState!==4||d.status===0&&!(d.responseURL&&d.responseURL.indexOf("file:")===0)||setTimeout(m)},d.onabort=function(){d&&(r(new g("Request aborted",g.ECONNABORTED,e,d)),d=null)},d.onerror=function(E){const v=E&&E.message?E.message:"Network Error",L=new g(v,g.ERR_NETWORK,e,d);L.event=E||null,r(L),d=null},d.ontimeout=function(){let E=i.timeout?"timeout of "+i.timeout+"ms exceeded":"timeout exceeded";const v=i.transitional||Kt;i.timeoutErrorMessage&&(E=i.timeoutErrorMessage),r(new g(E,v.clarifyTimeoutError?g.ETIMEDOUT:g.ECONNABORTED,e,d)),d=null},s===void 0&&o.setContentType(null),"setRequestHeader"in d&&f.forEach(o.toJSON(),function(E,v){d.setRequestHeader(v,E)}),f.isUndefined(i.withCredentials)||(d.withCredentials=!!i.withCredentials),a&&a!=="json"&&(d.responseType=i.responseType),u&&([y,p]=Qe(u,!0),d.addEventListener("progress",y)),c&&d.upload&&([h,x]=Qe(c),d.upload.addEventListener("progress",h),d.upload.addEventListener("loadend",x)),(i.cancelToken||i.signal)&&(l=b=>{d&&(r(!b||b.type?new De(null,e,d):b),d.abort(),d=null)},i.cancelToken&&i.cancelToken.subscribe(l),i.signal&&(i.signal.aborted?l():i.signal.addEventListener("abort",l)));const w=Js(i.url);if(w&&T.protocols.indexOf(w)===-1){r(new g("Unsupported protocol "+w+":",g.ERR_BAD_REQUEST,e));return}d.send(s||null)})},no=(e,t)=>{const{length:n}=e=e?e.filter(Boolean):[];if(t||n){let r=new AbortController,i;const s=function(u){if(!i){i=!0,a();const l=u instanceof Error?u:this.reason;r.abort(l instanceof g?l:new De(l instanceof Error?l.message:l))}};let o=t&&setTimeout(()=>{o=null,s(new g(`timeout of ${t}ms exceeded`,g.ETIMEDOUT))},t);const a=()=>{e&&(o&&clearTimeout(o),o=null,e.forEach(u=>{u.unsubscribe?u.unsubscribe(s):u.removeEventListener("abort",s)}),e=null)};e.forEach(u=>u.addEventListener("abort",s));const{signal:c}=r;return c.unsubscribe=()=>f.asap(a),c}},ro=function*(e,t){let n=e.byteLength;if(n<t){yield e;return}let r=0,i;for(;r<n;)i=r+t,yield e.slice(r,i),r=i},io=async function*(e,t){for await(const n of so(e))yield*ro(n,t)},so=async function*(e){if(e[Symbol.asyncIterator]){yield*e;return}const t=e.getReader();try{for(;;){const{done:n,value:r}=await t.read();if(n)break;yield r}}finally{await t.cancel()}},Mn=(e,t,n,r)=>{const i=io(e,t);let s=0,o,a=c=>{o||(o=!0,r&&r(c))};return new ReadableStream({async pull(c){try{const{done:u,value:l}=await i.next();if(u){a(),c.close();return}let h=l.byteLength;if(n){let y=s+=h;n(y)}c.enqueue(new Uint8Array(l))}catch(u){throw a(u),u}},cancel(c){return a(c),i.return()}},{highWaterMark:2})},Fn=64*1024,{isFunction:qe}=f,oo=(({Request:e,Response:t})=>({Request:e,Response:t}))(f.global),{ReadableStream:Ln,TextEncoder:In}=f.global,jn=(e,...t)=>{try{return!!e(...t)}catch{return!1}},ao=e=>{e=f.merge.call({skipUndefined:!0},oo,e);const{fetch:t,Request:n,Response:r}=e,i=t?qe(t):typeof fetch=="function",s=qe(n),o=qe(r);if(!i)return!1;const a=i&&qe(Ln),c=i&&(typeof In=="function"?(p=>_=>p.encode(_))(new In):async p=>new Uint8Array(await new n(p).arrayBuffer())),u=s&&a&&jn(()=>{let p=!1;const _=new n(T.origin,{body:new Ln,method:"POST",get duplex(){return p=!0,"half"}}).headers.has("Content-Type");return p&&!_}),l=o&&a&&jn(()=>f.isReadableStream(new r("").body)),h={stream:l&&(p=>p.body)};i&&["text","arrayBuffer","blob","formData","stream"].forEach(p=>{!h[p]&&(h[p]=(_,d)=>{let m=_&&_[p];if(m)return m.call(_);throw new g(`Response type '${p}' is not supported`,g.ERR_NOT_SUPPORT,d)})});const y=async p=>{if(p==null)return 0;if(f.isBlob(p))return p.size;if(f.isSpecCompliantForm(p))return(await new n(T.origin,{method:"POST",body:p}).arrayBuffer()).byteLength;if(f.isArrayBufferView(p)||f.isArrayBuffer(p))return p.byteLength;if(f.isURLSearchParams(p)&&(p=p+""),f.isString(p))return(await c(p)).byteLength},x=async(p,_)=>{const d=f.toFiniteNumber(p.getContentLength());return d??y(_)};return async p=>{let{url:_,method:d,data:m,signal:w,cancelToken:b,timeout:E,onDownloadProgress:v,onUploadProgress:L,responseType:C,headers:xe,withCredentials:ue="same-origin",fetchOptions:$e}=mr(p),yn=t||fetch;C=C?(C+"").toLowerCase():"text";let Ue=no([w,b&&b.toAbortSignal()],E),Ee=null;const V=Ue&&Ue.unsubscribe&&(()=>{Ue.unsubscribe()});let bn;try{if(L&&u&&d!=="get"&&d!=="head"&&(bn=await x(xe,m))!==0){let H=new n(_,{method:"POST",body:m,duplex:"half"}),le;if(f.isFormData(m)&&(le=H.headers.get("content-type"))&&xe.setContentType(le),H.body){const[_t,ke]=Cn(bn,Qe(Pn(L)));m=Mn(H.body,Fn,_t,ke)}}f.isString(ue)||(ue=ue?"include":"omit");const N=s&&"credentials"in n.prototype,wn={...$e,signal:Ue,method:d.toUpperCase(),headers:xe.normalize().toJSON(),body:m,duplex:"half",credentials:N?ue:void 0};Ee=s&&new n(_,wn);let q=await(s?yn(Ee,$e):yn(_,wn));const xn=l&&(C==="stream"||C==="response");if(l&&(v||xn&&V)){const H={};["status","statusText","headers"].forEach(En=>{H[En]=q[En]});const le=f.toFiniteNumber(q.headers.get("content-length")),[_t,ke]=v&&Cn(le,Qe(Pn(v),!0))||[];q=new r(Mn(q.body,Fn,_t,()=>{ke&&ke(),V&&V()}),H)}C=C||"text";let ji=await h[f.findKey(h,C)||"text"](q,p);return!xn&&V&&V(),await new Promise((H,le)=>{hr(H,le,{data:ji,headers:F.from(q.headers),status:q.status,statusText:q.statusText,config:p,request:Ee})})}catch(N){throw V&&V(),N&&N.name==="TypeError"&&/Load failed|fetch/i.test(N.message)?Object.assign(new g("Network Error",g.ERR_NETWORK,p,Ee,N&&N.response),{cause:N.cause||N}):g.from(N,N&&N.code,p,Ee,N&&N.response)}}},co=new Map,gr=e=>{let t=e&&e.env||{};const{fetch:n,Request:r,Response:i}=t,s=[r,i,n];let o=s.length,a=o,c,u,l=co;for(;a--;)c=s[a],u=l.get(c),u===void 0&&l.set(c,u=a?new Map:ao(t)),l=u;return u};gr();const Jt={http:Os,xhr:to,fetch:{get:gr}};f.forEach(Jt,(e,t)=>{if(e){try{Object.defineProperty(e,"name",{value:t})}catch{}Object.defineProperty(e,"adapterName",{value:t})}});const Dn=e=>`- ${e}`,uo=e=>f.isFunction(e)||e===null||e===!1;function lo(e,t){e=f.isArray(e)?e:[e];const{length:n}=e;let r,i;const s={};for(let o=0;o<n;o++){r=e[o];let a;if(i=r,!uo(r)&&(i=Jt[(a=String(r)).toLowerCase()],i===void 0))throw new g(`Unknown adapter '${a}'`);if(i&&(f.isFunction(i)||(i=i.get(t))))break;s[a||"#"+o]=i}if(!i){const o=Object.entries(s).map(([c,u])=>`adapter ${c} `+(u===!1?"is not supported by the environment":"is not available in the build"));let a=n?o.length>1?`since :
+`+o.map(Dn).join(`
+`):" "+Dn(o[0]):"as no adapter specified";throw new g("There is no suitable adapter to dispatch the request "+a,"ERR_NOT_SUPPORT")}return i}const yr={getAdapter:lo,adapters:Jt};function bt(e){if(e.cancelToken&&e.cancelToken.throwIfRequested(),e.signal&&e.signal.aborted)throw new De(null,e)}function Bn(e){return bt(e),e.headers=F.from(e.headers),e.data=yt.call(e,e.transformRequest),["post","put","patch"].indexOf(e.method)!==-1&&e.headers.setContentType("application/x-www-form-urlencoded",!1),yr.getAdapter(e.adapter||je.adapter,e)(e).then(function(r){return bt(e),r.data=yt.call(e,e.transformResponse,r),r.headers=F.from(r.headers),r},function(r){return pr(r)||(bt(e),r&&r.response&&(r.response.data=yt.call(e,e.transformResponse,r.response),r.response.headers=F.from(r.response.headers))),Promise.reject(r)})}const br="1.13.6",at={};["object","boolean","number","function","string","symbol"].forEach((e,t)=>{at[e]=function(r){return typeof r===e||"a"+(t<1?"n ":" ")+e}});const $n={};at.transitional=function(t,n,r){function i(s,o){return"[Axios v"+br+"] Transitional option '"+s+"'"+o+(r?". "+r:"")}return(s,o,a)=>{if(t===!1)throw new g(i(o," has been removed"+(n?" in "+n:"")),g.ERR_DEPRECATED);return n&&!$n[o]&&($n[o]=!0,console.warn(i(o," has been deprecated since v"+n+" and will be removed in the near future"))),t?t(s,o,a):!0}};at.spelling=function(t){return(n,r)=>(console.warn(`${r} is likely a misspelling of ${t}`),!0)};function fo(e,t,n){if(typeof e!="object")throw new g("options must be an object",g.ERR_BAD_OPTION_VALUE);const r=Object.keys(e);let i=r.length;for(;i-- >0;){const s=r[i],o=t[s];if(o){const a=e[s],c=a===void 0||o(a,s,e);if(c!==!0)throw new g("option "+s+" must be "+c,g.ERR_BAD_OPTION_VALUE);continue}if(n!==!0)throw new g("Unknown option "+s,g.ERR_BAD_OPTION)}}const Ye={assertOptions:fo,validators:at},I=Ye.validators;let Z=class{constructor(t){this.defaults=t||{},this.interceptors={request:new vn,response:new vn}}async request(t,n){try{return await this._request(t,n)}catch(r){if(r instanceof Error){let i={};Error.captureStackTrace?Error.captureStackTrace(i):i=new Error;const s=i.stack?i.stack.replace(/^.+\n/,""):"";try{r.stack?s&&!String(r.stack).endsWith(s.replace(/^.+\n.+\n/,""))&&(r.stack+=`
+`+s):r.stack=s}catch{}}throw r}}_request(t,n){typeof t=="string"?(n=n||{},n.url=t):n=t||{},n=re(this.defaults,n);const{transitional:r,paramsSerializer:i,headers:s}=n;r!==void 0&&Ye.assertOptions(r,{silentJSONParsing:I.transitional(I.boolean),forcedJSONParsing:I.transitional(I.boolean),clarifyTimeoutError:I.transitional(I.boolean),legacyInterceptorReqResOrdering:I.transitional(I.boolean)},!1),i!=null&&(f.isFunction(i)?n.paramsSerializer={serialize:i}:Ye.assertOptions(i,{encode:I.function,serialize:I.function},!0)),n.allowAbsoluteUrls!==void 0||(this.defaults.allowAbsoluteUrls!==void 0?n.allowAbsoluteUrls=this.defaults.allowAbsoluteUrls:n.allowAbsoluteUrls=!0),Ye.assertOptions(n,{baseUrl:I.spelling("baseURL"),withXsrfToken:I.spelling("withXSRFToken")},!0),n.method=(n.method||this.defaults.method||"get").toLowerCase();let o=s&&f.merge(s.common,s[n.method]);s&&f.forEach(["delete","get","head","post","put","patch","common"],p=>{delete s[p]}),n.headers=F.concat(o,s);const a=[];let c=!0;this.interceptors.request.forEach(function(_){if(typeof _.runWhen=="function"&&_.runWhen(n)===!1)return;c=c&&_.synchronous;const d=n.transitional||Kt;d&&d.legacyInterceptorReqResOrdering?a.unshift(_.fulfilled,_.rejected):a.push(_.fulfilled,_.rejected)});const u=[];this.interceptors.response.forEach(function(_){u.push(_.fulfilled,_.rejected)});let l,h=0,y;if(!c){const p=[Bn.bind(this),void 0];for(p.unshift(...a),p.push(...u),y=p.length,l=Promise.resolve(n);h<y;)l=l.then(p[h++],p[h++]);return l}y=a.length;let x=n;for(;h<y;){const p=a[h++],_=a[h++];try{x=p(x)}catch(d){_.call(this,d);break}}try{l=Bn.call(this,x)}catch(p){return Promise.reject(p)}for(h=0,y=u.length;h<y;)l=l.then(u[h++],u[h++]);return l}getUri(t){t=re(this.defaults,t);const n=_r(t.baseURL,t.url,t.allowAbsoluteUrls);return fr(n,t.params,t.paramsSerializer)}};f.forEach(["delete","get","head","options"],function(t){Z.prototype[t]=function(n,r){return this.request(re(r||{},{method:t,url:n,data:(r||{}).data}))}});f.forEach(["post","put","patch"],function(t){function n(r){return function(s,o,a){return this.request(re(a||{},{method:t,headers:r?{"Content-Type":"multipart/form-data"}:{},url:s,data:o}))}}Z.prototype[t]=n(),Z.prototype[t+"Form"]=n(!0)});let po=class wr{constructor(t){if(typeof t!="function")throw new TypeError("executor must be a function.");let n;this.promise=new Promise(function(s){n=s});const r=this;this.promise.then(i=>{if(!r._listeners)return;let s=r._listeners.length;for(;s-- >0;)r._listeners[s](i);r._listeners=null}),this.promise.then=i=>{let s;const o=new Promise(a=>{r.subscribe(a),s=a}).then(i);return o.cancel=function(){r.unsubscribe(s)},o},t(function(s,o,a){r.reason||(r.reason=new De(s,o,a),n(r.reason))})}throwIfRequested(){if(this.reason)throw this.reason}subscribe(t){if(this.reason){t(this.reason);return}this._listeners?this._listeners.push(t):this._listeners=[t]}unsubscribe(t){if(!this._listeners)return;const n=this._listeners.indexOf(t);n!==-1&&this._listeners.splice(n,1)}toAbortSignal(){const t=new AbortController,n=r=>{t.abort(r)};return this.subscribe(n),t.signal.unsubscribe=()=>this.unsubscribe(n),t.signal}static source(){let t;return{token:new wr(function(i){t=i}),cancel:t}}};function ho(e){return function(n){return e.apply(null,n)}}function _o(e){return f.isObject(e)&&e.isAxiosError===!0}const vt={Continue:100,SwitchingProtocols:101,Processing:102,EarlyHints:103,Ok:200,Created:201,Accepted:202,NonAuthoritativeInformation:203,NoContent:204,ResetContent:205,PartialContent:206,MultiStatus:207,AlreadyReported:208,ImUsed:226,MultipleChoices:300,MovedPermanently:301,Found:302,SeeOther:303,NotModified:304,UseProxy:305,Unused:306,TemporaryRedirect:307,PermanentRedirect:308,BadRequest:400,Unauthorized:401,PaymentRequired:402,Forbidden:403,NotFound:404,MethodNotAllowed:405,NotAcceptable:406,ProxyAuthenticationRequired:407,RequestTimeout:408,Conflict:409,Gone:410,LengthRequired:411,PreconditionFailed:412,PayloadTooLarge:413,UriTooLong:414,UnsupportedMediaType:415,RangeNotSatisfiable:416,ExpectationFailed:417,ImATeapot:418,MisdirectedRequest:421,UnprocessableEntity:422,Locked:423,FailedDependency:424,TooEarly:425,UpgradeRequired:426,PreconditionRequired:428,TooManyRequests:429,RequestHeaderFieldsTooLarge:431,UnavailableForLegalReasons:451,InternalServerError:500,NotImplemented:501,BadGateway:502,ServiceUnavailable:503,GatewayTimeout:504,HttpVersionNotSupported:505,VariantAlsoNegotiates:506,InsufficientStorage:507,LoopDetected:508,NotExtended:510,NetworkAuthenticationRequired:511,WebServerIsDown:521,ConnectionTimedOut:522,OriginIsUnreachable:523,TimeoutOccurred:524,SslHandshakeFailed:525,InvalidSslCertificate:526};Object.entries(vt).forEach(([e,t])=>{vt[t]=e});function xr(e){const t=new Z(e),n=er(Z.prototype.request,t);return f.extend(n,Z.prototype,t,{allOwnKeys:!0}),f.extend(n,t,null,{allOwnKeys:!0}),n.create=function(i){return xr(re(e,i))},n}const O=xr(je);O.Axios=Z;O.CanceledError=De;O.CancelToken=po;O.isCancel=pr;O.VERSION=br;O.toFormData=ot;O.AxiosError=g;O.Cancel=O.CanceledError;O.all=function(t){return Promise.all(t)};O.spread=ho;O.isAxiosError=_o;O.mergeConfig=re;O.AxiosHeaders=F;O.formToJSON=e=>dr(f.isHTMLForm(e)?new FormData(e):e);O.getAdapter=yr.getAdapter;O.HttpStatusCode=vt;O.default=O;const{Axios:Ic,AxiosError:jc,CanceledError:Dc,isCancel:Bc,CancelToken:$c,VERSION:Uc,all:kc,Cancel:qc,isAxiosError:Hc,spread:zc,toFormData:Kc,AxiosHeaders:Wc,HttpStatusCode:Jc,formToJSON:Vc,getAdapter:Xc,mergeConfig:Gc}=O;window.axios=O;window.axios.defaults.headers.common["X-Requested-With"]="XMLHttpRequest";var Tt=!1,Ct=!1,Q=[],Pt=-1,Vt=!1;function mo(e){bo(e)}function go(){Vt=!0}function yo(){Vt=!1,Er()}function bo(e){Q.includes(e)||Q.push(e),Er()}function wo(e){let t=Q.indexOf(e);t!==-1&&t>Pt&&Q.splice(t,1)}function Er(){if(!Ct&&!Tt){if(Vt)return;Tt=!0,queueMicrotask(xo)}}function xo(){Tt=!1,Ct=!0;for(let e=0;e<Q.length;e++)Q[e](),Pt=e;Q.length=0,Pt=-1,Ct=!1}var me,ce,ge,Sr,Nt=!0;function Eo(e){Nt=!1,e(),Nt=!0}function So(e){me=e.reactive,ge=e.release,ce=t=>e.effect(t,{scheduler:n=>{Nt?mo(n):n()}}),Sr=e.raw}function Un(e){ce=e}function Ao(e){let t=()=>{};return[r=>{let i=ce(r);return e._x_effects||(e._x_effects=new Set,e._x_runEffects=()=>{e._x_effects.forEach(s=>s())}),e._x_effects.add(i),t=()=>{i!==void 0&&(e._x_effects.delete(i),ge(i))},i},()=>{t()}]}function Ar(e,t){let n=!0,r,i=ce(()=>{let s=e();if(JSON.stringify(s),!n&&(typeof s=="object"||s!==r)){let o=r;queueMicrotask(()=>{t(s,o)})}r=s,n=!1});return()=>ge(i)}async function Oo(e){go();try{await e(),await Promise.resolve()}finally{yo()}}var Or=[],Rr=[],vr=[];function Ro(e){vr.push(e)}function Xt(e,t){typeof t=="function"?(e._x_cleanups||(e._x_cleanups=[]),e._x_cleanups.push(t)):(t=e,Rr.push(t))}function Tr(e){Or.push(e)}function Cr(e,t,n){e._x_attributeCleanups||(e._x_attributeCleanups={}),e._x_attributeCleanups[t]||(e._x_attributeCleanups[t]=[]),e._x_attributeCleanups[t].push(n)}function Pr(e,t){e._x_attributeCleanups&&Object.entries(e._x_attributeCleanups).forEach(([n,r])=>{(t===void 0||t.includes(n))&&(r.forEach(i=>i()),delete e._x_attributeCleanups[n])})}function vo(e){for(e._x_effects?.forEach(wo);e._x_cleanups?.length;)e._x_cleanups.pop()()}var Gt=new MutationObserver(en),Yt=!1;function Zt(){Gt.observe(document,{subtree:!0,childList:!0,attributes:!0,attributeOldValue:!0}),Yt=!0}function Nr(){To(),Gt.disconnect(),Yt=!1}var Ae=[];function To(){let e=Gt.takeRecords();Ae.push(()=>e.length>0&&en(e));let t=Ae.length;queueMicrotask(()=>{if(Ae.length===t)for(;Ae.length>0;)Ae.shift()()})}function A(e){if(!Yt)return e();Nr();let t=e();return Zt(),t}var Qt=!1,et=[];function Co(){Qt=!0}function Po(){Qt=!1,en(et),et=[]}function en(e){if(Qt){et=et.concat(e);return}let t=[],n=new Set,r=new Map,i=new Map;for(let s=0;s<e.length;s++)if(!e[s].target._x_ignoreMutationObserver&&(e[s].type==="childList"&&(e[s].removedNodes.forEach(o=>{o.nodeType===1&&o._x_marker&&n.add(o)}),e[s].addedNodes.forEach(o=>{if(o.nodeType===1){if(n.has(o)){n.delete(o);return}o._x_marker||t.push(o)}})),e[s].type==="attributes")){let o=e[s].target,a=e[s].attributeName,c=e[s].oldValue,u=()=>{r.has(o)||r.set(o,[]),r.get(o).push({name:a,value:o.getAttribute(a)})},l=()=>{i.has(o)||i.set(o,[]),i.get(o).push(a)};o.hasAttribute(a)&&c===null?u():o.hasAttribute(a)?(l(),u()):l()}i.forEach((s,o)=>{Pr(o,s)}),r.forEach((s,o)=>{Or.forEach(a=>a(o,s))});for(let s of n)t.some(o=>o.contains(s))||Rr.forEach(o=>o(s));for(let s of t)s.isConnected&&vr.forEach(o=>o(s));t=null,n=null,r=null,i=null}function Mr(e){return se(ie(e))}function Be(e,t,n){return e._x_dataStack=[t,...ie(n||e)],()=>{e._x_dataStack=e._x_dataStack.filter(r=>r!==t)}}function ie(e){return e._x_dataStack?e._x_dataStack:typeof ShadowRoot=="function"&&e instanceof ShadowRoot?ie(e.host):e.parentNode?ie(e.parentNode):[]}function se(e){return new Proxy({objects:e},No)}var No={ownKeys({objects:e}){return Array.from(new Set(e.flatMap(t=>Object.keys(t))))},has({objects:e},t){return t==Symbol.unscopables?!1:e.some(n=>Object.prototype.hasOwnProperty.call(n,t)||Reflect.has(n,t))},get({objects:e},t,n){return t=="toJSON"?Mo:Reflect.get(e.find(r=>Reflect.has(r,t))||{},t,n)},set({objects:e},t,n,r){const i=e.find(o=>Object.prototype.hasOwnProperty.call(o,t))||e[e.length-1],s=Object.getOwnPropertyDescriptor(i,t);return s?.set&&s?.get?s.set.call(r,n)||!0:Reflect.set(i,t,n)}};function Mo(){return Reflect.ownKeys(this).reduce((t,n)=>(t[n]=Reflect.get(this,n),t),{})}function tn(e){let t=r=>typeof r=="object"&&!Array.isArray(r)&&r!==null,n=(r,i="")=>{Object.entries(Object.getOwnPropertyDescriptors(r)).forEach(([s,{value:o,enumerable:a}])=>{if(a===!1||o===void 0||typeof o=="object"&&o!==null&&o.__v_skip)return;let c=i===""?s:`${i}.${s}`;typeof o=="object"&&o!==null&&o._x_interceptor?r[s]=o.initialize(e,c,s):t(o)&&o!==r&&!(o instanceof Element)&&n(o,c)})};return n(e)}function Fr(e,t=()=>{}){let n={initialValue:void 0,_x_interceptor:!0,initialize(r,i,s){return e(this.initialValue,()=>Fo(r,i),o=>Mt(r,i,o),i,s)}};return t(n),r=>{if(typeof r=="object"&&r!==null&&r._x_interceptor){let i=n.initialize.bind(n);n.initialize=(s,o,a)=>{let c=r.initialize(s,o,a);return n.initialValue=c,i(s,o,a)}}else n.initialValue=r;return n}}function Fo(e,t){return t.split(".").reduce((n,r)=>n[r],e)}function Mt(e,t,n){if(typeof t=="string"&&(t=t.split(".")),t.length===1)e[t[0]]=n;else{if(t.length===0)throw error;return e[t[0]]||(e[t[0]]={}),Mt(e[t[0]],t.slice(1),n)}}var Lr={};function $(e,t){Lr[e]=t}function Pe(e,t){let n=Lo(t);return Object.entries(Lr).forEach(([r,i])=>{Object.defineProperty(e,`$${r}`,{get(){return i(t,n)},enumerable:!1})}),e}function Lo(e){let[t,n]=qr(e),r={interceptor:Fr,...t};return Xt(e,n),r}function Io(e,t,n,...r){try{return n(...r)}catch(i){Ne(i,e,t)}}function Ne(...e){return Ir(...e)}var Ir=Do;function jo(e){Ir=e}function Do(e,t,n=void 0){e=Object.assign(e??{message:"No error message given."},{el:t,expression:n}),console.warn(`Alpine Expression Error: ${e.message}
+
+${n?'Expression: "'+n+`"
+
+`:""}`,t),setTimeout(()=>{throw e},0)}var de=!0;function jr(e){let t=de;de=!1;let n=e();return de=t,n}function ee(e,t,n={}){let r;return P(e,t)(i=>r=i,n),r}function P(...e){return Dr(...e)}var Dr=$r;function Bo(e){Dr=e}var Br;function $o(e){Br=e}function $r(e,t){let n={};Pe(n,e);let r=[n,...ie(e)],i=typeof t=="function"?Uo(r,t):qo(r,t,e);return Io.bind(null,e,t,i)}function Uo(e,t){return(n=()=>{},{scope:r={},params:i=[],context:s}={})=>{if(!de){Me(n,t,se([r,...e]),i);return}let o=t.apply(se([r,...e]),i);Me(n,o)}}var wt={};function ko(e,t){if(wt[e])return wt[e];let n=Object.getPrototypeOf(async function(){}).constructor,r=/^[\n\s]*if.*\(.*\)/.test(e.trim())||/^(let|const)\s/.test(e.trim())?`(async()=>{ ${e} })()`:e,s=(()=>{try{let o=new n(["__self","scope"],`with (scope) { __self.result = ${r} }; __self.finished = true; return __self.result;`);return Object.defineProperty(o,"name",{value:`[Alpine] ${e}`}),o}catch(o){return Ne(o,t,e),Promise.resolve()}})();return wt[e]=s,s}function qo(e,t,n){let r=ko(t,n);return(i=()=>{},{scope:s={},params:o=[],context:a}={})=>{r.result=void 0,r.finished=!1;let c=se([s,...e]);if(typeof r=="function"){let u=r.call(a,r,c).catch(l=>Ne(l,n,t));r.finished?(Me(i,r.result,c,o,n),r.result=void 0):u.then(l=>{Me(i,l,c,o,n)}).catch(l=>Ne(l,n,t)).finally(()=>r.result=void 0)}}}function Me(e,t,n,r,i){if(de&&typeof t=="function"){let s=t.apply(n,r);s instanceof Promise?s.then(o=>Me(e,o,n,r)).catch(o=>Ne(o,i,t)):e(s)}else typeof t=="object"&&t instanceof Promise?t.then(s=>e(s)):e(t)}function Ho(...e){return Br(...e)}function zo(e,t,n={}){let r={};Pe(r,e);let i=[r,...ie(e)],s=se([n.scope??{},...i]),o=n.params??[];if(t.includes("await")){let a=Object.getPrototypeOf(async function(){}).constructor,c=/^[\n\s]*if.*\(.*\)/.test(t.trim())||/^(let|const)\s/.test(t.trim())?`(async()=>{ ${t} })()`:t;return new a(["scope"],`with (scope) { let __result = ${c}; return __result }`).call(n.context,s)}else{let a=/^[\n\s]*if.*\(.*\)/.test(t.trim())||/^(let|const)\s/.test(t.trim())?`(()=>{ ${t} })()`:t,u=new Function(["scope"],`with (scope) { let __result = ${a}; return __result }`).call(n.context,s);return typeof u=="function"&&de?u.apply(s,o):u}}var nn="x-";function ye(e=""){return nn+e}function Ko(e){nn=e}var tt={};function R(e,t){return tt[e]=t,{before(n){if(!tt[n]){console.warn(String.raw`Cannot find directive \`${n}\`. \`${e}\` will use the default order of execution`);return}const r=Y.indexOf(n);Y.splice(r>=0?r:Y.indexOf("DEFAULT"),0,e)}}}function Wo(e){return Object.keys(tt).includes(e)}function rn(e,t,n){if(t=Array.from(t),e._x_virtualDirectives){let s=Object.entries(e._x_virtualDirectives).map(([a,c])=>({name:a,value:c})),o=Ur(s);s=s.map(a=>o.find(c=>c.name===a.name)?{name:`x-bind:${a.name}`,value:`"${a.value}"`}:a),t=t.concat(s)}let r={};return t.map(Kr((s,o)=>r[s]=o)).filter(Jr).map(Xo(r,n)).sort(Go).map(s=>Vo(e,s))}function Ur(e){return Array.from(e).map(Kr()).filter(t=>!Jr(t))}var Ft=!1,ve=new Map,kr=Symbol();function Jo(e){Ft=!0;let t=Symbol();kr=t,ve.set(t,[]);let n=()=>{for(;ve.get(t).length;)ve.get(t).shift()();ve.delete(t)},r=()=>{Ft=!1,n()};e(n),r()}function qr(e){let t=[],n=a=>t.push(a),[r,i]=Ao(e);return t.push(i),[{Alpine:we,effect:r,cleanup:n,evaluateLater:P.bind(P,e),evaluate:ee.bind(ee,e)},()=>t.forEach(a=>a())]}function Vo(e,t){let n=()=>{},r=tt[t.type]||n,[i,s]=qr(e);Cr(e,t.original,s);let o=()=>{e._x_ignore||e._x_ignoreSelf||(r.inline&&r.inline(e,t,i),r=r.bind(r,e,t,i),Ft?ve.get(kr).push(r):r())};return o.runCleanups=s,o}var Hr=(e,t)=>({name:n,value:r})=>(n.startsWith(e)&&(n=n.replace(e,t)),{name:n,value:r}),zr=e=>e;function Kr(e=()=>{}){return({name:t,value:n})=>{let{name:r,value:i}=Wr.reduce((s,o)=>o(s),{name:t,value:n});return r!==t&&e(r,t),{name:r,value:i}}}var Wr=[];function sn(e){Wr.push(e)}function Jr({name:e}){return Vr().test(e)}var Vr=()=>new RegExp(`^${nn}([^:^.]+)\\b`);function Xo(e,t){return({name:n,value:r})=>{n===r&&(r="");let i=n.match(Vr()),s=n.match(/:([a-zA-Z0-9\-_:]+)/),o=n.match(/\.[^.\]]+(?=[^\]]*$)/g)||[],a=t||e[n]||n;return{type:i?i[1]:null,value:s?s[1]:null,modifiers:o.map(c=>c.replace(".","")),expression:r,original:a}}}var Lt="DEFAULT",Y=["ignore","ref","data","id","anchor","bind","init","for","model","modelable","transition","show","if",Lt,"teleport"];function Go(e,t){let n=Y.indexOf(e.type)===-1?Lt:e.type,r=Y.indexOf(t.type)===-1?Lt:t.type;return Y.indexOf(n)-Y.indexOf(r)}function Te(e,t,n={}){e.dispatchEvent(new CustomEvent(t,{detail:n,bubbles:!0,composed:!0,cancelable:!0}))}function oe(e,t){if(typeof ShadowRoot=="function"&&e instanceof ShadowRoot){Array.from(e.children).forEach(i=>oe(i,t));return}let n=!1;if(t(e,()=>n=!0),n)return;let r=e.firstElementChild;for(;r;)oe(r,t),r=r.nextElementSibling}function j(e,...t){console.warn(`Alpine Warning: ${e}`,...t)}var kn=!1;function Yo(){kn&&j("Alpine has already been initialized on this page. Calling Alpine.start() more than once can cause problems."),kn=!0,document.body||j("Unable to initialize. Trying to load Alpine before `<body>` is available. Did you forget to add `defer` in Alpine's `<script>` tag?"),Te(document,"alpine:init"),Te(document,"alpine:initializing"),Zt(),Ro(t=>k(t,oe)),Xt(t=>be(t)),Tr((t,n)=>{rn(t,n).forEach(r=>r())});let e=t=>!ct(t.parentElement,!0);Array.from(document.querySelectorAll(Yr().join(","))).filter(e).forEach(t=>{k(t)}),Te(document,"alpine:initialized"),setTimeout(()=>{ta()})}var on=[],Xr=[];function Gr(){return on.map(e=>e())}function Yr(){return on.concat(Xr).map(e=>e())}function Zr(e){on.push(e)}function Qr(e){Xr.push(e)}function ct(e,t=!1){return ae(e,n=>{if((t?Yr():Gr()).some(i=>n.matches(i)))return!0})}function ae(e,t){if(e){if(t(e))return e;if(e._x_teleportBack&&(e=e._x_teleportBack),e.parentNode instanceof ShadowRoot)return ae(e.parentNode.host,t);if(e.parentElement)return ae(e.parentElement,t)}}function Zo(e){return Gr().some(t=>e.matches(t))}var ei=[];function Qo(e){ei.push(e)}var ea=1;function k(e,t=oe,n=()=>{}){ae(e,r=>r._x_ignore)||Jo(()=>{t(e,(r,i)=>{r._x_marker||(n(r,i),ei.forEach(s=>s(r,i)),rn(r,r.attributes).forEach(s=>s()),r._x_ignore||(r._x_marker=ea++),r._x_ignore&&i())})})}function be(e,t=oe){t(e,n=>{vo(n),Pr(n),delete n._x_marker})}function ta(){[["ui","dialog",["[x-dialog], [x-popover]"]],["anchor","anchor",["[x-anchor]"]],["sort","sort",["[x-sort]"]]].forEach(([t,n,r])=>{Wo(n)||r.some(i=>{if(document.querySelector(i))return j(`found "${i}", but missing ${t} plugin`),!0})})}var It=[],an=!1;function cn(e=()=>{}){return queueMicrotask(()=>{an||setTimeout(()=>{jt()})}),new Promise(t=>{It.push(()=>{e(),t()})})}function jt(){for(an=!1;It.length;)It.shift()()}function na(){an=!0}function un(e,t){return Array.isArray(t)?qn(e,t.join(" ")):typeof t=="object"&&t!==null?ra(e,t):typeof t=="function"?un(e,t()):qn(e,t)}function qn(e,t){let n=i=>i.split(" ").filter(s=>!e.classList.contains(s)).filter(Boolean),r=i=>(e.classList.add(...i),()=>{e.classList.remove(...i)});return t=t===!0?t="":t||"",r(n(t))}function ra(e,t){let n=a=>a.split(" ").filter(Boolean),r=Object.entries(t).flatMap(([a,c])=>c?n(a):!1).filter(Boolean),i=Object.entries(t).flatMap(([a,c])=>c?!1:n(a)).filter(Boolean),s=[],o=[];return i.forEach(a=>{e.classList.contains(a)&&(e.classList.remove(a),o.push(a))}),r.forEach(a=>{e.classList.contains(a)||(e.classList.add(a),s.push(a))}),()=>{o.forEach(a=>e.classList.add(a)),s.forEach(a=>e.classList.remove(a))}}function ut(e,t){return typeof t=="object"&&t!==null?ia(e,t):sa(e,t)}function ia(e,t){let n={};return Object.entries(t).forEach(([r,i])=>{n[r]=e.style[r],r.startsWith("--")||(r=oa(r)),e.style.setProperty(r,i)}),setTimeout(()=>{e.style.length===0&&e.removeAttribute("style")}),()=>{ut(e,n)}}function sa(e,t){let n=e.getAttribute("style",t);return e.setAttribute("style",t),()=>{e.setAttribute("style",n||"")}}function oa(e){return e.replace(/([a-z])([A-Z])/g,"$1-$2").toLowerCase()}function Dt(e,t=()=>{}){let n=!1;return function(){n?t.apply(this,arguments):(n=!0,e.apply(this,arguments))}}R("transition",(e,{value:t,modifiers:n,expression:r},{evaluate:i})=>{typeof r=="function"&&(r=i(r)),r!==!1&&(!r||typeof r=="boolean"?ca(e,n,t):aa(e,r,t))});function aa(e,t,n){ti(e,un,""),{enter:i=>{e._x_transition.enter.during=i},"enter-start":i=>{e._x_transition.enter.start=i},"enter-end":i=>{e._x_transition.enter.end=i},leave:i=>{e._x_transition.leave.during=i},"leave-start":i=>{e._x_transition.leave.start=i},"leave-end":i=>{e._x_transition.leave.end=i}}[n](t)}function ca(e,t,n){ti(e,ut);let r=!t.includes("in")&&!t.includes("out")&&!n,i=r||t.includes("in")||["enter"].includes(n),s=r||t.includes("out")||["leave"].includes(n);t.includes("in")&&!r&&(t=t.filter((m,w)=>w<t.indexOf("out"))),t.includes("out")&&!r&&(t=t.filter((m,w)=>w>t.indexOf("out")));let o=!t.includes("opacity")&&!t.includes("scale"),a=o||t.includes("opacity"),c=o||t.includes("scale"),u=a?0:1,l=c?Oe(t,"scale",95)/100:1,h=Oe(t,"delay",0)/1e3,y=Oe(t,"origin","center"),x="opacity, transform",p=Oe(t,"duration",150)/1e3,_=Oe(t,"duration",75)/1e3,d="cubic-bezier(0.4, 0.0, 0.2, 1)";i&&(e._x_transition.enter.during={transformOrigin:y,transitionDelay:`${h}s`,transitionProperty:x,transitionDuration:`${p}s`,transitionTimingFunction:d},e._x_transition.enter.start={opacity:u,transform:`scale(${l})`},e._x_transition.enter.end={opacity:1,transform:"scale(1)"}),s&&(e._x_transition.leave.during={transformOrigin:y,transitionDelay:`${h}s`,transitionProperty:x,transitionDuration:`${_}s`,transitionTimingFunction:d},e._x_transition.leave.start={opacity:1,transform:"scale(1)"},e._x_transition.leave.end={opacity:u,transform:`scale(${l})`})}function ti(e,t,n={}){e._x_transition||(e._x_transition={enter:{during:n,start:n,end:n},leave:{during:n,start:n,end:n},in(r=()=>{},i=()=>{}){Bt(e,t,{during:this.enter.during,start:this.enter.start,end:this.enter.end},r,i)},out(r=()=>{},i=()=>{}){Bt(e,t,{during:this.leave.during,start:this.leave.start,end:this.leave.end},r,i)}})}window.Element.prototype._x_toggleAndCascadeWithTransitions=function(e,t,n,r){const i=document.visibilityState==="visible"?requestAnimationFrame:setTimeout;let s=()=>i(n);if(t){e._x_transition&&(e._x_transition.enter||e._x_transition.leave)?e._x_transition.enter&&(Object.entries(e._x_transition.enter.during).length||Object.entries(e._x_transition.enter.start).length||Object.entries(e._x_transition.enter.end).length)?e._x_transition.in(n):s():e._x_transition?e._x_transition.in(n):s();return}e._x_hidePromise=e._x_transition?new Promise((o,a)=>{e._x_transition.out(()=>{},()=>o(r)),e._x_transitioning&&e._x_transitioning.beforeCancel(()=>a({isFromCancelledTransition:!0}))}):Promise.resolve(r),queueMicrotask(()=>{let o=ni(e);o?(o._x_hideChildren||(o._x_hideChildren=[]),o._x_hideChildren.push(e)):i(()=>{let a=c=>{let u=Promise.all([c._x_hidePromise,...(c._x_hideChildren||[]).map(a)]).then(([l])=>l?.());return delete c._x_hidePromise,delete c._x_hideChildren,u};a(e).catch(c=>{if(!c.isFromCancelledTransition)throw c})})})};function ni(e){let t=e.parentNode;if(t)return t._x_hidePromise?t:ni(t)}function Bt(e,t,{during:n,start:r,end:i}={},s=()=>{},o=()=>{}){if(e._x_transitioning&&e._x_transitioning.cancel(),Object.keys(n).length===0&&Object.keys(r).length===0&&Object.keys(i).length===0){s(),o();return}let a,c,u;ua(e,{start(){a=t(e,r)},during(){c=t(e,n)},before:s,end(){a(),u=t(e,i)},after:o,cleanup(){c(),u()}})}function ua(e,t){let n,r,i,s=Dt(()=>{A(()=>{n=!0,r||t.before(),i||(t.end(),jt()),t.after(),e.isConnected&&t.cleanup(),delete e._x_transitioning})});e._x_transitioning={beforeCancels:[],beforeCancel(o){this.beforeCancels.push(o)},cancel:Dt(function(){for(;this.beforeCancels.length;)this.beforeCancels.shift()();s()}),finish:s},A(()=>{t.start(),t.during()}),na(),requestAnimationFrame(()=>{if(n)return;let o=Number(getComputedStyle(e).transitionDuration.replace(/,.*/,"").replace("s",""))*1e3,a=Number(getComputedStyle(e).transitionDelay.replace(/,.*/,"").replace("s",""))*1e3;o===0&&(o=Number(getComputedStyle(e).animationDuration.replace("s",""))*1e3),A(()=>{t.before()}),r=!0,requestAnimationFrame(()=>{n||(A(()=>{t.end()}),jt(),setTimeout(e._x_transitioning.finish,o+a),i=!0)})})}function Oe(e,t,n){if(e.indexOf(t)===-1)return n;const r=e[e.indexOf(t)+1];if(!r||t==="scale"&&isNaN(r))return n;if(t==="duration"||t==="delay"){let i=r.match(/([0-9]+)ms/);if(i)return i[1]}return t==="origin"&&["top","right","left","center","bottom"].includes(e[e.indexOf(t)+2])?[r,e[e.indexOf(t)+2]].join(" "):r}var K=!1;function J(e,t=()=>{}){return(...n)=>K?t(...n):e(...n)}function la(e){return(...t)=>K&&e(...t)}var ri=[];function lt(e){ri.push(e)}function fa(e,t){ri.forEach(n=>n(e,t)),K=!0,ii(()=>{k(t,(n,r)=>{r(n,()=>{})})}),K=!1}var $t=!1;function da(e,t){t._x_dataStack||(t._x_dataStack=e._x_dataStack),K=!0,$t=!0,ii(()=>{pa(t)}),K=!1,$t=!1}function pa(e){let t=!1;k(e,(r,i)=>{oe(r,(s,o)=>{if(t&&Zo(s))return o();t=!0,i(s,o)})})}function ii(e){let t=ce;Un((n,r)=>{let i=t(n);return ge(i),()=>{}}),e(),Un(t)}function si(e,t,n,r=[]){switch(e._x_bindings||(e._x_bindings=me({})),e._x_bindings[t]=n,t=r.includes("camel")?xa(t):t,t){case"value":ha(e,n);break;case"style":ma(e,n);break;case"class":_a(e,n);break;case"selected":case"checked":ga(e,t,n);break;default:oi(e,t,n);break}}function ha(e,t){if(ui(e))e.attributes.value===void 0&&(e.value=t),window.fromModel&&(typeof t=="boolean"?e.checked=Ze(e.value)===t:e.checked=Hn(e.value,t));else if(ln(e))Number.isInteger(t)?e.value=t:!Array.isArray(t)&&typeof t!="boolean"&&![null,void 0].includes(t)?e.value=String(t):Array.isArray(t)?e.checked=t.some(n=>Hn(n,e.value)):e.checked=!!t;else if(e.tagName==="SELECT")wa(e,t);else{if(e.value===t)return;e.value=t===void 0?"":t}}function _a(e,t){e._x_undoAddedClasses&&e._x_undoAddedClasses(),e._x_undoAddedClasses=un(e,t)}function ma(e,t){e._x_undoAddedStyles&&e._x_undoAddedStyles(),e._x_undoAddedStyles=ut(e,t)}function ga(e,t,n){oi(e,t,n),ba(e,t,n)}function oi(e,t,n){[null,void 0,!1].includes(n)&&Sa(t)?e.removeAttribute(t):(ai(t)&&(n=t),ya(e,t,n))}function ya(e,t,n){e.getAttribute(t)!=n&&e.setAttribute(t,n)}function ba(e,t,n){e[t]!==n&&(e[t]=n)}function wa(e,t){const n=[].concat(t).map(r=>r+"");Array.from(e.options).forEach(r=>{r.selected=n.includes(r.value)})}function xa(e){return e.toLowerCase().replace(/-(\w)/g,(t,n)=>n.toUpperCase())}function Hn(e,t){return e==t}function Ze(e){return[1,"1","true","on","yes",!0].includes(e)?!0:[0,"0","false","off","no",!1].includes(e)?!1:e?!!e:null}var Ea=new Set(["allowfullscreen","async","autofocus","autoplay","checked","controls","default","defer","disabled","formnovalidate","inert","ismap","itemscope","loop","multiple","muted","nomodule","novalidate","open","playsinline","readonly","required","reversed","selected","shadowrootclonable","shadowrootdelegatesfocus","shadowrootserializable"]);function ai(e){return Ea.has(e)}function Sa(e){return!["aria-pressed","aria-checked","aria-expanded","aria-selected"].includes(e)}function Aa(e,t,n){return e._x_bindings&&e._x_bindings[t]!==void 0?e._x_bindings[t]:ci(e,t,n)}function Oa(e,t,n,r=!0){if(e._x_bindings&&e._x_bindings[t]!==void 0)return e._x_bindings[t];if(e._x_inlineBindings&&e._x_inlineBindings[t]!==void 0){let i=e._x_inlineBindings[t];return i.extract=r,jr(()=>ee(e,i.expression))}return ci(e,t,n)}function ci(e,t,n){let r=e.getAttribute(t);return r===null?typeof n=="function"?n():n:r===""?!0:ai(t)?!![t,"true"].includes(r):r}function ln(e){return e.type==="checkbox"||e.localName==="ui-checkbox"||e.localName==="ui-switch"}function ui(e){return e.type==="radio"||e.localName==="ui-radio"}function li(e,t){let n;return function(){const r=this,i=arguments,s=function(){n=null,e.apply(r,i)};clearTimeout(n),n=setTimeout(s,t)}}function fi(e,t){let n;return function(){let r=this,i=arguments;n||(e.apply(r,i),n=!0,setTimeout(()=>n=!1,t))}}function di({get:e,set:t},{get:n,set:r}){let i=!0,s,o=ce(()=>{let a=e(),c=n();if(i)r(xt(a)),i=!1;else{let u=JSON.stringify(a),l=JSON.stringify(c);u!==s?r(xt(a)):u!==l&&t(xt(c))}s=JSON.stringify(e()),JSON.stringify(n())});return()=>{ge(o)}}function xt(e){return typeof e=="object"?JSON.parse(JSON.stringify(e)):e}function Ra(e){(Array.isArray(e)?e:[e]).forEach(n=>n(we))}var X={},zn=!1;function va(e,t){if(zn||(X=me(X),zn=!0),t===void 0)return X[e];X[e]=t,tn(X[e]),typeof t=="object"&&t!==null&&t.hasOwnProperty("init")&&typeof t.init=="function"&&X[e].init()}function Ta(){return X}var pi={};function Ca(e,t){let n=typeof t!="function"?()=>t:t;return e instanceof Element?hi(e,n()):(pi[e]=n,()=>{})}function Pa(e){return Object.entries(pi).forEach(([t,n])=>{Object.defineProperty(e,t,{get(){return(...r)=>n(...r)}})}),e}function hi(e,t,n){let r=[];for(;r.length;)r.pop()();let i=Object.entries(t).map(([o,a])=>({name:o,value:a})),s=Ur(i);return i=i.map(o=>s.find(a=>a.name===o.name)?{name:`x-bind:${o.name}`,value:`"${o.value}"`}:o),rn(e,i,n).map(o=>{r.push(o.runCleanups),o()}),()=>{for(;r.length;)r.pop()()}}var _i={};function Na(e,t){_i[e]=t}function Ma(e,t){return Object.entries(_i).forEach(([n,r])=>{Object.defineProperty(e,n,{get(){return(...i)=>r.bind(t)(...i)},enumerable:!1})}),e}var Fa={get reactive(){return me},get release(){return ge},get effect(){return ce},get raw(){return Sr},get transaction(){return Oo},version:"3.15.8",flushAndStopDeferringMutations:Po,dontAutoEvaluateFunctions:jr,disableEffectScheduling:Eo,startObservingMutations:Zt,stopObservingMutations:Nr,setReactivityEngine:So,onAttributeRemoved:Cr,onAttributesAdded:Tr,closestDataStack:ie,skipDuringClone:J,onlyDuringClone:la,addRootSelector:Zr,addInitSelector:Qr,setErrorHandler:jo,interceptClone:lt,addScopeToNode:Be,deferMutations:Co,mapAttributes:sn,evaluateLater:P,interceptInit:Qo,initInterceptors:tn,injectMagics:Pe,setEvaluator:Bo,setRawEvaluator:$o,mergeProxies:se,extractProp:Oa,findClosest:ae,onElRemoved:Xt,closestRoot:ct,destroyTree:be,interceptor:Fr,transition:Bt,setStyles:ut,mutateDom:A,directive:R,entangle:di,throttle:fi,debounce:li,evaluate:ee,evaluateRaw:Ho,initTree:k,nextTick:cn,prefixed:ye,prefix:Ko,plugin:Ra,magic:$,store:va,start:Yo,clone:da,cloneNode:fa,bound:Aa,$data:Mr,watch:Ar,walk:oe,data:Na,bind:Ca},we=Fa;function La(e,t){const n=Object.create(null),r=e.split(",");for(let i=0;i<r.length;i++)n[r[i]]=!0;return i=>!!n[i]}var Ia=Object.freeze({}),ja=Object.prototype.hasOwnProperty,ft=(e,t)=>ja.call(e,t),te=Array.isArray,Ce=e=>mi(e)==="[object Map]",Da=e=>typeof e=="string",fn=e=>typeof e=="symbol",dt=e=>e!==null&&typeof e=="object",Ba=Object.prototype.toString,mi=e=>Ba.call(e),gi=e=>mi(e).slice(8,-1),dn=e=>Da(e)&&e!=="NaN"&&e[0]!=="-"&&""+parseInt(e,10)===e,$a=e=>{const t=Object.create(null);return n=>t[n]||(t[n]=e(n))},Ua=$a(e=>e.charAt(0).toUpperCase()+e.slice(1)),yi=(e,t)=>e!==t&&(e===e||t===t),Ut=new WeakMap,Re=[],U,ne=Symbol("iterate"),kt=Symbol("Map key iterate");function ka(e){return e&&e._isEffect===!0}function qa(e,t=Ia){ka(e)&&(e=e.raw);const n=Ka(e,t);return t.lazy||n(),n}function Ha(e){e.active&&(bi(e),e.options.onStop&&e.options.onStop(),e.active=!1)}var za=0;function Ka(e,t){const n=function(){if(!n.active)return e();if(!Re.includes(n)){bi(n);try{return Ja(),Re.push(n),U=n,e()}finally{Re.pop(),wi(),U=Re[Re.length-1]}}};return n.id=za++,n.allowRecurse=!!t.allowRecurse,n._isEffect=!0,n.active=!0,n.raw=e,n.deps=[],n.options=t,n}function bi(e){const{deps:t}=e;if(t.length){for(let n=0;n<t.length;n++)t[n].delete(e);t.length=0}}var he=!0,pn=[];function Wa(){pn.push(he),he=!1}function Ja(){pn.push(he),he=!0}function wi(){const e=pn.pop();he=e===void 0?!0:e}function D(e,t,n){if(!he||U===void 0)return;let r=Ut.get(e);r||Ut.set(e,r=new Map);let i=r.get(n);i||r.set(n,i=new Set),i.has(U)||(i.add(U),U.deps.push(i),U.options.onTrack&&U.options.onTrack({effect:U,target:e,type:t,key:n}))}function W(e,t,n,r,i,s){const o=Ut.get(e);if(!o)return;const a=new Set,c=l=>{l&&l.forEach(h=>{(h!==U||h.allowRecurse)&&a.add(h)})};if(t==="clear")o.forEach(c);else if(n==="length"&&te(e))o.forEach((l,h)=>{(h==="length"||h>=r)&&c(l)});else switch(n!==void 0&&c(o.get(n)),t){case"add":te(e)?dn(n)&&c(o.get("length")):(c(o.get(ne)),Ce(e)&&c(o.get(kt)));break;case"delete":te(e)||(c(o.get(ne)),Ce(e)&&c(o.get(kt)));break;case"set":Ce(e)&&c(o.get(ne));break}const u=l=>{l.options.onTrigger&&l.options.onTrigger({effect:l,target:e,key:n,type:t,newValue:r,oldValue:i,oldTarget:s}),l.options.scheduler?l.options.scheduler(l):l()};a.forEach(u)}var Va=La("__proto__,__v_isRef,__isVue"),xi=new Set(Object.getOwnPropertyNames(Symbol).map(e=>Symbol[e]).filter(fn)),Xa=Ei(),Ga=Ei(!0),Kn=Ya();function Ya(){const e={};return["includes","indexOf","lastIndexOf"].forEach(t=>{e[t]=function(...n){const r=S(this);for(let s=0,o=this.length;s<o;s++)D(r,"get",s+"");const i=r[t](...n);return i===-1||i===!1?r[t](...n.map(S)):i}}),["push","pop","shift","unshift","splice"].forEach(t=>{e[t]=function(...n){Wa();const r=S(this)[t].apply(this,n);return wi(),r}}),e}function Ei(e=!1,t=!1){return function(r,i,s){if(i==="__v_isReactive")return!e;if(i==="__v_isReadonly")return e;if(i==="__v_raw"&&s===(e?t?fc:Ri:t?lc:Oi).get(r))return r;const o=te(r);if(!e&&o&&ft(Kn,i))return Reflect.get(Kn,i,s);const a=Reflect.get(r,i,s);return(fn(i)?xi.has(i):Va(i))||(e||D(r,"get",i),t)?a:qt(a)?!o||!dn(i)?a.value:a:dt(a)?e?vi(a):gn(a):a}}var Za=Qa();function Qa(e=!1){return function(n,r,i,s){let o=n[r];if(!e&&(i=S(i),o=S(o),!te(n)&&qt(o)&&!qt(i)))return o.value=i,!0;const a=te(n)&&dn(r)?Number(r)<n.length:ft(n,r),c=Reflect.set(n,r,i,s);return n===S(s)&&(a?yi(i,o)&&W(n,"set",r,i,o):W(n,"add",r,i)),c}}function ec(e,t){const n=ft(e,t),r=e[t],i=Reflect.deleteProperty(e,t);return i&&n&&W(e,"delete",t,void 0,r),i}function tc(e,t){const n=Reflect.has(e,t);return(!fn(t)||!xi.has(t))&&D(e,"has",t),n}function nc(e){return D(e,"iterate",te(e)?"length":ne),Reflect.ownKeys(e)}var rc={get:Xa,set:Za,deleteProperty:ec,has:tc,ownKeys:nc},ic={get:Ga,set(e,t){return console.warn(`Set operation on key "${String(t)}" failed: target is readonly.`,e),!0},deleteProperty(e,t){return console.warn(`Delete operation on key "${String(t)}" failed: target is readonly.`,e),!0}},hn=e=>dt(e)?gn(e):e,_n=e=>dt(e)?vi(e):e,mn=e=>e,pt=e=>Reflect.getPrototypeOf(e);function He(e,t,n=!1,r=!1){e=e.__v_raw;const i=S(e),s=S(t);t!==s&&!n&&D(i,"get",t),!n&&D(i,"get",s);const{has:o}=pt(i),a=r?mn:n?_n:hn;if(o.call(i,t))return a(e.get(t));if(o.call(i,s))return a(e.get(s));e!==i&&e.get(t)}function ze(e,t=!1){const n=this.__v_raw,r=S(n),i=S(e);return e!==i&&!t&&D(r,"has",e),!t&&D(r,"has",i),e===i?n.has(e):n.has(e)||n.has(i)}function Ke(e,t=!1){return e=e.__v_raw,!t&&D(S(e),"iterate",ne),Reflect.get(e,"size",e)}function Wn(e){e=S(e);const t=S(this);return pt(t).has.call(t,e)||(t.add(e),W(t,"add",e,e)),this}function Jn(e,t){t=S(t);const n=S(this),{has:r,get:i}=pt(n);let s=r.call(n,e);s?Ai(n,r,e):(e=S(e),s=r.call(n,e));const o=i.call(n,e);return n.set(e,t),s?yi(t,o)&&W(n,"set",e,t,o):W(n,"add",e,t),this}function Vn(e){const t=S(this),{has:n,get:r}=pt(t);let i=n.call(t,e);i?Ai(t,n,e):(e=S(e),i=n.call(t,e));const s=r?r.call(t,e):void 0,o=t.delete(e);return i&&W(t,"delete",e,void 0,s),o}function Xn(){const e=S(this),t=e.size!==0,n=Ce(e)?new Map(e):new Set(e),r=e.clear();return t&&W(e,"clear",void 0,void 0,n),r}function We(e,t){return function(r,i){const s=this,o=s.__v_raw,a=S(o),c=t?mn:e?_n:hn;return!e&&D(a,"iterate",ne),o.forEach((u,l)=>r.call(i,c(u),c(l),s))}}function Je(e,t,n){return function(...r){const i=this.__v_raw,s=S(i),o=Ce(s),a=e==="entries"||e===Symbol.iterator&&o,c=e==="keys"&&o,u=i[e](...r),l=n?mn:t?_n:hn;return!t&&D(s,"iterate",c?kt:ne),{next(){const{value:h,done:y}=u.next();return y?{value:h,done:y}:{value:a?[l(h[0]),l(h[1])]:l(h),done:y}},[Symbol.iterator](){return this}}}}function z(e){return function(...t){{const n=t[0]?`on key "${t[0]}" `:"";console.warn(`${Ua(e)} operation ${n}failed: target is readonly.`,S(this))}return e==="delete"?!1:this}}function sc(){const e={get(s){return He(this,s)},get size(){return Ke(this)},has:ze,add:Wn,set:Jn,delete:Vn,clear:Xn,forEach:We(!1,!1)},t={get(s){return He(this,s,!1,!0)},get size(){return Ke(this)},has:ze,add:Wn,set:Jn,delete:Vn,clear:Xn,forEach:We(!1,!0)},n={get(s){return He(this,s,!0)},get size(){return Ke(this,!0)},has(s){return ze.call(this,s,!0)},add:z("add"),set:z("set"),delete:z("delete"),clear:z("clear"),forEach:We(!0,!1)},r={get(s){return He(this,s,!0,!0)},get size(){return Ke(this,!0)},has(s){return ze.call(this,s,!0)},add:z("add"),set:z("set"),delete:z("delete"),clear:z("clear"),forEach:We(!0,!0)};return["keys","values","entries",Symbol.iterator].forEach(s=>{e[s]=Je(s,!1,!1),n[s]=Je(s,!0,!1),t[s]=Je(s,!1,!0),r[s]=Je(s,!0,!0)}),[e,n,t,r]}var[oc,ac]=sc();function Si(e,t){const n=e?ac:oc;return(r,i,s)=>i==="__v_isReactive"?!e:i==="__v_isReadonly"?e:i==="__v_raw"?r:Reflect.get(ft(n,i)&&i in r?n:r,i,s)}var cc={get:Si(!1)},uc={get:Si(!0)};function Ai(e,t,n){const r=S(n);if(r!==n&&t.call(e,r)){const i=gi(e);console.warn(`Reactive ${i} contains both the raw and reactive versions of the same object${i==="Map"?" as keys":""}, which can lead to inconsistencies. Avoid differentiating between the raw and reactive versions of an object and only use the reactive version if possible.`)}}var Oi=new WeakMap,lc=new WeakMap,Ri=new WeakMap,fc=new WeakMap;function dc(e){switch(e){case"Object":case"Array":return 1;case"Map":case"Set":case"WeakMap":case"WeakSet":return 2;default:return 0}}function pc(e){return e.__v_skip||!Object.isExtensible(e)?0:dc(gi(e))}function gn(e){return e&&e.__v_isReadonly?e:Ti(e,!1,rc,cc,Oi)}function vi(e){return Ti(e,!0,ic,uc,Ri)}function Ti(e,t,n,r,i){if(!dt(e))return console.warn(`value cannot be made reactive: ${String(e)}`),e;if(e.__v_raw&&!(t&&e.__v_isReactive))return e;const s=i.get(e);if(s)return s;const o=pc(e);if(o===0)return e;const a=new Proxy(e,o===2?r:n);return i.set(e,a),a}function S(e){return e&&S(e.__v_raw)||e}function qt(e){return!!(e&&e.__v_isRef===!0)}$("nextTick",()=>cn);$("dispatch",e=>Te.bind(Te,e));$("watch",(e,{evaluateLater:t,cleanup:n})=>(r,i)=>{let s=t(r),a=Ar(()=>{let c;return s(u=>c=u),c},i);n(a)});$("store",Ta);$("data",e=>Mr(e));$("root",e=>ct(e));$("refs",e=>(e._x_refs_proxy||(e._x_refs_proxy=se(hc(e))),e._x_refs_proxy));function hc(e){let t=[];return ae(e,n=>{n._x_refs&&t.push(n._x_refs)}),t}var Et={};function Ci(e){return Et[e]||(Et[e]=0),++Et[e]}function _c(e,t){return ae(e,n=>{if(n._x_ids&&n._x_ids[t])return!0})}function mc(e,t){e._x_ids||(e._x_ids={}),e._x_ids[t]||(e._x_ids[t]=Ci(t))}$("id",(e,{cleanup:t})=>(n,r=null)=>{let i=`${n}${r?`-${r}`:""}`;return gc(e,i,t,()=>{let s=_c(e,n),o=s?s._x_ids[n]:Ci(n);return r?`${n}-${o}-${r}`:`${n}-${o}`})});lt((e,t)=>{e._x_id&&(t._x_id=e._x_id)});function gc(e,t,n,r){if(e._x_id||(e._x_id={}),e._x_id[t])return e._x_id[t];let i=r();return e._x_id[t]=i,n(()=>{delete e._x_id[t]}),i}$("el",e=>e);Pi("Focus","focus","focus");Pi("Persist","persist","persist");function Pi(e,t,n){$(t,r=>j(`You can't use [$${t}] without first installing the "${e}" plugin here: https://alpinejs.dev/plugins/${n}`,r))}R("modelable",(e,{expression:t},{effect:n,evaluateLater:r,cleanup:i})=>{let s=r(t),o=()=>{let l;return s(h=>l=h),l},a=r(`${t} = __placeholder`),c=l=>a(()=>{},{scope:{__placeholder:l}}),u=o();c(u),queueMicrotask(()=>{if(!e._x_model)return;e._x_removeModelListeners.default();let l=e._x_model.get,h=e._x_model.set,y=di({get(){return l()},set(x){h(x)}},{get(){return o()},set(x){c(x)}});i(y)})});R("teleport",(e,{modifiers:t,expression:n},{cleanup:r})=>{e.tagName.toLowerCase()!=="template"&&j("x-teleport can only be used on a <template> tag",e);let i=Gn(n),s=e.content.cloneNode(!0).firstElementChild;e._x_teleport=s,s._x_teleportBack=e,e.setAttribute("data-teleport-template",!0),s.setAttribute("data-teleport-target",!0),e._x_forwardEvents&&e._x_forwardEvents.forEach(a=>{s.addEventListener(a,c=>{c.stopPropagation(),e.dispatchEvent(new c.constructor(c.type,c))})}),Be(s,{},e);let o=(a,c,u)=>{u.includes("prepend")?c.parentNode.insertBefore(a,c):u.includes("append")?c.parentNode.insertBefore(a,c.nextSibling):c.appendChild(a)};A(()=>{o(s,i,t),J(()=>{k(s)})()}),e._x_teleportPutBack=()=>{let a=Gn(n);A(()=>{o(e._x_teleport,a,t)})},r(()=>A(()=>{s.remove(),be(s)}))});var yc=document.createElement("div");function Gn(e){let t=J(()=>document.querySelector(e),()=>yc)();return t||j(`Cannot find x-teleport element for selector: "${e}"`),t}var Ni=()=>{};Ni.inline=(e,{modifiers:t},{cleanup:n})=>{t.includes("self")?e._x_ignoreSelf=!0:e._x_ignore=!0,n(()=>{t.includes("self")?delete e._x_ignoreSelf:delete e._x_ignore})};R("ignore",Ni);R("effect",J((e,{expression:t},{effect:n})=>{n(P(e,t))}));function fe(e,t,n,r){let i=e,s=c=>r(c),o={},a=(c,u)=>l=>u(c,l);if(n.includes("dot")&&(t=bc(t)),n.includes("camel")&&(t=wc(t)),n.includes("passive")&&(o.passive=!0),n.includes("capture")&&(o.capture=!0),n.includes("window")&&(i=window),n.includes("document")&&(i=document),n.includes("debounce")){let c=n[n.indexOf("debounce")+1]||"invalid-wait",u=nt(c.split("ms")[0])?Number(c.split("ms")[0]):250;s=li(s,u)}if(n.includes("throttle")){let c=n[n.indexOf("throttle")+1]||"invalid-wait",u=nt(c.split("ms")[0])?Number(c.split("ms")[0]):250;s=fi(s,u)}return n.includes("prevent")&&(s=a(s,(c,u)=>{u.preventDefault(),c(u)})),n.includes("stop")&&(s=a(s,(c,u)=>{u.stopPropagation(),c(u)})),n.includes("once")&&(s=a(s,(c,u)=>{c(u),i.removeEventListener(t,s,o)})),(n.includes("away")||n.includes("outside"))&&(i=document,s=a(s,(c,u)=>{e.contains(u.target)||u.target.isConnected!==!1&&(e.offsetWidth<1&&e.offsetHeight<1||e._x_isShown!==!1&&c(u))})),n.includes("self")&&(s=a(s,(c,u)=>{u.target===e&&c(u)})),t==="submit"&&(s=a(s,(c,u)=>{u.target._x_pendingModelUpdates&&u.target._x_pendingModelUpdates.forEach(l=>l()),c(u)})),(Ec(t)||Mi(t))&&(s=a(s,(c,u)=>{Sc(u,n)||c(u)})),i.addEventListener(t,s,o),()=>{i.removeEventListener(t,s,o)}}function bc(e){return e.replace(/-/g,".")}function wc(e){return e.toLowerCase().replace(/-(\w)/g,(t,n)=>n.toUpperCase())}function nt(e){return!Array.isArray(e)&&!isNaN(e)}function xc(e){return[" ","_"].includes(e)?e:e.replace(/([a-z])([A-Z])/g,"$1-$2").replace(/[_\s]/,"-").toLowerCase()}function Ec(e){return["keydown","keyup"].includes(e)}function Mi(e){return["contextmenu","click","mouse"].some(t=>e.includes(t))}function Sc(e,t){let n=t.filter(s=>!["window","document","prevent","stop","once","capture","self","away","outside","passive","preserve-scroll","blur","change","lazy"].includes(s));if(n.includes("debounce")){let s=n.indexOf("debounce");n.splice(s,nt((n[s+1]||"invalid-wait").split("ms")[0])?2:1)}if(n.includes("throttle")){let s=n.indexOf("throttle");n.splice(s,nt((n[s+1]||"invalid-wait").split("ms")[0])?2:1)}if(n.length===0||n.length===1&&Yn(e.key).includes(n[0]))return!1;const i=["ctrl","shift","alt","meta","cmd","super"].filter(s=>n.includes(s));return n=n.filter(s=>!i.includes(s)),!(i.length>0&&i.filter(o=>((o==="cmd"||o==="super")&&(o="meta"),e[`${o}Key`])).length===i.length&&(Mi(e.type)||Yn(e.key).includes(n[0])))}function Yn(e){if(!e)return[];e=xc(e);let t={ctrl:"control",slash:"/",space:" ",spacebar:" ",cmd:"meta",esc:"escape",up:"arrow-up",down:"arrow-down",left:"arrow-left",right:"arrow-right",period:".",comma:",",equal:"=",minus:"-",underscore:"_"};return t[e]=e,Object.keys(t).map(n=>{if(t[n]===e)return n}).filter(n=>n)}R("model",(e,{modifiers:t,expression:n},{effect:r,cleanup:i})=>{let s=e;t.includes("parent")&&(s=e.parentNode);let o=P(s,n),a;typeof n=="string"?a=P(s,`${n} = __placeholder`):typeof n=="function"&&typeof n()=="string"?a=P(s,`${n()} = __placeholder`):a=()=>{};let c=()=>{let _;return o(d=>_=d),Zn(_)?_.get():_},u=_=>{let d;o(m=>d=m),Zn(d)?d.set(_):a(()=>{},{scope:{__placeholder:_}})};typeof n=="string"&&e.type==="radio"&&A(()=>{e.hasAttribute("name")||e.setAttribute("name",n)});let l=t.includes("change")||t.includes("lazy"),h=t.includes("blur"),y=t.includes("enter"),x=l||h||y,p;if(K)p=()=>{};else if(x){let _=[],d=m=>u(Ve(e,t,m,c()));if(l&&_.push(fe(e,"change",t,d)),h&&(_.push(fe(e,"blur",t,d)),e.form)){let m=()=>d({target:e});e.form._x_pendingModelUpdates||(e.form._x_pendingModelUpdates=[]),e.form._x_pendingModelUpdates.push(m),i(()=>e.form._x_pendingModelUpdates.splice(e.form._x_pendingModelUpdates.indexOf(m),1))}y&&_.push(fe(e,"keydown",t,m=>{m.key==="Enter"&&d(m)})),p=()=>_.forEach(m=>m())}else{let _=e.tagName.toLowerCase()==="select"||["checkbox","radio"].includes(e.type)?"change":"input";p=fe(e,_,t,d=>{u(Ve(e,t,d,c()))})}if(t.includes("fill")&&([void 0,null,""].includes(c())||ln(e)&&Array.isArray(c())||e.tagName.toLowerCase()==="select"&&e.multiple)&&u(Ve(e,t,{target:e},c())),e._x_removeModelListeners||(e._x_removeModelListeners={}),e._x_removeModelListeners.default=p,i(()=>e._x_removeModelListeners.default()),e.form){let _=fe(e.form,"reset",[],d=>{cn(()=>e._x_model&&e._x_model.set(Ve(e,t,{target:e},c())))});i(()=>_())}e._x_model={get(){return c()},set(_){u(_)}},e._x_forceModelUpdate=_=>{_===void 0&&typeof n=="string"&&n.match(/\./)&&(_=""),window.fromModel=!0,A(()=>si(e,"value",_)),delete window.fromModel},r(()=>{let _=c();t.includes("unintrusive")&&document.activeElement.isSameNode(e)||e._x_forceModelUpdate(_)})});function Ve(e,t,n,r){return A(()=>{if(n instanceof CustomEvent&&n.detail!==void 0)return n.detail!==null&&n.detail!==void 0?n.detail:n.target.value;if(ln(e))if(Array.isArray(r)){let i=null;return t.includes("number")?i=St(n.target.value):t.includes("boolean")?i=Ze(n.target.value):i=n.target.value,n.target.checked?r.includes(i)?r:r.concat([i]):r.filter(s=>!Ac(s,i))}else return n.target.checked;else{if(e.tagName.toLowerCase()==="select"&&e.multiple)return t.includes("number")?Array.from(n.target.selectedOptions).map(i=>{let s=i.value||i.text;return St(s)}):t.includes("boolean")?Array.from(n.target.selectedOptions).map(i=>{let s=i.value||i.text;return Ze(s)}):Array.from(n.target.selectedOptions).map(i=>i.value||i.text);{let i;return ui(e)?n.target.checked?i=n.target.value:i=r:i=n.target.value,t.includes("number")?St(i):t.includes("boolean")?Ze(i):t.includes("trim")?i.trim():i}}})}function St(e){let t=e?parseFloat(e):null;return Oc(t)?t:e}function Ac(e,t){return e==t}function Oc(e){return!Array.isArray(e)&&!isNaN(e)}function Zn(e){return e!==null&&typeof e=="object"&&typeof e.get=="function"&&typeof e.set=="function"}R("cloak",e=>queueMicrotask(()=>A(()=>e.removeAttribute(ye("cloak")))));Qr(()=>`[${ye("init")}]`);R("init",J((e,{expression:t},{evaluate:n})=>typeof t=="string"?!!t.trim()&&n(t,{},!1):n(t,{},!1)));R("text",(e,{expression:t},{effect:n,evaluateLater:r})=>{let i=r(t);n(()=>{i(s=>{A(()=>{e.textContent=s})})})});R("html",(e,{expression:t},{effect:n,evaluateLater:r})=>{let i=r(t);n(()=>{i(s=>{A(()=>{e.innerHTML=s,e._x_ignoreSelf=!0,k(e),delete e._x_ignoreSelf})})})});sn(Hr(":",zr(ye("bind:"))));var Fi=(e,{value:t,modifiers:n,expression:r,original:i},{effect:s,cleanup:o})=>{if(!t){let c={};Pa(c),P(e,r)(l=>{hi(e,l,i)},{scope:c});return}if(t==="key")return Rc(e,r);if(e._x_inlineBindings&&e._x_inlineBindings[t]&&e._x_inlineBindings[t].extract)return;let a=P(e,r);s(()=>a(c=>{c===void 0&&typeof r=="string"&&r.match(/\./)&&(c=""),A(()=>si(e,t,c,n))})),o(()=>{e._x_undoAddedClasses&&e._x_undoAddedClasses(),e._x_undoAddedStyles&&e._x_undoAddedStyles()})};Fi.inline=(e,{value:t,modifiers:n,expression:r})=>{t&&(e._x_inlineBindings||(e._x_inlineBindings={}),e._x_inlineBindings[t]={expression:r,extract:!1})};R("bind",Fi);function Rc(e,t){e._x_keyExpression=t}Zr(()=>`[${ye("data")}]`);R("data",(e,{expression:t},{cleanup:n})=>{if(vc(e))return;t=t===""?"{}":t;let r={};Pe(r,e);let i={};Ma(i,r);let s=ee(e,t,{scope:i});(s===void 0||s===!0)&&(s={}),Pe(s,e);let o=me(s);tn(o);let a=Be(e,o);o.init&&ee(e,o.init),n(()=>{o.destroy&&ee(e,o.destroy),a()})});lt((e,t)=>{e._x_dataStack&&(t._x_dataStack=e._x_dataStack,t.setAttribute("data-has-alpine-state",!0))});function vc(e){return K?$t?!0:e.hasAttribute("data-has-alpine-state"):!1}R("show",(e,{modifiers:t,expression:n},{effect:r})=>{let i=P(e,n);e._x_doHide||(e._x_doHide=()=>{A(()=>{e.style.setProperty("display","none",t.includes("important")?"important":void 0)})}),e._x_doShow||(e._x_doShow=()=>{A(()=>{e.style.length===1&&e.style.display==="none"?e.removeAttribute("style"):e.style.removeProperty("display")})});let s=()=>{e._x_doHide(),e._x_isShown=!1},o=()=>{e._x_doShow(),e._x_isShown=!0},a=()=>setTimeout(o),c=Dt(h=>h?o():s(),h=>{typeof e._x_toggleAndCascadeWithTransitions=="function"?e._x_toggleAndCascadeWithTransitions(e,h,o,s):h?a():s()}),u,l=!0;r(()=>i(h=>{!l&&h===u||(t.includes("immediate")&&(h?a():s()),c(h),u=h,l=!1)}))});R("for",(e,{expression:t},{effect:n,cleanup:r})=>{let i=Cc(t),s=P(e,i.items),o=P(e,e._x_keyExpression||"index");e._x_prevKeys=[],e._x_lookup={},n(()=>Tc(e,i,s,o)),r(()=>{Object.values(e._x_lookup).forEach(a=>A(()=>{be(a),a.remove()})),delete e._x_prevKeys,delete e._x_lookup})});function Tc(e,t,n,r){let i=o=>typeof o=="object"&&!Array.isArray(o),s=e;n(o=>{Pc(o)&&o>=0&&(o=Array.from(Array(o).keys(),d=>d+1)),o===void 0&&(o=[]);let a=e._x_lookup,c=e._x_prevKeys,u=[],l=[];if(i(o))o=Object.entries(o).map(([d,m])=>{let w=Qn(t,m,d,o);r(b=>{l.includes(b)&&j("Duplicate key on x-for",e),l.push(b)},{scope:{index:d,...w}}),u.push(w)});else for(let d=0;d<o.length;d++){let m=Qn(t,o[d],d,o);r(w=>{l.includes(w)&&j("Duplicate key on x-for",e),l.push(w)},{scope:{index:d,...m}}),u.push(m)}let h=[],y=[],x=[],p=[];for(let d=0;d<c.length;d++){let m=c[d];l.indexOf(m)===-1&&x.push(m)}c=c.filter(d=>!x.includes(d));let _="template";for(let d=0;d<l.length;d++){let m=l[d],w=c.indexOf(m);if(w===-1)c.splice(d,0,m),h.push([_,d]);else if(w!==d){let b=c.splice(d,1)[0],E=c.splice(w-1,1)[0];c.splice(d,0,E),c.splice(w,0,b),y.push([b,E])}else p.push(m);_=m}for(let d=0;d<x.length;d++){let m=x[d];m in a&&(A(()=>{be(a[m]),a[m].remove()}),delete a[m])}for(let d=0;d<y.length;d++){let[m,w]=y[d],b=a[m],E=a[w],v=document.createElement("div");A(()=>{E||j('x-for ":key" is undefined or invalid',s,w,a),E.after(v),b.after(E),E._x_currentIfEl&&E.after(E._x_currentIfEl),v.before(b),b._x_currentIfEl&&b.after(b._x_currentIfEl),v.remove()}),E._x_refreshXForScope(u[l.indexOf(w)])}for(let d=0;d<h.length;d++){let[m,w]=h[d],b=m==="template"?s:a[m];b._x_currentIfEl&&(b=b._x_currentIfEl);let E=u[w],v=l[w],L=document.importNode(s.content,!0).firstElementChild,C=me(E);Be(L,C,s),L._x_refreshXForScope=xe=>{Object.entries(xe).forEach(([ue,$e])=>{C[ue]=$e})},A(()=>{b.after(L),J(()=>k(L))()}),typeof v=="object"&&j("x-for key cannot be an object, it must be a string or an integer",s),a[v]=L}for(let d=0;d<p.length;d++)a[p[d]]._x_refreshXForScope(u[l.indexOf(p[d])]);s._x_prevKeys=l})}function Cc(e){let t=/,([^,\}\]]*)(?:,([^,\}\]]*))?$/,n=/^\s*\(|\)\s*$/g,r=/([\s\S]*?)\s+(?:in|of)\s+([\s\S]*)/,i=e.match(r);if(!i)return;let s={};s.items=i[2].trim();let o=i[1].replace(n,"").trim(),a=o.match(t);return a?(s.item=o.replace(t,"").trim(),s.index=a[1].trim(),a[2]&&(s.collection=a[2].trim())):s.item=o,s}function Qn(e,t,n,r){let i={};return/^\[.*\]$/.test(e.item)&&Array.isArray(t)?e.item.replace("[","").replace("]","").split(",").map(o=>o.trim()).forEach((o,a)=>{i[o]=t[a]}):/^\{.*\}$/.test(e.item)&&!Array.isArray(t)&&typeof t=="object"?e.item.replace("{","").replace("}","").split(",").map(o=>o.trim()).forEach(o=>{i[o]=t[o]}):i[e.item]=t,e.index&&(i[e.index]=n),e.collection&&(i[e.collection]=r),i}function Pc(e){return!Array.isArray(e)&&!isNaN(e)}function Li(){}Li.inline=(e,{expression:t},{cleanup:n})=>{let r=ct(e);r._x_refs||(r._x_refs={}),r._x_refs[t]=e,n(()=>delete r._x_refs[t])};R("ref",Li);R("if",(e,{expression:t},{effect:n,cleanup:r})=>{e.tagName.toLowerCase()!=="template"&&j("x-if can only be used on a <template> tag",e);let i=P(e,t),s=()=>{if(e._x_currentIfEl)return e._x_currentIfEl;let a=e.content.cloneNode(!0).firstElementChild;return Be(a,{},e),A(()=>{e.after(a),J(()=>k(a))()}),e._x_currentIfEl=a,e._x_undoIf=()=>{A(()=>{be(a),a.remove()}),delete e._x_currentIfEl},a},o=()=>{e._x_undoIf&&(e._x_undoIf(),delete e._x_undoIf)};n(()=>i(a=>{a?s():o()})),r(()=>e._x_undoIf&&e._x_undoIf())});R("id",(e,{expression:t},{evaluate:n})=>{n(t).forEach(i=>mc(e,i))});lt((e,t)=>{e._x_ids&&(t._x_ids=e._x_ids)});sn(Hr("@",zr(ye("on:"))));R("on",J((e,{value:t,modifiers:n,expression:r},{cleanup:i})=>{let s=r?P(e,r):()=>{};e.tagName.toLowerCase()==="template"&&(e._x_forwardEvents||(e._x_forwardEvents=[]),e._x_forwardEvents.includes(t)||e._x_forwardEvents.push(t));let o=fe(e,t,n,a=>{s(()=>{},{scope:{$event:a},params:[a]})});i(()=>o())}));ht("Collapse","collapse","collapse");ht("Intersect","intersect","intersect");ht("Focus","trap","focus");ht("Mask","mask","mask");function ht(e,t,n){R(t,r=>j(`You can't use [x-${t}] without first installing the "${e}" plugin here: https://alpinejs.dev/plugins/${n}`,r))}we.setEvaluator($r);we.setRawEvaluator(zo);we.setReactivityEngine({reactive:gn,effect:qa,release:Ha,raw:S});var Nc=we,Ii=Nc;window.Alpine=Ii;Ii.start();
diff --git a/html/build/assets/app-CEwZte8_.css b/html/build/assets/app-CEwZte8_.css
new file mode 100644
index 0000000..2a41591
--- /dev/null
+++ b/html/build/assets/app-CEwZte8_.css
@@ -0,0 +1 @@
+*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }*,:before,:after{box-sizing:border-box;border-width:0;border-style:solid;border-color:#e5e7eb}:before,:after{--tw-content: ""}html,:host{line-height:1.5;-webkit-text-size-adjust:100%;-moz-tab-size:4;-o-tab-size:4;tab-size:4;font-family:Figtree,ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji",Segoe UI Symbol,"Noto Color Emoji";font-feature-settings:normal;font-variation-settings:normal;-webkit-tap-highlight-color:transparent}body{margin:0;line-height:inherit}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,Liberation Mono,Courier New,monospace;font-feature-settings:normal;font-variation-settings:normal;font-size:1em}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}button,input,optgroup,select,textarea{font-family:inherit;font-feature-settings:inherit;font-variation-settings:inherit;font-size:100%;font-weight:inherit;line-height:inherit;letter-spacing:inherit;color:inherit;margin:0;padding:0}button,select{text-transform:none}button,input:where([type=button]),input:where([type=reset]),input:where([type=submit]){-webkit-appearance:button;background-color:transparent;background-image:none}:-moz-focusring{outline:auto}:-moz-ui-invalid{box-shadow:none}progress{vertical-align:baseline}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}summary{display:list-item}blockquote,dl,dd,h1,h2,h3,h4,h5,h6,hr,figure,p,pre{margin:0}fieldset{margin:0;padding:0}legend{padding:0}ol,ul,menu{list-style:none;margin:0;padding:0}dialog{padding:0}textarea{resize:vertical}input::-moz-placeholder,textarea::-moz-placeholder{opacity:1;color:#9ca3af}input::placeholder,textarea::placeholder{opacity:1;color:#9ca3af}button,[role=button]{cursor:pointer}:disabled{cursor:default}img,svg,video,canvas,audio,iframe,embed,object{display:block;vertical-align:middle}img,video{max-width:100%;height:auto}[hidden]:where(:not([hidden=until-found])){display:none}input:where([type=text]),input:where(:not([type])),input:where([type=email]),input:where([type=url]),input:where([type=password]),input:where([type=number]),input:where([type=date]),input:where([type=datetime-local]),input:where([type=month]),input:where([type=search]),input:where([type=tel]),input:where([type=time]),input:where([type=week]),select:where([multiple]),textarea,select{-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:#fff;border-color:#6b7280;border-width:1px;border-radius:0;padding:.5rem .75rem;font-size:1rem;line-height:1.5rem;--tw-shadow: 0 0 #0000}input:where([type=text]):focus,input:where(:not([type])):focus,input:where([type=email]):focus,input:where([type=url]):focus,input:where([type=password]):focus,input:where([type=number]):focus,input:where([type=date]):focus,input:where([type=datetime-local]):focus,input:where([type=month]):focus,input:where([type=search]):focus,input:where([type=tel]):focus,input:where([type=time]):focus,input:where([type=week]):focus,select:where([multiple]):focus,textarea:focus,select:focus{outline:2px solid transparent;outline-offset:2px;--tw-ring-inset: var(--tw-empty, );--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: #2563eb;--tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(1px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow);border-color:#2563eb}input::-moz-placeholder,textarea::-moz-placeholder{color:#6b7280;opacity:1}input::placeholder,textarea::placeholder{color:#6b7280;opacity:1}::-webkit-datetime-edit-fields-wrapper{padding:0}::-webkit-date-and-time-value{min-height:1.5em;text-align:inherit}::-webkit-datetime-edit{display:inline-flex}::-webkit-datetime-edit,::-webkit-datetime-edit-year-field,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute-field,::-webkit-datetime-edit-second-field,::-webkit-datetime-edit-millisecond-field,::-webkit-datetime-edit-meridiem-field{padding-top:0;padding-bottom:0}select{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='none' viewBox='0 0 20 20'%3e%3cpath stroke='%236b7280' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M6 8l4 4 4-4'/%3e%3c/svg%3e");background-position:right .5rem center;background-repeat:no-repeat;background-size:1.5em 1.5em;padding-right:2.5rem;-webkit-print-color-adjust:exact;print-color-adjust:exact}select:where([multiple]),select:where([size]:not([size="1"])){background-image:initial;background-position:initial;background-repeat:unset;background-size:initial;padding-right:.75rem;-webkit-print-color-adjust:unset;print-color-adjust:unset}input:where([type=checkbox]),input:where([type=radio]){-webkit-appearance:none;-moz-appearance:none;appearance:none;padding:0;-webkit-print-color-adjust:exact;print-color-adjust:exact;display:inline-block;vertical-align:middle;background-origin:border-box;-webkit-user-select:none;-moz-user-select:none;user-select:none;flex-shrink:0;height:1rem;width:1rem;color:#2563eb;background-color:#fff;border-color:#6b7280;border-width:1px;--tw-shadow: 0 0 #0000}input:where([type=checkbox]){border-radius:0}input:where([type=radio]){border-radius:100%}input:where([type=checkbox]):focus,input:where([type=radio]):focus{outline:2px solid transparent;outline-offset:2px;--tw-ring-inset: var(--tw-empty, );--tw-ring-offset-width: 2px;--tw-ring-offset-color: #fff;--tw-ring-color: #2563eb;--tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(2px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}input:where([type=checkbox]):checked,input:where([type=radio]):checked{border-color:transparent;background-color:currentColor;background-size:100% 100%;background-position:center;background-repeat:no-repeat}input:where([type=checkbox]):checked{background-image:url("data:image/svg+xml,%3csvg viewBox='0 0 16 16' fill='white' xmlns='http://www.w3.org/2000/svg'%3e%3cpath d='M12.207 4.793a1 1 0 010 1.414l-5 5a1 1 0 01-1.414 0l-2-2a1 1 0 011.414-1.414L6.5 9.086l4.293-4.293a1 1 0 011.414 0z'/%3e%3c/svg%3e")}@media(forced-colors:active){input:where([type=checkbox]):checked{-webkit-appearance:auto;-moz-appearance:auto;appearance:auto}}input:where([type=radio]):checked{background-image:url("data:image/svg+xml,%3csvg viewBox='0 0 16 16' fill='white' xmlns='http://www.w3.org/2000/svg'%3e%3ccircle cx='8' cy='8' r='3'/%3e%3c/svg%3e")}@media(forced-colors:active){input:where([type=radio]):checked{-webkit-appearance:auto;-moz-appearance:auto;appearance:auto}}input:where([type=checkbox]):checked:hover,input:where([type=checkbox]):checked:focus,input:where([type=radio]):checked:hover,input:where([type=radio]):checked:focus{border-color:transparent;background-color:currentColor}input:where([type=checkbox]):indeterminate{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='none' viewBox='0 0 16 16'%3e%3cpath stroke='white' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M4 8h8'/%3e%3c/svg%3e");border-color:transparent;background-color:currentColor;background-size:100% 100%;background-position:center;background-repeat:no-repeat}@media(forced-colors:active){input:where([type=checkbox]):indeterminate{-webkit-appearance:auto;-moz-appearance:auto;appearance:auto}}input:where([type=checkbox]):indeterminate:hover,input:where([type=checkbox]):indeterminate:focus{border-color:transparent;background-color:currentColor}input:where([type=file]){background:unset;border-color:inherit;border-width:0;border-radius:0;padding:0;font-size:unset;line-height:inherit}input:where([type=file]):focus{outline:1px solid ButtonText;outline:1px auto -webkit-focus-ring-color}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;border-width:0}.static{position:static}.fixed{position:fixed}.absolute{position:absolute}.relative{position:relative}.inset-0{inset:0}.bottom-1{bottom:.25rem}.end-0{inset-inline-end:0px}.start-0{inset-inline-start:0px}.top-1{top:.25rem}.z-50{z-index:50}.mx-auto{margin-left:auto;margin-right:auto}.-mb-px{margin-bottom:-1px}.-me-2{margin-inline-end:-.5rem}.-ml-8{margin-left:-2rem}.-ml-px{margin-left:-1px}.-mt-\[4\.9rem\]{margin-top:-4.9rem}.mb-1{margin-bottom:.25rem}.mb-2{margin-bottom:.5rem}.mb-4{margin-bottom:1rem}.mb-6{margin-bottom:1.5rem}.ml-1{margin-left:.25rem}.ms-1{margin-inline-start:.25rem}.ms-2{margin-inline-start:.5rem}.ms-3{margin-inline-start:.75rem}.ms-4{margin-inline-start:1rem}.mt-1{margin-top:.25rem}.mt-2{margin-top:.5rem}.mt-3{margin-top:.75rem}.mt-4{margin-top:1rem}.mt-6{margin-top:1.5rem}.block{display:block}.inline-block{display:inline-block}.flex{display:flex}.inline-flex{display:inline-flex}.table{display:table}.hidden{display:none}.aspect-\[335\/376\]{aspect-ratio:335/376}.h-1{height:.25rem}.h-1\.5{height:.375rem}.h-14{height:3.5rem}.h-16{height:4rem}.h-2{height:.5rem}.h-2\.5{height:.625rem}.h-20{height:5rem}.h-3{height:.75rem}.h-3\.5{height:.875rem}.h-4{height:1rem}.h-5{height:1.25rem}.h-6{height:1.5rem}.h-9{height:2.25rem}.min-h-screen{min-height:100vh}.w-1{width:.25rem}.w-1\.5{width:.375rem}.w-2{width:.5rem}.w-2\.5{width:.625rem}.w-20{width:5rem}.w-3{width:.75rem}.w-3\.5{width:.875rem}.w-3\/4{width:75%}.w-4{width:1rem}.w-48{width:12rem}.w-5{width:1.25rem}.w-6{width:1.5rem}.w-\[448px\]{width:448px}.w-auto{width:auto}.w-full{width:100%}.max-w-7xl{max-width:80rem}.max-w-\[335px\]{max-width:335px}.max-w-none{max-width:none}.max-w-xl{max-width:36rem}.flex-1{flex:1 1 0%}.shrink-0{flex-shrink:0}.origin-top{transform-origin:top}.translate-y-0{--tw-translate-y: 0px;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.translate-y-4{--tw-translate-y: 1rem;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scale-100{--tw-scale-x: 1;--tw-scale-y: 1;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scale-95{--tw-scale-x: .95;--tw-scale-y: .95;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.transform{transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.cursor-default{cursor:default}.cursor-not-allowed{cursor:not-allowed}.flex-col{flex-direction:column}.flex-col-reverse{flex-direction:column-reverse}.items-center{align-items:center}.justify-end{justify-content:flex-end}.justify-center{justify-content:center}.justify-between{justify-content:space-between}.justify-items-center{justify-items:center}.gap-2{gap:.5rem}.gap-3{gap:.75rem}.gap-4{gap:1rem}.space-x-1>:not([hidden])~:not([hidden]){--tw-space-x-reverse: 0;margin-right:calc(.25rem * var(--tw-space-x-reverse));margin-left:calc(.25rem * calc(1 - var(--tw-space-x-reverse)))}.space-x-8>:not([hidden])~:not([hidden]){--tw-space-x-reverse: 0;margin-right:calc(2rem * var(--tw-space-x-reverse));margin-left:calc(2rem * calc(1 - var(--tw-space-x-reverse)))}.space-y-1>:not([hidden])~:not([hidden]){--tw-space-y-reverse: 0;margin-top:calc(.25rem * calc(1 - var(--tw-space-y-reverse)));margin-bottom:calc(.25rem * var(--tw-space-y-reverse))}.space-y-6>:not([hidden])~:not([hidden]){--tw-space-y-reverse: 0;margin-top:calc(1.5rem * calc(1 - var(--tw-space-y-reverse)));margin-bottom:calc(1.5rem * var(--tw-space-y-reverse))}.overflow-hidden{overflow:hidden}.overflow-y-auto{overflow-y:auto}.overflow-y-hidden{overflow-y:hidden}.rounded{border-radius:.25rem}.rounded-full{border-radius:9999px}.rounded-lg{border-radius:.5rem}.rounded-md{border-radius:.375rem}.rounded-sm{border-radius:.125rem}.rounded-l-md{border-top-left-radius:.375rem;border-bottom-left-radius:.375rem}.rounded-r-md{border-top-right-radius:.375rem;border-bottom-right-radius:.375rem}.rounded-t-lg{border-top-left-radius:.5rem;border-top-right-radius:.5rem}.rounded-bl-lg{border-bottom-left-radius:.5rem}.rounded-br-lg{border-bottom-right-radius:.5rem}.border{border-width:1px}.border-b{border-bottom-width:1px}.border-b-2{border-bottom-width:2px}.border-l-4{border-left-width:4px}.border-t{border-top-width:1px}.border-\[\#19140035\]{border-color:#19140035}.border-\[\#e3e3e0\]{--tw-border-opacity: 1;border-color:rgb(227 227 224 / var(--tw-border-opacity, 1))}.border-black{--tw-border-opacity: 1;border-color:rgb(0 0 0 / var(--tw-border-opacity, 1))}.border-gray-100{--tw-border-opacity: 1;border-color:rgb(243 244 246 / var(--tw-border-opacity, 1))}.border-gray-200{--tw-border-opacity: 1;border-color:rgb(229 231 235 / var(--tw-border-opacity, 1))}.border-gray-300{--tw-border-opacity: 1;border-color:rgb(209 213 219 / var(--tw-border-opacity, 1))}.border-indigo-400{--tw-border-opacity: 1;border-color:rgb(129 140 248 / var(--tw-border-opacity, 1))}.border-transparent{border-color:transparent}.bg-\[\#1b1b18\]{--tw-bg-opacity: 1;background-color:rgb(27 27 24 / var(--tw-bg-opacity, 1))}.bg-\[\#FDFDFC\]{--tw-bg-opacity: 1;background-color:rgb(253 253 252 / var(--tw-bg-opacity, 1))}.bg-\[\#dbdbd7\]{--tw-bg-opacity: 1;background-color:rgb(219 219 215 / var(--tw-bg-opacity, 1))}.bg-\[\#fff2f2\]{--tw-bg-opacity: 1;background-color:rgb(255 242 242 / var(--tw-bg-opacity, 1))}.bg-gray-100{--tw-bg-opacity: 1;background-color:rgb(243 244 246 / var(--tw-bg-opacity, 1))}.bg-gray-200{--tw-bg-opacity: 1;background-color:rgb(229 231 235 / var(--tw-bg-opacity, 1))}.bg-gray-500{--tw-bg-opacity: 1;background-color:rgb(107 114 128 / var(--tw-bg-opacity, 1))}.bg-gray-800{--tw-bg-opacity: 1;background-color:rgb(31 41 55 / var(--tw-bg-opacity, 1))}.bg-indigo-50{--tw-bg-opacity: 1;background-color:rgb(238 242 255 / var(--tw-bg-opacity, 1))}.bg-red-600{--tw-bg-opacity: 1;background-color:rgb(220 38 38 / var(--tw-bg-opacity, 1))}.bg-white{--tw-bg-opacity: 1;background-color:rgb(255 255 255 / var(--tw-bg-opacity, 1))}.fill-current{fill:currentColor}.p-2{padding:.5rem}.p-4{padding:1rem}.p-6{padding:1.5rem}.px-1{padding-left:.25rem;padding-right:.25rem}.px-2{padding-left:.5rem;padding-right:.5rem}.px-3{padding-left:.75rem;padding-right:.75rem}.px-4{padding-left:1rem;padding-right:1rem}.px-5{padding-left:1.25rem;padding-right:1.25rem}.px-6{padding-left:1.5rem;padding-right:1.5rem}.py-1{padding-top:.25rem;padding-bottom:.25rem}.py-1\.5{padding-top:.375rem;padding-bottom:.375rem}.py-12{padding-top:3rem;padding-bottom:3rem}.py-2{padding-top:.5rem;padding-bottom:.5rem}.py-4{padding-top:1rem;padding-bottom:1rem}.py-6{padding-top:1.5rem;padding-bottom:1.5rem}.pb-1{padding-bottom:.25rem}.pb-12{padding-bottom:3rem}.pb-3{padding-bottom:.75rem}.pe-4{padding-inline-end:1rem}.ps-3{padding-inline-start:.75rem}.pt-1{padding-top:.25rem}.pt-2{padding-top:.5rem}.pt-4{padding-top:1rem}.pt-6{padding-top:1.5rem}.text-start{text-align:start}.font-sans{font-family:Figtree,ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji",Segoe UI Symbol,"Noto Color Emoji"}.text-\[13px\]{font-size:13px}.text-base{font-size:1rem;line-height:1.5rem}.text-lg{font-size:1.125rem;line-height:1.75rem}.text-sm{font-size:.875rem;line-height:1.25rem}.text-xl{font-size:1.25rem;line-height:1.75rem}.text-xs{font-size:.75rem;line-height:1rem}.font-medium{font-weight:500}.font-semibold{font-weight:600}.uppercase{text-transform:uppercase}.leading-4{line-height:1rem}.leading-5{line-height:1.25rem}.leading-\[20px\]{line-height:20px}.leading-normal{line-height:1.5}.leading-tight{line-height:1.25}.tracking-widest{letter-spacing:.1em}.text-\[\#1b1b18\]{--tw-text-opacity: 1;color:rgb(27 27 24 / var(--tw-text-opacity, 1))}.text-\[\#706f6c\]{--tw-text-opacity: 1;color:rgb(112 111 108 / var(--tw-text-opacity, 1))}.text-\[\#F53003\],.text-\[\#f53003\]{--tw-text-opacity: 1;color:rgb(245 48 3 / var(--tw-text-opacity, 1))}.text-gray-400{--tw-text-opacity: 1;color:rgb(156 163 175 / var(--tw-text-opacity, 1))}.text-gray-500{--tw-text-opacity: 1;color:rgb(107 114 128 / var(--tw-text-opacity, 1))}.text-gray-600{--tw-text-opacity: 1;color:rgb(75 85 99 / var(--tw-text-opacity, 1))}.text-gray-700{--tw-text-opacity: 1;color:rgb(55 65 81 / var(--tw-text-opacity, 1))}.text-gray-800{--tw-text-opacity: 1;color:rgb(31 41 55 / var(--tw-text-opacity, 1))}.text-gray-900{--tw-text-opacity: 1;color:rgb(17 24 39 / var(--tw-text-opacity, 1))}.text-green-600{--tw-text-opacity: 1;color:rgb(22 163 74 / var(--tw-text-opacity, 1))}.text-indigo-600{--tw-text-opacity: 1;color:rgb(79 70 229 / var(--tw-text-opacity, 1))}.text-indigo-700{--tw-text-opacity: 1;color:rgb(67 56 202 / var(--tw-text-opacity, 1))}.text-red-600{--tw-text-opacity: 1;color:rgb(220 38 38 / var(--tw-text-opacity, 1))}.text-white{--tw-text-opacity: 1;color:rgb(255 255 255 / var(--tw-text-opacity, 1))}.underline{text-decoration-line:underline}.underline-offset-4{text-underline-offset:4px}.antialiased{-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.opacity-0{opacity:0}.opacity-100{opacity:1}.opacity-75{opacity:.75}.shadow{--tw-shadow: 0 1px 3px 0 rgb(0 0 0 / .1), 0 1px 2px -1px rgb(0 0 0 / .1);--tw-shadow-colored: 0 1px 3px 0 var(--tw-shadow-color), 0 1px 2px -1px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.shadow-\[0px_0px_1px_0px_rgba\(0\,0\,0\,0\.03\)\,0px_1px_2px_0px_rgba\(0\,0\,0\,0\.06\)\]{--tw-shadow: 0px 0px 1px 0px rgba(0,0,0,.03),0px 1px 2px 0px rgba(0,0,0,.06);--tw-shadow-colored: 0px 0px 1px 0px var(--tw-shadow-color), 0px 1px 2px 0px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.shadow-\[inset_0px_0px_0px_1px_rgba\(26\,26\,0\,0\.16\)\]{--tw-shadow: inset 0px 0px 0px 1px rgba(26,26,0,.16);--tw-shadow-colored: inset 0px 0px 0px 1px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.shadow-lg{--tw-shadow: 0 10px 15px -3px rgb(0 0 0 / .1), 0 4px 6px -4px rgb(0 0 0 / .1);--tw-shadow-colored: 0 10px 15px -3px var(--tw-shadow-color), 0 4px 6px -4px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.shadow-md{--tw-shadow: 0 4px 6px -1px rgb(0 0 0 / .1), 0 2px 4px -2px rgb(0 0 0 / .1);--tw-shadow-colored: 0 4px 6px -1px var(--tw-shadow-color), 0 2px 4px -2px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.shadow-sm{--tw-shadow: 0 1px 2px 0 rgb(0 0 0 / .05);--tw-shadow-colored: 0 1px 2px 0 var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.shadow-xl{--tw-shadow: 0 20px 25px -5px rgb(0 0 0 / .1), 0 8px 10px -6px rgb(0 0 0 / .1);--tw-shadow-colored: 0 20px 25px -5px var(--tw-shadow-color), 0 8px 10px -6px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.ring-1{--tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(1px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow, 0 0 #0000)}.ring-black{--tw-ring-opacity: 1;--tw-ring-color: rgb(0 0 0 / var(--tw-ring-opacity, 1))}.ring-gray-300{--tw-ring-opacity: 1;--tw-ring-color: rgb(209 213 219 / var(--tw-ring-opacity, 1))}.ring-opacity-5{--tw-ring-opacity: .05}.\!filter{filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)!important}.filter{filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}.transition{transition-property:color,background-color,border-color,text-decoration-color,fill,stroke,opacity,box-shadow,transform,filter,backdrop-filter;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}.transition-all{transition-property:all;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}.transition-opacity{transition-property:opacity;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}.delay-300{transition-delay:.3s}.duration-150{transition-duration:.15s}.duration-200{transition-duration:.2s}.duration-300{transition-duration:.3s}.duration-75{transition-duration:75ms}.ease-in{transition-timing-function:cubic-bezier(.4,0,1,1)}.ease-in-out{transition-timing-function:cubic-bezier(.4,0,.2,1)}.ease-out{transition-timing-function:cubic-bezier(0,0,.2,1)}.before\:absolute:before{content:var(--tw-content);position:absolute}.before\:bottom-0:before{content:var(--tw-content);bottom:0}.before\:bottom-1\/2:before{content:var(--tw-content);bottom:50%}.before\:left-\[0\.4rem\]:before{content:var(--tw-content);left:.4rem}.before\:top-0:before{content:var(--tw-content);top:0}.before\:top-1\/2:before{content:var(--tw-content);top:50%}.before\:border-l:before{content:var(--tw-content);border-left-width:1px}.before\:border-\[\#e3e3e0\]:before{content:var(--tw-content);--tw-border-opacity: 1;border-color:rgb(227 227 224 / var(--tw-border-opacity, 1))}.hover\:border-\[\#19140035\]:hover{border-color:#19140035}.hover\:border-\[\#1915014a\]:hover{border-color:#1915014a}.hover\:border-black:hover{--tw-border-opacity: 1;border-color:rgb(0 0 0 / var(--tw-border-opacity, 1))}.hover\:border-gray-300:hover{--tw-border-opacity: 1;border-color:rgb(209 213 219 / var(--tw-border-opacity, 1))}.hover\:bg-black:hover{--tw-bg-opacity: 1;background-color:rgb(0 0 0 / var(--tw-bg-opacity, 1))}.hover\:bg-gray-100:hover{--tw-bg-opacity: 1;background-color:rgb(243 244 246 / var(--tw-bg-opacity, 1))}.hover\:bg-gray-50:hover{--tw-bg-opacity: 1;background-color:rgb(249 250 251 / var(--tw-bg-opacity, 1))}.hover\:bg-gray-700:hover{--tw-bg-opacity: 1;background-color:rgb(55 65 81 / var(--tw-bg-opacity, 1))}.hover\:bg-red-500:hover{--tw-bg-opacity: 1;background-color:rgb(239 68 68 / var(--tw-bg-opacity, 1))}.hover\:text-gray-400:hover{--tw-text-opacity: 1;color:rgb(156 163 175 / var(--tw-text-opacity, 1))}.hover\:text-gray-500:hover{--tw-text-opacity: 1;color:rgb(107 114 128 / var(--tw-text-opacity, 1))}.hover\:text-gray-700:hover{--tw-text-opacity: 1;color:rgb(55 65 81 / var(--tw-text-opacity, 1))}.hover\:text-gray-800:hover{--tw-text-opacity: 1;color:rgb(31 41 55 / var(--tw-text-opacity, 1))}.hover\:text-gray-900:hover{--tw-text-opacity: 1;color:rgb(17 24 39 / var(--tw-text-opacity, 1))}.focus\:border-blue-300:focus{--tw-border-opacity: 1;border-color:rgb(147 197 253 / var(--tw-border-opacity, 1))}.focus\:border-gray-300:focus{--tw-border-opacity: 1;border-color:rgb(209 213 219 / var(--tw-border-opacity, 1))}.focus\:border-indigo-500:focus{--tw-border-opacity: 1;border-color:rgb(99 102 241 / var(--tw-border-opacity, 1))}.focus\:border-indigo-700:focus{--tw-border-opacity: 1;border-color:rgb(67 56 202 / var(--tw-border-opacity, 1))}.focus\:bg-gray-100:focus{--tw-bg-opacity: 1;background-color:rgb(243 244 246 / var(--tw-bg-opacity, 1))}.focus\:bg-gray-50:focus{--tw-bg-opacity: 1;background-color:rgb(249 250 251 / var(--tw-bg-opacity, 1))}.focus\:bg-gray-700:focus{--tw-bg-opacity: 1;background-color:rgb(55 65 81 / var(--tw-bg-opacity, 1))}.focus\:bg-indigo-100:focus{--tw-bg-opacity: 1;background-color:rgb(224 231 255 / var(--tw-bg-opacity, 1))}.focus\:text-gray-500:focus{--tw-text-opacity: 1;color:rgb(107 114 128 / var(--tw-text-opacity, 1))}.focus\:text-gray-700:focus{--tw-text-opacity: 1;color:rgb(55 65 81 / var(--tw-text-opacity, 1))}.focus\:text-gray-800:focus{--tw-text-opacity: 1;color:rgb(31 41 55 / var(--tw-text-opacity, 1))}.focus\:text-indigo-800:focus{--tw-text-opacity: 1;color:rgb(55 48 163 / var(--tw-text-opacity, 1))}.focus\:outline-none:focus{outline:2px solid transparent;outline-offset:2px}.focus\:ring:focus{--tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(3px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow, 0 0 #0000)}.focus\:ring-2:focus{--tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(2px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow, 0 0 #0000)}.focus\:ring-indigo-500:focus{--tw-ring-opacity: 1;--tw-ring-color: rgb(99 102 241 / var(--tw-ring-opacity, 1))}.focus\:ring-red-500:focus{--tw-ring-opacity: 1;--tw-ring-color: rgb(239 68 68 / var(--tw-ring-opacity, 1))}.focus\:ring-offset-2:focus{--tw-ring-offset-width: 2px}.active\:bg-gray-100:active{--tw-bg-opacity: 1;background-color:rgb(243 244 246 / var(--tw-bg-opacity, 1))}.active\:bg-gray-900:active{--tw-bg-opacity: 1;background-color:rgb(17 24 39 / var(--tw-bg-opacity, 1))}.active\:bg-red-700:active{--tw-bg-opacity: 1;background-color:rgb(185 28 28 / var(--tw-bg-opacity, 1))}.active\:text-gray-500:active{--tw-text-opacity: 1;color:rgb(107 114 128 / var(--tw-text-opacity, 1))}.active\:text-gray-700:active{--tw-text-opacity: 1;color:rgb(55 65 81 / var(--tw-text-opacity, 1))}.active\:text-gray-800:active{--tw-text-opacity: 1;color:rgb(31 41 55 / var(--tw-text-opacity, 1))}.disabled\:opacity-25:disabled{opacity:.25}@media(min-width:640px){.sm\:-my-px{margin-top:-1px;margin-bottom:-1px}.sm\:mx-auto{margin-left:auto;margin-right:auto}.sm\:ms-10{margin-inline-start:2.5rem}.sm\:ms-6{margin-inline-start:1.5rem}.sm\:flex{display:flex}.sm\:hidden{display:none}.sm\:w-full{width:100%}.sm\:max-w-2xl{max-width:42rem}.sm\:max-w-lg{max-width:32rem}.sm\:max-w-md{max-width:28rem}.sm\:max-w-sm{max-width:24rem}.sm\:max-w-xl{max-width:36rem}.sm\:flex-1{flex:1 1 0%}.sm\:translate-y-0{--tw-translate-y: 0px;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.sm\:scale-100{--tw-scale-x: 1;--tw-scale-y: 1;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.sm\:scale-95{--tw-scale-x: .95;--tw-scale-y: .95;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.sm\:items-center{align-items:center}.sm\:justify-center{justify-content:center}.sm\:justify-between{justify-content:space-between}.sm\:gap-2{gap:.5rem}.sm\:rounded-lg{border-radius:.5rem}.sm\:p-8{padding:2rem}.sm\:px-0{padding-left:0;padding-right:0}.sm\:px-6{padding-left:1.5rem;padding-right:1.5rem}.sm\:pt-0{padding-top:0}}@media(min-width:1024px){.lg\:-ml-px{margin-left:-1px}.lg\:-mt-\[6\.6rem\]{margin-top:-6.6rem}.lg\:mb-0{margin-bottom:0}.lg\:mb-6{margin-bottom:1.5rem}.lg\:ml-0{margin-left:0}.lg\:block{display:block}.lg\:aspect-auto{aspect-ratio:auto}.lg\:w-\[438px\]{width:438px}.lg\:max-w-4xl{max-width:56rem}.lg\:grow{flex-grow:1}.lg\:flex-row{flex-direction:row}.lg\:justify-center{justify-content:center}.lg\:rounded-r-lg{border-top-right-radius:.5rem;border-bottom-right-radius:.5rem}.lg\:rounded-t-none{border-top-left-radius:0;border-top-right-radius:0}.lg\:rounded-br-none{border-bottom-right-radius:0}.lg\:rounded-tl-lg{border-top-left-radius:.5rem}.lg\:p-20{padding:5rem}.lg\:p-8{padding:2rem}.lg\:px-8{padding-left:2rem;padding-right:2rem}}.ltr\:origin-top-left:where([dir=ltr],[dir=ltr] *){transform-origin:top left}.ltr\:origin-top-right:where([dir=ltr],[dir=ltr] *){transform-origin:top right}.rtl\:origin-top-left:where([dir=rtl],[dir=rtl] *){transform-origin:top left}.rtl\:origin-top-right:where([dir=rtl],[dir=rtl] *){transform-origin:top right}.rtl\:flex-row-reverse:where([dir=rtl],[dir=rtl] *){flex-direction:row-reverse}@media(prefers-color-scheme:dark){.dark\:block{display:block}.dark\:hidden{display:none}.dark\:border-\[\#3E3E3A\]{--tw-border-opacity: 1;border-color:rgb(62 62 58 / var(--tw-border-opacity, 1))}.dark\:border-\[\#eeeeec\]{--tw-border-opacity: 1;border-color:rgb(238 238 236 / var(--tw-border-opacity, 1))}.dark\:border-gray-600{--tw-border-opacity: 1;border-color:rgb(75 85 99 / var(--tw-border-opacity, 1))}.dark\:bg-\[\#0a0a0a\]{--tw-bg-opacity: 1;background-color:rgb(10 10 10 / var(--tw-bg-opacity, 1))}.dark\:bg-\[\#161615\]{--tw-bg-opacity: 1;background-color:rgb(22 22 21 / var(--tw-bg-opacity, 1))}.dark\:bg-\[\#1D0002\]{--tw-bg-opacity: 1;background-color:rgb(29 0 2 / var(--tw-bg-opacity, 1))}.dark\:bg-\[\#3E3E3A\]{--tw-bg-opacity: 1;background-color:rgb(62 62 58 / var(--tw-bg-opacity, 1))}.dark\:bg-\[\#eeeeec\]{--tw-bg-opacity: 1;background-color:rgb(238 238 236 / var(--tw-bg-opacity, 1))}.dark\:bg-gray-700{--tw-bg-opacity: 1;background-color:rgb(55 65 81 / var(--tw-bg-opacity, 1))}.dark\:bg-gray-800{--tw-bg-opacity: 1;background-color:rgb(31 41 55 / var(--tw-bg-opacity, 1))}.dark\:text-\[\#1C1C1A\]{--tw-text-opacity: 1;color:rgb(28 28 26 / var(--tw-text-opacity, 1))}.dark\:text-\[\#A1A09A\]{--tw-text-opacity: 1;color:rgb(161 160 154 / var(--tw-text-opacity, 1))}.dark\:text-\[\#EDEDEC\]{--tw-text-opacity: 1;color:rgb(237 237 236 / var(--tw-text-opacity, 1))}.dark\:text-\[\#F61500\]{--tw-text-opacity: 1;color:rgb(246 21 0 / var(--tw-text-opacity, 1))}.dark\:text-\[\#FF4433\]{--tw-text-opacity: 1;color:rgb(255 68 51 / var(--tw-text-opacity, 1))}.dark\:text-gray-200{--tw-text-opacity: 1;color:rgb(229 231 235 / var(--tw-text-opacity, 1))}.dark\:text-gray-300{--tw-text-opacity: 1;color:rgb(209 213 219 / var(--tw-text-opacity, 1))}.dark\:text-gray-400{--tw-text-opacity: 1;color:rgb(156 163 175 / var(--tw-text-opacity, 1))}.dark\:text-gray-600{--tw-text-opacity: 1;color:rgb(75 85 99 / var(--tw-text-opacity, 1))}.dark\:shadow-\[inset_0px_0px_0px_1px_\#fffaed2d\]{--tw-shadow: inset 0px 0px 0px 1px #fffaed2d;--tw-shadow-colored: inset 0px 0px 0px 1px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.dark\:before\:border-\[\#3E3E3A\]:before{content:var(--tw-content);--tw-border-opacity: 1;border-color:rgb(62 62 58 / var(--tw-border-opacity, 1))}.dark\:hover\:border-\[\#3E3E3A\]:hover{--tw-border-opacity: 1;border-color:rgb(62 62 58 / var(--tw-border-opacity, 1))}.dark\:hover\:border-\[\#62605b\]:hover{--tw-border-opacity: 1;border-color:rgb(98 96 91 / var(--tw-border-opacity, 1))}.dark\:hover\:border-white:hover{--tw-border-opacity: 1;border-color:rgb(255 255 255 / var(--tw-border-opacity, 1))}.dark\:hover\:bg-gray-900:hover{--tw-bg-opacity: 1;background-color:rgb(17 24 39 / var(--tw-bg-opacity, 1))}.dark\:hover\:bg-white:hover{--tw-bg-opacity: 1;background-color:rgb(255 255 255 / var(--tw-bg-opacity, 1))}.dark\:hover\:text-gray-200:hover{--tw-text-opacity: 1;color:rgb(229 231 235 / var(--tw-text-opacity, 1))}.dark\:hover\:text-gray-300:hover{--tw-text-opacity: 1;color:rgb(209 213 219 / var(--tw-text-opacity, 1))}.dark\:focus\:border-blue-700:focus{--tw-border-opacity: 1;border-color:rgb(29 78 216 / var(--tw-border-opacity, 1))}.dark\:focus\:border-blue-800:focus{--tw-border-opacity: 1;border-color:rgb(30 64 175 / var(--tw-border-opacity, 1))}.dark\:active\:bg-gray-700:active{--tw-bg-opacity: 1;background-color:rgb(55 65 81 / var(--tw-bg-opacity, 1))}.dark\:active\:text-gray-300:active{--tw-text-opacity: 1;color:rgb(209 213 219 / var(--tw-text-opacity, 1))}}
diff --git a/html/build/manifest.json b/html/build/manifest.json
new file mode 100644
index 0000000..651a5c3
--- /dev/null
+++ b/html/build/manifest.json
@@ -0,0 +1,17 @@
+{
+  "resources/css/app.css": {
+    "file": "assets/app-CEwZte8_.css",
+    "src": "resources/css/app.css",
+    "isEntry": true,
+    "name": "app",
+    "names": [
+      "app.css"
+    ]
+  },
+  "resources/js/app.js": {
+    "file": "assets/app-BIJoUbyE.js",
+    "name": "app",
+    "src": "resources/js/app.js",
+    "isEntry": true
+  }
+}
\ No newline at end of file
diff --git a/html/favicon.ico b/html/favicon.ico
new file mode 100644
index 0000000..e69de29
diff --git a/html/index.php b/html/index.php
new file mode 100644
index 0000000..ee8f07e
--- /dev/null
+++ b/html/index.php
@@ -0,0 +1,20 @@
+<?php
+
+use Illuminate\Foundation\Application;
+use Illuminate\Http\Request;
+
+define('LARAVEL_START', microtime(true));
+
+// Determine if the application is in maintenance mode...
+if (file_exists($maintenance = __DIR__.'/../storage/framework/maintenance.php')) {
+    require $maintenance;
+}
+
+// Register the Composer autoloader...
+require __DIR__.'/../vendor/autoload.php';
+
+// Bootstrap Laravel and handle the request...
+/** @var Application $app */
+$app = require_once __DIR__.'/../bootstrap/app.php';
+
+$app->handleRequest(Request::capture());
diff --git a/html/robots.txt b/html/robots.txt
new file mode 100644
index 0000000..eb05362
--- /dev/null
+++ b/html/robots.txt
@@ -0,0 +1,2 @@
+User-agent: *
+Disallow:
diff --git a/html/storage/.gitignore b/html/storage/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/html/storage/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/package-lock.json b/package-lock.json
new file mode 100644
index 0000000..320f294
--- /dev/null
+++ b/package-lock.json
@@ -0,0 +1,3476 @@
+{
+    "name": "einkauf",
+    "lockfileVersion": 3,
+    "requires": true,
+    "packages": {
+        "": {
+            "devDependencies": {
+                "@tailwindcss/forms": "^0.5.2",
+                "@tailwindcss/vite": "^4.0.0",
+                "alpinejs": "^3.4.2",
+                "autoprefixer": "^10.4.2",
+                "axios": "^1.11.0",
+                "concurrently": "^9.0.1",
+                "laravel-vite-plugin": "^2.0.0",
+                "postcss": "^8.4.31",
+                "tailwindcss": "^3.1.0",
+                "vite": "^7.0.7"
+            }
+        },
+        "node_modules/@alloc/quick-lru": {
+            "version": "5.2.0",
+            "resolved": "https://registry.npmjs.org/@alloc/quick-lru/-/quick-lru-5.2.0.tgz",
+            "integrity": "sha512-UrcABB+4bUrFABwbluTIBErXwvbsU/V7TZWfmbgJfbkwiBuziS9gxdODUyuiecfdGQ85jglMW6juS3+z5TsKLw==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=10"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/sindresorhus"
+            }
+        },
+        "node_modules/@esbuild/aix-ppc64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/aix-ppc64/-/aix-ppc64-0.27.4.tgz",
+            "integrity": "sha512-cQPwL2mp2nSmHHJlCyoXgHGhbEPMrEEU5xhkcy3Hs/O7nGZqEpZ2sUtLaL9MORLtDfRvVl2/3PAuEkYZH0Ty8Q==",
+            "cpu": [
+                "ppc64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "aix"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/android-arm": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.27.4.tgz",
+            "integrity": "sha512-X9bUgvxiC8CHAGKYufLIHGXPJWnr0OCdR0anD2e21vdvgCI8lIfqFbnoeOz7lBjdrAGUhqLZLcQo6MLhTO2DKQ==",
+            "cpu": [
+                "arm"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "android"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/android-arm64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.27.4.tgz",
+            "integrity": "sha512-gdLscB7v75wRfu7QSm/zg6Rx29VLdy9eTr2t44sfTW7CxwAtQghZ4ZnqHk3/ogz7xao0QAgrkradbBzcqFPasw==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "android"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/android-x64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.27.4.tgz",
+            "integrity": "sha512-PzPFnBNVF292sfpfhiyiXCGSn9HZg5BcAz+ivBuSsl6Rk4ga1oEXAamhOXRFyMcjwr2DVtm40G65N3GLeH1Lvw==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "android"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/darwin-arm64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.27.4.tgz",
+            "integrity": "sha512-b7xaGIwdJlht8ZFCvMkpDN6uiSmnxxK56N2GDTMYPr2/gzvfdQN8rTfBsvVKmIVY/X7EM+/hJKEIbbHs9oA4tQ==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "darwin"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/darwin-x64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.27.4.tgz",
+            "integrity": "sha512-sR+OiKLwd15nmCdqpXMnuJ9W2kpy0KigzqScqHI3Hqwr7IXxBp3Yva+yJwoqh7rE8V77tdoheRYataNKL4QrPw==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "darwin"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/freebsd-arm64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.27.4.tgz",
+            "integrity": "sha512-jnfpKe+p79tCnm4GVav68A7tUFeKQwQyLgESwEAUzyxk/TJr4QdGog9sqWNcUbr/bZt/O/HXouspuQDd9JxFSw==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "freebsd"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/freebsd-x64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.27.4.tgz",
+            "integrity": "sha512-2kb4ceA/CpfUrIcTUl1wrP/9ad9Atrp5J94Lq69w7UwOMolPIGrfLSvAKJp0RTvkPPyn6CIWrNy13kyLikZRZQ==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "freebsd"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/linux-arm": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.27.4.tgz",
+            "integrity": "sha512-aBYgcIxX/wd5n2ys0yESGeYMGF+pv6g0DhZr3G1ZG4jMfruU9Tl1i2Z+Wnj9/KjGz1lTLCcorqE2viePZqj4Eg==",
+            "cpu": [
+                "arm"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/linux-arm64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.27.4.tgz",
+            "integrity": "sha512-7nQOttdzVGth1iz57kxg9uCz57dxQLHWxopL6mYuYthohPKEK0vU0C3O21CcBK6KDlkYVcnDXY099HcCDXd9dA==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/linux-ia32": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.27.4.tgz",
+            "integrity": "sha512-oPtixtAIzgvzYcKBQM/qZ3R+9TEUd1aNJQu0HhGyqtx6oS7qTpvjheIWBbes4+qu1bNlo2V4cbkISr8q6gRBFA==",
+            "cpu": [
+                "ia32"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/linux-loong64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.27.4.tgz",
+            "integrity": "sha512-8mL/vh8qeCoRcFH2nM8wm5uJP+ZcVYGGayMavi8GmRJjuI3g1v6Z7Ni0JJKAJW+m0EtUuARb6Lmp4hMjzCBWzA==",
+            "cpu": [
+                "loong64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/linux-mips64el": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.27.4.tgz",
+            "integrity": "sha512-1RdrWFFiiLIW7LQq9Q2NES+HiD4NyT8Itj9AUeCl0IVCA459WnPhREKgwrpaIfTOe+/2rdntisegiPWn/r/aAw==",
+            "cpu": [
+                "mips64el"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/linux-ppc64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.27.4.tgz",
+            "integrity": "sha512-tLCwNG47l3sd9lpfyx9LAGEGItCUeRCWeAx6x2Jmbav65nAwoPXfewtAdtbtit/pJFLUWOhpv0FpS6GQAmPrHA==",
+            "cpu": [
+                "ppc64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/linux-riscv64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.27.4.tgz",
+            "integrity": "sha512-BnASypppbUWyqjd1KIpU4AUBiIhVr6YlHx/cnPgqEkNoVOhHg+YiSVxM1RLfiy4t9cAulbRGTNCKOcqHrEQLIw==",
+            "cpu": [
+                "riscv64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/linux-s390x": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.27.4.tgz",
+            "integrity": "sha512-+eUqgb/Z7vxVLezG8bVB9SfBie89gMueS+I0xYh2tJdw3vqA/0ImZJ2ROeWwVJN59ihBeZ7Tu92dF/5dy5FttA==",
+            "cpu": [
+                "s390x"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/linux-x64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.27.4.tgz",
+            "integrity": "sha512-S5qOXrKV8BQEzJPVxAwnryi2+Iq5pB40gTEIT69BQONqR7JH1EPIcQ/Uiv9mCnn05jff9umq/5nqzxlqTOg9NA==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/netbsd-arm64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/netbsd-arm64/-/netbsd-arm64-0.27.4.tgz",
+            "integrity": "sha512-xHT8X4sb0GS8qTqiwzHqpY00C95DPAq7nAwX35Ie/s+LO9830hrMd3oX0ZMKLvy7vsonee73x0lmcdOVXFzd6Q==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "netbsd"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/netbsd-x64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.27.4.tgz",
+            "integrity": "sha512-RugOvOdXfdyi5Tyv40kgQnI0byv66BFgAqjdgtAKqHoZTbTF2QqfQrFwa7cHEORJf6X2ht+l9ABLMP0dnKYsgg==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "netbsd"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/openbsd-arm64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/openbsd-arm64/-/openbsd-arm64-0.27.4.tgz",
+            "integrity": "sha512-2MyL3IAaTX+1/qP0O1SwskwcwCoOI4kV2IBX1xYnDDqthmq5ArrW94qSIKCAuRraMgPOmG0RDTA74mzYNQA9ow==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "openbsd"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/openbsd-x64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.27.4.tgz",
+            "integrity": "sha512-u8fg/jQ5aQDfsnIV6+KwLOf1CmJnfu1ShpwqdwC0uA7ZPwFws55Ngc12vBdeUdnuWoQYx/SOQLGDcdlfXhYmXQ==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "openbsd"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/openharmony-arm64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/openharmony-arm64/-/openharmony-arm64-0.27.4.tgz",
+            "integrity": "sha512-JkTZrl6VbyO8lDQO3yv26nNr2RM2yZzNrNHEsj9bm6dOwwu9OYN28CjzZkH57bh4w0I2F7IodpQvUAEd1mbWXg==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "openharmony"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/sunos-x64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.27.4.tgz",
+            "integrity": "sha512-/gOzgaewZJfeJTlsWhvUEmUG4tWEY2Spp5M20INYRg2ZKl9QPO3QEEgPeRtLjEWSW8FilRNacPOg8R1uaYkA6g==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "sunos"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/win32-arm64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.27.4.tgz",
+            "integrity": "sha512-Z9SExBg2y32smoDQdf1HRwHRt6vAHLXcxD2uGgO/v2jK7Y718Ix4ndsbNMU/+1Qiem9OiOdaqitioZwxivhXYg==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "win32"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/win32-ia32": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.27.4.tgz",
+            "integrity": "sha512-DAyGLS0Jz5G5iixEbMHi5KdiApqHBWMGzTtMiJ72ZOLhbu/bzxgAe8Ue8CTS3n3HbIUHQz/L51yMdGMeoxXNJw==",
+            "cpu": [
+                "ia32"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "win32"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@esbuild/win32-x64": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.27.4.tgz",
+            "integrity": "sha512-+knoa0BDoeXgkNvvV1vvbZX4+hizelrkwmGJBdT17t8FNPwG2lKemmuMZlmaNQ3ws3DKKCxpb4zRZEIp3UxFCg==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "win32"
+            ],
+            "engines": {
+                "node": ">=18"
+            }
+        },
+        "node_modules/@jridgewell/gen-mapping": {
+            "version": "0.3.13",
+            "resolved": "https://registry.npmjs.org/@jridgewell/gen-mapping/-/gen-mapping-0.3.13.tgz",
+            "integrity": "sha512-2kkt/7niJ6MgEPxF0bYdQ6etZaA+fQvDcLKckhy1yIQOzaoKjBBjSj63/aLVjYE3qhRt5dvM+uUyfCg6UKCBbA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@jridgewell/sourcemap-codec": "^1.5.0",
+                "@jridgewell/trace-mapping": "^0.3.24"
+            }
+        },
+        "node_modules/@jridgewell/remapping": {
+            "version": "2.3.5",
+            "resolved": "https://registry.npmjs.org/@jridgewell/remapping/-/remapping-2.3.5.tgz",
+            "integrity": "sha512-LI9u/+laYG4Ds1TDKSJW2YPrIlcVYOwi2fUC6xB43lueCjgxV4lffOCZCtYFiH6TNOX+tQKXx97T4IKHbhyHEQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@jridgewell/gen-mapping": "^0.3.5",
+                "@jridgewell/trace-mapping": "^0.3.24"
+            }
+        },
+        "node_modules/@jridgewell/resolve-uri": {
+            "version": "3.1.2",
+            "resolved": "https://registry.npmjs.org/@jridgewell/resolve-uri/-/resolve-uri-3.1.2.tgz",
+            "integrity": "sha512-bRISgCIjP20/tbWSPWMEi54QVPRZExkuD9lJL+UIxUKtwVJA8wW1Trb1jMs1RFXo1CBTNZ/5hpC9QvmKWdopKw==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=6.0.0"
+            }
+        },
+        "node_modules/@jridgewell/sourcemap-codec": {
+            "version": "1.5.5",
+            "resolved": "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.5.5.tgz",
+            "integrity": "sha512-cYQ9310grqxueWbl+WuIUIaiUaDcj7WOq5fVhEljNVgRfOUhY9fy2zTvfoqWsnebh8Sl70VScFbICvJnLKB0Og==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/@jridgewell/trace-mapping": {
+            "version": "0.3.31",
+            "resolved": "https://registry.npmjs.org/@jridgewell/trace-mapping/-/trace-mapping-0.3.31.tgz",
+            "integrity": "sha512-zzNR+SdQSDJzc8joaeP8QQoCQr8NuYx2dIIytl1QeBEZHJ9uW6hebsrYgbz8hJwUQao3TWCMtmfV8Nu1twOLAw==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@jridgewell/resolve-uri": "^3.1.0",
+                "@jridgewell/sourcemap-codec": "^1.4.14"
+            }
+        },
+        "node_modules/@nodelib/fs.scandir": {
+            "version": "2.1.5",
+            "resolved": "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz",
+            "integrity": "sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@nodelib/fs.stat": "2.0.5",
+                "run-parallel": "^1.1.9"
+            },
+            "engines": {
+                "node": ">= 8"
+            }
+        },
+        "node_modules/@nodelib/fs.stat": {
+            "version": "2.0.5",
+            "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz",
+            "integrity": "sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 8"
+            }
+        },
+        "node_modules/@nodelib/fs.walk": {
+            "version": "1.2.8",
+            "resolved": "https://registry.npmjs.org/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz",
+            "integrity": "sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@nodelib/fs.scandir": "2.1.5",
+                "fastq": "^1.6.0"
+            },
+            "engines": {
+                "node": ">= 8"
+            }
+        },
+        "node_modules/@rollup/rollup-android-arm-eabi": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.60.0.tgz",
+            "integrity": "sha512-WOhNW9K8bR3kf4zLxbfg6Pxu2ybOUbB2AjMDHSQx86LIF4rH4Ft7vmMwNt0loO0eonglSNy4cpD3MKXXKQu0/A==",
+            "cpu": [
+                "arm"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "android"
+            ]
+        },
+        "node_modules/@rollup/rollup-android-arm64": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.60.0.tgz",
+            "integrity": "sha512-u6JHLll5QKRvjciE78bQXDmqRqNs5M/3GVqZeMwvmjaNODJih/WIrJlFVEihvV0MiYFmd+ZyPr9wxOVbPAG2Iw==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "android"
+            ]
+        },
+        "node_modules/@rollup/rollup-darwin-arm64": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.60.0.tgz",
+            "integrity": "sha512-qEF7CsKKzSRc20Ciu2Zw1wRrBz4g56F7r/vRwY430UPp/nt1x21Q/fpJ9N5l47WWvJlkNCPJz3QRVw008fi7yA==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "darwin"
+            ]
+        },
+        "node_modules/@rollup/rollup-darwin-x64": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.60.0.tgz",
+            "integrity": "sha512-WADYozJ4QCnXCH4wPB+3FuGmDPoFseVCUrANmA5LWwGmC6FL14BWC7pcq+FstOZv3baGX65tZ378uT6WG8ynTw==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "darwin"
+            ]
+        },
+        "node_modules/@rollup/rollup-freebsd-arm64": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-freebsd-arm64/-/rollup-freebsd-arm64-4.60.0.tgz",
+            "integrity": "sha512-6b8wGHJlDrGeSE3aH5mGNHBjA0TTkxdoNHik5EkvPHCt351XnigA4pS7Wsj/Eo9Y8RBU6f35cjN9SYmCFBtzxw==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "freebsd"
+            ]
+        },
+        "node_modules/@rollup/rollup-freebsd-x64": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-freebsd-x64/-/rollup-freebsd-x64-4.60.0.tgz",
+            "integrity": "sha512-h25Ga0t4jaylMB8M/JKAyrvvfxGRjnPQIR8lnCayyzEjEOx2EJIlIiMbhpWxDRKGKF8jbNH01NnN663dH638mA==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "freebsd"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-arm-gnueabihf": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.60.0.tgz",
+            "integrity": "sha512-RzeBwv0B3qtVBWtcuABtSuCzToo2IEAIQrcyB/b2zMvBWVbjo8bZDjACUpnaafaxhTw2W+imQbP2BD1usasK4g==",
+            "cpu": [
+                "arm"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-arm-musleabihf": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.60.0.tgz",
+            "integrity": "sha512-Sf7zusNI2CIU1HLzuu9Tc5YGAHEZs5Lu7N1ssJG4Tkw6e0MEsN7NdjUDDfGNHy2IU+ENyWT+L2obgWiguWibWQ==",
+            "cpu": [
+                "arm"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-arm64-gnu": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.60.0.tgz",
+            "integrity": "sha512-DX2x7CMcrJzsE91q7/O02IJQ5/aLkVtYFryqCjduJhUfGKG6yJV8hxaw8pZa93lLEpPTP/ohdN4wFz7yp/ry9A==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-arm64-musl": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.60.0.tgz",
+            "integrity": "sha512-09EL+yFVbJZlhcQfShpswwRZ0Rg+z/CsSELFCnPt3iK+iqwGsI4zht3secj5vLEs957QvFFXnzAT0FFPIxSrkQ==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-loong64-gnu": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-loong64-gnu/-/rollup-linux-loong64-gnu-4.60.0.tgz",
+            "integrity": "sha512-i9IcCMPr3EXm8EQg5jnja0Zyc1iFxJjZWlb4wr7U2Wx/GrddOuEafxRdMPRYVaXjgbhvqalp6np07hN1w9kAKw==",
+            "cpu": [
+                "loong64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-loong64-musl": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-loong64-musl/-/rollup-linux-loong64-musl-4.60.0.tgz",
+            "integrity": "sha512-DGzdJK9kyJ+B78MCkWeGnpXJ91tK/iKA6HwHxF4TAlPIY7GXEvMe8hBFRgdrR9Ly4qebR/7gfUs9y2IoaVEyog==",
+            "cpu": [
+                "loong64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-ppc64-gnu": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-ppc64-gnu/-/rollup-linux-ppc64-gnu-4.60.0.tgz",
+            "integrity": "sha512-RwpnLsqC8qbS8z1H1AxBA1H6qknR4YpPR9w2XX0vo2Sz10miu57PkNcnHVaZkbqyw/kUWfKMI73jhmfi9BRMUQ==",
+            "cpu": [
+                "ppc64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-ppc64-musl": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-ppc64-musl/-/rollup-linux-ppc64-musl-4.60.0.tgz",
+            "integrity": "sha512-Z8pPf54Ly3aqtdWC3G4rFigZgNvd+qJlOE52fmko3KST9SoGfAdSRCwyoyG05q1HrrAblLbk1/PSIV+80/pxLg==",
+            "cpu": [
+                "ppc64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-riscv64-gnu": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.60.0.tgz",
+            "integrity": "sha512-3a3qQustp3COCGvnP4SvrMHnPQ9d1vzCakQVRTliaz8cIp/wULGjiGpbcqrkv0WrHTEp8bQD/B3HBjzujVWLOA==",
+            "cpu": [
+                "riscv64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-riscv64-musl": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-riscv64-musl/-/rollup-linux-riscv64-musl-4.60.0.tgz",
+            "integrity": "sha512-pjZDsVH/1VsghMJ2/kAaxt6dL0psT6ZexQVrijczOf+PeP2BUqTHYejk3l6TlPRydggINOeNRhvpLa0AYpCWSQ==",
+            "cpu": [
+                "riscv64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-s390x-gnu": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.60.0.tgz",
+            "integrity": "sha512-3ObQs0BhvPgiUVZrN7gqCSvmFuMWvWvsjG5ayJ3Lraqv+2KhOsp+pUbigqbeWqueGIsnn+09HBw27rJ+gYK4VQ==",
+            "cpu": [
+                "s390x"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-x64-gnu": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.60.0.tgz",
+            "integrity": "sha512-EtylprDtQPdS5rXvAayrNDYoJhIz1/vzN2fEubo3yLE7tfAw+948dO0g4M0vkTVFhKojnF+n6C8bDNe+gDRdTg==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-linux-x64-musl": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.60.0.tgz",
+            "integrity": "sha512-k09oiRCi/bHU9UVFqD17r3eJR9bn03TyKraCrlz5ULFJGdJGi7VOmm9jl44vOJvRJ6P7WuBi/s2A97LxxHGIdw==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ]
+        },
+        "node_modules/@rollup/rollup-openbsd-x64": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-openbsd-x64/-/rollup-openbsd-x64-4.60.0.tgz",
+            "integrity": "sha512-1o/0/pIhozoSaDJoDcec+IVLbnRtQmHwPV730+AOD29lHEEo4F5BEUB24H0OBdhbBBDwIOSuf7vgg0Ywxdfiiw==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "openbsd"
+            ]
+        },
+        "node_modules/@rollup/rollup-openharmony-arm64": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-openharmony-arm64/-/rollup-openharmony-arm64-4.60.0.tgz",
+            "integrity": "sha512-pESDkos/PDzYwtyzB5p/UoNU/8fJo68vcXM9ZW2V0kjYayj1KaaUfi1NmTUTUpMn4UhU4gTuK8gIaFO4UGuMbA==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "openharmony"
+            ]
+        },
+        "node_modules/@rollup/rollup-win32-arm64-msvc": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.60.0.tgz",
+            "integrity": "sha512-hj1wFStD7B1YBeYmvY+lWXZ7ey73YGPcViMShYikqKT1GtstIKQAtfUI6yrzPjAy/O7pO0VLXGmUVWXQMaYgTQ==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "win32"
+            ]
+        },
+        "node_modules/@rollup/rollup-win32-ia32-msvc": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.60.0.tgz",
+            "integrity": "sha512-SyaIPFoxmUPlNDq5EHkTbiKzmSEmq/gOYFI/3HHJ8iS/v1mbugVa7dXUzcJGQfoytp9DJFLhHH4U3/eTy2Bq4w==",
+            "cpu": [
+                "ia32"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "win32"
+            ]
+        },
+        "node_modules/@rollup/rollup-win32-x64-gnu": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-x64-gnu/-/rollup-win32-x64-gnu-4.60.0.tgz",
+            "integrity": "sha512-RdcryEfzZr+lAr5kRm2ucN9aVlCCa2QNq4hXelZxb8GG0NJSazq44Z3PCCc8wISRuCVnGs0lQJVX5Vp6fKA+IA==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "win32"
+            ]
+        },
+        "node_modules/@rollup/rollup-win32-x64-msvc": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.60.0.tgz",
+            "integrity": "sha512-PrsWNQ8BuE00O3Xsx3ALh2Df8fAj9+cvvX9AIA6o4KpATR98c9mud4XtDWVvsEuyia5U4tVSTKygawyJkjm60w==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "win32"
+            ]
+        },
+        "node_modules/@tailwindcss/forms": {
+            "version": "0.5.11",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/forms/-/forms-0.5.11.tgz",
+            "integrity": "sha512-h9wegbZDPurxG22xZSoWtdzc41/OlNEUQERNqI/0fOwa2aVlWGu7C35E/x6LDyD3lgtztFSSjKZyuVM0hxhbgA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "mini-svg-data-uri": "^1.2.3"
+            },
+            "peerDependencies": {
+                "tailwindcss": ">=3.0.0 || >= 3.0.0-alpha.1 || >= 4.0.0-alpha.20 || >= 4.0.0-beta.1"
+            }
+        },
+        "node_modules/@tailwindcss/node": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/node/-/node-4.2.2.tgz",
+            "integrity": "sha512-pXS+wJ2gZpVXqFaUEjojq7jzMpTGf8rU6ipJz5ovJV6PUGmlJ+jvIwGrzdHdQ80Sg+wmQxUFuoW1UAAwHNEdFA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@jridgewell/remapping": "^2.3.5",
+                "enhanced-resolve": "^5.19.0",
+                "jiti": "^2.6.1",
+                "lightningcss": "1.32.0",
+                "magic-string": "^0.30.21",
+                "source-map-js": "^1.2.1",
+                "tailwindcss": "4.2.2"
+            }
+        },
+        "node_modules/@tailwindcss/node/node_modules/tailwindcss": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/tailwindcss/-/tailwindcss-4.2.2.tgz",
+            "integrity": "sha512-KWBIxs1Xb6NoLdMVqhbhgwZf2PGBpPEiwOqgI4pFIYbNTfBXiKYyWoTsXgBQ9WFg/OlhnvHaY+AEpW7wSmFo2Q==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/@tailwindcss/oxide": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide/-/oxide-4.2.2.tgz",
+            "integrity": "sha512-qEUA07+E5kehxYp9BVMpq9E8vnJuBHfJEC0vPC5e7iL/hw7HR61aDKoVoKzrG+QKp56vhNZe4qwkRmMC0zDLvg==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 20"
+            },
+            "optionalDependencies": {
+                "@tailwindcss/oxide-android-arm64": "4.2.2",
+                "@tailwindcss/oxide-darwin-arm64": "4.2.2",
+                "@tailwindcss/oxide-darwin-x64": "4.2.2",
+                "@tailwindcss/oxide-freebsd-x64": "4.2.2",
+                "@tailwindcss/oxide-linux-arm-gnueabihf": "4.2.2",
+                "@tailwindcss/oxide-linux-arm64-gnu": "4.2.2",
+                "@tailwindcss/oxide-linux-arm64-musl": "4.2.2",
+                "@tailwindcss/oxide-linux-x64-gnu": "4.2.2",
+                "@tailwindcss/oxide-linux-x64-musl": "4.2.2",
+                "@tailwindcss/oxide-wasm32-wasi": "4.2.2",
+                "@tailwindcss/oxide-win32-arm64-msvc": "4.2.2",
+                "@tailwindcss/oxide-win32-x64-msvc": "4.2.2"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-android-arm64": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-android-arm64/-/oxide-android-arm64-4.2.2.tgz",
+            "integrity": "sha512-dXGR1n+P3B6748jZO/SvHZq7qBOqqzQ+yFrXpoOWWALWndF9MoSKAT3Q0fYgAzYzGhxNYOoysRvYlpixRBBoDg==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "android"
+            ],
+            "engines": {
+                "node": ">= 20"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-darwin-arm64": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-darwin-arm64/-/oxide-darwin-arm64-4.2.2.tgz",
+            "integrity": "sha512-iq9Qjr6knfMpZHj55/37ouZeykwbDqF21gPFtfnhCCKGDcPI/21FKC9XdMO/XyBM7qKORx6UIhGgg6jLl7BZlg==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "darwin"
+            ],
+            "engines": {
+                "node": ">= 20"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-darwin-x64": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-darwin-x64/-/oxide-darwin-x64-4.2.2.tgz",
+            "integrity": "sha512-BlR+2c3nzc8f2G639LpL89YY4bdcIdUmiOOkv2GQv4/4M0vJlpXEa0JXNHhCHU7VWOKWT/CjqHdTP8aUuDJkuw==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "darwin"
+            ],
+            "engines": {
+                "node": ">= 20"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-freebsd-x64": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-freebsd-x64/-/oxide-freebsd-x64-4.2.2.tgz",
+            "integrity": "sha512-YUqUgrGMSu2CDO82hzlQ5qSb5xmx3RUrke/QgnoEx7KvmRJHQuZHZmZTLSuuHwFf0DJPybFMXMYf+WJdxHy/nQ==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "freebsd"
+            ],
+            "engines": {
+                "node": ">= 20"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-linux-arm-gnueabihf": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm-gnueabihf/-/oxide-linux-arm-gnueabihf-4.2.2.tgz",
+            "integrity": "sha512-FPdhvsW6g06T9BWT0qTwiVZYE2WIFo2dY5aCSpjG/S/u1tby+wXoslXS0kl3/KXnULlLr1E3NPRRw0g7t2kgaQ==",
+            "cpu": [
+                "arm"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">= 20"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-linux-arm64-gnu": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm64-gnu/-/oxide-linux-arm64-gnu-4.2.2.tgz",
+            "integrity": "sha512-4og1V+ftEPXGttOO7eCmW7VICmzzJWgMx+QXAJRAhjrSjumCwWqMfkDrNu1LXEQzNAwz28NCUpucgQPrR4S2yw==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">= 20"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-linux-arm64-musl": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm64-musl/-/oxide-linux-arm64-musl-4.2.2.tgz",
+            "integrity": "sha512-oCfG/mS+/+XRlwNjnsNLVwnMWYH7tn/kYPsNPh+JSOMlnt93mYNCKHYzylRhI51X+TbR+ufNhhKKzm6QkqX8ag==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">= 20"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-linux-x64-gnu": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-x64-gnu/-/oxide-linux-x64-gnu-4.2.2.tgz",
+            "integrity": "sha512-rTAGAkDgqbXHNp/xW0iugLVmX62wOp2PoE39BTCGKjv3Iocf6AFbRP/wZT/kuCxC9QBh9Pu8XPkv/zCZB2mcMg==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">= 20"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-linux-x64-musl": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-x64-musl/-/oxide-linux-x64-musl-4.2.2.tgz",
+            "integrity": "sha512-XW3t3qwbIwiSyRCggeO2zxe3KWaEbM0/kW9e8+0XpBgyKU4ATYzcVSMKteZJ1iukJ3HgHBjbg9P5YPRCVUxlnQ==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">= 20"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-wasm32-wasi": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-wasm32-wasi/-/oxide-wasm32-wasi-4.2.2.tgz",
+            "integrity": "sha512-eKSztKsmEsn1O5lJ4ZAfyn41NfG7vzCg496YiGtMDV86jz1q/irhms5O0VrY6ZwTUkFy/EKG3RfWgxSI3VbZ8Q==",
+            "bundleDependencies": [
+                "@napi-rs/wasm-runtime",
+                "@emnapi/core",
+                "@emnapi/runtime",
+                "@tybys/wasm-util",
+                "@emnapi/wasi-threads",
+                "tslib"
+            ],
+            "cpu": [
+                "wasm32"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "dependencies": {
+                "@emnapi/core": "^1.8.1",
+                "@emnapi/runtime": "^1.8.1",
+                "@emnapi/wasi-threads": "^1.1.0",
+                "@napi-rs/wasm-runtime": "^1.1.1",
+                "@tybys/wasm-util": "^0.10.1",
+                "tslib": "^2.8.1"
+            },
+            "engines": {
+                "node": ">=14.0.0"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-win32-arm64-msvc": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-win32-arm64-msvc/-/oxide-win32-arm64-msvc-4.2.2.tgz",
+            "integrity": "sha512-qPmaQM4iKu5mxpsrWZMOZRgZv1tOZpUm+zdhhQP0VhJfyGGO3aUKdbh3gDZc/dPLQwW4eSqWGrrcWNBZWUWaXQ==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "win32"
+            ],
+            "engines": {
+                "node": ">= 20"
+            }
+        },
+        "node_modules/@tailwindcss/oxide-win32-x64-msvc": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-win32-x64-msvc/-/oxide-win32-x64-msvc-4.2.2.tgz",
+            "integrity": "sha512-1T/37VvI7WyH66b+vqHj/cLwnCxt7Qt3WFu5Q8hk65aOvlwAhs7rAp1VkulBJw/N4tMirXjVnylTR72uI0HGcA==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "win32"
+            ],
+            "engines": {
+                "node": ">= 20"
+            }
+        },
+        "node_modules/@tailwindcss/vite": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/@tailwindcss/vite/-/vite-4.2.2.tgz",
+            "integrity": "sha512-mEiF5HO1QqCLXoNEfXVA1Tzo+cYsrqV7w9Juj2wdUFyW07JRenqMG225MvPwr3ZD9N1bFQj46X7r33iHxLUW0w==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@tailwindcss/node": "4.2.2",
+                "@tailwindcss/oxide": "4.2.2",
+                "tailwindcss": "4.2.2"
+            },
+            "peerDependencies": {
+                "vite": "^5.2.0 || ^6 || ^7 || ^8"
+            }
+        },
+        "node_modules/@tailwindcss/vite/node_modules/tailwindcss": {
+            "version": "4.2.2",
+            "resolved": "https://registry.npmjs.org/tailwindcss/-/tailwindcss-4.2.2.tgz",
+            "integrity": "sha512-KWBIxs1Xb6NoLdMVqhbhgwZf2PGBpPEiwOqgI4pFIYbNTfBXiKYyWoTsXgBQ9WFg/OlhnvHaY+AEpW7wSmFo2Q==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/@types/estree": {
+            "version": "1.0.8",
+            "resolved": "https://registry.npmjs.org/@types/estree/-/estree-1.0.8.tgz",
+            "integrity": "sha512-dWHzHa2WqEXI/O1E9OjrocMTKJl2mSrEolh1Iomrv6U+JuNwaHXsXx9bLu5gG7BUWFIN0skIQJQ/L1rIex4X6w==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/@vue/reactivity": {
+            "version": "3.1.5",
+            "resolved": "https://registry.npmjs.org/@vue/reactivity/-/reactivity-3.1.5.tgz",
+            "integrity": "sha512-1tdfLmNjWG6t/CsPldh+foumYFo3cpyCHgBYQ34ylaMsJ+SNHQ1kApMIa8jN+i593zQuaw3AdWH0nJTARzCFhg==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@vue/shared": "3.1.5"
+            }
+        },
+        "node_modules/@vue/shared": {
+            "version": "3.1.5",
+            "resolved": "https://registry.npmjs.org/@vue/shared/-/shared-3.1.5.tgz",
+            "integrity": "sha512-oJ4F3TnvpXaQwZJNF3ZK+kLPHKarDmJjJ6jyzVNDKH9md1dptjC7lWR//jrGuLdek/U6iltWxqAnYOu8gCiOvA==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/alpinejs": {
+            "version": "3.15.8",
+            "resolved": "https://registry.npmjs.org/alpinejs/-/alpinejs-3.15.8.tgz",
+            "integrity": "sha512-zxIfCRTBGvF1CCLIOMQOxAyBuqibxSEwS6Jm1a3HGA9rgrJVcjEWlwLcQTVGAWGS8YhAsTRLVrtQ5a5QT9bSSQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@vue/reactivity": "~3.1.1"
+            }
+        },
+        "node_modules/ansi-regex": {
+            "version": "5.0.1",
+            "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz",
+            "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=8"
+            }
+        },
+        "node_modules/ansi-styles": {
+            "version": "4.3.0",
+            "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz",
+            "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "color-convert": "^2.0.1"
+            },
+            "engines": {
+                "node": ">=8"
+            },
+            "funding": {
+                "url": "https://github.com/chalk/ansi-styles?sponsor=1"
+            }
+        },
+        "node_modules/any-promise": {
+            "version": "1.3.0",
+            "resolved": "https://registry.npmjs.org/any-promise/-/any-promise-1.3.0.tgz",
+            "integrity": "sha512-7UvmKalWRt1wgjL1RrGxoSJW/0QZFIegpeGvZG9kjp8vrRu55XTHbwnqq2GpXm9uLbcuhxm3IqX9OB4MZR1b2A==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/anymatch": {
+            "version": "3.1.3",
+            "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.3.tgz",
+            "integrity": "sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==",
+            "dev": true,
+            "license": "ISC",
+            "dependencies": {
+                "normalize-path": "^3.0.0",
+                "picomatch": "^2.0.4"
+            },
+            "engines": {
+                "node": ">= 8"
+            }
+        },
+        "node_modules/arg": {
+            "version": "5.0.2",
+            "resolved": "https://registry.npmjs.org/arg/-/arg-5.0.2.tgz",
+            "integrity": "sha512-PYjyFOLKQ9y57JvQ6QLo8dAgNqswh8M1RMJYdQduT6xbWSgK36P/Z/v+p888pM69jMMfS8Xd8F6I1kQ/I9HUGg==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/asynckit": {
+            "version": "0.4.0",
+            "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz",
+            "integrity": "sha512-Oei9OH4tRh0YqU3GxhX79dM/mwVgvbZJaSNaRk+bshkj0S5cfHcgYakreBjrHwatXKbz+IoIdYLxrKim2MjW0Q==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/autoprefixer": {
+            "version": "10.4.27",
+            "resolved": "https://registry.npmjs.org/autoprefixer/-/autoprefixer-10.4.27.tgz",
+            "integrity": "sha512-NP9APE+tO+LuJGn7/9+cohklunJsXWiaWEfV3si4Gi/XHDwVNgkwr1J3RQYFIvPy76GmJ9/bW8vyoU1LcxwKHA==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "opencollective",
+                    "url": "https://opencollective.com/postcss/"
+                },
+                {
+                    "type": "tidelift",
+                    "url": "https://tidelift.com/funding/github/npm/autoprefixer"
+                },
+                {
+                    "type": "github",
+                    "url": "https://github.com/sponsors/ai"
+                }
+            ],
+            "license": "MIT",
+            "dependencies": {
+                "browserslist": "^4.28.1",
+                "caniuse-lite": "^1.0.30001774",
+                "fraction.js": "^5.3.4",
+                "picocolors": "^1.1.1",
+                "postcss-value-parser": "^4.2.0"
+            },
+            "bin": {
+                "autoprefixer": "bin/autoprefixer"
+            },
+            "engines": {
+                "node": "^10 || ^12 || >=14"
+            },
+            "peerDependencies": {
+                "postcss": "^8.1.0"
+            }
+        },
+        "node_modules/axios": {
+            "version": "1.13.6",
+            "resolved": "https://registry.npmjs.org/axios/-/axios-1.13.6.tgz",
+            "integrity": "sha512-ChTCHMouEe2kn713WHbQGcuYrr6fXTBiu460OTwWrWob16g1bXn4vtz07Ope7ewMozJAnEquLk5lWQWtBig9DQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "follow-redirects": "^1.15.11",
+                "form-data": "^4.0.5",
+                "proxy-from-env": "^1.1.0"
+            }
+        },
+        "node_modules/baseline-browser-mapping": {
+            "version": "2.10.11",
+            "resolved": "https://registry.npmjs.org/baseline-browser-mapping/-/baseline-browser-mapping-2.10.11.tgz",
+            "integrity": "sha512-DAKrHphkJyiGuau/cFieRYhcTFeK/lBuD++C7cZ6KZHbMhBrisoi+EvhQ5RZrIfV5qwsW8kgQ07JIC+MDJRAhg==",
+            "dev": true,
+            "license": "Apache-2.0",
+            "bin": {
+                "baseline-browser-mapping": "dist/cli.cjs"
+            },
+            "engines": {
+                "node": ">=6.0.0"
+            }
+        },
+        "node_modules/binary-extensions": {
+            "version": "2.3.0",
+            "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.3.0.tgz",
+            "integrity": "sha512-Ceh+7ox5qe7LJuLHoY0feh3pHuUDHAcRUeyL2VYghZwfpkNIy/+8Ocg0a3UuSoYzavmylwuLWQOf3hl0jjMMIw==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=8"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/sindresorhus"
+            }
+        },
+        "node_modules/braces": {
+            "version": "3.0.3",
+            "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.3.tgz",
+            "integrity": "sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "fill-range": "^7.1.1"
+            },
+            "engines": {
+                "node": ">=8"
+            }
+        },
+        "node_modules/browserslist": {
+            "version": "4.28.1",
+            "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.28.1.tgz",
+            "integrity": "sha512-ZC5Bd0LgJXgwGqUknZY/vkUQ04r8NXnJZ3yYi4vDmSiZmC/pdSN0NbNRPxZpbtO4uAfDUAFffO8IZoM3Gj8IkA==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "opencollective",
+                    "url": "https://opencollective.com/browserslist"
+                },
+                {
+                    "type": "tidelift",
+                    "url": "https://tidelift.com/funding/github/npm/browserslist"
+                },
+                {
+                    "type": "github",
+                    "url": "https://github.com/sponsors/ai"
+                }
+            ],
+            "license": "MIT",
+            "dependencies": {
+                "baseline-browser-mapping": "^2.9.0",
+                "caniuse-lite": "^1.0.30001759",
+                "electron-to-chromium": "^1.5.263",
+                "node-releases": "^2.0.27",
+                "update-browserslist-db": "^1.2.0"
+            },
+            "bin": {
+                "browserslist": "cli.js"
+            },
+            "engines": {
+                "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7"
+            }
+        },
+        "node_modules/call-bind-apply-helpers": {
+            "version": "1.0.2",
+            "resolved": "https://registry.npmjs.org/call-bind-apply-helpers/-/call-bind-apply-helpers-1.0.2.tgz",
+            "integrity": "sha512-Sp1ablJ0ivDkSzjcaJdxEunN5/XvksFJ2sMBFfq6x0ryhQV/2b/KwFe21cMpmHtPOSij8K99/wSfoEuTObmuMQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "es-errors": "^1.3.0",
+                "function-bind": "^1.1.2"
+            },
+            "engines": {
+                "node": ">= 0.4"
+            }
+        },
+        "node_modules/camelcase-css": {
+            "version": "2.0.1",
+            "resolved": "https://registry.npmjs.org/camelcase-css/-/camelcase-css-2.0.1.tgz",
+            "integrity": "sha512-QOSvevhslijgYwRx6Rv7zKdMF8lbRmx+uQGx2+vDc+KI/eBnsy9kit5aj23AgGu3pa4t9AgwbnXWqS+iOY+2aA==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 6"
+            }
+        },
+        "node_modules/caniuse-lite": {
+            "version": "1.0.30001781",
+            "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001781.tgz",
+            "integrity": "sha512-RdwNCyMsNBftLjW6w01z8bKEvT6e/5tpPVEgtn22TiLGlstHOVecsX2KHFkD5e/vRnIE4EGzpuIODb3mtswtkw==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "opencollective",
+                    "url": "https://opencollective.com/browserslist"
+                },
+                {
+                    "type": "tidelift",
+                    "url": "https://tidelift.com/funding/github/npm/caniuse-lite"
+                },
+                {
+                    "type": "github",
+                    "url": "https://github.com/sponsors/ai"
+                }
+            ],
+            "license": "CC-BY-4.0"
+        },
+        "node_modules/chalk": {
+            "version": "4.1.2",
+            "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.1.2.tgz",
+            "integrity": "sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "ansi-styles": "^4.1.0",
+                "supports-color": "^7.1.0"
+            },
+            "engines": {
+                "node": ">=10"
+            },
+            "funding": {
+                "url": "https://github.com/chalk/chalk?sponsor=1"
+            }
+        },
+        "node_modules/chalk/node_modules/supports-color": {
+            "version": "7.2.0",
+            "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz",
+            "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "has-flag": "^4.0.0"
+            },
+            "engines": {
+                "node": ">=8"
+            }
+        },
+        "node_modules/chokidar": {
+            "version": "3.6.0",
+            "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.6.0.tgz",
+            "integrity": "sha512-7VT13fmjotKpGipCW9JEQAusEPE+Ei8nl6/g4FBAmIm0GOOLMua9NDDo/DWp0ZAxCr3cPq5ZpBqmPAQgDda2Pw==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "anymatch": "~3.1.2",
+                "braces": "~3.0.2",
+                "glob-parent": "~5.1.2",
+                "is-binary-path": "~2.1.0",
+                "is-glob": "~4.0.1",
+                "normalize-path": "~3.0.0",
+                "readdirp": "~3.6.0"
+            },
+            "engines": {
+                "node": ">= 8.10.0"
+            },
+            "funding": {
+                "url": "https://paulmillr.com/funding/"
+            },
+            "optionalDependencies": {
+                "fsevents": "~2.3.2"
+            }
+        },
+        "node_modules/chokidar/node_modules/glob-parent": {
+            "version": "5.1.2",
+            "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz",
+            "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==",
+            "dev": true,
+            "license": "ISC",
+            "dependencies": {
+                "is-glob": "^4.0.1"
+            },
+            "engines": {
+                "node": ">= 6"
+            }
+        },
+        "node_modules/cliui": {
+            "version": "8.0.1",
+            "resolved": "https://registry.npmjs.org/cliui/-/cliui-8.0.1.tgz",
+            "integrity": "sha512-BSeNnyus75C4//NQ9gQt1/csTXyo/8Sb+afLAkzAptFuMsod9HFokGNudZpi/oQV73hnVK+sR+5PVRMd+Dr7YQ==",
+            "dev": true,
+            "license": "ISC",
+            "dependencies": {
+                "string-width": "^4.2.0",
+                "strip-ansi": "^6.0.1",
+                "wrap-ansi": "^7.0.0"
+            },
+            "engines": {
+                "node": ">=12"
+            }
+        },
+        "node_modules/color-convert": {
+            "version": "2.0.1",
+            "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz",
+            "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "color-name": "~1.1.4"
+            },
+            "engines": {
+                "node": ">=7.0.0"
+            }
+        },
+        "node_modules/color-name": {
+            "version": "1.1.4",
+            "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz",
+            "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/combined-stream": {
+            "version": "1.0.8",
+            "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.8.tgz",
+            "integrity": "sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "delayed-stream": "~1.0.0"
+            },
+            "engines": {
+                "node": ">= 0.8"
+            }
+        },
+        "node_modules/commander": {
+            "version": "4.1.1",
+            "resolved": "https://registry.npmjs.org/commander/-/commander-4.1.1.tgz",
+            "integrity": "sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 6"
+            }
+        },
+        "node_modules/concurrently": {
+            "version": "9.2.1",
+            "resolved": "https://registry.npmjs.org/concurrently/-/concurrently-9.2.1.tgz",
+            "integrity": "sha512-fsfrO0MxV64Znoy8/l1vVIjjHa29SZyyqPgQBwhiDcaW8wJc2W3XWVOGx4M3oJBnv/zdUZIIp1gDeS98GzP8Ng==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "chalk": "4.1.2",
+                "rxjs": "7.8.2",
+                "shell-quote": "1.8.3",
+                "supports-color": "8.1.1",
+                "tree-kill": "1.2.2",
+                "yargs": "17.7.2"
+            },
+            "bin": {
+                "conc": "dist/bin/concurrently.js",
+                "concurrently": "dist/bin/concurrently.js"
+            },
+            "engines": {
+                "node": ">=18"
+            },
+            "funding": {
+                "url": "https://github.com/open-cli-tools/concurrently?sponsor=1"
+            }
+        },
+        "node_modules/cssesc": {
+            "version": "3.0.0",
+            "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-3.0.0.tgz",
+            "integrity": "sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==",
+            "dev": true,
+            "license": "MIT",
+            "bin": {
+                "cssesc": "bin/cssesc"
+            },
+            "engines": {
+                "node": ">=4"
+            }
+        },
+        "node_modules/delayed-stream": {
+            "version": "1.0.0",
+            "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz",
+            "integrity": "sha512-ZySD7Nf91aLB0RxL4KGrKHBXl7Eds1DAmEdcoVawXnLD7SDhpNgtuII2aAkg7a7QS41jxPSZ17p4VdGnMHk3MQ==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=0.4.0"
+            }
+        },
+        "node_modules/detect-libc": {
+            "version": "2.1.2",
+            "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-2.1.2.tgz",
+            "integrity": "sha512-Btj2BOOO83o3WyH59e8MgXsxEQVcarkUOpEYrubB0urwnN10yQ364rsiByU11nZlqWYZm05i/of7io4mzihBtQ==",
+            "dev": true,
+            "license": "Apache-2.0",
+            "engines": {
+                "node": ">=8"
+            }
+        },
+        "node_modules/didyoumean": {
+            "version": "1.2.2",
+            "resolved": "https://registry.npmjs.org/didyoumean/-/didyoumean-1.2.2.tgz",
+            "integrity": "sha512-gxtyfqMg7GKyhQmb056K7M3xszy/myH8w+B4RT+QXBQsvAOdc3XymqDDPHx1BgPgsdAA5SIifona89YtRATDzw==",
+            "dev": true,
+            "license": "Apache-2.0"
+        },
+        "node_modules/dlv": {
+            "version": "1.1.3",
+            "resolved": "https://registry.npmjs.org/dlv/-/dlv-1.1.3.tgz",
+            "integrity": "sha512-+HlytyjlPKnIG8XuRG8WvmBP8xs8P71y+SKKS6ZXWoEgLuePxtDoUEiH7WkdePWrQ5JBpE6aoVqfZfJUQkjXwA==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/dunder-proto": {
+            "version": "1.0.1",
+            "resolved": "https://registry.npmjs.org/dunder-proto/-/dunder-proto-1.0.1.tgz",
+            "integrity": "sha512-KIN/nDJBQRcXw0MLVhZE9iQHmG68qAVIBg9CqmUYjmQIhgij9U5MFvrqkUL5FbtyyzZuOeOt0zdeRe4UY7ct+A==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "call-bind-apply-helpers": "^1.0.1",
+                "es-errors": "^1.3.0",
+                "gopd": "^1.2.0"
+            },
+            "engines": {
+                "node": ">= 0.4"
+            }
+        },
+        "node_modules/electron-to-chromium": {
+            "version": "1.5.325",
+            "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.5.325.tgz",
+            "integrity": "sha512-PwfIw7WQSt3xX7yOf5OE/unLzsK9CaN2f/FvV3WjPR1Knoc1T9vePRVV4W1EM301JzzysK51K7FNKcusCr0zYA==",
+            "dev": true,
+            "license": "ISC"
+        },
+        "node_modules/emoji-regex": {
+            "version": "8.0.0",
+            "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz",
+            "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/enhanced-resolve": {
+            "version": "5.20.1",
+            "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-5.20.1.tgz",
+            "integrity": "sha512-Qohcme7V1inbAfvjItgw0EaxVX5q2rdVEZHRBrEQdRZTssLDGsL8Lwrznl8oQ/6kuTJONLaDcGjkNP247XEhcA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "graceful-fs": "^4.2.4",
+                "tapable": "^2.3.0"
+            },
+            "engines": {
+                "node": ">=10.13.0"
+            }
+        },
+        "node_modules/es-define-property": {
+            "version": "1.0.1",
+            "resolved": "https://registry.npmjs.org/es-define-property/-/es-define-property-1.0.1.tgz",
+            "integrity": "sha512-e3nRfgfUZ4rNGL232gUgX06QNyyez04KdjFrF+LTRoOXmrOgFKDg4BCdsjW8EnT69eqdYGmRpJwiPVYNrCaW3g==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 0.4"
+            }
+        },
+        "node_modules/es-errors": {
+            "version": "1.3.0",
+            "resolved": "https://registry.npmjs.org/es-errors/-/es-errors-1.3.0.tgz",
+            "integrity": "sha512-Zf5H2Kxt2xjTvbJvP2ZWLEICxA6j+hAmMzIlypy4xcBg1vKVnx89Wy0GbS+kf5cwCVFFzdCFh2XSCFNULS6csw==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 0.4"
+            }
+        },
+        "node_modules/es-object-atoms": {
+            "version": "1.1.1",
+            "resolved": "https://registry.npmjs.org/es-object-atoms/-/es-object-atoms-1.1.1.tgz",
+            "integrity": "sha512-FGgH2h8zKNim9ljj7dankFPcICIK9Cp5bm+c2gQSYePhpaG5+esrLODihIorn+Pe6FGJzWhXQotPv73jTaldXA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "es-errors": "^1.3.0"
+            },
+            "engines": {
+                "node": ">= 0.4"
+            }
+        },
+        "node_modules/es-set-tostringtag": {
+            "version": "2.1.0",
+            "resolved": "https://registry.npmjs.org/es-set-tostringtag/-/es-set-tostringtag-2.1.0.tgz",
+            "integrity": "sha512-j6vWzfrGVfyXxge+O0x5sh6cvxAog0a/4Rdd2K36zCMV5eJ+/+tOAngRO8cODMNWbVRdVlmGZQL2YS3yR8bIUA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "es-errors": "^1.3.0",
+                "get-intrinsic": "^1.2.6",
+                "has-tostringtag": "^1.0.2",
+                "hasown": "^2.0.2"
+            },
+            "engines": {
+                "node": ">= 0.4"
+            }
+        },
+        "node_modules/esbuild": {
+            "version": "0.27.4",
+            "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.27.4.tgz",
+            "integrity": "sha512-Rq4vbHnYkK5fws5NF7MYTU68FPRE1ajX7heQ/8QXXWqNgqqJ/GkmmyxIzUnf2Sr/bakf8l54716CcMGHYhMrrQ==",
+            "dev": true,
+            "hasInstallScript": true,
+            "license": "MIT",
+            "bin": {
+                "esbuild": "bin/esbuild"
+            },
+            "engines": {
+                "node": ">=18"
+            },
+            "optionalDependencies": {
+                "@esbuild/aix-ppc64": "0.27.4",
+                "@esbuild/android-arm": "0.27.4",
+                "@esbuild/android-arm64": "0.27.4",
+                "@esbuild/android-x64": "0.27.4",
+                "@esbuild/darwin-arm64": "0.27.4",
+                "@esbuild/darwin-x64": "0.27.4",
+                "@esbuild/freebsd-arm64": "0.27.4",
+                "@esbuild/freebsd-x64": "0.27.4",
+                "@esbuild/linux-arm": "0.27.4",
+                "@esbuild/linux-arm64": "0.27.4",
+                "@esbuild/linux-ia32": "0.27.4",
+                "@esbuild/linux-loong64": "0.27.4",
+                "@esbuild/linux-mips64el": "0.27.4",
+                "@esbuild/linux-ppc64": "0.27.4",
+                "@esbuild/linux-riscv64": "0.27.4",
+                "@esbuild/linux-s390x": "0.27.4",
+                "@esbuild/linux-x64": "0.27.4",
+                "@esbuild/netbsd-arm64": "0.27.4",
+                "@esbuild/netbsd-x64": "0.27.4",
+                "@esbuild/openbsd-arm64": "0.27.4",
+                "@esbuild/openbsd-x64": "0.27.4",
+                "@esbuild/openharmony-arm64": "0.27.4",
+                "@esbuild/sunos-x64": "0.27.4",
+                "@esbuild/win32-arm64": "0.27.4",
+                "@esbuild/win32-ia32": "0.27.4",
+                "@esbuild/win32-x64": "0.27.4"
+            }
+        },
+        "node_modules/escalade": {
+            "version": "3.2.0",
+            "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.2.0.tgz",
+            "integrity": "sha512-WUj2qlxaQtO4g6Pq5c29GTcWGDyd8itL8zTlipgECz3JesAiiOKotd8JU6otB3PACgG6xkJUyVhboMS+bje/jA==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=6"
+            }
+        },
+        "node_modules/fast-glob": {
+            "version": "3.3.3",
+            "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.3.tgz",
+            "integrity": "sha512-7MptL8U0cqcFdzIzwOTHoilX9x5BrNqye7Z/LuC7kCMRio1EMSyqRK3BEAUD7sXRq4iT4AzTVuZdhgQ2TCvYLg==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@nodelib/fs.stat": "^2.0.2",
+                "@nodelib/fs.walk": "^1.2.3",
+                "glob-parent": "^5.1.2",
+                "merge2": "^1.3.0",
+                "micromatch": "^4.0.8"
+            },
+            "engines": {
+                "node": ">=8.6.0"
+            }
+        },
+        "node_modules/fast-glob/node_modules/glob-parent": {
+            "version": "5.1.2",
+            "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz",
+            "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==",
+            "dev": true,
+            "license": "ISC",
+            "dependencies": {
+                "is-glob": "^4.0.1"
+            },
+            "engines": {
+                "node": ">= 6"
+            }
+        },
+        "node_modules/fastq": {
+            "version": "1.20.1",
+            "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.20.1.tgz",
+            "integrity": "sha512-GGToxJ/w1x32s/D2EKND7kTil4n8OVk/9mycTc4VDza13lOvpUZTGX3mFSCtV9ksdGBVzvsyAVLM6mHFThxXxw==",
+            "dev": true,
+            "license": "ISC",
+            "dependencies": {
+                "reusify": "^1.0.4"
+            }
+        },
+        "node_modules/fill-range": {
+            "version": "7.1.1",
+            "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.1.1.tgz",
+            "integrity": "sha512-YsGpe3WHLK8ZYi4tWDg2Jy3ebRz2rXowDxnld4bkQB00cc/1Zw9AWnC0i9ztDJitivtQvaI9KaLyKrc+hBW0yg==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "to-regex-range": "^5.0.1"
+            },
+            "engines": {
+                "node": ">=8"
+            }
+        },
+        "node_modules/follow-redirects": {
+            "version": "1.15.11",
+            "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.15.11.tgz",
+            "integrity": "sha512-deG2P0JfjrTxl50XGCDyfI97ZGVCxIpfKYmfyrQ54n5FO/0gfIES8C/Psl6kWVDolizcaaxZJnTS0QSMxvnsBQ==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "individual",
+                    "url": "https://github.com/sponsors/RubenVerborgh"
+                }
+            ],
+            "license": "MIT",
+            "engines": {
+                "node": ">=4.0"
+            },
+            "peerDependenciesMeta": {
+                "debug": {
+                    "optional": true
+                }
+            }
+        },
+        "node_modules/form-data": {
+            "version": "4.0.5",
+            "resolved": "https://registry.npmjs.org/form-data/-/form-data-4.0.5.tgz",
+            "integrity": "sha512-8RipRLol37bNs2bhoV67fiTEvdTrbMUYcFTiy3+wuuOnUog2QBHCZWXDRijWQfAkhBj2Uf5UnVaiWwA5vdd82w==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "asynckit": "^0.4.0",
+                "combined-stream": "^1.0.8",
+                "es-set-tostringtag": "^2.1.0",
+                "hasown": "^2.0.2",
+                "mime-types": "^2.1.12"
+            },
+            "engines": {
+                "node": ">= 6"
+            }
+        },
+        "node_modules/fraction.js": {
+            "version": "5.3.4",
+            "resolved": "https://registry.npmjs.org/fraction.js/-/fraction.js-5.3.4.tgz",
+            "integrity": "sha512-1X1NTtiJphryn/uLQz3whtY6jK3fTqoE3ohKs0tT+Ujr1W59oopxmoEh7Lu5p6vBaPbgoM0bzveAW4Qi5RyWDQ==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": "*"
+            },
+            "funding": {
+                "type": "github",
+                "url": "https://github.com/sponsors/rawify"
+            }
+        },
+        "node_modules/fsevents": {
+            "version": "2.3.3",
+            "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.3.tgz",
+            "integrity": "sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==",
+            "dev": true,
+            "hasInstallScript": true,
+            "license": "MIT",
+            "optional": true,
+            "os": [
+                "darwin"
+            ],
+            "engines": {
+                "node": "^8.16.0 || ^10.6.0 || >=11.0.0"
+            }
+        },
+        "node_modules/function-bind": {
+            "version": "1.1.2",
+            "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz",
+            "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==",
+            "dev": true,
+            "license": "MIT",
+            "funding": {
+                "url": "https://github.com/sponsors/ljharb"
+            }
+        },
+        "node_modules/get-caller-file": {
+            "version": "2.0.5",
+            "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz",
+            "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==",
+            "dev": true,
+            "license": "ISC",
+            "engines": {
+                "node": "6.* || 8.* || >= 10.*"
+            }
+        },
+        "node_modules/get-intrinsic": {
+            "version": "1.3.0",
+            "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.3.0.tgz",
+            "integrity": "sha512-9fSjSaos/fRIVIp+xSJlE6lfwhES7LNtKaCBIamHsjr2na1BiABJPo0mOjjz8GJDURarmCPGqaiVg5mfjb98CQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "call-bind-apply-helpers": "^1.0.2",
+                "es-define-property": "^1.0.1",
+                "es-errors": "^1.3.0",
+                "es-object-atoms": "^1.1.1",
+                "function-bind": "^1.1.2",
+                "get-proto": "^1.0.1",
+                "gopd": "^1.2.0",
+                "has-symbols": "^1.1.0",
+                "hasown": "^2.0.2",
+                "math-intrinsics": "^1.1.0"
+            },
+            "engines": {
+                "node": ">= 0.4"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/ljharb"
+            }
+        },
+        "node_modules/get-proto": {
+            "version": "1.0.1",
+            "resolved": "https://registry.npmjs.org/get-proto/-/get-proto-1.0.1.tgz",
+            "integrity": "sha512-sTSfBjoXBp89JvIKIefqw7U2CCebsc74kiY6awiGogKtoSGbgjYE/G/+l9sF3MWFPNc9IcoOC4ODfKHfxFmp0g==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "dunder-proto": "^1.0.1",
+                "es-object-atoms": "^1.0.0"
+            },
+            "engines": {
+                "node": ">= 0.4"
+            }
+        },
+        "node_modules/glob-parent": {
+            "version": "6.0.2",
+            "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-6.0.2.tgz",
+            "integrity": "sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==",
+            "dev": true,
+            "license": "ISC",
+            "dependencies": {
+                "is-glob": "^4.0.3"
+            },
+            "engines": {
+                "node": ">=10.13.0"
+            }
+        },
+        "node_modules/gopd": {
+            "version": "1.2.0",
+            "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.2.0.tgz",
+            "integrity": "sha512-ZUKRh6/kUFoAiTAtTYPZJ3hw9wNxx+BIBOijnlG9PnrJsCcSjs1wyyD6vJpaYtgnzDrKYRSqf3OO6Rfa93xsRg==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 0.4"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/ljharb"
+            }
+        },
+        "node_modules/graceful-fs": {
+            "version": "4.2.11",
+            "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.11.tgz",
+            "integrity": "sha512-RbJ5/jmFcNNCcDV5o9eTnBLJ/HszWV0P73bc+Ff4nS/rJj+YaS6IGyiOL0VoBYX+l1Wrl3k63h/KrH+nhJ0XvQ==",
+            "dev": true,
+            "license": "ISC"
+        },
+        "node_modules/has-flag": {
+            "version": "4.0.0",
+            "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz",
+            "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=8"
+            }
+        },
+        "node_modules/has-symbols": {
+            "version": "1.1.0",
+            "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.1.0.tgz",
+            "integrity": "sha512-1cDNdwJ2Jaohmb3sg4OmKaMBwuC48sYni5HUw2DvsC8LjGTLK9h+eb1X6RyuOHe4hT0ULCW68iomhjUoKUqlPQ==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 0.4"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/ljharb"
+            }
+        },
+        "node_modules/has-tostringtag": {
+            "version": "1.0.2",
+            "resolved": "https://registry.npmjs.org/has-tostringtag/-/has-tostringtag-1.0.2.tgz",
+            "integrity": "sha512-NqADB8VjPFLM2V0VvHUewwwsw0ZWBaIdgo+ieHtK3hasLz4qeCRjYcqfB6AQrBggRKppKF8L52/VqdVsO47Dlw==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "has-symbols": "^1.0.3"
+            },
+            "engines": {
+                "node": ">= 0.4"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/ljharb"
+            }
+        },
+        "node_modules/hasown": {
+            "version": "2.0.2",
+            "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz",
+            "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "function-bind": "^1.1.2"
+            },
+            "engines": {
+                "node": ">= 0.4"
+            }
+        },
+        "node_modules/is-binary-path": {
+            "version": "2.1.0",
+            "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz",
+            "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "binary-extensions": "^2.0.0"
+            },
+            "engines": {
+                "node": ">=8"
+            }
+        },
+        "node_modules/is-core-module": {
+            "version": "2.16.1",
+            "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.16.1.tgz",
+            "integrity": "sha512-UfoeMA6fIJ8wTYFEUjelnaGI67v6+N7qXJEvQuIGa99l4xsCruSYOVSQ0uPANn4dAzm8lkYPaKLrrijLq7x23w==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "hasown": "^2.0.2"
+            },
+            "engines": {
+                "node": ">= 0.4"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/ljharb"
+            }
+        },
+        "node_modules/is-extglob": {
+            "version": "2.1.1",
+            "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz",
+            "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=0.10.0"
+            }
+        },
+        "node_modules/is-fullwidth-code-point": {
+            "version": "3.0.0",
+            "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz",
+            "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=8"
+            }
+        },
+        "node_modules/is-glob": {
+            "version": "4.0.3",
+            "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz",
+            "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "is-extglob": "^2.1.1"
+            },
+            "engines": {
+                "node": ">=0.10.0"
+            }
+        },
+        "node_modules/is-number": {
+            "version": "7.0.0",
+            "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz",
+            "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=0.12.0"
+            }
+        },
+        "node_modules/jiti": {
+            "version": "2.6.1",
+            "resolved": "https://registry.npmjs.org/jiti/-/jiti-2.6.1.tgz",
+            "integrity": "sha512-ekilCSN1jwRvIbgeg/57YFh8qQDNbwDb9xT/qu2DAHbFFZUicIl4ygVaAvzveMhMVr3LnpSKTNnwt8PoOfmKhQ==",
+            "dev": true,
+            "license": "MIT",
+            "bin": {
+                "jiti": "lib/jiti-cli.mjs"
+            }
+        },
+        "node_modules/laravel-vite-plugin": {
+            "version": "2.1.0",
+            "resolved": "https://registry.npmjs.org/laravel-vite-plugin/-/laravel-vite-plugin-2.1.0.tgz",
+            "integrity": "sha512-z+ck2BSV6KWtYcoIzk9Y5+p4NEjqM+Y4i8/H+VZRLq0OgNjW2DqyADquwYu5j8qRvaXwzNmfCWl1KrMlV1zpsg==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "picocolors": "^1.0.0",
+                "vite-plugin-full-reload": "^1.1.0"
+            },
+            "bin": {
+                "clean-orphaned-assets": "bin/clean.js"
+            },
+            "engines": {
+                "node": "^20.19.0 || >=22.12.0"
+            },
+            "peerDependencies": {
+                "vite": "^7.0.0"
+            }
+        },
+        "node_modules/lightningcss": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss/-/lightningcss-1.32.0.tgz",
+            "integrity": "sha512-NXYBzinNrblfraPGyrbPoD19C1h9lfI/1mzgWYvXUTe414Gz/X1FD2XBZSZM7rRTrMA8JL3OtAaGifrIKhQ5yQ==",
+            "dev": true,
+            "license": "MPL-2.0",
+            "dependencies": {
+                "detect-libc": "^2.0.3"
+            },
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            },
+            "optionalDependencies": {
+                "lightningcss-android-arm64": "1.32.0",
+                "lightningcss-darwin-arm64": "1.32.0",
+                "lightningcss-darwin-x64": "1.32.0",
+                "lightningcss-freebsd-x64": "1.32.0",
+                "lightningcss-linux-arm-gnueabihf": "1.32.0",
+                "lightningcss-linux-arm64-gnu": "1.32.0",
+                "lightningcss-linux-arm64-musl": "1.32.0",
+                "lightningcss-linux-x64-gnu": "1.32.0",
+                "lightningcss-linux-x64-musl": "1.32.0",
+                "lightningcss-win32-arm64-msvc": "1.32.0",
+                "lightningcss-win32-x64-msvc": "1.32.0"
+            }
+        },
+        "node_modules/lightningcss-android-arm64": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss-android-arm64/-/lightningcss-android-arm64-1.32.0.tgz",
+            "integrity": "sha512-YK7/ClTt4kAK0vo6w3X+Pnm0D2cf2vPHbhOXdoNti1Ga0al1P4TBZhwjATvjNwLEBCnKvjJc2jQgHXH0NEwlAg==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MPL-2.0",
+            "optional": true,
+            "os": [
+                "android"
+            ],
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            }
+        },
+        "node_modules/lightningcss-darwin-arm64": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss-darwin-arm64/-/lightningcss-darwin-arm64-1.32.0.tgz",
+            "integrity": "sha512-RzeG9Ju5bag2Bv1/lwlVJvBE3q6TtXskdZLLCyfg5pt+HLz9BqlICO7LZM7VHNTTn/5PRhHFBSjk5lc4cmscPQ==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MPL-2.0",
+            "optional": true,
+            "os": [
+                "darwin"
+            ],
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            }
+        },
+        "node_modules/lightningcss-darwin-x64": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss-darwin-x64/-/lightningcss-darwin-x64-1.32.0.tgz",
+            "integrity": "sha512-U+QsBp2m/s2wqpUYT/6wnlagdZbtZdndSmut/NJqlCcMLTWp5muCrID+K5UJ6jqD2BFshejCYXniPDbNh73V8w==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MPL-2.0",
+            "optional": true,
+            "os": [
+                "darwin"
+            ],
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            }
+        },
+        "node_modules/lightningcss-freebsd-x64": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss-freebsd-x64/-/lightningcss-freebsd-x64-1.32.0.tgz",
+            "integrity": "sha512-JCTigedEksZk3tHTTthnMdVfGf61Fky8Ji2E4YjUTEQX14xiy/lTzXnu1vwiZe3bYe0q+SpsSH/CTeDXK6WHig==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MPL-2.0",
+            "optional": true,
+            "os": [
+                "freebsd"
+            ],
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            }
+        },
+        "node_modules/lightningcss-linux-arm-gnueabihf": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss-linux-arm-gnueabihf/-/lightningcss-linux-arm-gnueabihf-1.32.0.tgz",
+            "integrity": "sha512-x6rnnpRa2GL0zQOkt6rts3YDPzduLpWvwAF6EMhXFVZXD4tPrBkEFqzGowzCsIWsPjqSK+tyNEODUBXeeVHSkw==",
+            "cpu": [
+                "arm"
+            ],
+            "dev": true,
+            "license": "MPL-2.0",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            }
+        },
+        "node_modules/lightningcss-linux-arm64-gnu": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss-linux-arm64-gnu/-/lightningcss-linux-arm64-gnu-1.32.0.tgz",
+            "integrity": "sha512-0nnMyoyOLRJXfbMOilaSRcLH3Jw5z9HDNGfT/gwCPgaDjnx0i8w7vBzFLFR1f6CMLKF8gVbebmkUN3fa/kQJpQ==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MPL-2.0",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            }
+        },
+        "node_modules/lightningcss-linux-arm64-musl": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss-linux-arm64-musl/-/lightningcss-linux-arm64-musl-1.32.0.tgz",
+            "integrity": "sha512-UpQkoenr4UJEzgVIYpI80lDFvRmPVg6oqboNHfoH4CQIfNA+HOrZ7Mo7KZP02dC6LjghPQJeBsvXhJod/wnIBg==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MPL-2.0",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            }
+        },
+        "node_modules/lightningcss-linux-x64-gnu": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss-linux-x64-gnu/-/lightningcss-linux-x64-gnu-1.32.0.tgz",
+            "integrity": "sha512-V7Qr52IhZmdKPVr+Vtw8o+WLsQJYCTd8loIfpDaMRWGUZfBOYEJeyJIkqGIDMZPwPx24pUMfwSxxI8phr/MbOA==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MPL-2.0",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            }
+        },
+        "node_modules/lightningcss-linux-x64-musl": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss-linux-x64-musl/-/lightningcss-linux-x64-musl-1.32.0.tgz",
+            "integrity": "sha512-bYcLp+Vb0awsiXg/80uCRezCYHNg1/l3mt0gzHnWV9XP1W5sKa5/TCdGWaR/zBM2PeF/HbsQv/j2URNOiVuxWg==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MPL-2.0",
+            "optional": true,
+            "os": [
+                "linux"
+            ],
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            }
+        },
+        "node_modules/lightningcss-win32-arm64-msvc": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss-win32-arm64-msvc/-/lightningcss-win32-arm64-msvc-1.32.0.tgz",
+            "integrity": "sha512-8SbC8BR40pS6baCM8sbtYDSwEVQd4JlFTOlaD3gWGHfThTcABnNDBda6eTZeqbofalIJhFx0qKzgHJmcPTnGdw==",
+            "cpu": [
+                "arm64"
+            ],
+            "dev": true,
+            "license": "MPL-2.0",
+            "optional": true,
+            "os": [
+                "win32"
+            ],
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            }
+        },
+        "node_modules/lightningcss-win32-x64-msvc": {
+            "version": "1.32.0",
+            "resolved": "https://registry.npmjs.org/lightningcss-win32-x64-msvc/-/lightningcss-win32-x64-msvc-1.32.0.tgz",
+            "integrity": "sha512-Amq9B/SoZYdDi1kFrojnoqPLxYhQ4Wo5XiL8EVJrVsB8ARoC1PWW6VGtT0WKCemjy8aC+louJnjS7U18x3b06Q==",
+            "cpu": [
+                "x64"
+            ],
+            "dev": true,
+            "license": "MPL-2.0",
+            "optional": true,
+            "os": [
+                "win32"
+            ],
+            "engines": {
+                "node": ">= 12.0.0"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/parcel"
+            }
+        },
+        "node_modules/lilconfig": {
+            "version": "3.1.3",
+            "resolved": "https://registry.npmjs.org/lilconfig/-/lilconfig-3.1.3.tgz",
+            "integrity": "sha512-/vlFKAoH5Cgt3Ie+JLhRbwOsCQePABiU3tJ1egGvyQ+33R/vcwM2Zl2QR/LzjsBeItPt3oSVXapn+m4nQDvpzw==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=14"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/antonk52"
+            }
+        },
+        "node_modules/lines-and-columns": {
+            "version": "1.2.4",
+            "resolved": "https://registry.npmjs.org/lines-and-columns/-/lines-and-columns-1.2.4.tgz",
+            "integrity": "sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/magic-string": {
+            "version": "0.30.21",
+            "resolved": "https://registry.npmjs.org/magic-string/-/magic-string-0.30.21.tgz",
+            "integrity": "sha512-vd2F4YUyEXKGcLHoq+TEyCjxueSeHnFxyyjNp80yg0XV4vUhnDer/lvvlqM/arB5bXQN5K2/3oinyCRyx8T2CQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@jridgewell/sourcemap-codec": "^1.5.5"
+            }
+        },
+        "node_modules/math-intrinsics": {
+            "version": "1.1.0",
+            "resolved": "https://registry.npmjs.org/math-intrinsics/-/math-intrinsics-1.1.0.tgz",
+            "integrity": "sha512-/IXtbwEk5HTPyEwyKX6hGkYXxM9nbj64B+ilVJnC/R6B0pH5G4V3b0pVbL7DBj4tkhBAppbQUlf6F6Xl9LHu1g==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 0.4"
+            }
+        },
+        "node_modules/merge2": {
+            "version": "1.4.1",
+            "resolved": "https://registry.npmjs.org/merge2/-/merge2-1.4.1.tgz",
+            "integrity": "sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 8"
+            }
+        },
+        "node_modules/micromatch": {
+            "version": "4.0.8",
+            "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.8.tgz",
+            "integrity": "sha512-PXwfBhYu0hBCPw8Dn0E+WDYb7af3dSLVWKi3HGv84IdF4TyFoC0ysxFd0Goxw7nSv4T/PzEJQxsYsEiFCKo2BA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "braces": "^3.0.3",
+                "picomatch": "^2.3.1"
+            },
+            "engines": {
+                "node": ">=8.6"
+            }
+        },
+        "node_modules/mime-db": {
+            "version": "1.52.0",
+            "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz",
+            "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 0.6"
+            }
+        },
+        "node_modules/mime-types": {
+            "version": "2.1.35",
+            "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz",
+            "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "mime-db": "1.52.0"
+            },
+            "engines": {
+                "node": ">= 0.6"
+            }
+        },
+        "node_modules/mini-svg-data-uri": {
+            "version": "1.4.4",
+            "resolved": "https://registry.npmjs.org/mini-svg-data-uri/-/mini-svg-data-uri-1.4.4.tgz",
+            "integrity": "sha512-r9deDe9p5FJUPZAk3A59wGH7Ii9YrjjWw0jmw/liSbHl2CHiyXj6FcDXDu2K3TjVAXqiJdaw3xxwlZZr9E6nHg==",
+            "dev": true,
+            "license": "MIT",
+            "bin": {
+                "mini-svg-data-uri": "cli.js"
+            }
+        },
+        "node_modules/mz": {
+            "version": "2.7.0",
+            "resolved": "https://registry.npmjs.org/mz/-/mz-2.7.0.tgz",
+            "integrity": "sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "any-promise": "^1.0.0",
+                "object-assign": "^4.0.1",
+                "thenify-all": "^1.0.0"
+            }
+        },
+        "node_modules/nanoid": {
+            "version": "3.3.11",
+            "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.11.tgz",
+            "integrity": "sha512-N8SpfPUnUp1bK+PMYW8qSWdl9U+wwNWI4QKxOYDy9JAro3WMX7p2OeVRF9v+347pnakNevPmiHhNmZ2HbFA76w==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "github",
+                    "url": "https://github.com/sponsors/ai"
+                }
+            ],
+            "license": "MIT",
+            "bin": {
+                "nanoid": "bin/nanoid.cjs"
+            },
+            "engines": {
+                "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1"
+            }
+        },
+        "node_modules/node-releases": {
+            "version": "2.0.36",
+            "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-2.0.36.tgz",
+            "integrity": "sha512-TdC8FSgHz8Mwtw9g5L4gR/Sh9XhSP/0DEkQxfEFXOpiul5IiHgHan2VhYYb6agDSfp4KuvltmGApc8HMgUrIkA==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/normalize-path": {
+            "version": "3.0.0",
+            "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz",
+            "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=0.10.0"
+            }
+        },
+        "node_modules/object-assign": {
+            "version": "4.1.1",
+            "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
+            "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=0.10.0"
+            }
+        },
+        "node_modules/object-hash": {
+            "version": "3.0.0",
+            "resolved": "https://registry.npmjs.org/object-hash/-/object-hash-3.0.0.tgz",
+            "integrity": "sha512-RSn9F68PjH9HqtltsSnqYC1XXoWe9Bju5+213R98cNGttag9q9yAOTzdbsqvIa7aNm5WffBZFpWYr2aWrklWAw==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 6"
+            }
+        },
+        "node_modules/path-parse": {
+            "version": "1.0.7",
+            "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.7.tgz",
+            "integrity": "sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/picocolors": {
+            "version": "1.1.1",
+            "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.1.1.tgz",
+            "integrity": "sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==",
+            "dev": true,
+            "license": "ISC"
+        },
+        "node_modules/picomatch": {
+            "version": "2.3.2",
+            "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.2.tgz",
+            "integrity": "sha512-V7+vQEJ06Z+c5tSye8S+nHUfI51xoXIXjHQ99cQtKUkQqqO1kO/KCJUfZXuB47h/YBlDhah2H3hdUGXn8ie0oA==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=8.6"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/jonschlinkert"
+            }
+        },
+        "node_modules/pify": {
+            "version": "2.3.0",
+            "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz",
+            "integrity": "sha512-udgsAY+fTnvv7kI7aaxbqwWNb0AHiB0qBO89PZKPkoTmGOgdbrHDKD+0B2X4uTfJ/FT1R09r9gTsjUjNJotuog==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=0.10.0"
+            }
+        },
+        "node_modules/pirates": {
+            "version": "4.0.7",
+            "resolved": "https://registry.npmjs.org/pirates/-/pirates-4.0.7.tgz",
+            "integrity": "sha512-TfySrs/5nm8fQJDcBDuUng3VOUKsd7S+zqvbOTiGXHfxX4wK31ard+hoNuvkicM/2YFzlpDgABOevKSsB4G/FA==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 6"
+            }
+        },
+        "node_modules/postcss": {
+            "version": "8.5.8",
+            "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.5.8.tgz",
+            "integrity": "sha512-OW/rX8O/jXnm82Ey1k44pObPtdblfiuWnrd8X7GJ7emImCOstunGbXUpp7HdBrFQX6rJzn3sPT397Wp5aCwCHg==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "opencollective",
+                    "url": "https://opencollective.com/postcss/"
+                },
+                {
+                    "type": "tidelift",
+                    "url": "https://tidelift.com/funding/github/npm/postcss"
+                },
+                {
+                    "type": "github",
+                    "url": "https://github.com/sponsors/ai"
+                }
+            ],
+            "license": "MIT",
+            "dependencies": {
+                "nanoid": "^3.3.11",
+                "picocolors": "^1.1.1",
+                "source-map-js": "^1.2.1"
+            },
+            "engines": {
+                "node": "^10 || ^12 || >=14"
+            }
+        },
+        "node_modules/postcss-import": {
+            "version": "15.1.0",
+            "resolved": "https://registry.npmjs.org/postcss-import/-/postcss-import-15.1.0.tgz",
+            "integrity": "sha512-hpr+J05B2FVYUAXHeK1YyI267J/dDDhMU6B6civm8hSY1jYJnBXxzKDKDswzJmtLHryrjhnDjqqp/49t8FALew==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "postcss-value-parser": "^4.0.0",
+                "read-cache": "^1.0.0",
+                "resolve": "^1.1.7"
+            },
+            "engines": {
+                "node": ">=14.0.0"
+            },
+            "peerDependencies": {
+                "postcss": "^8.0.0"
+            }
+        },
+        "node_modules/postcss-js": {
+            "version": "4.1.0",
+            "resolved": "https://registry.npmjs.org/postcss-js/-/postcss-js-4.1.0.tgz",
+            "integrity": "sha512-oIAOTqgIo7q2EOwbhb8UalYePMvYoIeRY2YKntdpFQXNosSu3vLrniGgmH9OKs/qAkfoj5oB3le/7mINW1LCfw==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "opencollective",
+                    "url": "https://opencollective.com/postcss/"
+                },
+                {
+                    "type": "github",
+                    "url": "https://github.com/sponsors/ai"
+                }
+            ],
+            "license": "MIT",
+            "dependencies": {
+                "camelcase-css": "^2.0.1"
+            },
+            "engines": {
+                "node": "^12 || ^14 || >= 16"
+            },
+            "peerDependencies": {
+                "postcss": "^8.4.21"
+            }
+        },
+        "node_modules/postcss-load-config": {
+            "version": "6.0.1",
+            "resolved": "https://registry.npmjs.org/postcss-load-config/-/postcss-load-config-6.0.1.tgz",
+            "integrity": "sha512-oPtTM4oerL+UXmx+93ytZVN82RrlY/wPUV8IeDxFrzIjXOLF1pN+EmKPLbubvKHT2HC20xXsCAH2Z+CKV6Oz/g==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "opencollective",
+                    "url": "https://opencollective.com/postcss/"
+                },
+                {
+                    "type": "github",
+                    "url": "https://github.com/sponsors/ai"
+                }
+            ],
+            "license": "MIT",
+            "dependencies": {
+                "lilconfig": "^3.1.1"
+            },
+            "engines": {
+                "node": ">= 18"
+            },
+            "peerDependencies": {
+                "jiti": ">=1.21.0",
+                "postcss": ">=8.0.9",
+                "tsx": "^4.8.1",
+                "yaml": "^2.4.2"
+            },
+            "peerDependenciesMeta": {
+                "jiti": {
+                    "optional": true
+                },
+                "postcss": {
+                    "optional": true
+                },
+                "tsx": {
+                    "optional": true
+                },
+                "yaml": {
+                    "optional": true
+                }
+            }
+        },
+        "node_modules/postcss-nested": {
+            "version": "6.2.0",
+            "resolved": "https://registry.npmjs.org/postcss-nested/-/postcss-nested-6.2.0.tgz",
+            "integrity": "sha512-HQbt28KulC5AJzG+cZtj9kvKB93CFCdLvog1WFLf1D+xmMvPGlBstkpTEZfK5+AN9hfJocyBFCNiqyS48bpgzQ==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "opencollective",
+                    "url": "https://opencollective.com/postcss/"
+                },
+                {
+                    "type": "github",
+                    "url": "https://github.com/sponsors/ai"
+                }
+            ],
+            "license": "MIT",
+            "dependencies": {
+                "postcss-selector-parser": "^6.1.1"
+            },
+            "engines": {
+                "node": ">=12.0"
+            },
+            "peerDependencies": {
+                "postcss": "^8.2.14"
+            }
+        },
+        "node_modules/postcss-selector-parser": {
+            "version": "6.1.2",
+            "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.1.2.tgz",
+            "integrity": "sha512-Q8qQfPiZ+THO/3ZrOrO0cJJKfpYCagtMUkXbnEfmgUjwXg6z/WBeOyS9APBBPCTSiDV+s4SwQGu8yFsiMRIudg==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "cssesc": "^3.0.0",
+                "util-deprecate": "^1.0.2"
+            },
+            "engines": {
+                "node": ">=4"
+            }
+        },
+        "node_modules/postcss-value-parser": {
+            "version": "4.2.0",
+            "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-4.2.0.tgz",
+            "integrity": "sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/proxy-from-env": {
+            "version": "1.1.0",
+            "resolved": "https://registry.npmjs.org/proxy-from-env/-/proxy-from-env-1.1.0.tgz",
+            "integrity": "sha512-D+zkORCbA9f1tdWRK0RaCR3GPv50cMxcrz4X8k5LTSUD1Dkw47mKJEZQNunItRTkWwgtaUSo1RVFRIG9ZXiFYg==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/queue-microtask": {
+            "version": "1.2.3",
+            "resolved": "https://registry.npmjs.org/queue-microtask/-/queue-microtask-1.2.3.tgz",
+            "integrity": "sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "github",
+                    "url": "https://github.com/sponsors/feross"
+                },
+                {
+                    "type": "patreon",
+                    "url": "https://www.patreon.com/feross"
+                },
+                {
+                    "type": "consulting",
+                    "url": "https://feross.org/support"
+                }
+            ],
+            "license": "MIT"
+        },
+        "node_modules/read-cache": {
+            "version": "1.0.0",
+            "resolved": "https://registry.npmjs.org/read-cache/-/read-cache-1.0.0.tgz",
+            "integrity": "sha512-Owdv/Ft7IjOgm/i0xvNDZ1LrRANRfew4b2prF3OWMQLxLfu3bS8FVhCsrSCMK4lR56Y9ya+AThoTpDCTxCmpRA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "pify": "^2.3.0"
+            }
+        },
+        "node_modules/readdirp": {
+            "version": "3.6.0",
+            "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.6.0.tgz",
+            "integrity": "sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "picomatch": "^2.2.1"
+            },
+            "engines": {
+                "node": ">=8.10.0"
+            }
+        },
+        "node_modules/require-directory": {
+            "version": "2.1.1",
+            "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz",
+            "integrity": "sha512-fGxEI7+wsG9xrvdjsrlmL22OMTTiHRwAMroiEeMgq8gzoLC/PQr7RsRDSTLUg/bZAZtF+TVIkHc6/4RIKrui+Q==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=0.10.0"
+            }
+        },
+        "node_modules/resolve": {
+            "version": "1.22.11",
+            "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.22.11.tgz",
+            "integrity": "sha512-RfqAvLnMl313r7c9oclB1HhUEAezcpLjz95wFH4LVuhk9JF/r22qmVP9AMmOU4vMX7Q8pN8jwNg/CSpdFnMjTQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "is-core-module": "^2.16.1",
+                "path-parse": "^1.0.7",
+                "supports-preserve-symlinks-flag": "^1.0.0"
+            },
+            "bin": {
+                "resolve": "bin/resolve"
+            },
+            "engines": {
+                "node": ">= 0.4"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/ljharb"
+            }
+        },
+        "node_modules/reusify": {
+            "version": "1.1.0",
+            "resolved": "https://registry.npmjs.org/reusify/-/reusify-1.1.0.tgz",
+            "integrity": "sha512-g6QUff04oZpHs0eG5p83rFLhHeV00ug/Yf9nZM6fLeUrPguBTkTQOdpAWWspMh55TZfVQDPaN3NQJfbVRAxdIw==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "iojs": ">=1.0.0",
+                "node": ">=0.10.0"
+            }
+        },
+        "node_modules/rollup": {
+            "version": "4.60.0",
+            "resolved": "https://registry.npmjs.org/rollup/-/rollup-4.60.0.tgz",
+            "integrity": "sha512-yqjxruMGBQJ2gG4HtjZtAfXArHomazDHoFwFFmZZl0r7Pdo7qCIXKqKHZc8yeoMgzJJ+pO6pEEHa+V7uzWlrAQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@types/estree": "1.0.8"
+            },
+            "bin": {
+                "rollup": "dist/bin/rollup"
+            },
+            "engines": {
+                "node": ">=18.0.0",
+                "npm": ">=8.0.0"
+            },
+            "optionalDependencies": {
+                "@rollup/rollup-android-arm-eabi": "4.60.0",
+                "@rollup/rollup-android-arm64": "4.60.0",
+                "@rollup/rollup-darwin-arm64": "4.60.0",
+                "@rollup/rollup-darwin-x64": "4.60.0",
+                "@rollup/rollup-freebsd-arm64": "4.60.0",
+                "@rollup/rollup-freebsd-x64": "4.60.0",
+                "@rollup/rollup-linux-arm-gnueabihf": "4.60.0",
+                "@rollup/rollup-linux-arm-musleabihf": "4.60.0",
+                "@rollup/rollup-linux-arm64-gnu": "4.60.0",
+                "@rollup/rollup-linux-arm64-musl": "4.60.0",
+                "@rollup/rollup-linux-loong64-gnu": "4.60.0",
+                "@rollup/rollup-linux-loong64-musl": "4.60.0",
+                "@rollup/rollup-linux-ppc64-gnu": "4.60.0",
+                "@rollup/rollup-linux-ppc64-musl": "4.60.0",
+                "@rollup/rollup-linux-riscv64-gnu": "4.60.0",
+                "@rollup/rollup-linux-riscv64-musl": "4.60.0",
+                "@rollup/rollup-linux-s390x-gnu": "4.60.0",
+                "@rollup/rollup-linux-x64-gnu": "4.60.0",
+                "@rollup/rollup-linux-x64-musl": "4.60.0",
+                "@rollup/rollup-openbsd-x64": "4.60.0",
+                "@rollup/rollup-openharmony-arm64": "4.60.0",
+                "@rollup/rollup-win32-arm64-msvc": "4.60.0",
+                "@rollup/rollup-win32-ia32-msvc": "4.60.0",
+                "@rollup/rollup-win32-x64-gnu": "4.60.0",
+                "@rollup/rollup-win32-x64-msvc": "4.60.0",
+                "fsevents": "~2.3.2"
+            }
+        },
+        "node_modules/run-parallel": {
+            "version": "1.2.0",
+            "resolved": "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz",
+            "integrity": "sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "github",
+                    "url": "https://github.com/sponsors/feross"
+                },
+                {
+                    "type": "patreon",
+                    "url": "https://www.patreon.com/feross"
+                },
+                {
+                    "type": "consulting",
+                    "url": "https://feross.org/support"
+                }
+            ],
+            "license": "MIT",
+            "dependencies": {
+                "queue-microtask": "^1.2.2"
+            }
+        },
+        "node_modules/rxjs": {
+            "version": "7.8.2",
+            "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-7.8.2.tgz",
+            "integrity": "sha512-dhKf903U/PQZY6boNNtAGdWbG85WAbjT/1xYoZIC7FAY0yWapOBQVsVrDl58W86//e1VpMNBtRV4MaXfdMySFA==",
+            "dev": true,
+            "license": "Apache-2.0",
+            "dependencies": {
+                "tslib": "^2.1.0"
+            }
+        },
+        "node_modules/shell-quote": {
+            "version": "1.8.3",
+            "resolved": "https://registry.npmjs.org/shell-quote/-/shell-quote-1.8.3.tgz",
+            "integrity": "sha512-ObmnIF4hXNg1BqhnHmgbDETF8dLPCggZWBjkQfhZpbszZnYur5DUljTcCHii5LC3J5E0yeO/1LIMyH+UvHQgyw==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 0.4"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/ljharb"
+            }
+        },
+        "node_modules/source-map-js": {
+            "version": "1.2.1",
+            "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.2.1.tgz",
+            "integrity": "sha512-UXWMKhLOwVKb728IUtQPXxfYU+usdybtUrK/8uGE8CQMvrhOpwvzDBwj0QhSL7MQc7vIsISBG8VQ8+IDQxpfQA==",
+            "dev": true,
+            "license": "BSD-3-Clause",
+            "engines": {
+                "node": ">=0.10.0"
+            }
+        },
+        "node_modules/string-width": {
+            "version": "4.2.3",
+            "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz",
+            "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "emoji-regex": "^8.0.0",
+                "is-fullwidth-code-point": "^3.0.0",
+                "strip-ansi": "^6.0.1"
+            },
+            "engines": {
+                "node": ">=8"
+            }
+        },
+        "node_modules/strip-ansi": {
+            "version": "6.0.1",
+            "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz",
+            "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "ansi-regex": "^5.0.1"
+            },
+            "engines": {
+                "node": ">=8"
+            }
+        },
+        "node_modules/sucrase": {
+            "version": "3.35.1",
+            "resolved": "https://registry.npmjs.org/sucrase/-/sucrase-3.35.1.tgz",
+            "integrity": "sha512-DhuTmvZWux4H1UOnWMB3sk0sbaCVOoQZjv8u1rDoTV0HTdGem9hkAZtl4JZy8P2z4Bg0nT+YMeOFyVr4zcG5Tw==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@jridgewell/gen-mapping": "^0.3.2",
+                "commander": "^4.0.0",
+                "lines-and-columns": "^1.1.6",
+                "mz": "^2.7.0",
+                "pirates": "^4.0.1",
+                "tinyglobby": "^0.2.11",
+                "ts-interface-checker": "^0.1.9"
+            },
+            "bin": {
+                "sucrase": "bin/sucrase",
+                "sucrase-node": "bin/sucrase-node"
+            },
+            "engines": {
+                "node": ">=16 || 14 >=14.17"
+            }
+        },
+        "node_modules/supports-color": {
+            "version": "8.1.1",
+            "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-8.1.1.tgz",
+            "integrity": "sha512-MpUEN2OodtUzxvKQl72cUF7RQ5EiHsGvSsVG0ia9c5RbWGL2CI4C7EpPS8UTBIplnlzZiNuV56w+FuNxy3ty2Q==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "has-flag": "^4.0.0"
+            },
+            "engines": {
+                "node": ">=10"
+            },
+            "funding": {
+                "url": "https://github.com/chalk/supports-color?sponsor=1"
+            }
+        },
+        "node_modules/supports-preserve-symlinks-flag": {
+            "version": "1.0.0",
+            "resolved": "https://registry.npmjs.org/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz",
+            "integrity": "sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">= 0.4"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/ljharb"
+            }
+        },
+        "node_modules/tailwindcss": {
+            "version": "3.4.19",
+            "resolved": "https://registry.npmjs.org/tailwindcss/-/tailwindcss-3.4.19.tgz",
+            "integrity": "sha512-3ofp+LL8E+pK/JuPLPggVAIaEuhvIz4qNcf3nA1Xn2o/7fb7s/TYpHhwGDv1ZU3PkBluUVaF8PyCHcm48cKLWQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "@alloc/quick-lru": "^5.2.0",
+                "arg": "^5.0.2",
+                "chokidar": "^3.6.0",
+                "didyoumean": "^1.2.2",
+                "dlv": "^1.1.3",
+                "fast-glob": "^3.3.2",
+                "glob-parent": "^6.0.2",
+                "is-glob": "^4.0.3",
+                "jiti": "^1.21.7",
+                "lilconfig": "^3.1.3",
+                "micromatch": "^4.0.8",
+                "normalize-path": "^3.0.0",
+                "object-hash": "^3.0.0",
+                "picocolors": "^1.1.1",
+                "postcss": "^8.4.47",
+                "postcss-import": "^15.1.0",
+                "postcss-js": "^4.0.1",
+                "postcss-load-config": "^4.0.2 || ^5.0 || ^6.0",
+                "postcss-nested": "^6.2.0",
+                "postcss-selector-parser": "^6.1.2",
+                "resolve": "^1.22.8",
+                "sucrase": "^3.35.0"
+            },
+            "bin": {
+                "tailwind": "lib/cli.js",
+                "tailwindcss": "lib/cli.js"
+            },
+            "engines": {
+                "node": ">=14.0.0"
+            }
+        },
+        "node_modules/tailwindcss/node_modules/jiti": {
+            "version": "1.21.7",
+            "resolved": "https://registry.npmjs.org/jiti/-/jiti-1.21.7.tgz",
+            "integrity": "sha512-/imKNG4EbWNrVjoNC/1H5/9GFy+tqjGBHCaSsN+P2RnPqjsLmv6UD3Ej+Kj8nBWaRAwyk7kK5ZUc+OEatnTR3A==",
+            "dev": true,
+            "license": "MIT",
+            "bin": {
+                "jiti": "bin/jiti.js"
+            }
+        },
+        "node_modules/tapable": {
+            "version": "2.3.2",
+            "resolved": "https://registry.npmjs.org/tapable/-/tapable-2.3.2.tgz",
+            "integrity": "sha512-1MOpMXuhGzGL5TTCZFItxCc0AARf1EZFQkGqMm7ERKj8+Hgr5oLvJOVFcC+lRmR8hCe2S3jC4T5D7Vg/d7/fhA==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=6"
+            },
+            "funding": {
+                "type": "opencollective",
+                "url": "https://opencollective.com/webpack"
+            }
+        },
+        "node_modules/thenify": {
+            "version": "3.3.1",
+            "resolved": "https://registry.npmjs.org/thenify/-/thenify-3.3.1.tgz",
+            "integrity": "sha512-RVZSIV5IG10Hk3enotrhvz0T9em6cyHBLkH/YAZuKqd8hRkKhSfCGIcP2KUY0EPxndzANBmNllzWPwak+bheSw==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "any-promise": "^1.0.0"
+            }
+        },
+        "node_modules/thenify-all": {
+            "version": "1.6.0",
+            "resolved": "https://registry.npmjs.org/thenify-all/-/thenify-all-1.6.0.tgz",
+            "integrity": "sha512-RNxQH/qI8/t3thXJDwcstUO4zeqo64+Uy/+sNVRBx4Xn2OX+OZ9oP+iJnNFqplFra2ZUVeKCSa2oVWi3T4uVmA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "thenify": ">= 3.1.0 < 4"
+            },
+            "engines": {
+                "node": ">=0.8"
+            }
+        },
+        "node_modules/tinyglobby": {
+            "version": "0.2.15",
+            "resolved": "https://registry.npmjs.org/tinyglobby/-/tinyglobby-0.2.15.tgz",
+            "integrity": "sha512-j2Zq4NyQYG5XMST4cbs02Ak8iJUdxRM0XI5QyxXuZOzKOINmWurp3smXu3y5wDcJrptwpSjgXHzIQxR0omXljQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "fdir": "^6.5.0",
+                "picomatch": "^4.0.3"
+            },
+            "engines": {
+                "node": ">=12.0.0"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/SuperchupuDev"
+            }
+        },
+        "node_modules/tinyglobby/node_modules/fdir": {
+            "version": "6.5.0",
+            "resolved": "https://registry.npmjs.org/fdir/-/fdir-6.5.0.tgz",
+            "integrity": "sha512-tIbYtZbucOs0BRGqPJkshJUYdL+SDH7dVM8gjy+ERp3WAUjLEFJE+02kanyHtwjWOnwrKYBiwAmM0p4kLJAnXg==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=12.0.0"
+            },
+            "peerDependencies": {
+                "picomatch": "^3 || ^4"
+            },
+            "peerDependenciesMeta": {
+                "picomatch": {
+                    "optional": true
+                }
+            }
+        },
+        "node_modules/tinyglobby/node_modules/picomatch": {
+            "version": "4.0.4",
+            "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-4.0.4.tgz",
+            "integrity": "sha512-QP88BAKvMam/3NxH6vj2o21R6MjxZUAd6nlwAS/pnGvN9IVLocLHxGYIzFhg6fUQ+5th6P4dv4eW9jX3DSIj7A==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=12"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/jonschlinkert"
+            }
+        },
+        "node_modules/to-regex-range": {
+            "version": "5.0.1",
+            "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz",
+            "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "is-number": "^7.0.0"
+            },
+            "engines": {
+                "node": ">=8.0"
+            }
+        },
+        "node_modules/tree-kill": {
+            "version": "1.2.2",
+            "resolved": "https://registry.npmjs.org/tree-kill/-/tree-kill-1.2.2.tgz",
+            "integrity": "sha512-L0Orpi8qGpRG//Nd+H90vFB+3iHnue1zSSGmNOOCh1GLJ7rUKVwV2HvijphGQS2UmhUZewS9VgvxYIdgr+fG1A==",
+            "dev": true,
+            "license": "MIT",
+            "bin": {
+                "tree-kill": "cli.js"
+            }
+        },
+        "node_modules/ts-interface-checker": {
+            "version": "0.1.13",
+            "resolved": "https://registry.npmjs.org/ts-interface-checker/-/ts-interface-checker-0.1.13.tgz",
+            "integrity": "sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==",
+            "dev": true,
+            "license": "Apache-2.0"
+        },
+        "node_modules/tslib": {
+            "version": "2.8.1",
+            "resolved": "https://registry.npmjs.org/tslib/-/tslib-2.8.1.tgz",
+            "integrity": "sha512-oJFu94HQb+KVduSUQL7wnpmqnfmLsOA/nAh6b6EH0wCEoK0/mPeXU6c3wKDV83MkOuHPRHtSXKKU99IBazS/2w==",
+            "dev": true,
+            "license": "0BSD"
+        },
+        "node_modules/update-browserslist-db": {
+            "version": "1.2.3",
+            "resolved": "https://registry.npmjs.org/update-browserslist-db/-/update-browserslist-db-1.2.3.tgz",
+            "integrity": "sha512-Js0m9cx+qOgDxo0eMiFGEueWztz+d4+M3rGlmKPT+T4IS/jP4ylw3Nwpu6cpTTP8R1MAC1kF4VbdLt3ARf209w==",
+            "dev": true,
+            "funding": [
+                {
+                    "type": "opencollective",
+                    "url": "https://opencollective.com/browserslist"
+                },
+                {
+                    "type": "tidelift",
+                    "url": "https://tidelift.com/funding/github/npm/browserslist"
+                },
+                {
+                    "type": "github",
+                    "url": "https://github.com/sponsors/ai"
+                }
+            ],
+            "license": "MIT",
+            "dependencies": {
+                "escalade": "^3.2.0",
+                "picocolors": "^1.1.1"
+            },
+            "bin": {
+                "update-browserslist-db": "cli.js"
+            },
+            "peerDependencies": {
+                "browserslist": ">= 4.21.0"
+            }
+        },
+        "node_modules/util-deprecate": {
+            "version": "1.0.2",
+            "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
+            "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==",
+            "dev": true,
+            "license": "MIT"
+        },
+        "node_modules/vite": {
+            "version": "7.3.1",
+            "resolved": "https://registry.npmjs.org/vite/-/vite-7.3.1.tgz",
+            "integrity": "sha512-w+N7Hifpc3gRjZ63vYBXA56dvvRlNWRczTdmCBBa+CotUzAPf5b7YMdMR/8CQoeYE5LX3W4wj6RYTgonm1b9DA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "esbuild": "^0.27.0",
+                "fdir": "^6.5.0",
+                "picomatch": "^4.0.3",
+                "postcss": "^8.5.6",
+                "rollup": "^4.43.0",
+                "tinyglobby": "^0.2.15"
+            },
+            "bin": {
+                "vite": "bin/vite.js"
+            },
+            "engines": {
+                "node": "^20.19.0 || >=22.12.0"
+            },
+            "funding": {
+                "url": "https://github.com/vitejs/vite?sponsor=1"
+            },
+            "optionalDependencies": {
+                "fsevents": "~2.3.3"
+            },
+            "peerDependencies": {
+                "@types/node": "^20.19.0 || >=22.12.0",
+                "jiti": ">=1.21.0",
+                "less": "^4.0.0",
+                "lightningcss": "^1.21.0",
+                "sass": "^1.70.0",
+                "sass-embedded": "^1.70.0",
+                "stylus": ">=0.54.8",
+                "sugarss": "^5.0.0",
+                "terser": "^5.16.0",
+                "tsx": "^4.8.1",
+                "yaml": "^2.4.2"
+            },
+            "peerDependenciesMeta": {
+                "@types/node": {
+                    "optional": true
+                },
+                "jiti": {
+                    "optional": true
+                },
+                "less": {
+                    "optional": true
+                },
+                "lightningcss": {
+                    "optional": true
+                },
+                "sass": {
+                    "optional": true
+                },
+                "sass-embedded": {
+                    "optional": true
+                },
+                "stylus": {
+                    "optional": true
+                },
+                "sugarss": {
+                    "optional": true
+                },
+                "terser": {
+                    "optional": true
+                },
+                "tsx": {
+                    "optional": true
+                },
+                "yaml": {
+                    "optional": true
+                }
+            }
+        },
+        "node_modules/vite-plugin-full-reload": {
+            "version": "1.2.0",
+            "resolved": "https://registry.npmjs.org/vite-plugin-full-reload/-/vite-plugin-full-reload-1.2.0.tgz",
+            "integrity": "sha512-kz18NW79x0IHbxRSHm0jttP4zoO9P9gXh+n6UTwlNKnviTTEpOlum6oS9SmecrTtSr+muHEn5TUuC75UovQzcA==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "picocolors": "^1.0.0",
+                "picomatch": "^2.3.1"
+            }
+        },
+        "node_modules/vite/node_modules/fdir": {
+            "version": "6.5.0",
+            "resolved": "https://registry.npmjs.org/fdir/-/fdir-6.5.0.tgz",
+            "integrity": "sha512-tIbYtZbucOs0BRGqPJkshJUYdL+SDH7dVM8gjy+ERp3WAUjLEFJE+02kanyHtwjWOnwrKYBiwAmM0p4kLJAnXg==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=12.0.0"
+            },
+            "peerDependencies": {
+                "picomatch": "^3 || ^4"
+            },
+            "peerDependenciesMeta": {
+                "picomatch": {
+                    "optional": true
+                }
+            }
+        },
+        "node_modules/vite/node_modules/picomatch": {
+            "version": "4.0.4",
+            "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-4.0.4.tgz",
+            "integrity": "sha512-QP88BAKvMam/3NxH6vj2o21R6MjxZUAd6nlwAS/pnGvN9IVLocLHxGYIzFhg6fUQ+5th6P4dv4eW9jX3DSIj7A==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=12"
+            },
+            "funding": {
+                "url": "https://github.com/sponsors/jonschlinkert"
+            }
+        },
+        "node_modules/wrap-ansi": {
+            "version": "7.0.0",
+            "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-7.0.0.tgz",
+            "integrity": "sha512-YVGIj2kamLSTxw6NsZjoBxfSwsn0ycdesmc4p+Q21c5zPuZ1pl+NfxVdxPtdHvmNVOQ6XSYG4AUtyt/Fi7D16Q==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "ansi-styles": "^4.0.0",
+                "string-width": "^4.1.0",
+                "strip-ansi": "^6.0.0"
+            },
+            "engines": {
+                "node": ">=10"
+            },
+            "funding": {
+                "url": "https://github.com/chalk/wrap-ansi?sponsor=1"
+            }
+        },
+        "node_modules/y18n": {
+            "version": "5.0.8",
+            "resolved": "https://registry.npmjs.org/y18n/-/y18n-5.0.8.tgz",
+            "integrity": "sha512-0pfFzegeDWJHJIAmTLRP2DwHjdF5s7jo9tuztdQxAhINCdvS+3nGINqPd00AphqJR/0LhANUS6/+7SCb98YOfA==",
+            "dev": true,
+            "license": "ISC",
+            "engines": {
+                "node": ">=10"
+            }
+        },
+        "node_modules/yargs": {
+            "version": "17.7.2",
+            "resolved": "https://registry.npmjs.org/yargs/-/yargs-17.7.2.tgz",
+            "integrity": "sha512-7dSzzRQ++CKnNI/krKnYRV7JKKPUXMEh61soaHKg9mrWEhzFWhFnxPxGl+69cD1Ou63C13NUPCnmIcrvqCuM6w==",
+            "dev": true,
+            "license": "MIT",
+            "dependencies": {
+                "cliui": "^8.0.1",
+                "escalade": "^3.1.1",
+                "get-caller-file": "^2.0.5",
+                "require-directory": "^2.1.1",
+                "string-width": "^4.2.3",
+                "y18n": "^5.0.5",
+                "yargs-parser": "^21.1.1"
+            },
+            "engines": {
+                "node": ">=12"
+            }
+        },
+        "node_modules/yargs-parser": {
+            "version": "21.1.1",
+            "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-21.1.1.tgz",
+            "integrity": "sha512-tVpsJW7DdjecAiFpbIB1e3qxIQsE6NoPc5/eTdrbbIC4h0LVsWhnoa3g+m2HclBIujHzsxZ4VJVA+GUuc2/LBw==",
+            "dev": true,
+            "license": "ISC",
+            "engines": {
+                "node": ">=12"
+            }
+        }
+    }
+}
diff --git a/package.json b/package.json
new file mode 100644
index 0000000..2ea7e1d
--- /dev/null
+++ b/package.json
@@ -0,0 +1,21 @@
+{
+    "$schema": "https://www.schemastore.org/package.json",
+    "private": true,
+    "type": "module",
+    "scripts": {
+        "build": "vite build",
+        "dev": "vite"
+    },
+    "devDependencies": {
+        "@tailwindcss/forms": "^0.5.2",
+        "@tailwindcss/vite": "^4.0.0",
+        "alpinejs": "^3.4.2",
+        "autoprefixer": "^10.4.2",
+        "axios": "^1.11.0",
+        "concurrently": "^9.0.1",
+        "laravel-vite-plugin": "^2.0.0",
+        "postcss": "^8.4.31",
+        "tailwindcss": "^3.1.0",
+        "vite": "^7.0.7"
+    }
+}
diff --git a/phpunit.xml b/phpunit.xml
new file mode 100644
index 0000000..e7f0a48
--- /dev/null
+++ b/phpunit.xml
@@ -0,0 +1,36 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<phpunit xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+         xsi:noNamespaceSchemaLocation="vendor/phpunit/phpunit/phpunit.xsd"
+         bootstrap="vendor/autoload.php"
+         colors="true"
+>
+    <testsuites>
+        <testsuite name="Unit">
+            <directory>tests/Unit</directory>
+        </testsuite>
+        <testsuite name="Feature">
+            <directory>tests/Feature</directory>
+        </testsuite>
+    </testsuites>
+    <source>
+        <include>
+            <directory>app</directory>
+        </include>
+    </source>
+    <php>
+        <env name="APP_ENV" value="testing"/>
+        <env name="APP_MAINTENANCE_DRIVER" value="file"/>
+        <env name="BCRYPT_ROUNDS" value="4"/>
+        <env name="BROADCAST_CONNECTION" value="null"/>
+        <env name="CACHE_STORE" value="array"/>
+        <env name="DB_CONNECTION" value="sqlite"/>
+        <env name="DB_DATABASE" value=":memory:"/>
+        <env name="DB_URL" value=""/>
+        <env name="MAIL_MAILER" value="array"/>
+        <env name="QUEUE_CONNECTION" value="sync"/>
+        <env name="SESSION_DRIVER" value="array"/>
+        <env name="PULSE_ENABLED" value="false"/>
+        <env name="TELESCOPE_ENABLED" value="false"/>
+        <env name="NIGHTWATCH_ENABLED" value="false"/>
+    </php>
+</phpunit>
diff --git a/postcss.config.js b/postcss.config.js
new file mode 100644
index 0000000..49c0612
--- /dev/null
+++ b/postcss.config.js
@@ -0,0 +1,6 @@
+export default {
+    plugins: {
+        tailwindcss: {},
+        autoprefixer: {},
+    },
+};
diff --git a/public/.htaccess b/public/.htaccess
new file mode 100644
index 0000000..b574a59
--- /dev/null
+++ b/public/.htaccess
@@ -0,0 +1,25 @@
+<IfModule mod_rewrite.c>
+    <IfModule mod_negotiation.c>
+        Options -MultiViews -Indexes
+    </IfModule>
+
+    RewriteEngine On
+
+    # Handle Authorization Header
+    RewriteCond %{HTTP:Authorization} .
+    RewriteRule .* - [E=HTTP_AUTHORIZATION:%{HTTP:Authorization}]
+
+    # Handle X-XSRF-Token Header
+    RewriteCond %{HTTP:x-xsrf-token} .
+    RewriteRule .* - [E=HTTP_X_XSRF_TOKEN:%{HTTP:X-XSRF-Token}]
+
+    # Redirect Trailing Slashes If Not A Folder...
+    RewriteCond %{REQUEST_FILENAME} !-d
+    RewriteCond %{REQUEST_URI} (.+)/$
+    RewriteRule ^ %1 [L,R=301]
+
+    # Send Requests To Front Controller...
+    RewriteCond %{REQUEST_FILENAME} !-d
+    RewriteCond %{REQUEST_FILENAME} !-f
+    RewriteRule ^ index.php [L]
+</IfModule>
diff --git a/public/favicon.ico b/public/favicon.ico
new file mode 100644
index 0000000..e69de29
diff --git a/public/index.php b/public/index.php
new file mode 100644
index 0000000..ee8f07e
--- /dev/null
+++ b/public/index.php
@@ -0,0 +1,20 @@
+<?php
+
+use Illuminate\Foundation\Application;
+use Illuminate\Http\Request;
+
+define('LARAVEL_START', microtime(true));
+
+// Determine if the application is in maintenance mode...
+if (file_exists($maintenance = __DIR__.'/../storage/framework/maintenance.php')) {
+    require $maintenance;
+}
+
+// Register the Composer autoloader...
+require __DIR__.'/../vendor/autoload.php';
+
+// Bootstrap Laravel and handle the request...
+/** @var Application $app */
+$app = require_once __DIR__.'/../bootstrap/app.php';
+
+$app->handleRequest(Request::capture());
diff --git a/public/robots.txt b/public/robots.txt
new file mode 100644
index 0000000..eb05362
--- /dev/null
+++ b/public/robots.txt
@@ -0,0 +1,2 @@
+User-agent: *
+Disallow:
diff --git a/resources/css/app.css b/resources/css/app.css
new file mode 100644
index 0000000..b5c61c9
--- /dev/null
+++ b/resources/css/app.css
@@ -0,0 +1,3 @@
+@tailwind base;
+@tailwind components;
+@tailwind utilities;
diff --git a/resources/js/app.js b/resources/js/app.js
new file mode 100644
index 0000000..a8093be
--- /dev/null
+++ b/resources/js/app.js
@@ -0,0 +1,7 @@
+import './bootstrap';
+
+import Alpine from 'alpinejs';
+
+window.Alpine = Alpine;
+
+Alpine.start();
diff --git a/resources/js/bootstrap.js b/resources/js/bootstrap.js
new file mode 100644
index 0000000..5f1390b
--- /dev/null
+++ b/resources/js/bootstrap.js
@@ -0,0 +1,4 @@
+import axios from 'axios';
+window.axios = axios;
+
+window.axios.defaults.headers.common['X-Requested-With'] = 'XMLHttpRequest';
diff --git a/resources/views/auth/confirm-password.blade.php b/resources/views/auth/confirm-password.blade.php
new file mode 100644
index 0000000..3d38186
--- /dev/null
+++ b/resources/views/auth/confirm-password.blade.php
@@ -0,0 +1,27 @@
+<x-guest-layout>
+    <div class="mb-4 text-sm text-gray-600">
+        {{ __('This is a secure area of the application. Please confirm your password before continuing.') }}
+    </div>
+
+    <form method="POST" action="{{ route('password.confirm') }}">
+        @csrf
+
+        <!-- Password -->
+        <div>
+            <x-input-label for="password" :value="__('Password')" />
+
+            <x-text-input id="password" class="block mt-1 w-full"
+                            type="password"
+                            name="password"
+                            required autocomplete="current-password" />
+
+            <x-input-error :messages="$errors->get('password')" class="mt-2" />
+        </div>
+
+        <div class="flex justify-end mt-4">
+            <x-primary-button>
+                {{ __('Confirm') }}
+            </x-primary-button>
+        </div>
+    </form>
+</x-guest-layout>
diff --git a/resources/views/auth/forgot-password.blade.php b/resources/views/auth/forgot-password.blade.php
new file mode 100644
index 0000000..cb32e08
--- /dev/null
+++ b/resources/views/auth/forgot-password.blade.php
@@ -0,0 +1,25 @@
+<x-guest-layout>
+    <div class="mb-4 text-sm text-gray-600">
+        {{ __('Forgot your password? No problem. Just let us know your email address and we will email you a password reset link that will allow you to choose a new one.') }}
+    </div>
+
+    <!-- Session Status -->
+    <x-auth-session-status class="mb-4" :status="session('status')" />
+
+    <form method="POST" action="{{ route('password.email') }}">
+        @csrf
+
+        <!-- Email Address -->
+        <div>
+            <x-input-label for="email" :value="__('Email')" />
+            <x-text-input id="email" class="block mt-1 w-full" type="email" name="email" :value="old('email')" required autofocus />
+            <x-input-error :messages="$errors->get('email')" class="mt-2" />
+        </div>
+
+        <div class="flex items-center justify-end mt-4">
+            <x-primary-button>
+                {{ __('Email Password Reset Link') }}
+            </x-primary-button>
+        </div>
+    </form>
+</x-guest-layout>
diff --git a/resources/views/auth/login.blade.php b/resources/views/auth/login.blade.php
new file mode 100644
index 0000000..78b684f
--- /dev/null
+++ b/resources/views/auth/login.blade.php
@@ -0,0 +1,47 @@
+<x-guest-layout>
+    <!-- Session Status -->
+    <x-auth-session-status class="mb-4" :status="session('status')" />
+
+    <form method="POST" action="{{ route('login') }}">
+        @csrf
+
+        <!-- Email Address -->
+        <div>
+            <x-input-label for="email" :value="__('Email')" />
+            <x-text-input id="email" class="block mt-1 w-full" type="email" name="email" :value="old('email')" required autofocus autocomplete="username" />
+            <x-input-error :messages="$errors->get('email')" class="mt-2" />
+        </div>
+
+        <!-- Password -->
+        <div class="mt-4">
+            <x-input-label for="password" :value="__('Password')" />
+
+            <x-text-input id="password" class="block mt-1 w-full"
+                            type="password"
+                            name="password"
+                            required autocomplete="current-password" />
+
+            <x-input-error :messages="$errors->get('password')" class="mt-2" />
+        </div>
+
+        <!-- Remember Me -->
+        <div class="block mt-4">
+            <label for="remember_me" class="inline-flex items-center">
+                <input id="remember_me" type="checkbox" class="rounded border-gray-300 text-indigo-600 shadow-sm focus:ring-indigo-500" name="remember">
+                <span class="ms-2 text-sm text-gray-600">{{ __('Remember me') }}</span>
+            </label>
+        </div>
+
+        <div class="flex items-center justify-end mt-4">
+            @if (Route::has('password.request'))
+                <a class="underline text-sm text-gray-600 hover:text-gray-900 rounded-md focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-indigo-500" href="{{ route('password.request') }}">
+                    {{ __('Forgot your password?') }}
+                </a>
+            @endif
+
+            <x-primary-button class="ms-3">
+                {{ __('Log in') }}
+            </x-primary-button>
+        </div>
+    </form>
+</x-guest-layout>
diff --git a/resources/views/auth/register.blade.php b/resources/views/auth/register.blade.php
new file mode 100644
index 0000000..a857242
--- /dev/null
+++ b/resources/views/auth/register.blade.php
@@ -0,0 +1,52 @@
+<x-guest-layout>
+    <form method="POST" action="{{ route('register') }}">
+        @csrf
+
+        <!-- Name -->
+        <div>
+            <x-input-label for="name" :value="__('Name')" />
+            <x-text-input id="name" class="block mt-1 w-full" type="text" name="name" :value="old('name')" required autofocus autocomplete="name" />
+            <x-input-error :messages="$errors->get('name')" class="mt-2" />
+        </div>
+
+        <!-- Email Address -->
+        <div class="mt-4">
+            <x-input-label for="email" :value="__('Email')" />
+            <x-text-input id="email" class="block mt-1 w-full" type="email" name="email" :value="old('email')" required autocomplete="username" />
+            <x-input-error :messages="$errors->get('email')" class="mt-2" />
+        </div>
+
+        <!-- Password -->
+        <div class="mt-4">
+            <x-input-label for="password" :value="__('Password')" />
+
+            <x-text-input id="password" class="block mt-1 w-full"
+                            type="password"
+                            name="password"
+                            required autocomplete="new-password" />
+
+            <x-input-error :messages="$errors->get('password')" class="mt-2" />
+        </div>
+
+        <!-- Confirm Password -->
+        <div class="mt-4">
+            <x-input-label for="password_confirmation" :value="__('Confirm Password')" />
+
+            <x-text-input id="password_confirmation" class="block mt-1 w-full"
+                            type="password"
+                            name="password_confirmation" required autocomplete="new-password" />
+
+            <x-input-error :messages="$errors->get('password_confirmation')" class="mt-2" />
+        </div>
+
+        <div class="flex items-center justify-end mt-4">
+            <a class="underline text-sm text-gray-600 hover:text-gray-900 rounded-md focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-indigo-500" href="{{ route('login') }}">
+                {{ __('Already registered?') }}
+            </a>
+
+            <x-primary-button class="ms-4">
+                {{ __('Register') }}
+            </x-primary-button>
+        </div>
+    </form>
+</x-guest-layout>
diff --git a/resources/views/auth/reset-password.blade.php b/resources/views/auth/reset-password.blade.php
new file mode 100644
index 0000000..a6494cc
--- /dev/null
+++ b/resources/views/auth/reset-password.blade.php
@@ -0,0 +1,39 @@
+<x-guest-layout>
+    <form method="POST" action="{{ route('password.store') }}">
+        @csrf
+
+        <!-- Password Reset Token -->
+        <input type="hidden" name="token" value="{{ $request->route('token') }}">
+
+        <!-- Email Address -->
+        <div>
+            <x-input-label for="email" :value="__('Email')" />
+            <x-text-input id="email" class="block mt-1 w-full" type="email" name="email" :value="old('email', $request->email)" required autofocus autocomplete="username" />
+            <x-input-error :messages="$errors->get('email')" class="mt-2" />
+        </div>
+
+        <!-- Password -->
+        <div class="mt-4">
+            <x-input-label for="password" :value="__('Password')" />
+            <x-text-input id="password" class="block mt-1 w-full" type="password" name="password" required autocomplete="new-password" />
+            <x-input-error :messages="$errors->get('password')" class="mt-2" />
+        </div>
+
+        <!-- Confirm Password -->
+        <div class="mt-4">
+            <x-input-label for="password_confirmation" :value="__('Confirm Password')" />
+
+            <x-text-input id="password_confirmation" class="block mt-1 w-full"
+                                type="password"
+                                name="password_confirmation" required autocomplete="new-password" />
+
+            <x-input-error :messages="$errors->get('password_confirmation')" class="mt-2" />
+        </div>
+
+        <div class="flex items-center justify-end mt-4">
+            <x-primary-button>
+                {{ __('Reset Password') }}
+            </x-primary-button>
+        </div>
+    </form>
+</x-guest-layout>
diff --git a/resources/views/auth/verify-email.blade.php b/resources/views/auth/verify-email.blade.php
new file mode 100644
index 0000000..eaf811d
--- /dev/null
+++ b/resources/views/auth/verify-email.blade.php
@@ -0,0 +1,31 @@
+<x-guest-layout>
+    <div class="mb-4 text-sm text-gray-600">
+        {{ __('Thanks for signing up! Before getting started, could you verify your email address by clicking on the link we just emailed to you? If you didn\'t receive the email, we will gladly send you another.') }}
+    </div>
+
+    @if (session('status') == 'verification-link-sent')
+        <div class="mb-4 font-medium text-sm text-green-600">
+            {{ __('A new verification link has been sent to the email address you provided during registration.') }}
+        </div>
+    @endif
+
+    <div class="mt-4 flex items-center justify-between">
+        <form method="POST" action="{{ route('verification.send') }}">
+            @csrf
+
+            <div>
+                <x-primary-button>
+                    {{ __('Resend Verification Email') }}
+                </x-primary-button>
+            </div>
+        </form>
+
+        <form method="POST" action="{{ route('logout') }}">
+            @csrf
+
+            <button type="submit" class="underline text-sm text-gray-600 hover:text-gray-900 rounded-md focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-indigo-500">
+                {{ __('Log Out') }}
+            </button>
+        </form>
+    </div>
+</x-guest-layout>
diff --git a/resources/views/components/application-logo.blade.php b/resources/views/components/application-logo.blade.php
new file mode 100644
index 0000000..46579cf
--- /dev/null
+++ b/resources/views/components/application-logo.blade.php
@@ -0,0 +1,3 @@
+<svg viewBox="0 0 316 316" xmlns="http://www.w3.org/2000/svg" {{ $attributes }}>
+    <path d="M305.8 81.125C305.77 80.995 305.69 80.885 305.65 80.755C305.56 80.525 305.49 80.285 305.37 80.075C305.29 79.935 305.17 79.815 305.07 79.685C304.94 79.515 304.83 79.325 304.68 79.175C304.55 79.045 304.39 78.955 304.25 78.845C304.09 78.715 303.95 78.575 303.77 78.475L251.32 48.275C249.97 47.495 248.31 47.495 246.96 48.275L194.51 78.475C194.33 78.575 194.19 78.725 194.03 78.845C193.89 78.955 193.73 79.045 193.6 79.175C193.45 79.325 193.34 79.515 193.21 79.685C193.11 79.815 192.99 79.935 192.91 80.075C192.79 80.285 192.71 80.525 192.63 80.755C192.58 80.875 192.51 80.995 192.48 81.125C192.38 81.495 192.33 81.875 192.33 82.265V139.625L148.62 164.795V52.575C148.62 52.185 148.57 51.805 148.47 51.435C148.44 51.305 148.36 51.195 148.32 51.065C148.23 50.835 148.16 50.595 148.04 50.385C147.96 50.245 147.84 50.125 147.74 49.995C147.61 49.825 147.5 49.635 147.35 49.485C147.22 49.355 147.06 49.265 146.92 49.155C146.76 49.025 146.62 48.885 146.44 48.785L93.99 18.585C92.64 17.805 90.98 17.805 89.63 18.585L37.18 48.785C37 48.885 36.86 49.035 36.7 49.155C36.56 49.265 36.4 49.355 36.27 49.485C36.12 49.635 36.01 49.825 35.88 49.995C35.78 50.125 35.66 50.245 35.58 50.385C35.46 50.595 35.38 50.835 35.3 51.065C35.25 51.185 35.18 51.305 35.15 51.435C35.05 51.805 35 52.185 35 52.575V232.235C35 233.795 35.84 235.245 37.19 236.025L142.1 296.425C142.33 296.555 142.58 296.635 142.82 296.725C142.93 296.765 143.04 296.835 143.16 296.865C143.53 296.965 143.9 297.015 144.28 297.015C144.66 297.015 145.03 296.965 145.4 296.865C145.5 296.835 145.59 296.775 145.69 296.745C145.95 296.655 146.21 296.565 146.45 296.435L251.36 236.035C252.72 235.255 253.55 233.815 253.55 232.245V174.885L303.81 145.945C305.17 145.165 306 143.725 306 142.155V82.265C305.95 81.875 305.89 81.495 305.8 81.125ZM144.2 227.205L100.57 202.515L146.39 176.135L196.66 147.195L240.33 172.335L208.29 190.625L144.2 227.205ZM244.75 114.995V164.795L226.39 154.225L201.03 139.625V89.825L219.39 100.395L244.75 114.995ZM249.12 57.105L292.81 82.265L249.12 107.425L205.43 82.265L249.12 57.105ZM114.49 184.425L96.13 194.995V85.305L121.49 70.705L139.85 60.135V169.815L114.49 184.425ZM91.76 27.425L135.45 52.585L91.76 77.745L48.07 52.585L91.76 27.425ZM43.67 60.135L62.03 70.705L87.39 85.305V202.545V202.555V202.565C87.39 202.735 87.44 202.895 87.46 203.055C87.49 203.265 87.49 203.485 87.55 203.695V203.705C87.6 203.875 87.69 204.035 87.76 204.195C87.84 204.375 87.89 204.575 87.99 204.745C87.99 204.745 87.99 204.755 88 204.755C88.09 204.905 88.22 205.035 88.33 205.175C88.45 205.335 88.55 205.495 88.69 205.635L88.7 205.645C88.82 205.765 88.98 205.855 89.12 205.965C89.28 206.085 89.42 206.225 89.59 206.325C89.6 206.325 89.6 206.325 89.61 206.335C89.62 206.335 89.62 206.345 89.63 206.345L139.87 234.775V285.065L43.67 229.705V60.135ZM244.75 229.705L148.58 285.075V234.775L219.8 194.115L244.75 179.875V229.705ZM297.2 139.625L253.49 164.795V114.995L278.85 100.395L297.21 89.825V139.625H297.2Z"/>
+</svg>
diff --git a/resources/views/components/auth-session-status.blade.php b/resources/views/components/auth-session-status.blade.php
new file mode 100644
index 0000000..c4bd6e2
--- /dev/null
+++ b/resources/views/components/auth-session-status.blade.php
@@ -0,0 +1,7 @@
+@props(['status'])
+
+@if ($status)
+    <div {{ $attributes->merge(['class' => 'font-medium text-sm text-green-600']) }}>
+        {{ $status }}
+    </div>
+@endif
diff --git a/resources/views/components/danger-button.blade.php b/resources/views/components/danger-button.blade.php
new file mode 100644
index 0000000..d17d288
--- /dev/null
+++ b/resources/views/components/danger-button.blade.php
@@ -0,0 +1,3 @@
+<button {{ $attributes->merge(['type' => 'submit', 'class' => 'inline-flex items-center px-4 py-2 bg-red-600 border border-transparent rounded-md font-semibold text-xs text-white uppercase tracking-widest hover:bg-red-500 active:bg-red-700 focus:outline-none focus:ring-2 focus:ring-red-500 focus:ring-offset-2 transition ease-in-out duration-150']) }}>
+    {{ $slot }}
+</button>
diff --git a/resources/views/components/dropdown-link.blade.php b/resources/views/components/dropdown-link.blade.php
new file mode 100644
index 0000000..e0f8ce1
--- /dev/null
+++ b/resources/views/components/dropdown-link.blade.php
@@ -0,0 +1 @@
+<a {{ $attributes->merge(['class' => 'block w-full px-4 py-2 text-start text-sm leading-5 text-gray-700 hover:bg-gray-100 focus:outline-none focus:bg-gray-100 transition duration-150 ease-in-out']) }}>{{ $slot }}</a>
diff --git a/resources/views/components/dropdown.blade.php b/resources/views/components/dropdown.blade.php
new file mode 100644
index 0000000..a46f7c8
--- /dev/null
+++ b/resources/views/components/dropdown.blade.php
@@ -0,0 +1,35 @@
+@props(['align' => 'right', 'width' => '48', 'contentClasses' => 'py-1 bg-white'])
+
+@php
+$alignmentClasses = match ($align) {
+    'left' => 'ltr:origin-top-left rtl:origin-top-right start-0',
+    'top' => 'origin-top',
+    default => 'ltr:origin-top-right rtl:origin-top-left end-0',
+};
+
+$width = match ($width) {
+    '48' => 'w-48',
+    default => $width,
+};
+@endphp
+
+<div class="relative" x-data="{ open: false }" @click.outside="open = false" @close.stop="open = false">
+    <div @click="open = ! open">
+        {{ $trigger }}
+    </div>
+
+    <div x-show="open"
+            x-transition:enter="transition ease-out duration-200"
+            x-transition:enter-start="opacity-0 scale-95"
+            x-transition:enter-end="opacity-100 scale-100"
+            x-transition:leave="transition ease-in duration-75"
+            x-transition:leave-start="opacity-100 scale-100"
+            x-transition:leave-end="opacity-0 scale-95"
+            class="absolute z-50 mt-2 {{ $width }} rounded-md shadow-lg {{ $alignmentClasses }}"
+            style="display: none;"
+            @click="open = false">
+        <div class="rounded-md ring-1 ring-black ring-opacity-5 {{ $contentClasses }}">
+            {{ $content }}
+        </div>
+    </div>
+</div>
diff --git a/resources/views/components/input-error.blade.php b/resources/views/components/input-error.blade.php
new file mode 100644
index 0000000..9e6da21
--- /dev/null
+++ b/resources/views/components/input-error.blade.php
@@ -0,0 +1,9 @@
+@props(['messages'])
+
+@if ($messages)
+    <ul {{ $attributes->merge(['class' => 'text-sm text-red-600 space-y-1']) }}>
+        @foreach ((array) $messages as $message)
+            <li>{{ $message }}</li>
+        @endforeach
+    </ul>
+@endif
diff --git a/resources/views/components/input-label.blade.php b/resources/views/components/input-label.blade.php
new file mode 100644
index 0000000..1cc65e2
--- /dev/null
+++ b/resources/views/components/input-label.blade.php
@@ -0,0 +1,5 @@
+@props(['value'])
+
+<label {{ $attributes->merge(['class' => 'block font-medium text-sm text-gray-700']) }}>
+    {{ $value ?? $slot }}
+</label>
diff --git a/resources/views/components/modal.blade.php b/resources/views/components/modal.blade.php
new file mode 100644
index 0000000..70704c1
--- /dev/null
+++ b/resources/views/components/modal.blade.php
@@ -0,0 +1,78 @@
+@props([
+    'name',
+    'show' => false,
+    'maxWidth' => '2xl'
+])
+
+@php
+$maxWidth = [
+    'sm' => 'sm:max-w-sm',
+    'md' => 'sm:max-w-md',
+    'lg' => 'sm:max-w-lg',
+    'xl' => 'sm:max-w-xl',
+    '2xl' => 'sm:max-w-2xl',
+][$maxWidth];
+@endphp
+
+<div
+    x-data="{
+        show: @js($show),
+        focusables() {
+            // All focusable element types...
+            let selector = 'a, button, input:not([type=\'hidden\']), textarea, select, details, [tabindex]:not([tabindex=\'-1\'])'
+            return [...$el.querySelectorAll(selector)]
+                // All non-disabled elements...
+                .filter(el => ! el.hasAttribute('disabled'))
+        },
+        firstFocusable() { return this.focusables()[0] },
+        lastFocusable() { return this.focusables().slice(-1)[0] },
+        nextFocusable() { return this.focusables()[this.nextFocusableIndex()] || this.firstFocusable() },
+        prevFocusable() { return this.focusables()[this.prevFocusableIndex()] || this.lastFocusable() },
+        nextFocusableIndex() { return (this.focusables().indexOf(document.activeElement) + 1) % (this.focusables().length + 1) },
+        prevFocusableIndex() { return Math.max(0, this.focusables().indexOf(document.activeElement)) -1 },
+    }"
+    x-init="$watch('show', value => {
+        if (value) {
+            document.body.classList.add('overflow-y-hidden');
+            {{ $attributes->has('focusable') ? 'setTimeout(() => firstFocusable().focus(), 100)' : '' }}
+        } else {
+            document.body.classList.remove('overflow-y-hidden');
+        }
+    })"
+    x-on:open-modal.window="$event.detail == '{{ $name }}' ? show = true : null"
+    x-on:close-modal.window="$event.detail == '{{ $name }}' ? show = false : null"
+    x-on:close.stop="show = false"
+    x-on:keydown.escape.window="show = false"
+    x-on:keydown.tab.prevent="$event.shiftKey || nextFocusable().focus()"
+    x-on:keydown.shift.tab.prevent="prevFocusable().focus()"
+    x-show="show"
+    class="fixed inset-0 overflow-y-auto px-4 py-6 sm:px-0 z-50"
+    style="display: {{ $show ? 'block' : 'none' }};"
+>
+    <div
+        x-show="show"
+        class="fixed inset-0 transform transition-all"
+        x-on:click="show = false"
+        x-transition:enter="ease-out duration-300"
+        x-transition:enter-start="opacity-0"
+        x-transition:enter-end="opacity-100"
+        x-transition:leave="ease-in duration-200"
+        x-transition:leave-start="opacity-100"
+        x-transition:leave-end="opacity-0"
+    >
+        <div class="absolute inset-0 bg-gray-500 opacity-75"></div>
+    </div>
+
+    <div
+        x-show="show"
+        class="mb-6 bg-white rounded-lg overflow-hidden shadow-xl transform transition-all sm:w-full {{ $maxWidth }} sm:mx-auto"
+        x-transition:enter="ease-out duration-300"
+        x-transition:enter-start="opacity-0 translate-y-4 sm:translate-y-0 sm:scale-95"
+        x-transition:enter-end="opacity-100 translate-y-0 sm:scale-100"
+        x-transition:leave="ease-in duration-200"
+        x-transition:leave-start="opacity-100 translate-y-0 sm:scale-100"
+        x-transition:leave-end="opacity-0 translate-y-4 sm:translate-y-0 sm:scale-95"
+    >
+        {{ $slot }}
+    </div>
+</div>
diff --git a/resources/views/components/nav-link.blade.php b/resources/views/components/nav-link.blade.php
new file mode 100644
index 0000000..5c101a2
--- /dev/null
+++ b/resources/views/components/nav-link.blade.php
@@ -0,0 +1,11 @@
+@props(['active'])
+
+@php
+$classes = ($active ?? false)
+            ? 'inline-flex items-center px-1 pt-1 border-b-2 border-indigo-400 text-sm font-medium leading-5 text-gray-900 focus:outline-none focus:border-indigo-700 transition duration-150 ease-in-out'
+            : 'inline-flex items-center px-1 pt-1 border-b-2 border-transparent text-sm font-medium leading-5 text-gray-500 hover:text-gray-700 hover:border-gray-300 focus:outline-none focus:text-gray-700 focus:border-gray-300 transition duration-150 ease-in-out';
+@endphp
+
+<a {{ $attributes->merge(['class' => $classes]) }}>
+    {{ $slot }}
+</a>
diff --git a/resources/views/components/primary-button.blade.php b/resources/views/components/primary-button.blade.php
new file mode 100644
index 0000000..d71f0b6
--- /dev/null
+++ b/resources/views/components/primary-button.blade.php
@@ -0,0 +1,3 @@
+<button {{ $attributes->merge(['type' => 'submit', 'class' => 'inline-flex items-center px-4 py-2 bg-gray-800 border border-transparent rounded-md font-semibold text-xs text-white uppercase tracking-widest hover:bg-gray-700 focus:bg-gray-700 active:bg-gray-900 focus:outline-none focus:ring-2 focus:ring-indigo-500 focus:ring-offset-2 transition ease-in-out duration-150']) }}>
+    {{ $slot }}
+</button>
diff --git a/resources/views/components/responsive-nav-link.blade.php b/resources/views/components/responsive-nav-link.blade.php
new file mode 100644
index 0000000..43b91e7
--- /dev/null
+++ b/resources/views/components/responsive-nav-link.blade.php
@@ -0,0 +1,11 @@
+@props(['active'])
+
+@php
+$classes = ($active ?? false)
+            ? 'block w-full ps-3 pe-4 py-2 border-l-4 border-indigo-400 text-start text-base font-medium text-indigo-700 bg-indigo-50 focus:outline-none focus:text-indigo-800 focus:bg-indigo-100 focus:border-indigo-700 transition duration-150 ease-in-out'
+            : 'block w-full ps-3 pe-4 py-2 border-l-4 border-transparent text-start text-base font-medium text-gray-600 hover:text-gray-800 hover:bg-gray-50 hover:border-gray-300 focus:outline-none focus:text-gray-800 focus:bg-gray-50 focus:border-gray-300 transition duration-150 ease-in-out';
+@endphp
+
+<a {{ $attributes->merge(['class' => $classes]) }}>
+    {{ $slot }}
+</a>
diff --git a/resources/views/components/secondary-button.blade.php b/resources/views/components/secondary-button.blade.php
new file mode 100644
index 0000000..b32b69f
--- /dev/null
+++ b/resources/views/components/secondary-button.blade.php
@@ -0,0 +1,3 @@
+<button {{ $attributes->merge(['type' => 'button', 'class' => 'inline-flex items-center px-4 py-2 bg-white border border-gray-300 rounded-md font-semibold text-xs text-gray-700 uppercase tracking-widest shadow-sm hover:bg-gray-50 focus:outline-none focus:ring-2 focus:ring-indigo-500 focus:ring-offset-2 disabled:opacity-25 transition ease-in-out duration-150']) }}>
+    {{ $slot }}
+</button>
diff --git a/resources/views/components/text-input.blade.php b/resources/views/components/text-input.blade.php
new file mode 100644
index 0000000..da1b12d
--- /dev/null
+++ b/resources/views/components/text-input.blade.php
@@ -0,0 +1,3 @@
+@props(['disabled' => false])
+
+<input @disabled($disabled) {{ $attributes->merge(['class' => 'border-gray-300 focus:border-indigo-500 focus:ring-indigo-500 rounded-md shadow-sm']) }}>
diff --git a/resources/views/dashboard.blade.php b/resources/views/dashboard.blade.php
new file mode 100644
index 0000000..66028f2
--- /dev/null
+++ b/resources/views/dashboard.blade.php
@@ -0,0 +1,17 @@
+<x-app-layout>
+    <x-slot name="header">
+        <h2 class="font-semibold text-xl text-gray-800 leading-tight">
+            {{ __('Dashboard') }}
+        </h2>
+    </x-slot>
+
+    <div class="py-12">
+        <div class="max-w-7xl mx-auto sm:px-6 lg:px-8">
+            <div class="bg-white overflow-hidden shadow-sm sm:rounded-lg">
+                <div class="p-6 text-gray-900">
+                    {{ __("You're logged in!") }}
+                </div>
+            </div>
+        </div>
+    </div>
+</x-app-layout>
diff --git a/resources/views/layouts/app.blade.php b/resources/views/layouts/app.blade.php
new file mode 100644
index 0000000..c5ff315
--- /dev/null
+++ b/resources/views/layouts/app.blade.php
@@ -0,0 +1,36 @@
+<!DOCTYPE html>
+<html lang="{{ str_replace('_', '-', app()->getLocale()) }}">
+    <head>
+        <meta charset="utf-8">
+        <meta name="viewport" content="width=device-width, initial-scale=1">
+        <meta name="csrf-token" content="{{ csrf_token() }}">
+
+        <title>{{ config('app.name', 'Laravel') }}</title>
+
+        <!-- Fonts -->
+        <link rel="preconnect" href="https://fonts.bunny.net">
+        <link href="https://fonts.bunny.net/css?family=figtree:400,500,600&display=swap" rel="stylesheet" />
+
+        <!-- Scripts -->
+        @vite(['resources/css/app.css', 'resources/js/app.js'])
+    </head>
+    <body class="font-sans antialiased">
+        <div class="min-h-screen bg-gray-100">
+            @include('layouts.navigation')
+
+            <!-- Page Heading -->
+            @isset($header)
+                <header class="bg-white shadow">
+                    <div class="max-w-7xl mx-auto py-6 px-4 sm:px-6 lg:px-8">
+                        {{ $header }}
+                    </div>
+                </header>
+            @endisset
+
+            <!-- Page Content -->
+            <main>
+                {{ $slot }}
+            </main>
+        </div>
+    </body>
+</html>
diff --git a/resources/views/layouts/guest.blade.php b/resources/views/layouts/guest.blade.php
new file mode 100644
index 0000000..11feb47
--- /dev/null
+++ b/resources/views/layouts/guest.blade.php
@@ -0,0 +1,30 @@
+<!DOCTYPE html>
+<html lang="{{ str_replace('_', '-', app()->getLocale()) }}">
+    <head>
+        <meta charset="utf-8">
+        <meta name="viewport" content="width=device-width, initial-scale=1">
+        <meta name="csrf-token" content="{{ csrf_token() }}">
+
+        <title>{{ config('app.name', 'Laravel') }}</title>
+
+        <!-- Fonts -->
+        <link rel="preconnect" href="https://fonts.bunny.net">
+        <link href="https://fonts.bunny.net/css?family=figtree:400,500,600&display=swap" rel="stylesheet" />
+
+        <!-- Scripts -->
+        @vite(['resources/css/app.css', 'resources/js/app.js'])
+    </head>
+    <body class="font-sans text-gray-900 antialiased">
+        <div class="min-h-screen flex flex-col sm:justify-center items-center pt-6 sm:pt-0 bg-gray-100">
+            <div>
+                <a href="/">
+                    <x-application-logo class="w-20 h-20 fill-current text-gray-500" />
+                </a>
+            </div>
+
+            <div class="w-full sm:max-w-md mt-6 px-6 py-4 bg-white shadow-md overflow-hidden sm:rounded-lg">
+                {{ $slot }}
+            </div>
+        </div>
+    </body>
+</html>
diff --git a/resources/views/layouts/navigation.blade.php b/resources/views/layouts/navigation.blade.php
new file mode 100644
index 0000000..83e76ad
--- /dev/null
+++ b/resources/views/layouts/navigation.blade.php
@@ -0,0 +1,100 @@
+<nav x-data="{ open: false }" class="bg-white border-b border-gray-100">
+    <!-- Primary Navigation Menu -->
+    <div class="max-w-7xl mx-auto px-4 sm:px-6 lg:px-8">
+        <div class="flex justify-between h-16">
+            <div class="flex">
+                <!-- Logo -->
+                <div class="shrink-0 flex items-center">
+                    <a href="{{ route('dashboard') }}">
+                        <x-application-logo class="block h-9 w-auto fill-current text-gray-800" />
+                    </a>
+                </div>
+
+                <!-- Navigation Links -->
+                <div class="hidden space-x-8 sm:-my-px sm:ms-10 sm:flex">
+                    <x-nav-link :href="route('dashboard')" :active="request()->routeIs('dashboard')">
+                        {{ __('Einkaufsliste') }}
+                    </x-nav-link>
+                </div>
+            </div>
+
+            <!-- Settings Dropdown -->
+            <div class="hidden sm:flex sm:items-center sm:ms-6">
+                <x-dropdown align="right" width="48">
+                    <x-slot name="trigger">
+                        <button class="inline-flex items-center px-3 py-2 border border-transparent text-sm leading-4 font-medium rounded-md text-gray-500 bg-white hover:text-gray-700 focus:outline-none transition ease-in-out duration-150">
+                            <div>{{ Auth::user()->name }}</div>
+
+                            <div class="ms-1">
+                                <svg class="fill-current h-4 w-4" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 20 20">
+                                    <path fill-rule="evenodd" d="M5.293 7.293a1 1 0 011.414 0L10 10.586l3.293-3.293a1 1 0 111.414 1.414l-4 4a1 1 0 01-1.414 0l-4-4a1 1 0 010-1.414z" clip-rule="evenodd" />
+                                </svg>
+                            </div>
+                        </button>
+                    </x-slot>
+
+                    <x-slot name="content">
+                        <x-dropdown-link :href="route('profile.edit')">
+                            {{ __('Profile') }}
+                        </x-dropdown-link>
+
+                        <!-- Authentication -->
+                        <form method="POST" action="{{ route('logout') }}">
+                            @csrf
+
+                            <x-dropdown-link :href="route('logout')"
+                                    onclick="event.preventDefault();
+                                                this.closest('form').submit();">
+                                {{ __('Log Out') }}
+                            </x-dropdown-link>
+                        </form>
+                    </x-slot>
+                </x-dropdown>
+            </div>
+
+            <!-- Hamburger -->
+            <div class="-me-2 flex items-center sm:hidden">
+                <button @click="open = ! open" class="inline-flex items-center justify-center p-2 rounded-md text-gray-400 hover:text-gray-500 hover:bg-gray-100 focus:outline-none focus:bg-gray-100 focus:text-gray-500 transition duration-150 ease-in-out">
+                    <svg class="h-6 w-6" stroke="currentColor" fill="none" viewBox="0 0 24 24">
+                        <path :class="{'hidden': open, 'inline-flex': ! open }" class="inline-flex" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M4 6h16M4 12h16M4 18h16" />
+                        <path :class="{'hidden': ! open, 'inline-flex': open }" class="hidden" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M6 18L18 6M6 6l12 12" />
+                    </svg>
+                </button>
+            </div>
+        </div>
+    </div>
+
+    <!-- Responsive Navigation Menu -->
+    <div :class="{'block': open, 'hidden': ! open}" class="hidden sm:hidden">
+        <div class="pt-2 pb-3 space-y-1">
+            <x-responsive-nav-link :href="route('dashboard')" :active="request()->routeIs('dashboard')">
+                {{ __('Einkaufsliste') }}
+            </x-responsive-nav-link>
+        </div>
+
+        <!-- Responsive Settings Options -->
+        <div class="pt-4 pb-1 border-t border-gray-200">
+            <div class="px-4">
+                <div class="font-medium text-base text-gray-800">{{ Auth::user()->name }}</div>
+                <div class="font-medium text-sm text-gray-500">{{ Auth::user()->email }}</div>
+            </div>
+
+            <div class="mt-3 space-y-1">
+                <x-responsive-nav-link :href="route('profile.edit')">
+                    {{ __('Profile') }}
+                </x-responsive-nav-link>
+
+                <!-- Authentication -->
+                <form method="POST" action="{{ route('logout') }}">
+                    @csrf
+
+                    <x-responsive-nav-link :href="route('logout')"
+                            onclick="event.preventDefault();
+                                        this.closest('form').submit();">
+                        {{ __('Log Out') }}
+                    </x-responsive-nav-link>
+                </form>
+            </div>
+        </div>
+    </div>
+</nav>
diff --git a/resources/views/profile/edit.blade.php b/resources/views/profile/edit.blade.php
new file mode 100644
index 0000000..e0e1d38
--- /dev/null
+++ b/resources/views/profile/edit.blade.php
@@ -0,0 +1,29 @@
+<x-app-layout>
+    <x-slot name="header">
+        <h2 class="font-semibold text-xl text-gray-800 leading-tight">
+            {{ __('Profile') }}
+        </h2>
+    </x-slot>
+
+    <div class="py-12">
+        <div class="max-w-7xl mx-auto sm:px-6 lg:px-8 space-y-6">
+            <div class="p-4 sm:p-8 bg-white shadow sm:rounded-lg">
+                <div class="max-w-xl">
+                    @include('profile.partials.update-profile-information-form')
+                </div>
+            </div>
+
+            <div class="p-4 sm:p-8 bg-white shadow sm:rounded-lg">
+                <div class="max-w-xl">
+                    @include('profile.partials.update-password-form')
+                </div>
+            </div>
+
+            <div class="p-4 sm:p-8 bg-white shadow sm:rounded-lg">
+                <div class="max-w-xl">
+                    @include('profile.partials.delete-user-form')
+                </div>
+            </div>
+        </div>
+    </div>
+</x-app-layout>
diff --git a/resources/views/profile/partials/delete-user-form.blade.php b/resources/views/profile/partials/delete-user-form.blade.php
new file mode 100644
index 0000000..edeeb4a
--- /dev/null
+++ b/resources/views/profile/partials/delete-user-form.blade.php
@@ -0,0 +1,55 @@
+<section class="space-y-6">
+    <header>
+        <h2 class="text-lg font-medium text-gray-900">
+            {{ __('Delete Account') }}
+        </h2>
+
+        <p class="mt-1 text-sm text-gray-600">
+            {{ __('Once your account is deleted, all of its resources and data will be permanently deleted. Before deleting your account, please download any data or information that you wish to retain.') }}
+        </p>
+    </header>
+
+    <x-danger-button
+        x-data=""
+        x-on:click.prevent="$dispatch('open-modal', 'confirm-user-deletion')"
+    >{{ __('Delete Account') }}</x-danger-button>
+
+    <x-modal name="confirm-user-deletion" :show="$errors->userDeletion->isNotEmpty()" focusable>
+        <form method="post" action="{{ route('profile.destroy') }}" class="p-6">
+            @csrf
+            @method('delete')
+
+            <h2 class="text-lg font-medium text-gray-900">
+                {{ __('Are you sure you want to delete your account?') }}
+            </h2>
+
+            <p class="mt-1 text-sm text-gray-600">
+                {{ __('Once your account is deleted, all of its resources and data will be permanently deleted. Please enter your password to confirm you would like to permanently delete your account.') }}
+            </p>
+
+            <div class="mt-6">
+                <x-input-label for="password" value="{{ __('Password') }}" class="sr-only" />
+
+                <x-text-input
+                    id="password"
+                    name="password"
+                    type="password"
+                    class="mt-1 block w-3/4"
+                    placeholder="{{ __('Password') }}"
+                />
+
+                <x-input-error :messages="$errors->userDeletion->get('password')" class="mt-2" />
+            </div>
+
+            <div class="mt-6 flex justify-end">
+                <x-secondary-button x-on:click="$dispatch('close')">
+                    {{ __('Cancel') }}
+                </x-secondary-button>
+
+                <x-danger-button class="ms-3">
+                    {{ __('Delete Account') }}
+                </x-danger-button>
+            </div>
+        </form>
+    </x-modal>
+</section>
diff --git a/resources/views/profile/partials/update-password-form.blade.php b/resources/views/profile/partials/update-password-form.blade.php
new file mode 100644
index 0000000..eaca1ac
--- /dev/null
+++ b/resources/views/profile/partials/update-password-form.blade.php
@@ -0,0 +1,48 @@
+<section>
+    <header>
+        <h2 class="text-lg font-medium text-gray-900">
+            {{ __('Update Password') }}
+        </h2>
+
+        <p class="mt-1 text-sm text-gray-600">
+            {{ __('Ensure your account is using a long, random password to stay secure.') }}
+        </p>
+    </header>
+
+    <form method="post" action="{{ route('password.update') }}" class="mt-6 space-y-6">
+        @csrf
+        @method('put')
+
+        <div>
+            <x-input-label for="update_password_current_password" :value="__('Current Password')" />
+            <x-text-input id="update_password_current_password" name="current_password" type="password" class="mt-1 block w-full" autocomplete="current-password" />
+            <x-input-error :messages="$errors->updatePassword->get('current_password')" class="mt-2" />
+        </div>
+
+        <div>
+            <x-input-label for="update_password_password" :value="__('New Password')" />
+            <x-text-input id="update_password_password" name="password" type="password" class="mt-1 block w-full" autocomplete="new-password" />
+            <x-input-error :messages="$errors->updatePassword->get('password')" class="mt-2" />
+        </div>
+
+        <div>
+            <x-input-label for="update_password_password_confirmation" :value="__('Confirm Password')" />
+            <x-text-input id="update_password_password_confirmation" name="password_confirmation" type="password" class="mt-1 block w-full" autocomplete="new-password" />
+            <x-input-error :messages="$errors->updatePassword->get('password_confirmation')" class="mt-2" />
+        </div>
+
+        <div class="flex items-center gap-4">
+            <x-primary-button>{{ __('Save') }}</x-primary-button>
+
+            @if (session('status') === 'password-updated')
+                <p
+                    x-data="{ show: true }"
+                    x-show="show"
+                    x-transition
+                    x-init="setTimeout(() => show = false, 2000)"
+                    class="text-sm text-gray-600"
+                >{{ __('Saved.') }}</p>
+            @endif
+        </div>
+    </form>
+</section>
diff --git a/resources/views/profile/partials/update-profile-information-form.blade.php b/resources/views/profile/partials/update-profile-information-form.blade.php
new file mode 100644
index 0000000..5ae3d35
--- /dev/null
+++ b/resources/views/profile/partials/update-profile-information-form.blade.php
@@ -0,0 +1,64 @@
+<section>
+    <header>
+        <h2 class="text-lg font-medium text-gray-900">
+            {{ __('Profile Information') }}
+        </h2>
+
+        <p class="mt-1 text-sm text-gray-600">
+            {{ __("Update your account's profile information and email address.") }}
+        </p>
+    </header>
+
+    <form id="send-verification" method="post" action="{{ route('verification.send') }}">
+        @csrf
+    </form>
+
+    <form method="post" action="{{ route('profile.update') }}" class="mt-6 space-y-6">
+        @csrf
+        @method('patch')
+
+        <div>
+            <x-input-label for="name" :value="__('Name')" />
+            <x-text-input id="name" name="name" type="text" class="mt-1 block w-full" :value="old('name', $user->name)" required autofocus autocomplete="name" />
+            <x-input-error class="mt-2" :messages="$errors->get('name')" />
+        </div>
+
+        <div>
+            <x-input-label for="email" :value="__('Email')" />
+            <x-text-input id="email" name="email" type="email" class="mt-1 block w-full" :value="old('email', $user->email)" required autocomplete="username" />
+            <x-input-error class="mt-2" :messages="$errors->get('email')" />
+
+            @if ($user instanceof \Illuminate\Contracts\Auth\MustVerifyEmail && ! $user->hasVerifiedEmail())
+                <div>
+                    <p class="text-sm mt-2 text-gray-800">
+                        {{ __('Your email address is unverified.') }}
+
+                        <button form="send-verification" class="underline text-sm text-gray-600 hover:text-gray-900 rounded-md focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-indigo-500">
+                            {{ __('Click here to re-send the verification email.') }}
+                        </button>
+                    </p>
+
+                    @if (session('status') === 'verification-link-sent')
+                        <p class="mt-2 font-medium text-sm text-green-600">
+                            {{ __('A new verification link has been sent to your email address.') }}
+                        </p>
+                    @endif
+                </div>
+            @endif
+        </div>
+
+        <div class="flex items-center gap-4">
+            <x-primary-button>{{ __('Save') }}</x-primary-button>
+
+            @if (session('status') === 'profile-updated')
+                <p
+                    x-data="{ show: true }"
+                    x-show="show"
+                    x-transition
+                    x-init="setTimeout(() => show = false, 2000)"
+                    class="text-sm text-gray-600"
+                >{{ __('Saved.') }}</p>
+            @endif
+        </div>
+    </form>
+</section>
diff --git a/resources/views/shopping-list/index.blade.php b/resources/views/shopping-list/index.blade.php
new file mode 100644
index 0000000..3226ed2
--- /dev/null
+++ b/resources/views/shopping-list/index.blade.php
@@ -0,0 +1,161 @@
+<x-app-layout>
+    <x-slot name="header">
+        <h2 class="font-semibold text-xl text-gray-800 leading-tight">
+            Einkaufsliste
+        </h2>
+    </x-slot>
+
+    <div class="py-6">
+        <div class="max-w-7xl mx-auto sm:px-6 lg:px-8 space-y-6">
+            <datalist id="store-options">
+                @foreach($stores as $store)
+                    <option value="{{ $store->name }}"></option>
+                @endforeach
+            </datalist>
+
+            @if (session('status'))
+                <div class="bg-green-100 border border-green-300 text-green-800 px-4 py-3 rounded">
+                    {{ session('status') }}
+                </div>
+            @endif
+            @if ($errors->any())
+                <div class="bg-red-100 border border-red-300 text-red-800 px-4 py-3 rounded">
+                    <ul class="list-disc ms-5">
+                        @foreach ($errors->all() as $error)
+                            <li>{{ $error }}</li>
+                        @endforeach
+                    </ul>
+                </div>
+            @endif
+
+            <div class="bg-white overflow-hidden shadow-sm sm:rounded-xl p-4 sm:p-6">
+                <h3 class="text-lg font-semibold mb-4">Neuen Eintrag erfassen</h3>
+                <form method="POST" action="{{ route('shopping-items.store') }}" class="grid grid-cols-1 md:grid-cols-5 gap-3">
+                    @csrf
+                    <input
+                        type="text"
+                        name="product_name"
+                        value="{{ old('product_name') }}"
+                        placeholder="Produktname"
+                        class="rounded border-gray-300 min-h-[44px]"
+                        required
+                    >
+                    <input
+                        type="text"
+                        name="quantity"
+                        value="{{ old('quantity') }}"
+                        placeholder="Menge (optional)"
+                        class="rounded border-gray-300 min-h-[44px]"
+                    >
+                    <select name="store_id" class="rounded border-gray-300 min-h-[44px]">
+                        <option value="">Geschaeft (optional)</option>
+                        @foreach($stores as $store)
+                            <option value="{{ $store->id }}" @selected(old('store_id') == $store->id)>
+                                {{ $store->name }}
+                            </option>
+                        @endforeach
+                    </select>
+                    <input
+                        type="text"
+                        name="new_store_name"
+                        value="{{ old('new_store_name') }}"
+                        placeholder="Geschaeft frei eingeben (optional)"
+                        list="store-options"
+                        class="rounded border-gray-300 min-h-[44px]"
+                    >
+                    <button class="rounded bg-blue-600 text-white px-4 py-2 min-h-[44px] text-base hover:bg-blue-700">
+                        Hinzufuegen
+                    </button>
+                </form>
+            </div>
+
+            <div class="grid grid-cols-1 lg:grid-cols-2 gap-6">
+                <div class="bg-white overflow-hidden shadow-sm sm:rounded-xl p-4 sm:p-6">
+                    <h3 class="text-lg font-semibold mb-4">Offene Eintraege</h3>
+                    <div class="space-y-3">
+                        @forelse($openItems as $item)
+                            <form method="POST" action="{{ route('shopping-items.toggle', $item) }}" enctype="multipart/form-data" class="border rounded-lg p-3">
+                                @csrf
+                                @method('PATCH')
+                                <input type="hidden" name="is_done" value="1">
+                                <div class="font-medium">{{ $item->product_name }}</div>
+                                <div class="text-sm text-gray-600 mb-2">
+                                    Menge: {{ $item->quantity ?: '-' }} | Geschaeft: {{ $item->store?->name ?: '-' }}
+                                </div>
+                                <div class="grid grid-cols-1 md:grid-cols-3 gap-2">
+                                    <select name="store_id" class="rounded border-gray-300 text-sm min-h-[44px]">
+                                        <option value="">Geschaeft waehlen</option>
+                                        @foreach($stores as $store)
+                                            <option value="{{ $store->id }}" @selected($item->store_id === $store->id)>
+                                                {{ $store->name }}
+                                            </option>
+                                        @endforeach
+                                    </select>
+                                    <input type="text" name="new_store_name" placeholder="Oder Geschaeft eingeben" list="store-options" class="rounded border-gray-300 text-sm min-h-[44px]">
+                                    <input type="number" step="0.01" min="0" name="price_decimal" placeholder="Preis in EUR (optional)" class="rounded border-gray-300 text-sm min-h-[44px]">
+                                </div>
+                                <input type="file" name="photo" accept="image/*" class="rounded border-gray-300 text-sm mt-2 min-h-[44px]">
+                                @if($item->latestPriceLog)
+                                    <div class="text-xs text-gray-500 mt-2">
+                                        Letzter Preis:
+                                        {{ number_format((float) $item->latestPriceLog->price_decimal, 2, ',', '.') }} EUR
+                                        bei {{ $item->latestPriceLog->store?->name ?: 'ohne Geschaeft' }}
+                                        ({{ optional($item->latestPriceLog->logged_at)->format('d.m.Y H:i') }})
+                                    </div>
+                                @endif
+                                <button class="mt-2 rounded bg-green-600 text-white px-3 py-2 text-sm min-h-[44px] hover:bg-green-700">
+                                    Als erledigt markieren
+                                </button>
+                            </form>
+                        @empty
+                            <p class="text-gray-600">Keine offenen Eintraege.</p>
+                        @endforelse
+                    </div>
+                </div>
+
+                <div class="bg-white overflow-hidden shadow-sm sm:rounded-xl p-4 sm:p-6">
+                    <h3 class="text-lg font-semibold mb-4">Erledigte Eintraege</h3>
+                    <div class="space-y-3">
+                        @forelse($doneItems as $item)
+                            <form method="POST" action="{{ route('shopping-items.toggle', $item) }}" class="border rounded-lg p-3">
+                                @csrf
+                                @method('PATCH')
+                                <input type="hidden" name="is_done" value="0">
+                                <div class="font-medium line-through text-gray-700">{{ $item->product_name }}</div>
+                                <div class="text-sm text-gray-600">
+                                    Erledigt: {{ optional($item->done_at)->format('d.m.Y H:i') ?: '-' }}
+                                </div>
+                                <div class="text-sm text-gray-600 mb-2">
+                                    Letzter Preis: {{ $item->latestPriceLog?->price_decimal !== null ? number_format((float) $item->latestPriceLog->price_decimal, 2, ',', '.') . ' EUR' : '-' }}
+                                </div>
+                                <button class="rounded bg-gray-600 text-white px-3 py-2 text-sm min-h-[44px] hover:bg-gray-700">
+                                    Wieder offen setzen
+                                </button>
+                            </form>
+                        @empty
+                            <p class="text-gray-600">Noch keine erledigten Eintraege.</p>
+                        @endforelse
+                    </div>
+                </div>
+            </div>
+
+            <div class="bg-white overflow-hidden shadow-sm sm:rounded-xl p-4 sm:p-6">
+                <h3 class="text-lg font-semibold mb-4">Kosten pro Geschaeft (alle Eintraege)</h3>
+                <div class="space-y-1">
+                    @forelse($totalsByStore as $storeName => $sum)
+                        <div class="flex justify-between border-b py-1">
+                            <span>{{ $storeName }}</span>
+                            <span>{{ number_format((float) $sum, 2, ',', '.') }} EUR</span>
+                        </div>
+                    @empty
+                        <p class="text-gray-600">Noch keine Preise erfasst.</p>
+                    @endforelse
+                </div>
+                <div class="flex justify-between font-semibold mt-3">
+                    <span>Gesamt</span>
+                    <span>{{ number_format((float) $totalAll, 2, ',', '.') }} EUR</span>
+                </div>
+            </div>
+        </div>
+    </div>
+</x-app-layout>
diff --git a/resources/views/welcome.blade.php b/resources/views/welcome.blade.php
new file mode 100644
index 0000000..b7355d7
--- /dev/null
+++ b/resources/views/welcome.blade.php
@@ -0,0 +1,277 @@
+<!DOCTYPE html>
+<html lang="{{ str_replace('_', '-', app()->getLocale()) }}">
+    <head>
+        <meta charset="utf-8">
+        <meta name="viewport" content="width=device-width, initial-scale=1">
+
+        <title>{{ config('app.name', 'Laravel') }}</title>
+
+        <!-- Fonts -->
+        <link rel="preconnect" href="https://fonts.bunny.net">
+        <link href="https://fonts.bunny.net/css?family=instrument-sans:400,500,600" rel="stylesheet" />
+
+        <!-- Styles / Scripts -->
+        @if (file_exists(public_path('build/manifest.json')) || file_exists(public_path('hot')))
+            @vite(['resources/css/app.css', 'resources/js/app.js'])
+        @else
+            <style>
+                /*! tailwindcss v4.0.7 | MIT License | https://tailwindcss.com */@layer theme{:root,:host{--font-sans:'Instrument Sans',ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-serif:ui-serif,Georgia,Cambria,"Times New Roman",Times,serif;--font-mono:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--color-red-50:oklch(.971 .013 17.38);--color-red-100:oklch(.936 .032 17.717);--color-red-200:oklch(.885 .062 18.334);--color-red-300:oklch(.808 .114 19.571);--color-red-400:oklch(.704 .191 22.216);--color-red-500:oklch(.637 .237 25.331);--color-red-600:oklch(.577 .245 27.325);--color-red-700:oklch(.505 .213 27.518);--color-red-800:oklch(.444 .177 26.899);--color-red-900:oklch(.396 .141 25.723);--color-red-950:oklch(.258 .092 26.042);--color-orange-50:oklch(.98 .016 73.684);--color-orange-100:oklch(.954 .038 75.164);--color-orange-200:oklch(.901 .076 70.697);--color-orange-300:oklch(.837 .128 66.29);--color-orange-400:oklch(.75 .183 55.934);--color-orange-500:oklch(.705 .213 47.604);--color-orange-600:oklch(.646 .222 41.116);--color-orange-700:oklch(.553 .195 38.402);--color-orange-800:oklch(.47 .157 37.304);--color-orange-900:oklch(.408 .123 38.172);--color-orange-950:oklch(.266 .079 36.259);--color-amber-50:oklch(.987 .022 95.277);--color-amber-100:oklch(.962 .059 95.617);--color-amber-200:oklch(.924 .12 95.746);--color-amber-300:oklch(.879 .169 91.605);--color-amber-400:oklch(.828 .189 84.429);--color-amber-500:oklch(.769 .188 70.08);--color-amber-600:oklch(.666 .179 58.318);--color-amber-700:oklch(.555 .163 48.998);--color-amber-800:oklch(.473 .137 46.201);--color-amber-900:oklch(.414 .112 45.904);--color-amber-950:oklch(.279 .077 45.635);--color-yellow-50:oklch(.987 .026 102.212);--color-yellow-100:oklch(.973 .071 103.193);--color-yellow-200:oklch(.945 .129 101.54);--color-yellow-300:oklch(.905 .182 98.111);--color-yellow-400:oklch(.852 .199 91.936);--color-yellow-500:oklch(.795 .184 86.047);--color-yellow-600:oklch(.681 .162 75.834);--color-yellow-700:oklch(.554 .135 66.442);--color-yellow-800:oklch(.476 .114 61.907);--color-yellow-900:oklch(.421 .095 57.708);--color-yellow-950:oklch(.286 .066 53.813);--color-lime-50:oklch(.986 .031 120.757);--color-lime-100:oklch(.967 .067 122.328);--color-lime-200:oklch(.938 .127 124.321);--color-lime-300:oklch(.897 .196 126.665);--color-lime-400:oklch(.841 .238 128.85);--color-lime-500:oklch(.768 .233 130.85);--color-lime-600:oklch(.648 .2 131.684);--color-lime-700:oklch(.532 .157 131.589);--color-lime-800:oklch(.453 .124 130.933);--color-lime-900:oklch(.405 .101 131.063);--color-lime-950:oklch(.274 .072 132.109);--color-green-50:oklch(.982 .018 155.826);--color-green-100:oklch(.962 .044 156.743);--color-green-200:oklch(.925 .084 155.995);--color-green-300:oklch(.871 .15 154.449);--color-green-400:oklch(.792 .209 151.711);--color-green-500:oklch(.723 .219 149.579);--color-green-600:oklch(.627 .194 149.214);--color-green-700:oklch(.527 .154 150.069);--color-green-800:oklch(.448 .119 151.328);--color-green-900:oklch(.393 .095 152.535);--color-green-950:oklch(.266 .065 152.934);--color-emerald-50:oklch(.979 .021 166.113);--color-emerald-100:oklch(.95 .052 163.051);--color-emerald-200:oklch(.905 .093 164.15);--color-emerald-300:oklch(.845 .143 164.978);--color-emerald-400:oklch(.765 .177 163.223);--color-emerald-500:oklch(.696 .17 162.48);--color-emerald-600:oklch(.596 .145 163.225);--color-emerald-700:oklch(.508 .118 165.612);--color-emerald-800:oklch(.432 .095 166.913);--color-emerald-900:oklch(.378 .077 168.94);--color-emerald-950:oklch(.262 .051 172.552);--color-teal-50:oklch(.984 .014 180.72);--color-teal-100:oklch(.953 .051 180.801);--color-teal-200:oklch(.91 .096 180.426);--color-teal-300:oklch(.855 .138 181.071);--color-teal-400:oklch(.777 .152 181.912);--color-teal-500:oklch(.704 .14 182.503);--color-teal-600:oklch(.6 .118 184.704);--color-teal-700:oklch(.511 .096 186.391);--color-teal-800:oklch(.437 .078 188.216);--color-teal-900:oklch(.386 .063 188.416);--color-teal-950:oklch(.277 .046 192.524);--color-cyan-50:oklch(.984 .019 200.873);--color-cyan-100:oklch(.956 .045 203.388);--color-cyan-200:oklch(.917 .08 205.041);--color-cyan-300:oklch(.865 .127 207.078);--color-cyan-400:oklch(.789 .154 211.53);--color-cyan-500:oklch(.715 .143 215.221);--color-cyan-600:oklch(.609 .126 221.723);--color-cyan-700:oklch(.52 .105 223.128);--color-cyan-800:oklch(.45 .085 224.283);--color-cyan-900:oklch(.398 .07 227.392);--color-cyan-950:oklch(.302 .056 229.695);--color-sky-50:oklch(.977 .013 236.62);--color-sky-100:oklch(.951 .026 236.824);--color-sky-200:oklch(.901 .058 230.902);--color-sky-300:oklch(.828 .111 230.318);--color-sky-400:oklch(.746 .16 232.661);--color-sky-500:oklch(.685 .169 237.323);--color-sky-600:oklch(.588 .158 241.966);--color-sky-700:oklch(.5 .134 242.749);--color-sky-800:oklch(.443 .11 240.79);--color-sky-900:oklch(.391 .09 240.876);--color-sky-950:oklch(.293 .066 243.157);--color-blue-50:oklch(.97 .014 254.604);--color-blue-100:oklch(.932 .032 255.585);--color-blue-200:oklch(.882 .059 254.128);--color-blue-300:oklch(.809 .105 251.813);--color-blue-400:oklch(.707 .165 254.624);--color-blue-500:oklch(.623 .214 259.815);--color-blue-600:oklch(.546 .245 262.881);--color-blue-700:oklch(.488 .243 264.376);--color-blue-800:oklch(.424 .199 265.638);--color-blue-900:oklch(.379 .146 265.522);--color-blue-950:oklch(.282 .091 267.935);--color-indigo-50:oklch(.962 .018 272.314);--color-indigo-100:oklch(.93 .034 272.788);--color-indigo-200:oklch(.87 .065 274.039);--color-indigo-300:oklch(.785 .115 274.713);--color-indigo-400:oklch(.673 .182 276.935);--color-indigo-500:oklch(.585 .233 277.117);--color-indigo-600:oklch(.511 .262 276.966);--color-indigo-700:oklch(.457 .24 277.023);--color-indigo-800:oklch(.398 .195 277.366);--color-indigo-900:oklch(.359 .144 278.697);--color-indigo-950:oklch(.257 .09 281.288);--color-violet-50:oklch(.969 .016 293.756);--color-violet-100:oklch(.943 .029 294.588);--color-violet-200:oklch(.894 .057 293.283);--color-violet-300:oklch(.811 .111 293.571);--color-violet-400:oklch(.702 .183 293.541);--color-violet-500:oklch(.606 .25 292.717);--color-violet-600:oklch(.541 .281 293.009);--color-violet-700:oklch(.491 .27 292.581);--color-violet-800:oklch(.432 .232 292.759);--color-violet-900:oklch(.38 .189 293.745);--color-violet-950:oklch(.283 .141 291.089);--color-purple-50:oklch(.977 .014 308.299);--color-purple-100:oklch(.946 .033 307.174);--color-purple-200:oklch(.902 .063 306.703);--color-purple-300:oklch(.827 .119 306.383);--color-purple-400:oklch(.714 .203 305.504);--color-purple-500:oklch(.627 .265 303.9);--color-purple-600:oklch(.558 .288 302.321);--color-purple-700:oklch(.496 .265 301.924);--color-purple-800:oklch(.438 .218 303.724);--color-purple-900:oklch(.381 .176 304.987);--color-purple-950:oklch(.291 .149 302.717);--color-fuchsia-50:oklch(.977 .017 320.058);--color-fuchsia-100:oklch(.952 .037 318.852);--color-fuchsia-200:oklch(.903 .076 319.62);--color-fuchsia-300:oklch(.833 .145 321.434);--color-fuchsia-400:oklch(.74 .238 322.16);--color-fuchsia-500:oklch(.667 .295 322.15);--color-fuchsia-600:oklch(.591 .293 322.896);--color-fuchsia-700:oklch(.518 .253 323.949);--color-fuchsia-800:oklch(.452 .211 324.591);--color-fuchsia-900:oklch(.401 .17 325.612);--color-fuchsia-950:oklch(.293 .136 325.661);--color-pink-50:oklch(.971 .014 343.198);--color-pink-100:oklch(.948 .028 342.258);--color-pink-200:oklch(.899 .061 343.231);--color-pink-300:oklch(.823 .12 346.018);--color-pink-400:oklch(.718 .202 349.761);--color-pink-500:oklch(.656 .241 354.308);--color-pink-600:oklch(.592 .249 .584);--color-pink-700:oklch(.525 .223 3.958);--color-pink-800:oklch(.459 .187 3.815);--color-pink-900:oklch(.408 .153 2.432);--color-pink-950:oklch(.284 .109 3.907);--color-rose-50:oklch(.969 .015 12.422);--color-rose-100:oklch(.941 .03 12.58);--color-rose-200:oklch(.892 .058 10.001);--color-rose-300:oklch(.81 .117 11.638);--color-rose-400:oklch(.712 .194 13.428);--color-rose-500:oklch(.645 .246 16.439);--color-rose-600:oklch(.586 .253 17.585);--color-rose-700:oklch(.514 .222 16.935);--color-rose-800:oklch(.455 .188 13.697);--color-rose-900:oklch(.41 .159 10.272);--color-rose-950:oklch(.271 .105 12.094);--color-slate-50:oklch(.984 .003 247.858);--color-slate-100:oklch(.968 .007 247.896);--color-slate-200:oklch(.929 .013 255.508);--color-slate-300:oklch(.869 .022 252.894);--color-slate-400:oklch(.704 .04 256.788);--color-slate-500:oklch(.554 .046 257.417);--color-slate-600:oklch(.446 .043 257.281);--color-slate-700:oklch(.372 .044 257.287);--color-slate-800:oklch(.279 .041 260.031);--color-slate-900:oklch(.208 .042 265.755);--color-slate-950:oklch(.129 .042 264.695);--color-gray-50:oklch(.985 .002 247.839);--color-gray-100:oklch(.967 .003 264.542);--color-gray-200:oklch(.928 .006 264.531);--color-gray-300:oklch(.872 .01 258.338);--color-gray-400:oklch(.707 .022 261.325);--color-gray-500:oklch(.551 .027 264.364);--color-gray-600:oklch(.446 .03 256.802);--color-gray-700:oklch(.373 .034 259.733);--color-gray-800:oklch(.278 .033 256.848);--color-gray-900:oklch(.21 .034 264.665);--color-gray-950:oklch(.13 .028 261.692);--color-zinc-50:oklch(.985 0 0);--color-zinc-100:oklch(.967 .001 286.375);--color-zinc-200:oklch(.92 .004 286.32);--color-zinc-300:oklch(.871 .006 286.286);--color-zinc-400:oklch(.705 .015 286.067);--color-zinc-500:oklch(.552 .016 285.938);--color-zinc-600:oklch(.442 .017 285.786);--color-zinc-700:oklch(.37 .013 285.805);--color-zinc-800:oklch(.274 .006 286.033);--color-zinc-900:oklch(.21 .006 285.885);--color-zinc-950:oklch(.141 .005 285.823);--color-neutral-50:oklch(.985 0 0);--color-neutral-100:oklch(.97 0 0);--color-neutral-200:oklch(.922 0 0);--color-neutral-300:oklch(.87 0 0);--color-neutral-400:oklch(.708 0 0);--color-neutral-500:oklch(.556 0 0);--color-neutral-600:oklch(.439 0 0);--color-neutral-700:oklch(.371 0 0);--color-neutral-800:oklch(.269 0 0);--color-neutral-900:oklch(.205 0 0);--color-neutral-950:oklch(.145 0 0);--color-stone-50:oklch(.985 .001 106.423);--color-stone-100:oklch(.97 .001 106.424);--color-stone-200:oklch(.923 .003 48.717);--color-stone-300:oklch(.869 .005 56.366);--color-stone-400:oklch(.709 .01 56.259);--color-stone-500:oklch(.553 .013 58.071);--color-stone-600:oklch(.444 .011 73.639);--color-stone-700:oklch(.374 .01 67.558);--color-stone-800:oklch(.268 .007 34.298);--color-stone-900:oklch(.216 .006 56.043);--color-stone-950:oklch(.147 .004 49.25);--color-black:#000;--color-white:#fff;--spacing:.25rem;--breakpoint-sm:40rem;--breakpoint-md:48rem;--breakpoint-lg:64rem;--breakpoint-xl:80rem;--breakpoint-2xl:96rem;--container-3xs:16rem;--container-2xs:18rem;--container-xs:20rem;--container-sm:24rem;--container-md:28rem;--container-lg:32rem;--container-xl:36rem;--container-2xl:42rem;--container-3xl:48rem;--container-4xl:56rem;--container-5xl:64rem;--container-6xl:72rem;--container-7xl:80rem;--text-xs:.75rem;--text-xs--line-height:calc(1/.75);--text-sm:.875rem;--text-sm--line-height:calc(1.25/.875);--text-base:1rem;--text-base--line-height: 1.5 ;--text-lg:1.125rem;--text-lg--line-height:calc(1.75/1.125);--text-xl:1.25rem;--text-xl--line-height:calc(1.75/1.25);--text-2xl:1.5rem;--text-2xl--line-height:calc(2/1.5);--text-3xl:1.875rem;--text-3xl--line-height: 1.2 ;--text-4xl:2.25rem;--text-4xl--line-height:calc(2.5/2.25);--text-5xl:3rem;--text-5xl--line-height:1;--text-6xl:3.75rem;--text-6xl--line-height:1;--text-7xl:4.5rem;--text-7xl--line-height:1;--text-8xl:6rem;--text-8xl--line-height:1;--text-9xl:8rem;--text-9xl--line-height:1;--font-weight-thin:100;--font-weight-extralight:200;--font-weight-light:300;--font-weight-normal:400;--font-weight-medium:500;--font-weight-semibold:600;--font-weight-bold:700;--font-weight-extrabold:800;--font-weight-black:900;--tracking-tighter:-.05em;--tracking-tight:-.025em;--tracking-normal:0em;--tracking-wide:.025em;--tracking-wider:.05em;--tracking-widest:.1em;--leading-tight:1.25;--leading-snug:1.375;--leading-normal:1.5;--leading-relaxed:1.625;--leading-loose:2;--radius-xs:.125rem;--radius-sm:.25rem;--radius-md:.375rem;--radius-lg:.5rem;--radius-xl:.75rem;--radius-2xl:1rem;--radius-3xl:1.5rem;--radius-4xl:2rem;--shadow-2xs:0 1px #0000000d;--shadow-xs:0 1px 2px 0 #0000000d;--shadow-sm:0 1px 3px 0 #0000001a,0 1px 2px -1px #0000001a;--shadow-md:0 4px 6px -1px #0000001a,0 2px 4px -2px #0000001a;--shadow-lg:0 10px 15px -3px #0000001a,0 4px 6px -4px #0000001a;--shadow-xl:0 20px 25px -5px #0000001a,0 8px 10px -6px #0000001a;--shadow-2xl:0 25px 50px -12px #00000040;--inset-shadow-2xs:inset 0 1px #0000000d;--inset-shadow-xs:inset 0 1px 1px #0000000d;--inset-shadow-sm:inset 0 2px 4px #0000000d;--drop-shadow-xs:0 1px 1px #0000000d;--drop-shadow-sm:0 1px 2px #00000026;--drop-shadow-md:0 3px 3px #0000001f;--drop-shadow-lg:0 4px 4px #00000026;--drop-shadow-xl:0 9px 7px #0000001a;--drop-shadow-2xl:0 25px 25px #00000026;--ease-in:cubic-bezier(.4,0,1,1);--ease-out:cubic-bezier(0,0,.2,1);--ease-in-out:cubic-bezier(.4,0,.2,1);--animate-spin:spin 1s linear infinite;--animate-ping:ping 1s cubic-bezier(0,0,.2,1)infinite;--animate-pulse:pulse 2s cubic-bezier(.4,0,.6,1)infinite;--animate-bounce:bounce 1s infinite;--blur-xs:4px;--blur-sm:8px;--blur-md:12px;--blur-lg:16px;--blur-xl:24px;--blur-2xl:40px;--blur-3xl:64px;--perspective-dramatic:100px;--perspective-near:300px;--perspective-normal:500px;--perspective-midrange:800px;--perspective-distant:1200px;--aspect-video:16/9;--default-transition-duration:.15s;--default-transition-timing-function:cubic-bezier(.4,0,.2,1);--default-font-family:var(--font-sans);--default-font-feature-settings:var(--font-sans--font-feature-settings);--default-font-variation-settings:var(--font-sans--font-variation-settings);--default-mono-font-family:var(--font-mono);--default-mono-font-feature-settings:var(--font-mono--font-feature-settings);--default-mono-font-variation-settings:var(--font-mono--font-variation-settings)}}@layer base{*,:after,:before,::backdrop{box-sizing:border-box;border:0 solid;margin:0;padding:0}::file-selector-button{box-sizing:border-box;border:0 solid;margin:0;padding:0}html,:host{-webkit-text-size-adjust:100%;-moz-tab-size:4;tab-size:4;line-height:1.5;font-family:var(--default-font-family,ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji");font-feature-settings:var(--default-font-feature-settings,normal);font-variation-settings:var(--default-font-variation-settings,normal);-webkit-tap-highlight-color:transparent}body{line-height:inherit}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;-webkit-text-decoration:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:var(--default-mono-font-family,ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace);font-feature-settings:var(--default-mono-font-feature-settings,normal);font-variation-settings:var(--default-mono-font-variation-settings,normal);font-size:1em}small{font-size:80%}sub,sup{vertical-align:baseline;font-size:75%;line-height:0;position:relative}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}:-moz-focusring{outline:auto}progress{vertical-align:baseline}summary{display:list-item}ol,ul,menu{list-style:none}img,svg,video,canvas,audio,iframe,embed,object{vertical-align:middle;display:block}img,video{max-width:100%;height:auto}button,input,select,optgroup,textarea{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}::file-selector-button{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}:where(select:is([multiple],[size])) optgroup{font-weight:bolder}:where(select:is([multiple],[size])) optgroup option{padding-inline-start:20px}::file-selector-button{margin-inline-end:4px}::placeholder{opacity:1;color:color-mix(in oklab,currentColor 50%,transparent)}textarea{resize:vertical}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-date-and-time-value{min-height:1lh;text-align:inherit}::-webkit-datetime-edit{display:inline-flex}::-webkit-datetime-edit-fields-wrapper{padding:0}::-webkit-datetime-edit{padding-block:0}::-webkit-datetime-edit-year-field{padding-block:0}::-webkit-datetime-edit-month-field{padding-block:0}::-webkit-datetime-edit-day-field{padding-block:0}::-webkit-datetime-edit-hour-field{padding-block:0}::-webkit-datetime-edit-minute-field{padding-block:0}::-webkit-datetime-edit-second-field{padding-block:0}::-webkit-datetime-edit-millisecond-field{padding-block:0}::-webkit-datetime-edit-meridiem-field{padding-block:0}:-moz-ui-invalid{box-shadow:none}button,input:where([type=button],[type=reset],[type=submit]){-webkit-appearance:button;-moz-appearance:button;appearance:button}::file-selector-button{-webkit-appearance:button;-moz-appearance:button;appearance:button}::-webkit-inner-spin-button{height:auto}::-webkit-outer-spin-button{height:auto}[hidden]:where(:not([hidden=until-found])){display:none!important}}@layer components;@layer utilities{.absolute{position:absolute}.relative{position:relative}.static{position:static}.inset-0{inset:calc(var(--spacing)*0)}.-mt-\[4\.9rem\]{margin-top:-4.9rem}.-mb-px{margin-bottom:-1px}.mb-1{margin-bottom:calc(var(--spacing)*1)}.mb-2{margin-bottom:calc(var(--spacing)*2)}.mb-4{margin-bottom:calc(var(--spacing)*4)}.mb-6{margin-bottom:calc(var(--spacing)*6)}.-ml-8{margin-left:calc(var(--spacing)*-8)}.flex{display:flex}.hidden{display:none}.inline-block{display:inline-block}.inline-flex{display:inline-flex}.table{display:table}.aspect-\[335\/376\]{aspect-ratio:335/376}.h-1{height:calc(var(--spacing)*1)}.h-1\.5{height:calc(var(--spacing)*1.5)}.h-2{height:calc(var(--spacing)*2)}.h-2\.5{height:calc(var(--spacing)*2.5)}.h-3{height:calc(var(--spacing)*3)}.h-3\.5{height:calc(var(--spacing)*3.5)}.h-14{height:calc(var(--spacing)*14)}.h-14\.5{height:calc(var(--spacing)*14.5)}.min-h-screen{min-height:100vh}.w-1{width:calc(var(--spacing)*1)}.w-1\.5{width:calc(var(--spacing)*1.5)}.w-2{width:calc(var(--spacing)*2)}.w-2\.5{width:calc(var(--spacing)*2.5)}.w-3{width:calc(var(--spacing)*3)}.w-3\.5{width:calc(var(--spacing)*3.5)}.w-\[448px\]{width:448px}.w-full{width:100%}.max-w-\[335px\]{max-width:335px}.max-w-none{max-width:none}.flex-1{flex:1}.shrink-0{flex-shrink:0}.translate-y-0{--tw-translate-y:calc(var(--spacing)*0);translate:var(--tw-translate-x)var(--tw-translate-y)}.transform{transform:var(--tw-rotate-x)var(--tw-rotate-y)var(--tw-rotate-z)var(--tw-skew-x)var(--tw-skew-y)}.flex-col{flex-direction:column}.flex-col-reverse{flex-direction:column-reverse}.items-center{align-items:center}.justify-center{justify-content:center}.justify-end{justify-content:flex-end}.gap-3{gap:calc(var(--spacing)*3)}.gap-4{gap:calc(var(--spacing)*4)}:where(.space-x-1>:not(:last-child)){--tw-space-x-reverse:0;margin-inline-start:calc(calc(var(--spacing)*1)*var(--tw-space-x-reverse));margin-inline-end:calc(calc(var(--spacing)*1)*calc(1 - var(--tw-space-x-reverse)))}.overflow-hidden{overflow:hidden}.rounded-full{border-radius:3.40282e38px}.rounded-sm{border-radius:var(--radius-sm)}.rounded-t-lg{border-top-left-radius:var(--radius-lg);border-top-right-radius:var(--radius-lg)}.rounded-br-lg{border-bottom-right-radius:var(--radius-lg)}.rounded-bl-lg{border-bottom-left-radius:var(--radius-lg)}.border{border-style:var(--tw-border-style);border-width:1px}.border-\[\#19140035\]{border-color:#19140035}.border-\[\#e3e3e0\]{border-color:#e3e3e0}.border-black{border-color:var(--color-black)}.border-transparent{border-color:#0000}.bg-\[\#1b1b18\]{background-color:#1b1b18}.bg-\[\#FDFDFC\]{background-color:#fdfdfc}.bg-\[\#dbdbd7\]{background-color:#dbdbd7}.bg-\[\#fff2f2\]{background-color:#fff2f2}.bg-white{background-color:var(--color-white)}.p-6{padding:calc(var(--spacing)*6)}.px-5{padding-inline:calc(var(--spacing)*5)}.py-1{padding-block:calc(var(--spacing)*1)}.py-1\.5{padding-block:calc(var(--spacing)*1.5)}.py-2{padding-block:calc(var(--spacing)*2)}.pb-12{padding-bottom:calc(var(--spacing)*12)}.text-sm{font-size:var(--text-sm);line-height:var(--tw-leading,var(--text-sm--line-height))}.text-\[13px\]{font-size:13px}.leading-\[20px\]{--tw-leading:20px;line-height:20px}.leading-normal{--tw-leading:var(--leading-normal);line-height:var(--leading-normal)}.font-medium{--tw-font-weight:var(--font-weight-medium);font-weight:var(--font-weight-medium)}.text-\[\#1b1b18\]{color:#1b1b18}.text-\[\#706f6c\]{color:#706f6c}.text-\[\#F53003\],.text-\[\#f53003\]{color:#f53003}.text-white{color:var(--color-white)}.underline{text-decoration-line:underline}.underline-offset-4{text-underline-offset:4px}.opacity-100{opacity:1}.shadow-\[0px_0px_1px_0px_rgba\(0\,0\,0\,0\.03\)\,0px_1px_2px_0px_rgba\(0\,0\,0\,0\.06\)\]{--tw-shadow:0px 0px 1px 0px var(--tw-shadow-color,#00000008),0px 1px 2px 0px var(--tw-shadow-color,#0000000f);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.shadow-\[inset_0px_0px_0px_1px_rgba\(26\,26\,0\,0\.16\)\]{--tw-shadow:inset 0px 0px 0px 1px var(--tw-shadow-color,#1a1a0029);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.\!filter{filter:var(--tw-blur,)var(--tw-brightness,)var(--tw-contrast,)var(--tw-grayscale,)var(--tw-hue-rotate,)var(--tw-invert,)var(--tw-saturate,)var(--tw-sepia,)var(--tw-drop-shadow,)!important}.filter{filter:var(--tw-blur,)var(--tw-brightness,)var(--tw-contrast,)var(--tw-grayscale,)var(--tw-hue-rotate,)var(--tw-invert,)var(--tw-saturate,)var(--tw-sepia,)var(--tw-drop-shadow,)}.transition-all{transition-property:all;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-opacity{transition-property:opacity;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.delay-300{transition-delay:.3s}.duration-750{--tw-duration:.75s;transition-duration:.75s}.not-has-\[nav\]\:hidden:not(:has(:is(nav))){display:none}.before\:absolute:before{content:var(--tw-content);position:absolute}.before\:top-0:before{content:var(--tw-content);top:calc(var(--spacing)*0)}.before\:top-1\/2:before{content:var(--tw-content);top:50%}.before\:bottom-0:before{content:var(--tw-content);bottom:calc(var(--spacing)*0)}.before\:bottom-1\/2:before{content:var(--tw-content);bottom:50%}.before\:left-\[0\.4rem\]:before{content:var(--tw-content);left:.4rem}.before\:border-l:before{content:var(--tw-content);border-left-style:var(--tw-border-style);border-left-width:1px}.before\:border-\[\#e3e3e0\]:before{content:var(--tw-content);border-color:#e3e3e0}@media (hover:hover){.hover\:border-\[\#1915014a\]:hover{border-color:#1915014a}.hover\:border-\[\#19140035\]:hover{border-color:#19140035}.hover\:border-black:hover{border-color:var(--color-black)}.hover\:bg-black:hover{background-color:var(--color-black)}}@media (width>=64rem){.lg\:-mt-\[6\.6rem\]{margin-top:-6.6rem}.lg\:mb-0{margin-bottom:calc(var(--spacing)*0)}.lg\:mb-6{margin-bottom:calc(var(--spacing)*6)}.lg\:-ml-px{margin-left:-1px}.lg\:ml-0{margin-left:calc(var(--spacing)*0)}.lg\:block{display:block}.lg\:aspect-auto{aspect-ratio:auto}.lg\:w-\[438px\]{width:438px}.lg\:max-w-4xl{max-width:var(--container-4xl)}.lg\:grow{flex-grow:1}.lg\:flex-row{flex-direction:row}.lg\:justify-center{justify-content:center}.lg\:rounded-t-none{border-top-left-radius:0;border-top-right-radius:0}.lg\:rounded-tl-lg{border-top-left-radius:var(--radius-lg)}.lg\:rounded-r-lg{border-top-right-radius:var(--radius-lg);border-bottom-right-radius:var(--radius-lg)}.lg\:rounded-br-none{border-bottom-right-radius:0}.lg\:p-8{padding:calc(var(--spacing)*8)}.lg\:p-20{padding:calc(var(--spacing)*20)}}@media (prefers-color-scheme:dark){.dark\:block{display:block}.dark\:hidden{display:none}.dark\:border-\[\#3E3E3A\]{border-color:#3e3e3a}.dark\:border-\[\#eeeeec\]{border-color:#eeeeec}.dark\:bg-\[\#0a0a0a\]{background-color:#0a0a0a}.dark\:bg-\[\#1D0002\]{background-color:#1d0002}.dark\:bg-\[\#3E3E3A\]{background-color:#3e3e3a}.dark\:bg-\[\#161615\]{background-color:#161615}.dark\:bg-\[\#eeeeec\]{background-color:#eeeeec}.dark\:text-\[\#1C1C1A\]{color:#1c1c1a}.dark\:text-\[\#A1A09A\]{color:#a1a09a}.dark\:text-\[\#EDEDEC\]{color:#ededec}.dark\:text-\[\#F61500\]{color:#f61500}.dark\:text-\[\#FF4433\]{color:#f43}.dark\:shadow-\[inset_0px_0px_0px_1px_\#fffaed2d\]{--tw-shadow:inset 0px 0px 0px 1px var(--tw-shadow-color,#fffaed2d);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.dark\:before\:border-\[\#3E3E3A\]:before{content:var(--tw-content);border-color:#3e3e3a}@media (hover:hover){.dark\:hover\:border-\[\#3E3E3A\]:hover{border-color:#3e3e3a}.dark\:hover\:border-\[\#62605b\]:hover{border-color:#62605b}.dark\:hover\:border-white:hover{border-color:var(--color-white)}.dark\:hover\:bg-white:hover{background-color:var(--color-white)}}}@starting-style{.starting\:translate-y-4{--tw-translate-y:calc(var(--spacing)*4);translate:var(--tw-translate-x)var(--tw-translate-y)}}@starting-style{.starting\:translate-y-6{--tw-translate-y:calc(var(--spacing)*6);translate:var(--tw-translate-x)var(--tw-translate-y)}}@starting-style{.starting\:opacity-0{opacity:0}}}@keyframes spin{to{transform:rotate(360deg)}}@keyframes ping{75%,to{opacity:0;transform:scale(2)}}@keyframes pulse{50%{opacity:.5}}@keyframes bounce{0%,to{animation-timing-function:cubic-bezier(.8,0,1,1);transform:translateY(-25%)}50%{animation-timing-function:cubic-bezier(0,0,.2,1);transform:none}}@property --tw-translate-x{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-y{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-z{syntax:"*";inherits:false;initial-value:0}@property --tw-rotate-x{syntax:"*";inherits:false;initial-value:rotateX(0)}@property --tw-rotate-y{syntax:"*";inherits:false;initial-value:rotateY(0)}@property --tw-rotate-z{syntax:"*";inherits:false;initial-value:rotateZ(0)}@property --tw-skew-x{syntax:"*";inherits:false;initial-value:skewX(0)}@property --tw-skew-y{syntax:"*";inherits:false;initial-value:skewY(0)}@property --tw-space-x-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-border-style{syntax:"*";inherits:false;initial-value:solid}@property --tw-leading{syntax:"*";inherits:false}@property --tw-font-weight{syntax:"*";inherits:false}@property --tw-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-shadow-color{syntax:"*";inherits:false}@property --tw-inset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-shadow-color{syntax:"*";inherits:false}@property --tw-ring-color{syntax:"*";inherits:false}@property --tw-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-ring-color{syntax:"*";inherits:false}@property --tw-inset-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-ring-inset{syntax:"*";inherits:false}@property --tw-ring-offset-width{syntax:"<length>";inherits:false;initial-value:0}@property --tw-ring-offset-color{syntax:"*";inherits:false;initial-value:#fff}@property --tw-ring-offset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-blur{syntax:"*";inherits:false}@property --tw-brightness{syntax:"*";inherits:false}@property --tw-contrast{syntax:"*";inherits:false}@property --tw-grayscale{syntax:"*";inherits:false}@property --tw-hue-rotate{syntax:"*";inherits:false}@property --tw-invert{syntax:"*";inherits:false}@property --tw-opacity{syntax:"*";inherits:false}@property --tw-saturate{syntax:"*";inherits:false}@property --tw-sepia{syntax:"*";inherits:false}@property --tw-drop-shadow{syntax:"*";inherits:false}@property --tw-duration{syntax:"*";inherits:false}@property --tw-content{syntax:"*";inherits:false;initial-value:""}
+            </style>
+        @endif
+    </head>
+    <body class="bg-[#FDFDFC] dark:bg-[#0a0a0a] text-[#1b1b18] flex p-6 lg:p-8 items-center lg:justify-center min-h-screen flex-col">
+        <header class="w-full lg:max-w-4xl max-w-[335px] text-sm mb-6 not-has-[nav]:hidden">
+            @if (Route::has('login'))
+                <nav class="flex items-center justify-end gap-4">
+                    @auth
+                        <a
+                            href="{{ url('/dashboard') }}"
+                            class="inline-block px-5 py-1.5 dark:text-[#EDEDEC] border-[#19140035] hover:border-[#1915014a] border text-[#1b1b18] dark:border-[#3E3E3A] dark:hover:border-[#62605b] rounded-sm text-sm leading-normal"
+                        >
+                            Dashboard
+                        </a>
+                    @else
+                        <a
+                            href="{{ route('login') }}"
+                            class="inline-block px-5 py-1.5 dark:text-[#EDEDEC] text-[#1b1b18] border border-transparent hover:border-[#19140035] dark:hover:border-[#3E3E3A] rounded-sm text-sm leading-normal"
+                        >
+                            Log in
+                        </a>
+
+                        @if (Route::has('register'))
+                            <a
+                                href="{{ route('register') }}"
+                                class="inline-block px-5 py-1.5 dark:text-[#EDEDEC] border-[#19140035] hover:border-[#1915014a] border text-[#1b1b18] dark:border-[#3E3E3A] dark:hover:border-[#62605b] rounded-sm text-sm leading-normal">
+                                Register
+                            </a>
+                        @endif
+                    @endauth
+                </nav>
+            @endif
+        </header>
+        <div class="flex items-center justify-center w-full transition-opacity opacity-100 duration-750 lg:grow starting:opacity-0">
+            <main class="flex max-w-[335px] w-full flex-col-reverse lg:max-w-4xl lg:flex-row">
+                <div class="text-[13px] leading-[20px] flex-1 p-6 pb-12 lg:p-20 bg-white dark:bg-[#161615] dark:text-[#EDEDEC] shadow-[inset_0px_0px_0px_1px_rgba(26,26,0,0.16)] dark:shadow-[inset_0px_0px_0px_1px_#fffaed2d] rounded-bl-lg rounded-br-lg lg:rounded-tl-lg lg:rounded-br-none">
+                    <h1 class="mb-1 font-medium">Let's get started</h1>
+                    <p class="mb-2 text-[#706f6c] dark:text-[#A1A09A]">Laravel has an incredibly rich ecosystem. <br>We suggest starting with the following.</p>
+                    <ul class="flex flex-col mb-4 lg:mb-6">
+                        <li class="flex items-center gap-4 py-2 relative before:border-l before:border-[#e3e3e0] dark:before:border-[#3E3E3A] before:top-1/2 before:bottom-0 before:left-[0.4rem] before:absolute">
+                            <span class="relative py-1 bg-white dark:bg-[#161615]">
+                                <span class="flex items-center justify-center rounded-full bg-[#FDFDFC] dark:bg-[#161615] shadow-[0px_0px_1px_0px_rgba(0,0,0,0.03),0px_1px_2px_0px_rgba(0,0,0,0.06)] w-3.5 h-3.5 border dark:border-[#3E3E3A] border-[#e3e3e0]">
+                                    <span class="rounded-full bg-[#dbdbd7] dark:bg-[#3E3E3A] w-1.5 h-1.5"></span>
+                                </span>
+                            </span>
+                            <span>
+                                Read the
+                                <a href="https://laravel.com/docs" target="_blank" class="inline-flex items-center space-x-1 font-medium underline underline-offset-4 text-[#f53003] dark:text-[#FF4433] ml-1">
+                                    <span>Documentation</span>
+                                    <svg
+                                        width="10"
+                                        height="11"
+                                        viewBox="0 0 10 11"
+                                        fill="none"
+                                        xmlns="http://www.w3.org/2000/svg"
+                                        class="w-2.5 h-2.5"
+                                    >
+                                        <path
+                                            d="M7.70833 6.95834V2.79167H3.54167M2.5 8L7.5 3.00001"
+                                            stroke="currentColor"
+                                            stroke-linecap="square"
+                                        />
+                                    </svg>
+                                </a>
+                            </span>
+                        </li>
+                        <li class="flex items-center gap-4 py-2 relative before:border-l before:border-[#e3e3e0] dark:before:border-[#3E3E3A] before:bottom-1/2 before:top-0 before:left-[0.4rem] before:absolute">
+                            <span class="relative py-1 bg-white dark:bg-[#161615]">
+                                <span class="flex items-center justify-center rounded-full bg-[#FDFDFC] dark:bg-[#161615] shadow-[0px_0px_1px_0px_rgba(0,0,0,0.03),0px_1px_2px_0px_rgba(0,0,0,0.06)] w-3.5 h-3.5 border dark:border-[#3E3E3A] border-[#e3e3e0]">
+                                    <span class="rounded-full bg-[#dbdbd7] dark:bg-[#3E3E3A] w-1.5 h-1.5"></span>
+                                </span>
+                            </span>
+                            <span>
+                                Watch video tutorials at
+                                <a href="https://laracasts.com" target="_blank" class="inline-flex items-center space-x-1 font-medium underline underline-offset-4 text-[#f53003] dark:text-[#FF4433] ml-1">
+                                    <span>Laracasts</span>
+                                    <svg
+                                        width="10"
+                                        height="11"
+                                        viewBox="0 0 10 11"
+                                        fill="none"
+                                        xmlns="http://www.w3.org/2000/svg"
+                                        class="w-2.5 h-2.5"
+                                    >
+                                        <path
+                                            d="M7.70833 6.95834V2.79167H3.54167M2.5 8L7.5 3.00001"
+                                            stroke="currentColor"
+                                            stroke-linecap="square"
+                                        />
+                                    </svg>
+                                </a>
+                            </span>
+                        </li>
+                    </ul>
+                    <ul class="flex gap-3 text-sm leading-normal">
+                        <li>
+                            <a href="https://cloud.laravel.com" target="_blank" class="inline-block dark:bg-[#eeeeec] dark:border-[#eeeeec] dark:text-[#1C1C1A] dark:hover:bg-white dark:hover:border-white hover:bg-black hover:border-black px-5 py-1.5 bg-[#1b1b18] rounded-sm border border-black text-white text-sm leading-normal">
+                                Deploy now
+                            </a>
+                        </li>
+                    </ul>
+                </div>
+                <div class="bg-[#fff2f2] dark:bg-[#1D0002] relative lg:-ml-px -mb-px lg:mb-0 rounded-t-lg lg:rounded-t-none lg:rounded-r-lg aspect-[335/376] lg:aspect-auto w-full lg:w-[438px] shrink-0 overflow-hidden">
+                    {{-- Laravel Logo --}}
+                    <svg class="w-full text-[#F53003] dark:text-[#F61500] transition-all translate-y-0 opacity-100 max-w-none duration-750 starting:opacity-0 starting:translate-y-6" viewBox="0 0 438 104" fill="none" xmlns="http://www.w3.org/2000/svg">
+                        <path d="M17.2036 -3H0V102.197H49.5189V86.7187H17.2036V-3Z" fill="currentColor" />
+                        <path d="M110.256 41.6337C108.061 38.1275 104.945 35.3731 100.905 33.3681C96.8667 31.3647 92.8016 30.3618 88.7131 30.3618C83.4247 30.3618 78.5885 31.3389 74.201 33.2923C69.8111 35.2456 66.0474 37.928 62.9059 41.3333C59.7643 44.7401 57.3198 48.6726 55.5754 53.1293C53.8287 57.589 52.9572 62.274 52.9572 67.1813C52.9572 72.1925 53.8287 76.8995 55.5754 81.3069C57.3191 85.7173 59.7636 89.6241 62.9059 93.0293C66.0474 96.4361 69.8119 99.1155 74.201 101.069C78.5885 103.022 83.4247 103.999 88.7131 103.999C92.8016 103.999 96.8667 102.997 100.905 100.994C104.945 98.9911 108.061 96.2359 110.256 92.7282V102.195H126.563V32.1642H110.256V41.6337ZM108.76 75.7472C107.762 78.4531 106.366 80.8078 104.572 82.8112C102.776 84.8161 100.606 86.4183 98.0637 87.6206C95.5202 88.823 92.7004 89.4238 89.6103 89.4238C86.5178 89.4238 83.7252 88.823 81.2324 87.6206C78.7388 86.4183 76.5949 84.8161 74.7998 82.8112C73.004 80.8078 71.6319 78.4531 70.6856 75.7472C69.7356 73.0421 69.2644 70.1868 69.2644 67.1821C69.2644 64.1758 69.7356 61.3205 70.6856 58.6154C71.6319 55.9102 73.004 53.5571 74.7998 51.5522C76.5949 49.5495 78.738 47.9451 81.2324 46.7427C83.7252 45.5404 86.5178 44.9396 89.6103 44.9396C92.7012 44.9396 95.5202 45.5404 98.0637 46.7427C100.606 47.9451 102.776 49.5487 104.572 51.5522C106.367 53.5571 107.762 55.9102 108.76 58.6154C109.756 61.3205 110.256 64.1758 110.256 67.1821C110.256 70.1868 109.756 73.0421 108.76 75.7472Z" fill="currentColor" />
+                        <path d="M242.805 41.6337C240.611 38.1275 237.494 35.3731 233.455 33.3681C229.416 31.3647 225.351 30.3618 221.262 30.3618C215.974 30.3618 211.138 31.3389 206.75 33.2923C202.36 35.2456 198.597 37.928 195.455 41.3333C192.314 44.7401 189.869 48.6726 188.125 53.1293C186.378 57.589 185.507 62.274 185.507 67.1813C185.507 72.1925 186.378 76.8995 188.125 81.3069C189.868 85.7173 192.313 89.6241 195.455 93.0293C198.597 96.4361 202.361 99.1155 206.75 101.069C211.138 103.022 215.974 103.999 221.262 103.999C225.351 103.999 229.416 102.997 233.455 100.994C237.494 98.9911 240.611 96.2359 242.805 92.7282V102.195H259.112V32.1642H242.805V41.6337ZM241.31 75.7472C240.312 78.4531 238.916 80.8078 237.122 82.8112C235.326 84.8161 233.156 86.4183 230.614 87.6206C228.07 88.823 225.251 89.4238 222.16 89.4238C219.068 89.4238 216.275 88.823 213.782 87.6206C211.289 86.4183 209.145 84.8161 207.35 82.8112C205.554 80.8078 204.182 78.4531 203.236 75.7472C202.286 73.0421 201.814 70.1868 201.814 67.1821C201.814 64.1758 202.286 61.3205 203.236 58.6154C204.182 55.9102 205.554 53.5571 207.35 51.5522C209.145 49.5495 211.288 47.9451 213.782 46.7427C216.275 45.5404 219.068 44.9396 222.16 44.9396C225.251 44.9396 228.07 45.5404 230.614 46.7427C233.156 47.9451 235.326 49.5487 237.122 51.5522C238.917 53.5571 240.312 55.9102 241.31 58.6154C242.306 61.3205 242.806 64.1758 242.806 67.1821C242.805 70.1868 242.305 73.0421 241.31 75.7472Z" fill="currentColor" />
+                        <path d="M438 -3H421.694V102.197H438V-3Z" fill="currentColor" />
+                        <path d="M139.43 102.197H155.735V48.2834H183.712V32.1665H139.43V102.197Z" fill="currentColor" />
+                        <path d="M324.49 32.1665L303.995 85.794L283.498 32.1665H266.983L293.748 102.197H314.242L341.006 32.1665H324.49Z" fill="currentColor" />
+                        <path d="M376.571 30.3656C356.603 30.3656 340.797 46.8497 340.797 67.1828C340.797 89.6597 356.094 104 378.661 104C391.29 104 399.354 99.1488 409.206 88.5848L398.189 80.0226C398.183 80.031 389.874 90.9895 377.468 90.9895C363.048 90.9895 356.977 79.3111 356.977 73.269H411.075C413.917 50.1328 398.775 30.3656 376.571 30.3656ZM357.02 61.0967C357.145 59.7487 359.023 43.3761 376.442 43.3761C393.861 43.3761 395.978 59.7464 396.099 61.0967H357.02Z" fill="currentColor" />
+                    </svg>
+
+                    {{-- Light Mode 12 SVG --}}
+                    <svg class="w-[448px] max-w-none relative -mt-[4.9rem] -ml-8 lg:ml-0 lg:-mt-[6.6rem] dark:hidden" viewBox="0 0 440 376" fill="none" xmlns="http://www.w3.org/2000/svg">
+                        <g class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4">
+                            <path d="M188.263 355.73L188.595 355.73C195.441 348.845 205.766 339.761 219.569 328.477C232.93 317.193 242.978 308.205 249.714 301.511C256.34 294.626 260.867 287.358 263.296 279.708C265.725 272.058 264.565 264.121 259.816 255.896C254.516 246.716 247.062 239.352 237.454 233.805C227.957 228.067 217.908 225.198 207.307 225.198C196.927 225.197 190.136 227.97 186.934 233.516C183.621 238.872 184.726 246.331 190.247 255.894L125.647 255.891C116.371 239.825 112.395 225.481 113.72 212.858C115.265 200.235 121.559 190.481 132.602 183.596C143.754 176.52 158.607 172.982 177.159 172.983C196.594 172.984 215.863 176.523 234.968 183.6C253.961 190.486 271.299 200.241 286.98 212.864C302.661 225.488 315.14 239.833 324.416 255.899C333.03 270.817 336.841 283.918 335.847 295.203C335.075 306.487 331.376 316.336 324.75 324.751C318.346 333.167 308.408 343.494 294.936 355.734L377.094 355.737L405.917 405.656L217.087 405.649L188.263 355.73Z" fill="black" />
+                            <path d="M9.11884 226.339L-13.7396 226.338L-42.7286 176.132L43.0733 176.135L175.595 405.649L112.651 405.647L9.11884 226.339Z" fill="black" />
+                            <path d="M188.263 355.73L188.595 355.73C195.441 348.845 205.766 339.761 219.569 328.477C232.93 317.193 242.978 308.205 249.714 301.511C256.34 294.626 260.867 287.358 263.296 279.708C265.725 272.058 264.565 264.121 259.816 255.896C254.516 246.716 247.062 239.352 237.454 233.805C227.957 228.067 217.908 225.198 207.307 225.198C196.927 225.197 190.136 227.97 186.934 233.516C183.621 238.872 184.726 246.331 190.247 255.894L125.647 255.891C116.371 239.825 112.395 225.481 113.72 212.858C115.265 200.235 121.559 190.481 132.602 183.596C143.754 176.52 158.607 172.982 177.159 172.983C196.594 172.984 215.863 176.523 234.968 183.6C253.961 190.486 271.299 200.241 286.98 212.864C302.661 225.488 315.14 239.833 324.416 255.899C333.03 270.817 336.841 283.918 335.847 295.203C335.075 306.487 331.376 316.336 324.75 324.751C318.346 333.167 308.408 343.494 294.936 355.734L377.094 355.737L405.917 405.656L217.087 405.649L188.263 355.73Z" stroke="#1B1B18" stroke-width="1" />
+                            <path d="M9.11884 226.339L-13.7396 226.338L-42.7286 176.132L43.0733 176.135L175.595 405.649L112.651 405.647L9.11884 226.339Z" stroke="#1B1B18" stroke-width="1" />
+                            <path d="M204.592 327.449L204.923 327.449C211.769 320.564 222.094 311.479 235.897 300.196C249.258 288.912 259.306 279.923 266.042 273.23C272.668 266.345 277.195 259.077 279.624 251.427C282.053 243.777 280.893 235.839 276.145 227.615C270.844 218.435 263.39 211.071 253.782 205.524C244.285 199.786 234.236 196.917 223.635 196.916C213.255 196.916 206.464 199.689 203.262 205.235C199.949 210.59 201.054 218.049 206.575 227.612L141.975 227.61C132.699 211.544 128.723 197.2 130.048 184.577C131.593 171.954 137.887 162.2 148.93 155.315C160.083 148.239 174.935 144.701 193.487 144.702C212.922 144.703 232.192 148.242 251.296 155.319C270.289 162.205 287.627 171.96 303.308 184.583C318.989 197.207 331.468 211.552 340.745 227.618C349.358 242.536 353.169 255.637 352.175 266.921C351.403 278.205 347.704 288.055 341.078 296.47C334.674 304.885 324.736 315.213 311.264 327.453L393.422 327.456L422.246 377.375L233.415 377.368L204.592 327.449Z" fill="#F8B803" />
+                            <path d="M25.447 198.058L2.58852 198.057L-26.4005 147.851L59.4015 147.854L191.923 377.368L128.979 377.365L25.447 198.058Z" fill="#F8B803" />
+                            <path d="M204.592 327.449L204.923 327.449C211.769 320.564 222.094 311.479 235.897 300.196C249.258 288.912 259.306 279.923 266.042 273.23C272.668 266.345 277.195 259.077 279.624 251.427C282.053 243.777 280.893 235.839 276.145 227.615C270.844 218.435 263.39 211.071 253.782 205.524C244.285 199.786 234.236 196.917 223.635 196.916C213.255 196.916 206.464 199.689 203.262 205.235C199.949 210.59 201.054 218.049 206.575 227.612L141.975 227.61C132.699 211.544 128.723 197.2 130.048 184.577C131.593 171.954 137.887 162.2 148.93 155.315C160.083 148.239 174.935 144.701 193.487 144.702C212.922 144.703 232.192 148.242 251.296 155.319C270.289 162.205 287.627 171.96 303.308 184.583C318.989 197.207 331.468 211.552 340.745 227.618C349.358 242.536 353.169 255.637 352.175 266.921C351.403 278.205 347.704 288.055 341.078 296.47C334.674 304.885 324.736 315.213 311.264 327.453L393.422 327.456L422.246 377.375L233.415 377.368L204.592 327.449Z" stroke="#1B1B18" stroke-width="1" />
+                            <path d="M25.447 198.058L2.58852 198.057L-26.4005 147.851L59.4015 147.854L191.923 377.368L128.979 377.365L25.447 198.058Z" stroke="#1B1B18" stroke-width="1" />
+                        </g>
+                        <g style="mix-blend-mode: hard-light" class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4">
+                            <path d="M217.342 305.363L217.673 305.363C224.519 298.478 234.844 289.393 248.647 278.11C262.008 266.826 272.056 257.837 278.792 251.144C285.418 244.259 289.945 236.991 292.374 229.341C294.803 221.691 293.643 213.753 288.895 205.529C283.594 196.349 276.14 188.985 266.532 183.438C257.035 177.7 246.986 174.831 236.385 174.83C226.005 174.83 219.214 177.603 216.012 183.149C212.699 188.504 213.804 195.963 219.325 205.527L154.725 205.524C145.449 189.458 141.473 175.114 142.798 162.491C144.343 149.868 150.637 140.114 161.68 133.229C172.833 126.153 187.685 122.615 206.237 122.616C225.672 122.617 244.942 126.156 264.046 133.233C283.039 140.119 300.377 149.874 316.058 162.497C331.739 175.121 344.218 189.466 353.495 205.532C362.108 220.45 365.919 233.551 364.925 244.835C364.153 256.12 360.454 265.969 353.828 274.384C347.424 282.799 337.486 293.127 324.014 305.367L406.172 305.37L434.996 355.289L246.165 355.282L217.342 305.363Z" fill="#F0ACB8" />
+                            <path d="M38.197 175.972L15.3385 175.971L-13.6505 125.765L72.1515 125.768L204.673 355.282L141.729 355.279L38.197 175.972Z" fill="#F0ACB8" />
+                            <path d="M217.342 305.363L217.673 305.363C224.519 298.478 234.844 289.393 248.647 278.11C262.008 266.826 272.056 257.837 278.792 251.144C285.418 244.259 289.945 236.991 292.374 229.341C294.803 221.691 293.643 213.753 288.895 205.529C283.594 196.349 276.14 188.985 266.532 183.438C257.035 177.7 246.986 174.831 236.385 174.83C226.005 174.83 219.214 177.603 216.012 183.149C212.699 188.504 213.804 195.963 219.325 205.527L154.725 205.524C145.449 189.458 141.473 175.114 142.798 162.491C144.343 149.868 150.637 140.114 161.68 133.229C172.833 126.153 187.685 122.615 206.237 122.616C225.672 122.617 244.942 126.156 264.046 133.233C283.039 140.119 300.377 149.874 316.058 162.497C331.739 175.121 344.218 189.466 353.495 205.532C362.108 220.45 365.919 233.551 364.925 244.835C364.153 256.12 360.454 265.969 353.828 274.384C347.424 282.799 337.486 293.127 324.014 305.367L406.172 305.37L434.996 355.289L246.165 355.282L217.342 305.363Z" stroke="#1B1B18" stroke-width="1" />
+                            <path d="M38.197 175.972L15.3385 175.971L-13.6505 125.765L72.1515 125.768L204.673 355.282L141.729 355.279L38.197 175.972Z" stroke="#1B1B18" stroke-width="1" />
+                        </g>
+                        <g style="mix-blend-mode: plus-darker" class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4">
+                            <path d="M230.951 281.792L231.282 281.793C238.128 274.907 248.453 265.823 262.256 254.539C275.617 243.256 285.666 234.267 292.402 227.573C299.027 220.688 303.554 213.421 305.983 205.771C308.412 198.12 307.253 190.183 302.504 181.959C297.203 172.778 289.749 165.415 280.142 159.868C270.645 154.13 260.596 151.26 249.995 151.26C239.615 151.26 232.823 154.033 229.621 159.579C226.309 164.934 227.413 172.393 232.935 181.956L168.335 181.954C159.058 165.888 155.082 151.543 156.407 138.92C157.953 126.298 164.247 116.544 175.289 109.659C186.442 102.583 201.294 99.045 219.846 99.0457C239.281 99.0464 258.551 102.585 277.655 109.663C296.649 116.549 313.986 126.303 329.667 138.927C345.349 151.551 357.827 165.895 367.104 181.961C375.718 196.88 379.528 209.981 378.535 221.265C377.762 232.549 374.063 242.399 367.438 250.814C361.033 259.229 351.095 269.557 337.624 281.796L419.782 281.8L448.605 331.719L259.774 331.712L230.951 281.792Z" fill="#F3BEC7" />
+                            <path d="M51.8063 152.402L28.9479 152.401L-0.0411453 102.195L85.7608 102.198L218.282 331.711L155.339 331.709L51.8063 152.402Z" fill="#F3BEC7" />
+                            <path d="M230.951 281.792L231.282 281.793C238.128 274.907 248.453 265.823 262.256 254.539C275.617 243.256 285.666 234.267 292.402 227.573C299.027 220.688 303.554 213.421 305.983 205.771C308.412 198.12 307.253 190.183 302.504 181.959C297.203 172.778 289.749 165.415 280.142 159.868C270.645 154.13 260.596 151.26 249.995 151.26C239.615 151.26 232.823 154.033 229.621 159.579C226.309 164.934 227.413 172.393 232.935 181.956L168.335 181.954C159.058 165.888 155.082 151.543 156.407 138.92C157.953 126.298 164.247 116.544 175.289 109.659C186.442 102.583 201.294 99.045 219.846 99.0457C239.281 99.0464 258.551 102.585 277.655 109.663C296.649 116.549 313.986 126.303 329.667 138.927C345.349 151.551 357.827 165.895 367.104 181.961C375.718 196.88 379.528 209.981 378.535 221.265C377.762 232.549 374.063 242.399 367.438 250.814C361.033 259.229 351.095 269.557 337.624 281.796L419.782 281.8L448.605 331.719L259.774 331.712L230.951 281.792Z" stroke="#1B1B18" stroke-width="1" />
+                            <path d="M51.8063 152.402L28.9479 152.401L-0.0411453 102.195L85.7608 102.198L218.282 331.711L155.339 331.709L51.8063 152.402Z" stroke="#1B1B18" stroke-width="1" />
+                        </g>
+                        <g class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4">
+                            <path d="M188.467 355.363L188.798 355.363C195.644 348.478 205.969 339.393 219.772 328.11C233.133 316.826 243.181 307.837 249.917 301.144C253.696 297.217 256.792 293.166 259.205 288.991C261.024 285.845 262.455 282.628 263.499 279.341C265.928 271.691 264.768 263.753 260.02 255.529C254.719 246.349 247.265 238.985 237.657 233.438C228.16 227.7 218.111 224.831 207.51 224.83C197.13 224.83 190.339 227.603 187.137 233.149C183.824 238.504 184.929 245.963 190.45 255.527L125.851 255.524C116.574 239.458 112.598 225.114 113.923 212.491C114.615 206.836 116.261 201.756 118.859 197.253C122.061 191.704 126.709 187.03 132.805 183.229C143.958 176.153 158.81 172.615 177.362 172.616C196.797 172.617 216.067 176.156 235.171 183.233C254.164 190.119 271.502 199.874 287.183 212.497C302.864 225.121 315.343 239.466 324.62 255.532C333.233 270.45 337.044 283.551 336.05 294.835C335.46 303.459 333.16 311.245 329.151 318.194C327.915 320.337 326.515 322.4 324.953 324.384C318.549 332.799 308.611 343.127 295.139 355.367L377.297 355.37L406.121 405.289L217.29 405.282L188.467 355.363Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M9.32197 225.972L-13.5365 225.971L-42.5255 175.765L43.2765 175.768L175.798 405.282L112.854 405.279L9.32197 225.972Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M345.247 111.915C329.566 99.2919 312.229 89.5371 293.235 82.6512L235.167 183.228C254.161 190.114 271.498 199.869 287.179 212.492L345.247 111.915Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M382.686 154.964C373.41 138.898 360.931 124.553 345.25 111.93L287.182 212.506C302.863 225.13 315.342 239.475 324.618 255.541L382.686 154.964Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M293.243 82.6472C274.139 75.57 254.869 72.031 235.434 72.0303L177.366 172.607C196.801 172.608 216.071 176.147 235.175 183.224L293.243 82.6472Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M394.118 194.257C395.112 182.973 391.301 169.872 382.688 154.953L324.619 255.53C333.233 270.448 337.044 283.55 336.05 294.834L394.118 194.257Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M235.432 72.0311C216.88 72.0304 202.027 75.5681 190.875 82.6442L132.806 183.221C143.959 176.145 158.812 172.607 177.363 172.608L235.432 72.0311Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M265.59 124.25C276.191 124.251 286.24 127.12 295.737 132.858L237.669 233.435C228.172 227.697 218.123 224.828 207.522 224.827L265.59 124.25Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M295.719 132.859C305.326 138.406 312.78 145.77 318.081 154.95L260.013 255.527C254.712 246.347 247.258 238.983 237.651 233.436L295.719 132.859Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M387.218 217.608C391.227 210.66 393.527 202.874 394.117 194.25L336.049 294.827C335.459 303.451 333.159 311.237 329.15 318.185L387.218 217.608Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M245.211 132.577C248.413 127.03 255.204 124.257 265.584 124.258L207.516 224.835C197.136 224.834 190.345 227.607 187.143 233.154L245.211 132.577Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M318.094 154.945C322.842 163.17 324.002 171.107 321.573 178.757L263.505 279.334C265.934 271.684 264.774 263.746 260.026 255.522L318.094 154.945Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M176.925 96.6737C180.127 91.1249 184.776 86.4503 190.871 82.6499L132.803 183.227C126.708 187.027 122.059 191.702 118.857 197.25L176.925 96.6737Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M387.226 217.606C385.989 219.749 384.59 221.813 383.028 223.797L324.96 324.373C326.522 322.39 327.921 320.326 329.157 318.183L387.226 217.606Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M317.269 188.408C319.087 185.262 320.519 182.045 321.562 178.758L263.494 279.335C262.451 282.622 261.019 285.839 259.201 288.985L317.269 188.408Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M245.208 132.573C241.895 137.928 243 145.387 248.522 154.95L190.454 255.527C184.932 245.964 183.827 238.505 187.14 233.15L245.208 132.573Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M176.93 96.6719C174.331 101.175 172.686 106.255 171.993 111.91L113.925 212.487C114.618 206.831 116.263 201.752 118.862 197.249L176.93 96.6719Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M317.266 188.413C314.853 192.589 311.757 196.64 307.978 200.566L249.91 301.143C253.689 297.216 256.785 293.166 259.198 288.99L317.266 188.413Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M464.198 304.708L435.375 254.789L377.307 355.366L406.13 405.285L464.198 304.708Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M353.209 254.787C366.68 242.548 376.618 232.22 383.023 223.805L324.955 324.382C318.55 332.797 308.612 343.124 295.141 355.364L353.209 254.787Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M435.37 254.787L353.212 254.784L295.144 355.361L377.302 355.364L435.37 254.787Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M183.921 154.947L248.521 154.95L190.453 255.527L125.853 255.524L183.921 154.947Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M171.992 111.914C170.668 124.537 174.643 138.881 183.92 154.947L125.852 255.524C116.575 239.458 112.599 225.114 113.924 212.491L171.992 111.914Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M307.987 200.562C301.251 207.256 291.203 216.244 277.842 227.528L219.774 328.105C233.135 316.821 243.183 307.832 249.919 301.139L307.987 200.562Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M15.5469 75.1797L44.5359 125.386L-13.5321 225.963L-42.5212 175.756L15.5469 75.1797Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M277.836 227.536C264.033 238.82 253.708 247.904 246.862 254.789L188.794 355.366C195.64 348.481 205.965 339.397 219.768 328.113L277.836 227.536Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M275.358 304.706L464.189 304.713L406.12 405.29L217.29 405.283L275.358 304.706Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M44.5279 125.39L67.3864 125.39L9.31834 225.967L-13.5401 225.966L44.5279 125.39Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M101.341 75.1911L233.863 304.705L175.795 405.282L43.2733 175.768L101.341 75.1911ZM15.5431 75.19L-42.525 175.767L43.277 175.77L101.345 75.1932L15.5431 75.19Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M246.866 254.784L246.534 254.784L188.466 355.361L188.798 355.361L246.866 254.784Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M246.539 254.781L275.362 304.701L217.294 405.277L188.471 355.358L246.539 254.781Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M67.3906 125.391L170.923 304.698L112.855 405.275L9.32257 225.967L67.3906 125.391Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                            <path d="M170.921 304.699L233.865 304.701L175.797 405.278L112.853 405.276L170.921 304.699Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="bevel" />
+                        </g>
+                        <g style="mix-blend-mode: hard-light" class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4">
+                            <path d="M246.544 254.79L246.875 254.79C253.722 247.905 264.046 238.82 277.849 227.537C291.21 216.253 301.259 207.264 307.995 200.57C314.62 193.685 319.147 186.418 321.577 178.768C324.006 171.117 322.846 163.18 318.097 154.956C312.796 145.775 305.342 138.412 295.735 132.865C286.238 127.127 276.189 124.258 265.588 124.257C255.208 124.257 248.416 127.03 245.214 132.576C241.902 137.931 243.006 145.39 248.528 154.953L183.928 154.951C174.652 138.885 170.676 124.541 172 111.918C173.546 99.2946 179.84 89.5408 190.882 82.6559C202.035 75.5798 216.887 72.0421 235.439 72.0428C254.874 72.0435 274.144 75.5825 293.248 82.6598C312.242 89.5457 329.579 99.3005 345.261 111.924C360.942 124.548 373.421 138.892 382.697 154.958C391.311 169.877 395.121 182.978 394.128 194.262C393.355 205.546 389.656 215.396 383.031 223.811C376.627 232.226 366.688 242.554 353.217 254.794L435.375 254.797L464.198 304.716L275.367 304.709L246.544 254.79Z" fill="#F0ACB8" />
+                            <path d="M246.544 254.79L246.875 254.79C253.722 247.905 264.046 238.82 277.849 227.537C291.21 216.253 301.259 207.264 307.995 200.57C314.62 193.685 319.147 186.418 321.577 178.768C324.006 171.117 322.846 163.18 318.097 154.956C312.796 145.775 305.342 138.412 295.735 132.865C286.238 127.127 276.189 124.258 265.588 124.257C255.208 124.257 248.416 127.03 245.214 132.576C241.902 137.931 243.006 145.39 248.528 154.953L183.928 154.951C174.652 138.885 170.676 124.541 172 111.918C173.546 99.2946 179.84 89.5408 190.882 82.6559C202.035 75.5798 216.887 72.0421 235.439 72.0428C254.874 72.0435 274.144 75.5825 293.248 82.6598C312.242 89.5457 329.579 99.3005 345.261 111.924C360.942 124.548 373.421 138.892 382.697 154.958C391.311 169.877 395.121 182.978 394.128 194.262C393.355 205.546 389.656 215.396 383.031 223.811C376.627 232.226 366.688 242.554 353.217 254.794L435.375 254.797L464.198 304.716L275.367 304.709L246.544 254.79Z" stroke="#1B1B18" stroke-width="1" stroke-linejoin="round" />
+                        </g>
+                        <g style="mix-blend-mode: hard-light" class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4">
+                            <path d="M67.41 125.402L44.5515 125.401L15.5625 75.1953L101.364 75.1985L233.886 304.712L170.942 304.71L67.41 125.402Z" fill="#F0ACB8" />
+                            <path d="M67.41 125.402L44.5515 125.401L15.5625 75.1953L101.364 75.1985L233.886 304.712L170.942 304.71L67.41 125.402Z" stroke="#1B1B18" stroke-width="1" />
+                        </g>
+                    </svg>
+
+                    {{-- Dark Mode 12 SVG --}}
+                    <svg class="w-[448px] max-w-none relative -mt-[4.9rem] -ml-8 lg:ml-0 lg:-mt-[6.6rem] hidden dark:block" viewBox="0 0 440 376" fill="none" xmlns="http://www.w3.org/2000/svg">
+                        <g class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4">
+                            <path d="M188.263 355.73L188.595 355.73C195.441 348.845 205.766 339.761 219.569 328.477C232.93 317.193 242.978 308.205 249.714 301.511C256.34 294.626 260.867 287.358 263.296 279.708C265.725 272.058 264.565 264.121 259.816 255.896C254.516 246.716 247.062 239.352 237.454 233.805C227.957 228.067 217.908 225.198 207.307 225.198C196.927 225.197 190.136 227.97 186.934 233.516C183.621 238.872 184.726 246.331 190.247 255.894L125.647 255.891C116.371 239.825 112.395 225.481 113.72 212.858C115.265 200.235 121.559 190.481 132.602 183.596C143.754 176.52 158.607 172.982 177.159 172.983C196.594 172.984 215.863 176.523 234.968 183.6C253.961 190.486 271.299 200.241 286.98 212.864C302.661 225.488 315.14 239.833 324.416 255.899C333.03 270.817 336.841 283.918 335.847 295.203C335.075 306.487 331.376 316.336 324.75 324.751C318.346 333.167 308.408 343.494 294.936 355.734L377.094 355.737L405.917 405.656L217.087 405.649L188.263 355.73Z" fill="black"/>
+                            <path d="M9.11884 226.339L-13.7396 226.338L-42.7286 176.132L43.0733 176.135L175.595 405.649L112.651 405.647L9.11884 226.339Z" fill="black"/>
+                            <path d="M188.263 355.73L188.595 355.73C195.441 348.845 205.766 339.761 219.569 328.477C232.93 317.193 242.978 308.205 249.714 301.511C256.34 294.626 260.867 287.358 263.296 279.708C265.725 272.058 264.565 264.121 259.816 255.896C254.516 246.716 247.062 239.352 237.454 233.805C227.957 228.067 217.908 225.198 207.307 225.198C196.927 225.197 190.136 227.97 186.934 233.516C183.621 238.872 184.726 246.331 190.247 255.894L125.647 255.891C116.371 239.825 112.395 225.481 113.72 212.858C115.265 200.235 121.559 190.481 132.602 183.596C143.754 176.52 158.607 172.982 177.159 172.983C196.594 172.984 215.863 176.523 234.968 183.6C253.961 190.486 271.299 200.241 286.98 212.864C302.661 225.488 315.14 239.833 324.416 255.899C333.03 270.817 336.841 283.918 335.847 295.203C335.075 306.487 331.376 316.336 324.75 324.751C318.346 333.167 308.408 343.494 294.936 355.734L377.094 355.737L405.917 405.656L217.087 405.649L188.263 355.73Z" stroke="#FF750F" stroke-width="1"/>
+                            <path d="M9.11884 226.339L-13.7396 226.338L-42.7286 176.132L43.0733 176.135L175.595 405.649L112.651 405.647L9.11884 226.339Z" stroke="#FF750F" stroke-width="1"/>
+                            <path d="M204.592 327.449L204.923 327.449C211.769 320.564 222.094 311.479 235.897 300.196C249.258 288.912 259.306 279.923 266.042 273.23C272.668 266.345 277.195 259.077 279.624 251.427C282.053 243.777 280.893 235.839 276.145 227.615C270.844 218.435 263.39 211.071 253.782 205.524C244.285 199.786 234.236 196.917 223.635 196.916C213.255 196.916 206.464 199.689 203.262 205.235C199.949 210.59 201.054 218.049 206.575 227.612L141.975 227.61C132.699 211.544 128.723 197.2 130.048 184.577C131.593 171.954 137.887 162.2 148.93 155.315C160.083 148.239 174.935 144.701 193.487 144.702C212.922 144.703 232.192 148.242 251.296 155.319C270.289 162.205 287.627 171.96 303.308 184.583C318.989 197.207 331.468 211.552 340.745 227.618C349.358 242.536 353.169 255.637 352.175 266.921C351.403 278.205 347.704 288.055 341.078 296.47C334.674 304.885 324.736 315.213 311.264 327.453L393.422 327.456L422.246 377.375L233.415 377.368L204.592 327.449Z" fill="#391800"/>
+                            <path d="M25.447 198.058L2.58852 198.057L-26.4005 147.851L59.4015 147.854L191.923 377.368L128.979 377.365L25.447 198.058Z" fill="#391800"/>
+                            <path d="M204.592 327.449L204.923 327.449C211.769 320.564 222.094 311.479 235.897 300.196C249.258 288.912 259.306 279.923 266.042 273.23C272.668 266.345 277.195 259.077 279.624 251.427C282.053 243.777 280.893 235.839 276.145 227.615C270.844 218.435 263.39 211.071 253.782 205.524C244.285 199.786 234.236 196.917 223.635 196.916C213.255 196.916 206.464 199.689 203.262 205.235C199.949 210.59 201.054 218.049 206.575 227.612L141.975 227.61C132.699 211.544 128.723 197.2 130.048 184.577C131.593 171.954 137.887 162.2 148.93 155.315C160.083 148.239 174.935 144.701 193.487 144.702C212.922 144.703 232.192 148.242 251.296 155.319C270.289 162.205 287.627 171.96 303.308 184.583C318.989 197.207 331.468 211.552 340.745 227.618C349.358 242.536 353.169 255.637 352.175 266.921C351.403 278.205 347.704 288.055 341.078 296.47C334.674 304.885 324.736 315.213 311.264 327.453L393.422 327.456L422.246 377.375L233.415 377.368L204.592 327.449Z" stroke="#FF750F" stroke-width="1"/>
+                            <path d="M25.447 198.058L2.58852 198.057L-26.4005 147.851L59.4015 147.854L191.923 377.368L128.979 377.365L25.447 198.058Z" stroke="#FF750F" stroke-width="1"/>
+                        </g>
+                        <g class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4" style="mix-blend-mode:hard-light">
+                            <path d="M217.342 305.363L217.673 305.363C224.519 298.478 234.844 289.393 248.647 278.11C262.008 266.826 272.056 257.837 278.792 251.144C285.418 244.259 289.945 236.991 292.374 229.341C294.803 221.691 293.643 213.753 288.895 205.529C283.594 196.349 276.14 188.985 266.532 183.438C257.035 177.7 246.986 174.831 236.385 174.83C226.005 174.83 219.214 177.603 216.012 183.149C212.699 188.504 213.804 195.963 219.325 205.527L154.725 205.524C145.449 189.458 141.473 175.114 142.798 162.491C144.343 149.868 150.637 140.114 161.68 133.229C172.833 126.153 187.685 122.615 206.237 122.616C225.672 122.617 244.942 126.156 264.046 133.233C283.039 140.119 300.377 149.874 316.058 162.497C331.739 175.121 344.218 189.466 353.495 205.532C362.108 220.45 365.919 233.551 364.925 244.835C364.153 256.12 360.454 265.969 353.828 274.384C347.424 282.799 337.486 293.127 324.014 305.367L406.172 305.37L434.996 355.289L246.165 355.282L217.342 305.363Z" fill="#733000"/>
+                            <path d="M38.197 175.972L15.3385 175.971L-13.6505 125.765L72.1515 125.768L204.673 355.282L141.729 355.279L38.197 175.972Z" fill="#733000"/>
+                            <path d="M217.342 305.363L217.673 305.363C224.519 298.478 234.844 289.393 248.647 278.11C262.008 266.826 272.056 257.837 278.792 251.144C285.418 244.259 289.945 236.991 292.374 229.341C294.803 221.691 293.643 213.753 288.895 205.529C283.594 196.349 276.14 188.985 266.532 183.438C257.035 177.7 246.986 174.831 236.385 174.83C226.005 174.83 219.214 177.603 216.012 183.149C212.699 188.504 213.804 195.963 219.325 205.527L154.725 205.524C145.449 189.458 141.473 175.114 142.798 162.491C144.343 149.868 150.637 140.114 161.68 133.229C172.833 126.153 187.685 122.615 206.237 122.616C225.672 122.617 244.942 126.156 264.046 133.233C283.039 140.119 300.377 149.874 316.058 162.497C331.739 175.121 344.218 189.466 353.495 205.532C362.108 220.45 365.919 233.551 364.925 244.835C364.153 256.12 360.454 265.969 353.828 274.384C347.424 282.799 337.486 293.127 324.014 305.367L406.172 305.37L434.996 355.289L246.165 355.282L217.342 305.363Z" stroke="#FF750F" stroke-width="1"/>
+                            <path d="M38.197 175.972L15.3385 175.971L-13.6505 125.765L72.1515 125.768L204.673 355.282L141.729 355.279L38.197 175.972Z" stroke="#FF750F" stroke-width="1"/>
+                        </g>
+                        <g class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4">
+                            <path d="M217.342 305.363L217.673 305.363C224.519 298.478 234.844 289.393 248.647 278.11C262.008 266.826 272.056 257.837 278.792 251.144C285.418 244.259 289.945 236.991 292.374 229.341C294.803 221.691 293.643 213.753 288.895 205.529C283.594 196.349 276.14 188.985 266.532 183.438C257.035 177.7 246.986 174.831 236.385 174.83C226.005 174.83 219.214 177.603 216.012 183.149C212.699 188.504 213.804 195.963 219.325 205.527L154.726 205.524C145.449 189.458 141.473 175.114 142.798 162.491C144.343 149.868 150.637 140.114 161.68 133.229C172.833 126.153 187.685 122.615 206.237 122.616C225.672 122.617 244.942 126.156 264.046 133.233C283.039 140.119 300.377 149.874 316.058 162.497C331.739 175.121 344.218 189.466 353.495 205.532C362.108 220.45 365.919 233.551 364.925 244.835C364.153 256.12 360.454 265.969 353.828 274.384C347.424 282.799 337.486 293.127 324.014 305.367L406.172 305.37L434.996 355.289L246.165 355.282L217.342 305.363Z" stroke="#FF750F" stroke-width="1"/>
+                            <path d="M38.197 175.972L15.3385 175.971L-13.6505 125.765L72.1515 125.768L204.673 355.282L141.729 355.279L38.197 175.972Z" stroke="#FF750F" stroke-width="1"/>
+                        </g>
+                        <g class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4">
+                            <path d="M188.467 355.363L188.798 355.363C195.644 348.478 205.969 339.393 219.772 328.11C233.133 316.826 243.181 307.837 249.917 301.144C253.696 297.217 256.792 293.166 259.205 288.991C261.024 285.845 262.455 282.628 263.499 279.341C265.928 271.691 264.768 263.753 260.02 255.529C254.719 246.349 247.265 238.985 237.657 233.438C228.16 227.7 218.111 224.831 207.51 224.83C197.13 224.83 190.339 227.603 187.137 233.149C183.824 238.504 184.929 245.963 190.45 255.527L125.851 255.524C116.574 239.458 112.598 225.114 113.923 212.491C114.615 206.836 116.261 201.756 118.859 197.253C122.061 191.704 126.709 187.03 132.805 183.229C143.958 176.153 158.81 172.615 177.362 172.616C196.797 172.617 216.067 176.156 235.171 183.233C254.164 190.119 271.502 199.874 287.183 212.497C302.864 225.121 315.343 239.466 324.62 255.532C333.233 270.45 337.044 283.551 336.05 294.835C335.46 303.459 333.16 311.245 329.151 318.194C327.915 320.337 326.515 322.4 324.953 324.384C318.549 332.799 308.611 343.127 295.139 355.367L377.297 355.37L406.121 405.289L217.29 405.282L188.467 355.363Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M9.32197 225.972L-13.5365 225.971L-42.5255 175.765L43.2765 175.768L175.798 405.282L112.854 405.279L9.32197 225.972Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M345.247 111.915C329.566 99.2919 312.229 89.5371 293.235 82.6512L235.167 183.228C254.161 190.114 271.498 199.869 287.179 212.492L345.247 111.915Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M382.686 154.964C373.41 138.898 360.931 124.553 345.25 111.93L287.182 212.506C302.863 225.13 315.342 239.475 324.618 255.541L382.686 154.964Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M293.243 82.6472C274.139 75.57 254.869 72.031 235.434 72.0303L177.366 172.607C196.801 172.608 216.071 176.147 235.175 183.224L293.243 82.6472Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M394.118 194.257C395.112 182.973 391.301 169.872 382.688 154.953L324.619 255.53C333.233 270.448 337.044 283.55 336.05 294.834L394.118 194.257Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M235.432 72.0311C216.88 72.0304 202.027 75.5681 190.875 82.6442L132.806 183.221C143.959 176.145 158.812 172.607 177.363 172.608L235.432 72.0311Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M265.59 124.25C276.191 124.251 286.24 127.12 295.737 132.858L237.669 233.435C228.172 227.697 218.123 224.828 207.522 224.827L265.59 124.25Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M295.719 132.859C305.326 138.406 312.78 145.77 318.081 154.95L260.013 255.527C254.712 246.347 247.258 238.983 237.651 233.436L295.719 132.859Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M387.218 217.608C391.227 210.66 393.527 202.874 394.117 194.25L336.049 294.827C335.459 303.451 333.159 311.237 329.15 318.185L387.218 217.608Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M245.211 132.577C248.413 127.03 255.204 124.257 265.584 124.258L207.516 224.835C197.136 224.834 190.345 227.607 187.143 233.154L245.211 132.577Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M318.094 154.945C322.842 163.17 324.002 171.107 321.573 178.757L263.505 279.334C265.934 271.684 264.774 263.746 260.026 255.522L318.094 154.945Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M176.925 96.6737C180.127 91.1249 184.776 86.4503 190.871 82.6499L132.803 183.227C126.708 187.027 122.059 191.702 118.857 197.25L176.925 96.6737Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M387.226 217.606C385.989 219.749 384.59 221.813 383.028 223.797L324.96 324.373C326.522 322.39 327.921 320.326 329.157 318.183L387.226 217.606Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M317.269 188.408C319.087 185.262 320.519 182.045 321.562 178.758L263.494 279.335C262.451 282.622 261.019 285.839 259.201 288.985L317.269 188.408Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M245.208 132.573C241.895 137.928 243 145.387 248.522 154.95L190.454 255.527C184.932 245.964 183.827 238.505 187.14 233.15L245.208 132.573Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M176.93 96.6719C174.331 101.175 172.686 106.255 171.993 111.91L113.925 212.487C114.618 206.831 116.263 201.752 118.862 197.249L176.93 96.6719Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M317.266 188.413C314.853 192.589 311.757 196.64 307.978 200.566L249.91 301.143C253.689 297.216 256.785 293.166 259.198 288.99L317.266 188.413Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M464.198 304.708L435.375 254.789L377.307 355.366L406.13 405.285L464.198 304.708Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M353.209 254.787C366.68 242.548 376.618 232.22 383.023 223.805L324.955 324.382C318.55 332.797 308.612 343.124 295.141 355.364L353.209 254.787Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M435.37 254.787L353.212 254.784L295.144 355.361L377.302 355.364L435.37 254.787Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M183.921 154.947L248.521 154.95L190.453 255.527L125.853 255.524L183.921 154.947Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M171.992 111.914C170.668 124.537 174.643 138.881 183.92 154.947L125.852 255.524C116.575 239.458 112.599 225.114 113.924 212.491L171.992 111.914Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M307.987 200.562C301.251 207.256 291.203 216.244 277.842 227.528L219.774 328.105C233.135 316.821 243.183 307.832 249.919 301.139L307.987 200.562Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M15.5469 75.1797L44.5359 125.386L-13.5321 225.963L-42.5212 175.756L15.5469 75.1797Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M277.836 227.536C264.033 238.82 253.708 247.904 246.862 254.789L188.794 355.366C195.64 348.481 205.965 339.397 219.768 328.113L277.836 227.536Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M275.358 304.706L464.189 304.713L406.12 405.29L217.29 405.283L275.358 304.706Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M44.5279 125.39L67.3864 125.39L9.31834 225.967L-13.5401 225.966L44.5279 125.39Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M101.341 75.1911L233.863 304.705L175.795 405.282L43.2733 175.768L101.341 75.1911ZM15.5431 75.19L-42.525 175.767L43.277 175.77L101.345 75.1932L15.5431 75.19Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M246.866 254.784L246.534 254.784L188.466 355.361L188.798 355.361L246.866 254.784Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M246.539 254.781L275.362 304.701L217.294 405.277L188.471 355.358L246.539 254.781Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M67.3906 125.391L170.923 304.698L112.855 405.275L9.32257 225.967L67.3906 125.391Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                            <path d="M170.921 304.699L233.865 304.701L175.797 405.278L112.853 405.276L170.921 304.699Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="bevel"/>
+                        </g>
+                        <g class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4" style="mix-blend-mode:hard-light">
+                            <path d="M246.544 254.79L246.875 254.79C253.722 247.905 264.046 238.82 277.849 227.537C291.21 216.253 301.259 207.264 307.995 200.57C314.62 193.685 319.147 186.418 321.577 178.768C324.006 171.117 322.846 163.18 318.097 154.956C312.796 145.775 305.342 138.412 295.735 132.865C286.238 127.127 276.189 124.258 265.588 124.257C255.208 124.257 248.416 127.03 245.214 132.576C241.902 137.931 243.006 145.39 248.528 154.953L183.928 154.951C174.652 138.885 170.676 124.541 172 111.918C173.546 99.2946 179.84 89.5408 190.882 82.6559C202.035 75.5798 216.887 72.0421 235.439 72.0428C254.874 72.0435 274.144 75.5825 293.248 82.6598C312.242 89.5457 329.579 99.3005 345.261 111.924C360.942 124.548 373.421 138.892 382.697 154.958C391.311 169.877 395.121 182.978 394.128 194.262C393.355 205.546 389.656 215.396 383.031 223.811C376.627 232.226 366.688 242.554 353.217 254.794L435.375 254.797L464.198 304.716L275.367 304.709L246.544 254.79Z" fill="#4B0600"/>
+                            <path d="M246.544 254.79L246.875 254.79C253.722 247.905 264.046 238.82 277.849 227.537C291.21 216.253 301.259 207.264 307.995 200.57C314.62 193.685 319.147 186.418 321.577 178.768C324.006 171.117 322.846 163.18 318.097 154.956C312.796 145.775 305.342 138.412 295.735 132.865C286.238 127.127 276.189 124.258 265.588 124.257C255.208 124.257 248.416 127.03 245.214 132.576C241.902 137.931 243.006 145.39 248.528 154.953L183.928 154.951C174.652 138.885 170.676 124.541 172 111.918C173.546 99.2946 179.84 89.5408 190.882 82.6559C202.035 75.5798 216.887 72.0421 235.439 72.0428C254.874 72.0435 274.144 75.5825 293.248 82.6598C312.242 89.5457 329.579 99.3005 345.261 111.924C360.942 124.548 373.421 138.892 382.697 154.958C391.311 169.877 395.121 182.978 394.128 194.262C393.355 205.546 389.656 215.396 383.031 223.811C376.627 232.226 366.688 242.554 353.217 254.794L435.375 254.797L464.198 304.716L275.367 304.709L246.544 254.79Z" stroke="#FF750F" stroke-width="1" stroke-linejoin="round"/>
+                        </g>
+                        <g class="transition-all delay-300 translate-y-0 opacity-100 duration-750 starting:opacity-0 starting:translate-y-4" style="mix-blend-mode:hard-light">
+                            <path d="M67.41 125.402L44.5515 125.401L15.5625 75.1953L101.364 75.1985L233.886 304.712L170.942 304.71L67.41 125.402Z" fill="#4B0600"/>
+                            <path d="M67.41 125.402L44.5515 125.401L15.5625 75.1953L101.364 75.1985L233.886 304.712L170.942 304.71L67.41 125.402Z" stroke="#FF750F" stroke-width="1"/>
+                        </g>
+                    </svg>
+                    <div class="absolute inset-0 rounded-t-lg lg:rounded-t-none lg:rounded-r-lg shadow-[inset_0px_0px_0px_1px_rgba(26,26,0,0.16)] dark:shadow-[inset_0px_0px_0px_1px_#fffaed2d]"></div>
+                </div>
+            </main>
+        </div>
+
+        @if (Route::has('login'))
+            <div class="h-14.5 hidden lg:block"></div>
+        @endif
+    </body>
+</html>
diff --git a/routes/auth.php b/routes/auth.php
new file mode 100644
index 0000000..3926ecf
--- /dev/null
+++ b/routes/auth.php
@@ -0,0 +1,59 @@
+<?php
+
+use App\Http\Controllers\Auth\AuthenticatedSessionController;
+use App\Http\Controllers\Auth\ConfirmablePasswordController;
+use App\Http\Controllers\Auth\EmailVerificationNotificationController;
+use App\Http\Controllers\Auth\EmailVerificationPromptController;
+use App\Http\Controllers\Auth\NewPasswordController;
+use App\Http\Controllers\Auth\PasswordController;
+use App\Http\Controllers\Auth\PasswordResetLinkController;
+use App\Http\Controllers\Auth\RegisteredUserController;
+use App\Http\Controllers\Auth\VerifyEmailController;
+use Illuminate\Support\Facades\Route;
+
+Route::middleware('guest')->group(function () {
+    Route::get('register', [RegisteredUserController::class, 'create'])
+        ->name('register');
+
+    Route::post('register', [RegisteredUserController::class, 'store']);
+
+    Route::get('login', [AuthenticatedSessionController::class, 'create'])
+        ->name('login');
+
+    Route::post('login', [AuthenticatedSessionController::class, 'store']);
+
+    Route::get('forgot-password', [PasswordResetLinkController::class, 'create'])
+        ->name('password.request');
+
+    Route::post('forgot-password', [PasswordResetLinkController::class, 'store'])
+        ->name('password.email');
+
+    Route::get('reset-password/{token}', [NewPasswordController::class, 'create'])
+        ->name('password.reset');
+
+    Route::post('reset-password', [NewPasswordController::class, 'store'])
+        ->name('password.store');
+});
+
+Route::middleware('auth')->group(function () {
+    Route::get('verify-email', EmailVerificationPromptController::class)
+        ->name('verification.notice');
+
+    Route::get('verify-email/{id}/{hash}', VerifyEmailController::class)
+        ->middleware(['signed', 'throttle:6,1'])
+        ->name('verification.verify');
+
+    Route::post('email/verification-notification', [EmailVerificationNotificationController::class, 'store'])
+        ->middleware('throttle:6,1')
+        ->name('verification.send');
+
+    Route::get('confirm-password', [ConfirmablePasswordController::class, 'show'])
+        ->name('password.confirm');
+
+    Route::post('confirm-password', [ConfirmablePasswordController::class, 'store']);
+
+    Route::put('password', [PasswordController::class, 'update'])->name('password.update');
+
+    Route::post('logout', [AuthenticatedSessionController::class, 'destroy'])
+        ->name('logout');
+});
diff --git a/routes/console.php b/routes/console.php
new file mode 100644
index 0000000..3c9adf1
--- /dev/null
+++ b/routes/console.php
@@ -0,0 +1,8 @@
+<?php
+
+use Illuminate\Foundation\Inspiring;
+use Illuminate\Support\Facades\Artisan;
+
+Artisan::command('inspire', function () {
+    $this->comment(Inspiring::quote());
+})->purpose('Display an inspiring quote');
diff --git a/routes/web.php b/routes/web.php
new file mode 100644
index 0000000..b133a97
--- /dev/null
+++ b/routes/web.php
@@ -0,0 +1,23 @@
+<?php
+
+use App\Http\Controllers\ShoppingListController;
+use App\Http\Controllers\ProfileController;
+use Illuminate\Support\Facades\Route;
+
+Route::get('/', function () {
+    return redirect()->route('dashboard');
+});
+
+Route::middleware(['auth', 'verified'])->group(function () {
+    Route::get('/dashboard', [ShoppingListController::class, 'index'])->name('dashboard');
+    Route::post('/shopping-items', [ShoppingListController::class, 'store'])->name('shopping-items.store');
+    Route::patch('/shopping-items/{shoppingItem}/toggle', [ShoppingListController::class, 'toggle'])->name('shopping-items.toggle');
+});
+
+Route::middleware('auth')->group(function () {
+    Route::get('/profile', [ProfileController::class, 'edit'])->name('profile.edit');
+    Route::patch('/profile', [ProfileController::class, 'update'])->name('profile.update');
+    Route::delete('/profile', [ProfileController::class, 'destroy'])->name('profile.destroy');
+});
+
+require __DIR__.'/auth.php';
diff --git a/storage/app/.gitignore b/storage/app/.gitignore
new file mode 100644
index 0000000..fedb287
--- /dev/null
+++ b/storage/app/.gitignore
@@ -0,0 +1,4 @@
+*
+!private/
+!public/
+!.gitignore
diff --git a/storage/app/private/.gitignore b/storage/app/private/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/storage/app/private/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/storage/app/public/.gitignore b/storage/app/public/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/storage/app/public/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/storage/framework/.gitignore b/storage/framework/.gitignore
new file mode 100644
index 0000000..05c4471
--- /dev/null
+++ b/storage/framework/.gitignore
@@ -0,0 +1,9 @@
+compiled.php
+config.php
+down
+events.scanned.php
+maintenance.php
+routes.php
+routes.scanned.php
+schedule-*
+services.json
diff --git a/storage/framework/cache/.gitignore b/storage/framework/cache/.gitignore
new file mode 100644
index 0000000..01e4a6c
--- /dev/null
+++ b/storage/framework/cache/.gitignore
@@ -0,0 +1,3 @@
+*
+!data/
+!.gitignore
diff --git a/storage/framework/cache/data/.gitignore b/storage/framework/cache/data/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/storage/framework/cache/data/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/storage/framework/sessions/.gitignore b/storage/framework/sessions/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/storage/framework/sessions/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/storage/framework/testing/.gitignore b/storage/framework/testing/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/storage/framework/testing/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/storage/framework/views/.gitignore b/storage/framework/views/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/storage/framework/views/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/storage/logs/.gitignore b/storage/logs/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/storage/logs/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/tailwind.config.js b/tailwind.config.js
new file mode 100644
index 0000000..c29eb1a
--- /dev/null
+++ b/tailwind.config.js
@@ -0,0 +1,21 @@
+import defaultTheme from 'tailwindcss/defaultTheme';
+import forms from '@tailwindcss/forms';
+
+/** @type {import('tailwindcss').Config} */
+export default {
+    content: [
+        './vendor/laravel/framework/src/Illuminate/Pagination/resources/views/*.blade.php',
+        './storage/framework/views/*.php',
+        './resources/views/**/*.blade.php',
+    ],
+
+    theme: {
+        extend: {
+            fontFamily: {
+                sans: ['Figtree', ...defaultTheme.fontFamily.sans],
+            },
+        },
+    },
+
+    plugins: [forms],
+};
diff --git a/tests/Feature/Auth/AuthenticationTest.php b/tests/Feature/Auth/AuthenticationTest.php
new file mode 100644
index 0000000..13dcb7c
--- /dev/null
+++ b/tests/Feature/Auth/AuthenticationTest.php
@@ -0,0 +1,54 @@
+<?php
+
+namespace Tests\Feature\Auth;
+
+use App\Models\User;
+use Illuminate\Foundation\Testing\RefreshDatabase;
+use Tests\TestCase;
+
+class AuthenticationTest extends TestCase
+{
+    use RefreshDatabase;
+
+    public function test_login_screen_can_be_rendered(): void
+    {
+        $response = $this->get('/login');
+
+        $response->assertStatus(200);
+    }
+
+    public function test_users_can_authenticate_using_the_login_screen(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this->post('/login', [
+            'email' => $user->email,
+            'password' => 'password',
+        ]);
+
+        $this->assertAuthenticated();
+        $response->assertRedirect(route('dashboard', absolute: false));
+    }
+
+    public function test_users_can_not_authenticate_with_invalid_password(): void
+    {
+        $user = User::factory()->create();
+
+        $this->post('/login', [
+            'email' => $user->email,
+            'password' => 'wrong-password',
+        ]);
+
+        $this->assertGuest();
+    }
+
+    public function test_users_can_logout(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this->actingAs($user)->post('/logout');
+
+        $this->assertGuest();
+        $response->assertRedirect('/');
+    }
+}
diff --git a/tests/Feature/Auth/EmailVerificationTest.php b/tests/Feature/Auth/EmailVerificationTest.php
new file mode 100644
index 0000000..705570b
--- /dev/null
+++ b/tests/Feature/Auth/EmailVerificationTest.php
@@ -0,0 +1,58 @@
+<?php
+
+namespace Tests\Feature\Auth;
+
+use App\Models\User;
+use Illuminate\Auth\Events\Verified;
+use Illuminate\Foundation\Testing\RefreshDatabase;
+use Illuminate\Support\Facades\Event;
+use Illuminate\Support\Facades\URL;
+use Tests\TestCase;
+
+class EmailVerificationTest extends TestCase
+{
+    use RefreshDatabase;
+
+    public function test_email_verification_screen_can_be_rendered(): void
+    {
+        $user = User::factory()->unverified()->create();
+
+        $response = $this->actingAs($user)->get('/verify-email');
+
+        $response->assertStatus(200);
+    }
+
+    public function test_email_can_be_verified(): void
+    {
+        $user = User::factory()->unverified()->create();
+
+        Event::fake();
+
+        $verificationUrl = URL::temporarySignedRoute(
+            'verification.verify',
+            now()->addMinutes(60),
+            ['id' => $user->id, 'hash' => sha1($user->email)]
+        );
+
+        $response = $this->actingAs($user)->get($verificationUrl);
+
+        Event::assertDispatched(Verified::class);
+        $this->assertTrue($user->fresh()->hasVerifiedEmail());
+        $response->assertRedirect(route('dashboard', absolute: false).'?verified=1');
+    }
+
+    public function test_email_is_not_verified_with_invalid_hash(): void
+    {
+        $user = User::factory()->unverified()->create();
+
+        $verificationUrl = URL::temporarySignedRoute(
+            'verification.verify',
+            now()->addMinutes(60),
+            ['id' => $user->id, 'hash' => sha1('wrong-email')]
+        );
+
+        $this->actingAs($user)->get($verificationUrl);
+
+        $this->assertFalse($user->fresh()->hasVerifiedEmail());
+    }
+}
diff --git a/tests/Feature/Auth/PasswordConfirmationTest.php b/tests/Feature/Auth/PasswordConfirmationTest.php
new file mode 100644
index 0000000..ff85721
--- /dev/null
+++ b/tests/Feature/Auth/PasswordConfirmationTest.php
@@ -0,0 +1,44 @@
+<?php
+
+namespace Tests\Feature\Auth;
+
+use App\Models\User;
+use Illuminate\Foundation\Testing\RefreshDatabase;
+use Tests\TestCase;
+
+class PasswordConfirmationTest extends TestCase
+{
+    use RefreshDatabase;
+
+    public function test_confirm_password_screen_can_be_rendered(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this->actingAs($user)->get('/confirm-password');
+
+        $response->assertStatus(200);
+    }
+
+    public function test_password_can_be_confirmed(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this->actingAs($user)->post('/confirm-password', [
+            'password' => 'password',
+        ]);
+
+        $response->assertRedirect();
+        $response->assertSessionHasNoErrors();
+    }
+
+    public function test_password_is_not_confirmed_with_invalid_password(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this->actingAs($user)->post('/confirm-password', [
+            'password' => 'wrong-password',
+        ]);
+
+        $response->assertSessionHasErrors();
+    }
+}
diff --git a/tests/Feature/Auth/PasswordResetTest.php b/tests/Feature/Auth/PasswordResetTest.php
new file mode 100644
index 0000000..aa50350
--- /dev/null
+++ b/tests/Feature/Auth/PasswordResetTest.php
@@ -0,0 +1,73 @@
+<?php
+
+namespace Tests\Feature\Auth;
+
+use App\Models\User;
+use Illuminate\Auth\Notifications\ResetPassword;
+use Illuminate\Foundation\Testing\RefreshDatabase;
+use Illuminate\Support\Facades\Notification;
+use Tests\TestCase;
+
+class PasswordResetTest extends TestCase
+{
+    use RefreshDatabase;
+
+    public function test_reset_password_link_screen_can_be_rendered(): void
+    {
+        $response = $this->get('/forgot-password');
+
+        $response->assertStatus(200);
+    }
+
+    public function test_reset_password_link_can_be_requested(): void
+    {
+        Notification::fake();
+
+        $user = User::factory()->create();
+
+        $this->post('/forgot-password', ['email' => $user->email]);
+
+        Notification::assertSentTo($user, ResetPassword::class);
+    }
+
+    public function test_reset_password_screen_can_be_rendered(): void
+    {
+        Notification::fake();
+
+        $user = User::factory()->create();
+
+        $this->post('/forgot-password', ['email' => $user->email]);
+
+        Notification::assertSentTo($user, ResetPassword::class, function ($notification) {
+            $response = $this->get('/reset-password/'.$notification->token);
+
+            $response->assertStatus(200);
+
+            return true;
+        });
+    }
+
+    public function test_password_can_be_reset_with_valid_token(): void
+    {
+        Notification::fake();
+
+        $user = User::factory()->create();
+
+        $this->post('/forgot-password', ['email' => $user->email]);
+
+        Notification::assertSentTo($user, ResetPassword::class, function ($notification) use ($user) {
+            $response = $this->post('/reset-password', [
+                'token' => $notification->token,
+                'email' => $user->email,
+                'password' => 'password',
+                'password_confirmation' => 'password',
+            ]);
+
+            $response
+                ->assertSessionHasNoErrors()
+                ->assertRedirect(route('login'));
+
+            return true;
+        });
+    }
+}
diff --git a/tests/Feature/Auth/PasswordUpdateTest.php b/tests/Feature/Auth/PasswordUpdateTest.php
new file mode 100644
index 0000000..ca28c6c
--- /dev/null
+++ b/tests/Feature/Auth/PasswordUpdateTest.php
@@ -0,0 +1,51 @@
+<?php
+
+namespace Tests\Feature\Auth;
+
+use App\Models\User;
+use Illuminate\Foundation\Testing\RefreshDatabase;
+use Illuminate\Support\Facades\Hash;
+use Tests\TestCase;
+
+class PasswordUpdateTest extends TestCase
+{
+    use RefreshDatabase;
+
+    public function test_password_can_be_updated(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this
+            ->actingAs($user)
+            ->from('/profile')
+            ->put('/password', [
+                'current_password' => 'password',
+                'password' => 'new-password',
+                'password_confirmation' => 'new-password',
+            ]);
+
+        $response
+            ->assertSessionHasNoErrors()
+            ->assertRedirect('/profile');
+
+        $this->assertTrue(Hash::check('new-password', $user->refresh()->password));
+    }
+
+    public function test_correct_password_must_be_provided_to_update_password(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this
+            ->actingAs($user)
+            ->from('/profile')
+            ->put('/password', [
+                'current_password' => 'wrong-password',
+                'password' => 'new-password',
+                'password_confirmation' => 'new-password',
+            ]);
+
+        $response
+            ->assertSessionHasErrorsIn('updatePassword', 'current_password')
+            ->assertRedirect('/profile');
+    }
+}
diff --git a/tests/Feature/Auth/RegistrationTest.php b/tests/Feature/Auth/RegistrationTest.php
new file mode 100644
index 0000000..1489d0e
--- /dev/null
+++ b/tests/Feature/Auth/RegistrationTest.php
@@ -0,0 +1,31 @@
+<?php
+
+namespace Tests\Feature\Auth;
+
+use Illuminate\Foundation\Testing\RefreshDatabase;
+use Tests\TestCase;
+
+class RegistrationTest extends TestCase
+{
+    use RefreshDatabase;
+
+    public function test_registration_screen_can_be_rendered(): void
+    {
+        $response = $this->get('/register');
+
+        $response->assertStatus(200);
+    }
+
+    public function test_new_users_can_register(): void
+    {
+        $response = $this->post('/register', [
+            'name' => 'Test User',
+            'email' => 'test@example.com',
+            'password' => 'password',
+            'password_confirmation' => 'password',
+        ]);
+
+        $this->assertAuthenticated();
+        $response->assertRedirect(route('dashboard', absolute: false));
+    }
+}
diff --git a/tests/Feature/ExampleTest.php b/tests/Feature/ExampleTest.php
new file mode 100644
index 0000000..8364a84
--- /dev/null
+++ b/tests/Feature/ExampleTest.php
@@ -0,0 +1,19 @@
+<?php
+
+namespace Tests\Feature;
+
+// use Illuminate\Foundation\Testing\RefreshDatabase;
+use Tests\TestCase;
+
+class ExampleTest extends TestCase
+{
+    /**
+     * A basic test example.
+     */
+    public function test_the_application_returns_a_successful_response(): void
+    {
+        $response = $this->get('/');
+
+        $response->assertStatus(200);
+    }
+}
diff --git a/tests/Feature/ProfileTest.php b/tests/Feature/ProfileTest.php
new file mode 100644
index 0000000..252fdcc
--- /dev/null
+++ b/tests/Feature/ProfileTest.php
@@ -0,0 +1,99 @@
+<?php
+
+namespace Tests\Feature;
+
+use App\Models\User;
+use Illuminate\Foundation\Testing\RefreshDatabase;
+use Tests\TestCase;
+
+class ProfileTest extends TestCase
+{
+    use RefreshDatabase;
+
+    public function test_profile_page_is_displayed(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this
+            ->actingAs($user)
+            ->get('/profile');
+
+        $response->assertOk();
+    }
+
+    public function test_profile_information_can_be_updated(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this
+            ->actingAs($user)
+            ->patch('/profile', [
+                'name' => 'Test User',
+                'email' => 'test@example.com',
+            ]);
+
+        $response
+            ->assertSessionHasNoErrors()
+            ->assertRedirect('/profile');
+
+        $user->refresh();
+
+        $this->assertSame('Test User', $user->name);
+        $this->assertSame('test@example.com', $user->email);
+        $this->assertNull($user->email_verified_at);
+    }
+
+    public function test_email_verification_status_is_unchanged_when_the_email_address_is_unchanged(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this
+            ->actingAs($user)
+            ->patch('/profile', [
+                'name' => 'Test User',
+                'email' => $user->email,
+            ]);
+
+        $response
+            ->assertSessionHasNoErrors()
+            ->assertRedirect('/profile');
+
+        $this->assertNotNull($user->refresh()->email_verified_at);
+    }
+
+    public function test_user_can_delete_their_account(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this
+            ->actingAs($user)
+            ->delete('/profile', [
+                'password' => 'password',
+            ]);
+
+        $response
+            ->assertSessionHasNoErrors()
+            ->assertRedirect('/');
+
+        $this->assertGuest();
+        $this->assertNull($user->fresh());
+    }
+
+    public function test_correct_password_must_be_provided_to_delete_account(): void
+    {
+        $user = User::factory()->create();
+
+        $response = $this
+            ->actingAs($user)
+            ->from('/profile')
+            ->delete('/profile', [
+                'password' => 'wrong-password',
+            ]);
+
+        $response
+            ->assertSessionHasErrorsIn('userDeletion', 'password')
+            ->assertRedirect('/profile');
+
+        $this->assertNotNull($user->fresh());
+    }
+}
diff --git a/tests/TestCase.php b/tests/TestCase.php
new file mode 100644
index 0000000..fe1ffc2
--- /dev/null
+++ b/tests/TestCase.php
@@ -0,0 +1,10 @@
+<?php
+
+namespace Tests;
+
+use Illuminate\Foundation\Testing\TestCase as BaseTestCase;
+
+abstract class TestCase extends BaseTestCase
+{
+    //
+}
diff --git a/tests/Unit/ExampleTest.php b/tests/Unit/ExampleTest.php
new file mode 100644
index 0000000..5773b0c
--- /dev/null
+++ b/tests/Unit/ExampleTest.php
@@ -0,0 +1,16 @@
+<?php
+
+namespace Tests\Unit;
+
+use PHPUnit\Framework\TestCase;
+
+class ExampleTest extends TestCase
+{
+    /**
+     * A basic test example.
+     */
+    public function test_that_true_is_true(): void
+    {
+        $this->assertTrue(true);
+    }
+}
diff --git a/vite.config.js b/vite.config.js
new file mode 100644
index 0000000..421b569
--- /dev/null
+++ b/vite.config.js
@@ -0,0 +1,11 @@
+import { defineConfig } from 'vite';
+import laravel from 'laravel-vite-plugin';
+
+export default defineConfig({
+    plugins: [
+        laravel({
+            input: ['resources/css/app.css', 'resources/js/app.js'],
+            refresh: true,
+        }),
+    ],
+});